{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "31f3dcb4-0f35-490c-a74c-2679eba2f41c",
          "code": "961-07-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=961-07-9",
          "code_system": "CAS",
          "references": [
            "003bc8e2-0da0-417f-86ed-d53492d93288",
            "8ce217f3-cc99-43bc-8946-d0a7f118e887"
          ]
        },
        {
          "uuid": "aaecc683-c0be-4865-8020-1ffc5310a6e7",
          "code": "213-505-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.278",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "003bc8e2-0da0-417f-86ed-d53492d93288"
          ]
        },
        {
          "uuid": "29d59b1e-a818-6db8-28de-303ba4b3559a",
          "code": "135398592",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135398592",
          "code_system": "PUBCHEM",
          "references": [
            "75084e58-f1ce-8cf0-1e33-48d40a05d8d5"
          ]
        },
        {
          "uuid": "2ec15ff6-3fb6-c409-0724-fefd148679b1",
          "code": "Deoxyguanosine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Deoxyguanosine",
          "code_system": "WIKIPEDIA",
          "references": [
            "c592374f-1028-2655-e24f-c9a410b6a7cf"
          ]
        },
        {
          "uuid": "0ccf0f3d-ba49-c9f9-b0b0-6bd5e749c72a",
          "code": "C707",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Nucleic Acids, Nucleosides, and Nucleotides[C708]|Nucleoside",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0377ff16-a834-7807-6c58-b4392c360e0d"
          ]
        },
        {
          "uuid": "7c698c10-2e4b-4885-aeab-7e4a3b55eae9",
          "code": "SUB197050",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0dfb3d05-8bd8-da7d-be6f-f616be4489f3"
          ]
        },
        {
          "uuid": "45169e23-b0ad-4974-133b-cb4821ca6bce",
          "code": "75149-5",
          "comments": "LOINC|ACTIVE|CHEM|CSF|Deoxyguanosine [Moles/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/75149-5/",
          "code_system": "LOINC",
          "references": [
            "0377ff16-a834-7807-6c58-b4392c360e0d"
          ]
        },
        {
          "uuid": "ced21b00-939c-8f51-a6d2-7589061a6c9d",
          "code": "59201-4",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Deoxyguanosine/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/59201-4/",
          "code_system": "LOINC",
          "references": [
            "0377ff16-a834-7807-6c58-b4392c360e0d"
          ]
        },
        {
          "uuid": "f0e180cb-42bd-4f5c-920b-413213509ebd",
          "code": "75134-7",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Deoxyguanosine [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/75134-7/",
          "code_system": "LOINC",
          "references": [
            "0377ff16-a834-7807-6c58-b4392c360e0d"
          ]
        },
        {
          "uuid": "4964fb75-83cd-13e1-b325-f791ca73d853",
          "code": "C421",
          "comments": "NCIT",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C421",
          "code_system": "NCI_THESAURUS",
          "references": [
            "dbfb9809-3e7f-fff4-f1b5-f617b6cae8e0"
          ]
        },
        {
          "uuid": "ee367086-c277-48f4-be75-2a56c3570bcb",
          "code": "G9481N71RO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e47c0c84-bb58-2258-5104-6be37cafd4e4",
          "code": "17172",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17172",
          "code_system": "CHEBI",
          "references": [
            "0377ff16-a834-7807-6c58-b4392c360e0d"
          ]
        },
        {
          "uuid": "f0b1f0c5-a275-3c87-f84a-5be71301a9fe",
          "code": "DTXSID30883626",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30883626",
          "code_system": "EPA CompTox",
          "references": [
            "6a3faf25-4f45-8f48-556f-2b56ee852272"
          ]
        },
        {
          "uuid": "c7441f7f-1b84-9957-bba2-f433f6f51dc6",
          "code": "100000182770",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "06871225-1d7a-7ea9-57fa-c158527e6181"
          ]
        },
        {
          "uuid": "4fbb7a33-d61d-cb43-beb3-6413161a1086",
          "code": "22837",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=22837",
          "code_system": "NSC",
          "references": [
            "67da2664-12d9-8ecb-0249-6a8ba3b1b816"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5a474497-dbe0-4536-a0ef-9a0e8da7e892",
          "name": "2'-DEOXYGUANOSINE",
          "stdName": "2'-DEOXYGUANOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cce7155-aedd-4113-bb9f-8bc9e87a52dc"
          ],
          "display_name": true
        },
        {
          "uuid": "f82aec08-b55a-412b-bd07-0d1a2afd487c",
          "name": "2'-DESOXYGUANOSINE",
          "stdName": "2'-DESOXYGUANOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cce7155-aedd-4113-bb9f-8bc9e87a52dc",
            "7b2989c0-c5f2-4586-9906-63c2e166b22e"
          ],
          "display_name": false
        },
        {
          "uuid": "05ccad0f-5434-4fa0-8932-3950bd1a5c03",
          "name": "9-(2-DEOXY-.BETA.-D-ERYTHRO-PENTOFURANOSYL)GUANINE",
          "stdName": "9-(2-DEOXY-.BETA.-D-ERYTHRO-PENTOFURANOSYL)GUANINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cce7155-aedd-4113-bb9f-8bc9e87a52dc",
            "7b2989c0-c5f2-4586-9906-63c2e166b22e"
          ],
          "display_name": false
        },
        {
          "uuid": "a31e3a3c-52a3-4c54-8ab5-49a4887730d9",
          "name": "DEOXYGUANOSINE",
          "stdName": "DEOXYGUANOSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29c189e6-e47f-44bd-a4dc-cc96ee1a77e4",
            "7b2989c0-c5f2-4586-9906-63c2e166b22e"
          ],
          "display_name": false
        },
        {
          "uuid": "58042a46-5d84-40d9-b8b0-166790ab6086",
          "name": "GUANOSINE, 2'-DEOXY-",
          "stdName": "GUANOSINE, 2'-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cce7155-aedd-4113-bb9f-8bc9e87a52dc",
            "7b2989c0-c5f2-4586-9906-63c2e166b22e"
          ],
          "display_name": false
        },
        {
          "uuid": "6fc8c5db-871a-4d7f-b123-17e9e8a5bfd8",
