{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "de70faff-6a02-4c12-93b8-7fec766f4f9d",
          "code": "CHEMBL2111021",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2111021",
          "code_system": "ChEMBL",
          "references": [
            "c26f353f-15d2-4adf-a783-493b3e9f827c"
          ]
        },
        {
          "uuid": "9e063199-4e4a-47c3-a25b-84b7a6c0de01",
          "code": "214-231-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.938",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c26f353f-15d2-4adf-a783-493b3e9f827c"
          ]
        },
        {
          "uuid": "f43700ba-6e3e-49ab-a808-a4a720c3ab29",
          "code": "16217806",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16217806",
          "code_system": "PUBCHEM",
          "references": [
            "c26f353f-15d2-4adf-a783-493b3e9f827c"
          ]
        },
        {
          "uuid": "41a38305-d54b-406d-b27d-283ca43453db",
          "code": "QA02BX04",
          "comments": "VATC|DRUGS FOR ACID RELATED DISORDERS|DRUGS FOR PEPTIC ULCER AND GASTRO-OESOPHAGEAL REFLUX DISEASE (GORD)|Other drugs for peptic ulcer and gastro-oesophageal reflux disease (GORD)|methiosulfonium chloride",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA02BX04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c26f353f-15d2-4adf-a783-493b3e9f827c"
          ]
        },
        {
          "uuid": "9b8f7663-0112-4278-b105-4ae03649d327",
          "code": "1115-84-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1115-84-0",
          "code_system": "CAS",
          "references": [
            "c26f353f-15d2-4adf-a783-493b3e9f827c",
            "2c0acbdf-c1ef-4351-82d7-7701e43ad1cf"
          ]
        },
        {
          "uuid": "36e1e7cc-dcbb-4ac4-942d-8db036c9fb16",
          "code": "C82926",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C82926",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c26f353f-15d2-4adf-a783-493b3e9f827c"
          ]
        },
        {
          "uuid": "6365445c-83da-48fe-83e5-3a60c0c6b90b",
          "code": "A02BX04",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS FOR ACID RELATED DISORDERS|DRUGS FOR PEPTIC ULCER AND GASTRO-OESOPHAGEAL REFLUX DISEASE (GORD)|Other",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A02BX04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c26f353f-15d2-4adf-a783-493b3e9f827c"
          ]
        },
        {
          "uuid": "b5fc1a2f-aedc-49d1-8989-323f595b4659",
          "code": "SUB20717",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c26f353f-15d2-4adf-a783-493b3e9f827c"
          ]
        },
        {
          "uuid": "0b12fd58-6285-8b1f-1fae-d97079962243",
          "code": "DTXSID80274005",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80274005",
          "code_system": "EPA CompTox",
          "references": [
            "40f0a20a-1ba5-e00e-0c02-3310c6e908b1"
          ]
        },
        {
          "uuid": "dd1e146d-39fe-43bb-b04b-30eac8f071fa",
          "code": "m7440",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7440",
          "code_system": "MERCK INDEX",
          "references": [
            "25619653-d08c-a178-3450-8fd7187d8f26"
          ]
        },
        {
          "uuid": "c21d6845-11dd-074a-2cd6-5af9c19acc8f",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "445dae18-295f-efae-72b1-da3f737cdf1b"
          ]
        },
        {
          "uuid": "4b76a16a-2288-bf65-3013-a1f109ab9032",
          "code": "DB13250",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13250",
          "code_system": "DRUG BANK",
          "references": [
            "445dae18-295f-efae-72b1-da3f737cdf1b"
          ]
        },
        {
          "uuid": "b8191c28-62cc-4a6a-a625-50b4f8778c6b",
          "code": "G9CUR2204U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9762de61-aaae-d3f6-d928-78f61496a6e6",
          "code": "3354",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3354",
          "code_system": "DRUG CENTRAL",
          "references": [
            "445dae18-295f-efae-72b1-da3f737cdf1b"
          ]
        },
        {
          "uuid": "e2d18890-b98e-cf6e-298b-68b2e21c2c7a",
          "code": "100000088546",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "87db9286-aad7-da5c-0122-e54c750dc1d1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d563bfb8-e119-4561-bc6e-7b4be66efdaa",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ed7c3aed-5225-44b7-92f0-94be6ab19e72",
            "refuuid": "2e4609e5-8694-474b-ab0f-cbca71fae922",
            "name": "METHYLMETHIONINE",
            "unii": "3485Y39925",
            "linking_id": "3485Y39925",
            "ref_pname": "METHYLMETHIONINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "79bf5a48-3aa3-4093-aee9-95e230ce4d49",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "5c199149-7bf1-437d-aa49-de73fa2b1230",
            "refuuid": "2e4609e5-8694-474b-ab0f-cbca71fae922",
            "name": "METHYLMETHIONINE",
