{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8c209efc-2380-4c5b-ad7c-aa2b3f608148", "code": "G8D4792Q7K", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "31b66f01-e7ba-b6e5-d4d0-e4189505f0b8", "code": "9852086", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9852086", "code_system": "PUBCHEM", "references": [ "9c3222f7-0f0d-6cf3-254e-6e56b6117121" ] }, { "uuid": "0da0941f-c063-47da-b9ab-c0e90745f595", "code": "39262-14-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=39262-14-1", "code_system": "CAS", "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ] }, { "uuid": "9155ca12-3763-0a34-8ec8-8ca36305f1a7", "code": "DTXSID60431770", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60431770", "code_system": "EPA CompTox", "references": [ "a6757c43-ca27-985e-7e30-002893a1b1da" ] }, { "uuid": "ba634181-9609-c45c-0855-24bdb9794c6c", "code": "G8D4792Q7K", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(G8D4792Q7K)", "code_system": "DAILYMED", "references": [ "afecebe1-ee64-bd51-b966-d20d6cae36a6" ] } ], "substance_class": "chemical", "names": [ { "uuid": "7610e503-a848-40e3-8528-577739e19504", "name": "(2S,3R,4S,5S,6R)-2-{[(2S)-2-[(1S,3aR,3bR,5aR,7S,9aR,9bR,11R,11aR)-7,11-dihydroxy-3a,3b,6,6,9a-pentamethyl-hexadecahydro-1H-cyclopenta[a]phenanthren-1-yl]-6-methylhept-5-en-2-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol", "stdName": "(2S,3R,4S,5S,6R)-2-(((2S)-2-((1S,3AR,3BR,5AR,7S,9AR,9BR,11R,11AR)-7,11-DIHYDROXY-3A,3B,6,6,9A-PENTAMETHYL-HEXADECAHYDRO-1H-CYCLOPENTA(A)PHENANTHREN-1-YL)-6-METHYLHEPT-5-EN-2-YL)OXY)-6-(HYDROXYMETHYL)OXANE-3,4,5-TRIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "c4a64dc7-e038-4ee8-8d81-ea1478fd4c7e", "name": "(3.BETA.,12.BETA.)-3,12-DIHYDROXYDAMMAR-24-EN-20-YL .BETA.-D-GLUCOPYRANOSIDE", "stdName": "(3.BETA.,12.BETA.)-3,12-DIHYDROXYDAMMAR-24-EN-20-YL .BETA.-D-GLUCOPYRANOSIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "909c82b8-a8a3-4702-99b6-df46e10fdbcc", "name": ".BETA.-D-GLUCOPYRANOSIDE, (3.BETA.,12.BETA.)-3,12-DIHYDROXYDAMMAR-24-EN-20-YL", "stdName": ".BETA.-D-GLUCOPYRANOSIDE, (3.BETA.,12.BETA.)-3,12-DIHYDROXYDAMMAR-24-EN-20-YL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "c3c4f819-4861-44b5-b8d4-c59cec157dc0", "name": "20(S)-Ginsenoside CK", "stdName": "20(S)-GINSENOSIDE CK", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "162db5f8-199b-4ce8-ba5e-a5b961dba288", "name": "20(S)-PROTOPANAXADIOL 20-O-.BETA.-D-GLUCOPYRANOSIDE", "stdName": "20(S)-PROTOPANAXADIOL 20-O-.BETA.-D-GLUCOPYRANOSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "2e21a530-9a07-4357-8bd8-2b67b4dcd5a1", "name": "20-O-β-Glucopyranosyl-20(S)-protopanaxadiol", "stdName": "20-O-.BETA.-GLUCOPYRANOSYL-20(S)-PROTOPANAXADIOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "0f7c1a29-fe9d-4c3a-8741-be83878834c8", "name": "3-O-DEGLUCOSYLGINSENOSIDE F2", "stdName": "3-O-DEGLUCOSYLGINSENOSIDE F2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "63c7815d-7de7-478d-9eee-3939265fb1f4", "name": "GINSENOSIDE COMPOUND K", "stdName": "GINSENOSIDE COMPOUND K", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "87831c24-a716-46bd-8723-e91df0575493" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "0c415ca9-c742-4325-ac2b-97719cc6852b", "name_org": "INCI" } ] }, { "uuid": "f7060100-a5ea-4ec5-af89-2b5dd4fc34bb", "name": "Ginsenoside C-K", "stdName": "GINSENOSIDE C-K", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "2c8b4606-d5b9-460e-8cdd-d36d32d681c3", "name": "Ginsenoside M1", "stdName": "GINSENOSIDE M1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "fa22d59d-8cb8-4d23-a9c1-c7eb6a6668e6", "name": "NT3 VAN SC6", "stdName": "NT3 VAN SC6", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false }, { "uuid": "3f672470-39d3-4923-acf8-108a35a9569c", "name": "Protopanaxadiol 20-O-glucoside", "stdName": "PROTOPANAXADIOL 20-O-GLUCOSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fba217c6-e914-441f-afd1-9f87c6ad18c9" ], "display_name": false } ], "references": [ { "uuid": "fba217c6-e914-441f-afd1-9f87c6ad18c9", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "87831c24-a716-46bd-8723-e91df0575493", "citation": "https://www.chemfaces.com/natural/Compound-K-CFN99756.html", "url": "https://www.chemfaces.com/natural/Compound-K-CFN99756.html", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9c3222f7-0f0d-6cf3-254e-6e56b6117121", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "a6757c43-ca27-985e-7e30-002893a1b1da", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "afecebe1-ee64-bd51-b966-d20d6cae36a6", "citation": "DAILYMED", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "75ce546b-d205-42c8-8638-08b850f83c92", "id": "75ce546b-d205-42c8-8638-08b850f83c92", "molfile": "\n Marvin 10102214352D \n\n 48 52 0 0 1 0 999 V2000\n 5.9560 4.9122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3351 2.5790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3301 4.