{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3f1e2346-ac94-4ff3-981d-2470278062f1",
          "code": "104594-70-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=104594-70-9",
          "code_system": "CAS",
          "references": [
            "ac38ebf4-169b-4d9f-8603-6e17b8b8ee91",
            "4ad21f90-a472-489e-a777-37852bf3f28c"
          ]
        },
        {
          "uuid": "e80d3326-82d4-4db5-9558-ee72264ccc98",
          "code": "C63756",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C63756",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ac38ebf4-169b-4d9f-8603-6e17b8b8ee91"
          ]
        },
        {
          "uuid": "d8049c58-3fa1-468c-852a-bd05de28c136",
          "code": "C055494",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67055494",
          "code_system": "MESH",
          "references": [
            "ac38ebf4-169b-4d9f-8603-6e17b8b8ee91"
          ]
        },
        {
          "uuid": "ff0bbde2-7457-4ce6-b1eb-7806b164d477",
          "code": "5281787",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281787",
          "code_system": "PUBCHEM",
          "references": [
            "ac38ebf4-169b-4d9f-8603-6e17b8b8ee91"
          ]
        },
        {
          "uuid": "e93c7d36-d54f-521d-d6f4-55204f716970",
          "code": "Caffeic acid phenethyl ester",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Caffeic_acid%20phenethyl%20ester",
          "code_system": "WIKIPEDIA",
          "references": [
            "0d5be1e6-75d5-e429-5133-6a0253340267"
          ]
        },
        {
          "uuid": "3420dbf5-5de6-0a9c-0e26-a44db8ac0c97",
          "code": "DTXSID8040987",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8040987",
          "code_system": "EPA CompTox",
          "references": [
            "f45eeb58-9a8b-44a6-977c-6093e3cd5db3"
          ]
        },
        {
          "uuid": "f1e399a1-006b-35b4-e347-096971e6e264",
          "code": "C2189",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Signal Transduction Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2189",
          "code_system": "NCI_THESAURUS",
          "references": [
            "01fe368c-ad14-dd60-87ab-3c1f218c9f81"
          ]
        },
        {
          "uuid": "b7174907-0488-f96c-a39b-15d108d1a702",
          "code": "3202 (Number of products:3)",
          "comments": "Dietary Supplement Label Database|chemical|Caffeic acid analog",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3202&item=Caffeic acid analog",
          "code_system": "DSLD",
          "references": [
            "01fe368c-ad14-dd60-87ab-3c1f218c9f81"
          ]
        },
        {
          "uuid": "ef0679c7-0966-4ab0-9701-7d8196cf34d7",
          "code": "G960R9S5SK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "514fd0a5-b960-e90e-f2b0-bf5c3dcecf98",
          "code": "8062",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8062",
          "code_system": "CHEBI",
          "references": [
            "01fe368c-ad14-dd60-87ab-3c1f218c9f81"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ba920f88-7b98-404b-b6c1-ba6a0711ce11",
          "name": "CAFFEIC ACID PHENETHYL ESTER",
          "stdName": "CAFFEIC ACID PHENETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0184c01-78da-4f8e-95b0-27ed7a249aa4"
          ],
          "display_name": true
        },
        {
          "uuid": "c4723201-d976-4b34-99d0-7f9e6159f3f9",
          "name": "PHENETHYL CAFFEATE",
          "stdName": "PHENETHYL CAFFEATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "d7eada58-f7bb-4e5d-bf05-4d3ef07759f6",
            "009a6557-6190-4f45-8340-7ca89f5dd6dc",
            "42688ff1-048e-4522-a36a-50853e10ac72",
            "2a87c0fd-c8c7-4375-bac3-d8fd9db20f85"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "015b97f8-d43e-4fa1-8c17-b9f6985a6c0e",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "d0184c01-78da-4f8e-95b0-27ed7a249aa4",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "009a6557-6190-4f45-8340-7ca89f5dd6dc",
          "citation": "http://www.chemblink.com/products/104594-70-9.htm",
          "url": "http://www.chemblink.com/products/104594-70-9.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a87c0fd-c8c7-4375-bac3-d8fd9db20f85",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7eada58-f7bb-4e5d-bf05-4d3ef07759f6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac38ebf4-169b-4d9f-8603-6e17b8b8ee91",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390930000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0be4232d-4964-4b09-a9b7-e8fba4c3f62e",
          "citation": "SRS import [G960R9S5SK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G960R9S5SK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390930000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "635bcf68-41e9-4a28-a2fe-664c9dc5a075",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42688ff1-048e-4522-a36a-50853e10ac72",
          "citation": "PHENETHYL CAFFEATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0d5be1e6-75d5-e429-5133-6a0253340267",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Caffeic_acid%20phenethyl%20ester",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f45eeb58-9a8b-44a6-977c-6093e3cd5db3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=104594-70-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "01fe368c-ad14-dd60-87ab-3c1f218c9f81",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4ad21f90-a472-489e-a777-37852bf3f28c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2a4f789d-f62c-4008-8586-e33d3f1d6f3c",
          "id": "2a4f789d-f62c-4008-8586-e33d3f1d6f3c",
          "molfile": "\n  Marvin  01132102182D          \n\n 21 22  0  0  0  0            999 V2000\n    3.0437   -5.8896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7623   -5.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7623   -4.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4844   -4.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1987   -4.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9085   -4.2499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6179   -4.6598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3363   -4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3363   -3.4301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0502   -4.6643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7641   -4.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4734   -4.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1873   -4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9104   -4.6635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6238   -4.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6238   -3.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8900   -3.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1873   -3.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1987   -5.4926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4797   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4797   -6.7217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 20  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 19  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)CCOC(=O)/C=C/c2ccc(c(c2)O)O",
          "formula": "C17H16O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1769f220-cfc4-4cf2-b41f-46d672f0cb95"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "284.3072",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ee378a3e-8654-4f7e-88ee-98544d705aa9",
      "version": "10",
      "structure": {
        "id": "93b5638a-aa8d-4961-a59b-8e097038f6f3",
        "molfile": "\n  Marvin  01132107402D          \n\n 21 22  0  0  0  0            999 V2000\n    3.7623   -5.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4797   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1987   -5.4926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1987   -4.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4844   -4.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7623   -4.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9085   -4.2499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6179   -4.6598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3363   -4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0502   -4.6643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7641   -4.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4734   -4.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1873   -4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9104   -4.6635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6238   -4.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6238   -3.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8900   -3.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1873   -3.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3363   -3.4301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4797   -6.7217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0437   -5.8896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 13  1  0  0  0  0\n  9 19  2  0  0  0  0\n  2 20  1  0  0  0  0\n  1 21  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)CCOC(=O)/C=C/c2ccc(c(c2)O)O",
        "formula": "C17H16O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "284.3072",
        "optical_activity": "NONE",
        "references": [
          "635bcf68-41e9-4a28-a2fe-664c9dc5a075",
          "0be4232d-4964-4b09-a9b7-e8fba4c3f62e"
        ],
        "stereo_centers": 0
      },
      "unii": "G960R9S5SK"
    }
  ]
}