            "unii": "3485Y39925",
            "linking_id": "3485Y39925",
            "ref_pname": "METHYLMETHIONINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "05681e7a-5345-4d36-aa7a-7cc44c4d1c11",
          "name": "(S)-(3-AMINO-3-CARBOXYPROPYL)DIMETHYLSULFONIUM CHLORIDE",
          "stdName": "(S)-(3-AMINO-3-CARBOXYPROPYL)DIMETHYLSULFONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b266138b-4f4e-4263-b561-aa3dd97f748e"
          ],
          "display_name": false
        },
        {
          "uuid": "8857dcb1-0141-4a13-9515-bb9fce6b72a3",
          "name": "ARDESYL",
          "stdName": "ARDESYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "8757c524-9969-401c-947b-c706617be0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "d293fe21-10f1-4aab-9419-72c1495b2e1a",
          "name": "CABAGIN",
          "stdName": "CABAGIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "8757c524-9969-401c-947b-c706617be0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "78e2c60b-c03e-4bf6-b0e9-69b2aea3895e",
          "name": "CABAGIN U",
          "stdName": "CABAGIN U",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "8757c524-9969-401c-947b-c706617be0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "0ef14ea9-84ee-43e3-96c9-7da5e97fef25",
          "name": "EPADYN U",
          "stdName": "EPADYN U",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "8757c524-9969-401c-947b-c706617be0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "9069d965-2c70-4954-a588-0a57a748e29a",
          "name": "MERASTOM",
          "stdName": "MERASTOM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "8757c524-9969-401c-947b-c706617be0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "d3e07f17-eb74-4ab7-a9b5-48a26b0d6916",
          "name": "METHIOSULFONIUM CHLORIDE",
          "stdName": "METHIOSULFONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "efa5c2be-7071-4fd1-b9d5-ff7b00ee6e1b",
            "3bdfd8f9-e326-45d6-92e7-4a859a992ead",
            "b6d2939e-0749-4c37-b9a3-01dbc1eb9244"
          ],
          "display_name": false
        },
        {
          "uuid": "431b04d1-6980-4186-8129-8dcd7fb65e92",
          "name": "METHIOSULFONIUM CHLORIDE [MART.]",
          "stdName": "METHIOSULFONIUM CHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6d2939e-0749-4c37-b9a3-01dbc1eb9244"
          ],
          "display_name": false
        },
        {
          "uuid": "085e716e-e150-426d-8989-bee72a1db7cf",
          "name": "METHYLMETHIONINE CHLORIDE",
          "stdName": "METHYLMETHIONINE CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "bafd0864-556e-45e6-bef6-9a90be54f636"
          ],
          "display_name": true
        },
        {
          "uuid": "919c946c-4271-496d-b990-d902242624f0",
          "name": "METHYLMETHIONINE SULFONIUM CHLORIDE",
          "stdName": "METHYLMETHIONINE SULFONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "b266138b-4f4e-4263-b561-aa3dd97f748e",
            "c3017de7-6836-4ca6-af7e-fb0c476bdd5a",
            "3b69893a-acff-4479-8c0d-8a717506a62d"
          ],
          "display_name": false
        },
        {
          "uuid": "40dd3cda-7592-43a0-b8e2-08bd8eb6d450",
          "name": "METHYLMETHIONINE SULFONIUM CHLORIDE [JAN]",
          "stdName": "METHYLMETHIONINE SULFONIUM CHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "c3017de7-6836-4ca6-af7e-fb0c476bdd5a"
          ],
          "display_name": false
        },
        {
          "uuid": "17325247-1d8b-4d64-b985-9d70d5d1afec",
          "name": "S-METHYLMETHIONINE L-FORM CHLORIDE [MI]",
          "stdName": "S-METHYLMETHIONINE L-FORM CHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "f610df8c-7bee-4aa9-83ba-3a1e8b97f95b"
          ],
          "display_name": false
        },
        {
          "uuid": "46421a84-a426-4059-b04c-527b49bf9b91",
          "name": "SULFONIUM, ((3S)-3-AMINO-3-CARBOXYPROPYL)DIMETHYL-, CHLORIDE (1:1)",
          "stdName": "SULFONIUM, ((3S)-3-AMINO-3-CARBOXYPROPYL)DIMETHYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "8757c524-9969-401c-947b-c706617be0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "cf32d905-5dae-4eaa-883b-7a22ef6c17cf",
          "name": "U-VIT",
          "stdName": "U-VIT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "8757c524-9969-401c-947b-c706617be0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "4f533b1e-b92d-47d6-8740-1cdf443239a7",
          "name": "VITAMIN U CHLORIDE",
          "stdName": "VITAMIN U CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "bafd0864-556e-45e6-bef6-9a90be54f636"
          ],
          "display_name": false
        },
        {
          "uuid": "9b885ba4-2b66-4292-bf0c-386954f327d7",
          "name": "VITAS U",
          "stdName": "VITAS U",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "8757c524-9969-401c-947b-c706617be0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "497a2347-1dcf-4f92-a28c-1281574c3739",
          "name": "YUCRON",