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9320 1.9719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4198 4.3975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5012 4.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3000 3.5724 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.4750 3.5724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3000 4.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3000 2.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5856 4.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5856 5.6349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8711 6.0474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8711 6.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1566 5.6349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8820 3.4009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 3.5724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4750 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0625 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 2.1434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5820 3.4009 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.1695 4.1154 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.4070 3.4009 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.1695 2.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3445 4.1154 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.5820 4.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8195 4.1154 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.8195 2.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3445 2.6863 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.9320 3.4009 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.7924 4.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4070 4.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6445 4.1154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6445 2.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1250 3.5724 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.0388 4.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0570 3.4009 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.0625 2.8579 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.4750 2.1434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2375 2.8579 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.0625 1.4290 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.8250 2.1434 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1.2375 1.4290 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.7955 2.6039 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2320 4.8298 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4471 2.7334 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0388 2.7519 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 23 1 1 1 0 0 0\n 24 2 1 1 0 0 0\n 26 3 1 6 0 0 0\n 30 4 1 1 0 0 0\n 5 34 1 0 0 0 0\n 6 34 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 6 0 0 0\n 7 10 1 0 0 0 0\n 7 36 1 0 0 0 0\n 39 8 1 6 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 38 16 1 1 0 0 0\n 41 17 1 1 0 0 0\n 18 19 1 0 0 0 0\n 42 18 1 6 0 0 0\n 43 20 1 6 0 0 0\n 44 21 1 1 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 22 25 1 0 0 0 0\n 22 45 1 6 0 0 0\n 23 26 1 0 0 0 0\n 23 27 1 0 0 0 0\n 24 28 1 0 0 0 0\n 24 29 1 0 0 0 0\n 25 30 1 0 0 0 0\n 26 31 1 0 0 0 0\n 26 32 1 0 0 0 0\n 27 33 1 0 0 0 0\n 28 33 1 0 0 0 0\n 28 34 1 0 0 0 0\n 28 46 1 6 0 0 0\n 29 35 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 36 1 0 0 0 0\n 31 47 1 1 0 0 0\n 32 37 1 0 0 0 0\n 34 38 1 0 0 0 0\n 35 38 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 48 1 6 0 0 0\n 39 40 1 0 0 0 0\n 39 41 1 0 0 0 0\n 40 42 1 0 0 0 0\n 41 43 1 0 0 0 0\n 42 44 1 0 0 0 0\n 43 44 1 0 0 0 0\nM END", "smiles": "CC(=CCC[C@@](C)([C@@]1([H])CC[C@]2(C)[C@]1([H])[C@@H](C[C@]3([H])[C@@]4(C)CC[C@@H](C(C)(C)[C@]4([H])CC[C@]32C)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)C", "formula": "C36H62O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e7bc306e-a224-45da-b1c6-576812b23476" }, "defined_stereo": 15, "ez_centers": 0, "molecular_weight": "622.8741", "optical_activity": "UNSPECIFIED", "stereo_centers": 15 } ], "definition_level": "COMPLETE", "uuid": "c2288a0a-13d6-4ceb-8637-56dbedf1cdc5", "version": "10", "structure": { "id": "b58389da-1bc5-413f-879c-e9f7c3cfb4ad", "molfile": "Ginsenoside K\n JSDraw210102214352D\n\n 48 52 0 0 1 0 0 V2000\n 27.6152 -5.