          "name": "NSC-22837",
          "stdName": "NSC-22837",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cce7155-aedd-4113-bb9f-8bc9e87a52dc",
            "7b2989c0-c5f2-4586-9906-63c2e166b22e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5cce7155-aedd-4113-bb9f-8bc9e87a52dc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7b2989c0-c5f2-4586-9906-63c2e166b22e",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29c189e6-e47f-44bd-a4dc-cc96ee1a77e4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "003bc8e2-0da0-417f-86ed-d53492d93288",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389705000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12cf178e-4d7b-46cf-a6c0-52c402b31ad1",
          "citation": "SRS import [G9481N71RO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G9481N71RO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389705000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "152758f8-cc5a-46e0-be7a-082989346e0f",
          "citation": "COMMON CHEMISTRY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c592374f-1028-2655-e24f-c9a410b6a7cf",
          "citation": "Deoxyguanosine",
          "url": "https://en.wikipedia.org/wiki/Deoxyguanosine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0377ff16-a834-7807-6c58-b4392c360e0d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0dfb3d05-8bd8-da7d-be6f-f616be4489f3",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ce217f3-cc99-43bc-8946-d0a7f118e887",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "75084e58-f1ce-8cf0-1e33-48d40a05d8d5",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "7a515e48-59ad-10b2-ebd5-86782646dc05",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "dbfb9809-3e7f-fff4-f1b5-f617b6cae8e0",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "67da2664-12d9-8ecb-0249-6a8ba3b1b816",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6a3faf25-4f45-8f48-556f-2b56ee852272",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "06871225-1d7a-7ea9-57fa-c158527e6181",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e3a0f124-e20c-4d5c-988f-3d455adf3c43",
          "id": "e3a0f124-e20c-4d5c-988f-3d455adf3c43",
          "molfile": "\n  Marvin  01132111472D          \n\n 19 21  0  0  1  0            999 V2000\n    5.3605   -5.7277    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.0459   -6.4902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3375   -5.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6394   -5.1174    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.8474   -4.6803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0628   -5.1306    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.4259   -4.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6045   -4.6094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6296   -3.9421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1424   -3.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6185   -2.6156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4040   -2.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4109   -3.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1271   -4.0853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8411   -3.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5527   -4.0733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8342   -2.8379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1133   -2.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1064   -1.6120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  1  0  0  0\n  5  4  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 18 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\nM  END",
          "smiles": "C1[C@@H]([C@@H](CO)O[C@H]1n2cnc3c2[nH]c(N)nc3=O)O",
          "formula": "C10H13N5O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e97573fc-06a5-4c2d-8fab-6017227deff3"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "267.2417",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "30c542f8-3f9b-4376-83fd-d0ec1fdd0ea2",
      "version": "21",
      "structure": {
        "id": "de47a450-8634-4e37-bba1-05ce3430cb9c",
        "molfile": "\n  Marvin  01132111312D          \n\n 19 21  0  0  1  0            999 V2000\n    7.4109   -3.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6296   -3.9421    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    6.6394   -5.1174    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.8474   -4.6803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0628   -5.1306    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.4259   -4.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6045   -4.6094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3605   -5.7277    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3375   -5.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0459   -6.4902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1424   -3.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6185   -2.6156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4040   -2.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1133   -2.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1064   -1.6120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8342   -2.8379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8411   -3.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1271   -4.0853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5527   -4.0733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  1  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  3  1  0  0  0  0\n  8 10  1  6  0  0  0\n 11  2  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13  1  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18  1  1  0  0  0  0\n 19 17  1  0  0  0  0\nM  END",
        "smiles": "C1[C@@H]([C@@H](CO)O[C@H]1n2cnc3c2nc(N)[nH]c3=O)O",
        "formula": "C10H13N5O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "267.2417",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "152758f8-cc5a-46e0-be7a-082989346e0f",
          "12cf178e-4d7b-46cf-a6c0-52c402b31ad1"
        ],
        "stereo_centers": 3
      },
      "unii": "G9481N71RO"
    }
  ]
}