          "stdName": "YUCRON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a18a4838-3253-456f-a1a3-dfdc9090d470",
            "8757c524-9969-401c-947b-c706617be0cb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b266138b-4f4e-4263-b561-aa3dd97f748e",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c3017de7-6836-4ca6-af7e-fb0c476bdd5a",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a18a4838-3253-456f-a1a3-dfdc9090d470",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6d2939e-0749-4c37-b9a3-01dbc1eb9244",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bafd0864-556e-45e6-bef6-9a90be54f636",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8757c524-9969-401c-947b-c706617be0cb",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f610df8c-7bee-4aa9-83ba-3a1e8b97f95b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bdfd8f9-e326-45d6-92e7-4a859a992ead",
          "citation": "martindale",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c26f353f-15d2-4adf-a783-493b3e9f827c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e312cfe2-e940-4866-93e2-92c89f63f29a",
          "citation": "SRS import [G9CUR2204U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G9CUR2204U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b69893a-acff-4479-8c0d-8a717506a62d",
          "citation": "METHYLMETHIONINE SULFONIUM CHLORIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "efa5c2be-7071-4fd1-b9d5-ff7b00ee6e1b",
          "citation": "METHIOSULFONIUM CHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40f0a20a-1ba5-e00e-0c02-3310c6e908b1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1115-84-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "25619653-d08c-a178-3450-8fd7187d8f26",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "445dae18-295f-efae-72b1-da3f737cdf1b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2c0acbdf-c1ef-4351-82d7-7701e43ad1cf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "87db9286-aad7-da5c-0122-e54c750dc1d1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "55ebfc6b-6766-4349-94d1-964878778427",
          "id": "55ebfc6b-6766-4349-94d1-964878778427",
          "molfile": "\n  Marvin  01132104282D          \n\n  1  0  0  0  1  0            999 V2000\n    7.6921   -2.0791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aa06f92d-b301-4e2f-9ebb-1715b829b2cc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1ccfbe07-8026-463e-8437-8ea9012a06d7",
          "id": "1ccfbe07-8026-463e-8437-8ea9012a06d7",
          "molfile": "\n  Marvin  01132101402D          \n\n 10  9  0  0  1  0            999 V2000\n    4.5324   -1.3777    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.5324   -0.4470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8333   -1.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1069   -1.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4736   -1.7840    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    1.7268   -1.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4736   -2.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2248   -1.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9147   -1.3891    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.2248   -2.6716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\nM  CHG  2   5   1   9  -1\nM  END",
          "smiles": "C[S+](C)CC[C@@H](C(=O)[O-])N",
          "formula": "C6H13NO2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4b1ef92d-41f8-453a-b232-8dc902dd67ac"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "163.2392",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8c681932-1594-46bc-9b54-dffb79db36d9",
      "version": "8",
      "structure": {
        "id": "c05e4c4b-447d-4125-a9ff-a600f1feeb77",
        "molfile": "\n  Marvin  01132109572D          \n\n 11  9  0  0  1  0            999 V2000\n    4.5324   -1.3777    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.8333   -1.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2248   -1.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5324   -0.4470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1069   -1.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9147   -1.3891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2248   -2.6716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4736   -1.7840    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    1.7268   -1.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4736   -2.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6921   -2.0791    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  6  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\nM  CHG  2   8   1  11  -1\nM  END",
        "smiles": "C[S+](C)CC[C@@H](C(=O)O)N.[Cl-]",
        "formula": "C6H14NO2S.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "199.7001",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b266138b-4f4e-4263-b561-aa3dd97f748e",
          "e312cfe2-e940-4866-93e2-92c89f63f29a"
        ],
        "stereo_centers": 1
      },
      "unii": "G9CUR2204U"
    }
  ]
}