{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1fde8648-63cf-483b-99d2-41c72371cb45", "code": "182677-30-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=182677-30-1", "code_system": "CAS", "references": [ "ac4b6d3c-10cc-4499-b936-dee457939615", "ca50585d-78d1-472e-aff3-2c9b03abd2f6" ] }, { "uuid": "911f7adf-dd72-4aec-8dc8-ce3fed128d77", "code": "15254861", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15254861", "code_system": "PUBCHEM", "references": [ "ac4b6d3c-10cc-4499-b936-dee457939615" ] }, { "uuid": "f23d1c78-d52c-44c1-acf9-3bbdab32777b", "code": "G8C1F1S4W9", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a77572c1-8380-761a-2b51-bb7c18018583", "code": "DTXSID60872265", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60872265", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "1bb23e67-7f2b-4260-a5e6-d98fec591510", "name": "2,2',3,4,4',5'-HEXABROMODIPHENYL ETHER", "stdName": "2,2',3,4,4',5'-HEXABROMODIPHENYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bd9e8a9d-e39c-4278-a2f7-89c424302c4a", "12ccdac1-75a9-4082-8095-fa17fba576ed" ], "display_name": true }, { "uuid": "a6fefdb5-f2e9-4337-82cc-eb97ff2ab37e", "name": "BENZENE, 1,2,3-TRIBROMO-4-(2,4,5-TRIBROMOPHENOXY)-", "stdName": "BENZENE, 1,2,3-TRIBROMO-4-(2,4,5-TRIBROMOPHENOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bd9e8a9d-e39c-4278-a2f7-89c424302c4a", "12ccdac1-75a9-4082-8095-fa17fba576ed" ], "display_name": false }, { "uuid": "9e61bfcf-678f-49f8-927f-12ef75bb9301", "name": "PBDE 138", "stdName": "PBDE 138", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bd9e8a9d-e39c-4278-a2f7-89c424302c4a", "12ccdac1-75a9-4082-8095-fa17fba576ed" ], "display_name": false } ], "references": [ { "uuid": "12ccdac1-75a9-4082-8095-fa17fba576ed", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "bd9e8a9d-e39c-4278-a2f7-89c424302c4a", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ac4b6d3c-10cc-4499-b936-dee457939615", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392861000, "tags": [ "NOMEN" ] }, { "uuid": "4296b0fa-05af-45eb-babd-995e3ac7abe0", "citation": "SRS import [G8C1F1S4W9]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G8C1F1S4W9", "doc_type": "SRS", "public_domain": true, "document_date": 1493392861000, "tags": [ "NOMEN" ] }, { "uuid": "446a579f-981c-4750-a66a-58c097192b1a", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ca50585d-78d1-472e-aff3-2c9b03abd2f6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4eb245c1-04ef-43a8-b992-5821d24155ee", "id": "4eb245c1-04ef-43a8-b992-5821d24155ee", "molfile": "\n Marvin 01132104062D \n\n 19 20 0 0 0 0 999 V2000\n 4.6506 -4.0761 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3611 -4.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3525 -5.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0631 -5.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0544 -6.5622 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7821 -5.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4926 -5.7536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2118 -5.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9223 -5.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6415 -5.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6501 -4.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3647 -4.1362 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9396 -4.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9483 -3.2975 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2205 -4.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5100 -4.1062 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7908 -4.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0803 -4.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0890 -3.2674 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 18 2 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 17 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 15 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 11 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "c1cc(c(c(c1Br)Br)Br)Oc2cc(c(cc2Br)Br)Br", "formula": "C12H4Br6O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "166beba9-148a-4f82-9748-2fd98c2c9076" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "643.5812", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "446f2586-3d00-4554-ae55-0a056947ad21", "version": "3", "structure": { "id": "ce7aee2b-9474-4820-8c65-d859510b7707", "molfile": "\n Marvin 01132110402D \n\n 19 20 0 0 0 0 999 V2000\n 7.4926 -5.7536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2118 -5.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2205 -4.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9396 -4.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6501 -4.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6415 -5.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9223 -5.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3647 -4.1362 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9483 -3.2975 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5100 -4.1062 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7821 -5.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0631 -5.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3525 -5.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3611 -4.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0803 -4.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7908 -4.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0890 -3.2674 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6506 -4.0761 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0544 -6.5622 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 2 7 2 0 0 0 0\n 5 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 3 10 1 0 0 0 0\n 1 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 11 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 14 18 1 0 0 0 0\n 12 19 1 0 0 0 0\nM END", "smiles": "c1cc(c(c(c1Br)Br)Br)Oc2cc(c(cc2Br)Br)Br", "formula": "C12H4Br6O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "643.5812", "optical_activity": "NONE", "references": [ "4296b0fa-05af-45eb-babd-995e3ac7abe0", "446a579f-981c-4750-a66a-58c097192b1a" ], "stereo_centers": 0 }, "unii": "G8C1F1S4W9" } ] }