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2227 -9.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4317 -5.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6790 -10.8259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.1646 -6.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.4277 -5.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5932 -7.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0333 -7.7997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5932 -6.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5932 -9.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2423 -5.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2423 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8914 -3.1199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8914 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5403 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.0385 -8.1240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9134 -7.7997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0333 -13.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2533 -14.5545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3535 -10.5016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9134 -13.2034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7989 -8.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0189 -6.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3588 -8.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0189 -9.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4590 -6.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7989 -5.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1387 -6.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.1387 -9.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4590 -9.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6790 -8.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4151 -5.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3588 -5.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6987 -6.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.6987 -9.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1531 -7.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9901 -6.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.4786 -8.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2533 -9.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0333 -10.5016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6934 -9.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2533 -11.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9134 -10.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6934 -11.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2026 -9.6309 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9187 -5.4222 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7621 -9.3862 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9901 -9.3512 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 23 1 1 1 0 0 0\n 24 2 1 1 0 0 0\n 26 3 1 6 0 0 0\n 30 4 1 1 0 0 0\n 5 34 1 0 0 0 0\n 6 34 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 6 0 0 0\n 7 10 1 0 0 0 0\n 7 36 1 0 0 0 0\n 39 8 1 6 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 38 16 1 1 0 0 0\n 41 17 1 1 0 0 0\n 18 19 1 0 0 0 0\n 42 18 1 6 0 0 0\n 43 20 1 6 0 0 0\n 44 21 1 1 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 22 25 1 0 0 0 0\n 22 45 1 6 0 0 0\n 23 26 1 0 0 0 0\n 23 27 1 0 0 0 0\n 24 28 1 0 0 0 0\n 24 29 1 0 0 0 0\n 25 30 1 0 0 0 0\n 26 31 1 0 0 0 0\n 26 32 1 0 0 0 0\n 27 33 1 0 0 0 0\n 28 33 1 0 0 0 0\n 28 34 1 0 0 0 0\n 28 46 1 6 0 0 0\n 29 35 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 36 1 0 0 0 0\n 31 47 1 1 0 0 0\n 32 37 1 0 0 0 0\n 34 38 1 0 0 0 0\n 35 38 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 48 1 6 0 0 0\n 39 40 1 0 0 0 0\n 39 41 1 0 0 0 0\n 40 42 1 0 0 0 0\n 41 43 1 0 0 0 0\n 42 44 1 0 0 0 0\n 43 44 1 0 0 0 0\nM END", "smiles": "CC(=CCC[C@@](C)([C@@]1([H])CC[C@]2(C)[C@]1([H])[C@@H](C[C@]3([H])[C@@]4(C)CC[C@@H](C(C)(C)[C@]4([H])CC[C@]32C)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)C", "formula": "C36H62O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 15, "ez_centers": 0, "molecular_weight": "622.8741", "optical_activity": "UNSPECIFIED", "references": [ "87831c24-a716-46bd-8723-e91df0575493" ], "stereo_centers": 15 }, "unii": "G8D4792Q7K" } ] }