{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ad61c2e3-ec49-499c-9354-206f4c7aa75a", "code": "192211-41-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=192211-41-9", "code_system": "CAS", "references": [ "95702656-379a-4ec5-aa78-e63ab22ebf37", "398ee3bf-1f53-4898-a2f2-928b52bff88c" ] }, { "uuid": "072aac84-2eaf-4579-89a6-384453aebcec", "code": "67952979", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67952979", "code_system": "PUBCHEM", "references": [ "95702656-379a-4ec5-aa78-e63ab22ebf37" ] }, { "uuid": "33aac86f-c443-f739-47e2-7c562272ad07", "code": "DTXSID30172800", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30172800", "code_system": "EPA CompTox", "references": [ "29bc2eef-26b0-675b-0bbe-70c2d7d4ee21" ] }, { "uuid": "928684cc-0e35-4c35-81cb-b6c0f3cbb9f8", "code": "G6IKF0I8B4", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "4f345a73-7710-4d15-a33f-c05c1511fe12", "name": "BENZYL URSOLATE", "stdName": "BENZYL URSOLATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "f0a01019-ae2a-40dc-a41b-da12d8cdd9ea", "b0b08999-ee69-45d1-b8b2-7a9e5594ed4e", "fef07b82-0fb6-4a7a-a82c-02975b4ba3e5" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f945fa57-6971-452f-99d3-2a1be82bb81c", "name_org": "INCI" } ] }, { "uuid": "1b01ead1-9ee8-429a-b7d5-4382f5d2de14", "name": "URS-12-EN-28-OIC ACID, 3-HYDROXY-, PHENYLMETHYL ESTER, (3.BETA.)-", "stdName": "URS-12-EN-28-OIC ACID, 3-HYDROXY-, PHENYLMETHYL ESTER, (3.BETA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f0a01019-ae2a-40dc-a41b-da12d8cdd9ea", "253611b0-18e3-4583-b891-3100d66f3b31" ], "display_name": false }, { "uuid": "c1481b47-0e9f-4232-bcba-5612776ad47a", "name": "URSOLIC ACID BENZYL ESTER", "stdName": "URSOLIC ACID BENZYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f0a01019-ae2a-40dc-a41b-da12d8cdd9ea", "253611b0-18e3-4583-b891-3100d66f3b31" ], "display_name": false } ], "references": [ { "uuid": "b0b08999-ee69-45d1-b8b2-7a9e5594ed4e", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f0a01019-ae2a-40dc-a41b-da12d8cdd9ea", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "253611b0-18e3-4583-b891-3100d66f3b31", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "95702656-379a-4ec5-aa78-e63ab22ebf37", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391922000, "tags": [ "NOMEN" ] }, { "uuid": "53f2b860-c7df-4ea9-b1bf-40c46ea04f35", "citation": "SRS import [G6IKF0I8B4]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G6IKF0I8B4", "doc_type": "SRS", "public_domain": true, "document_date": 1493391922000, "tags": [ "NOMEN" ] }, { "uuid": "fef07b82-0fb6-4a7a-a82c-02975b4ba3e5", "citation": "BENZYL URSOLATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "29bc2eef-26b0-675b-0bbe-70c2d7d4ee21", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=192211-41-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "398ee3bf-1f53-4898-a2f2-928b52bff88c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c92c7b1e-4882-4af2-baf2-4579872f8cd8", "id": "c92c7b1e-4882-4af2-baf2-4579872f8cd8", "molfile": "\n Marvin 01132110232D \n\n 40 45 0 0 1 0 999 V2000\n 10.0688 -2.6826 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.0694 -1.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7829 -3.0956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7823 -3.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0675 -4.3326 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.0669 -5.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3521 -5.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6379 -5.1565 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.6373 -5.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6386 -4.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9244 -3.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2096 -4.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2090 -5.1554 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.4942 -5.5674 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.4948 -4.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7800 -5.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0653 -5.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0646 -6.3913 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.3498 -6.8033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7788 -6.8043 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.1907 -7.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2480 -7.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4935 -6.3924 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.2077 -6.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9225 -6.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9232 -5.5685 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.9238 -4.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3534 -3.9196 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.3540 -3.0946 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.6398 -2.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7816 -4.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4964 -4.3337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7810 -5.5706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4952 -5.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2099 -5.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2106 -4.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9254 -4.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6396 -4.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6389 -5.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9242 -5.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 29 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 28 1 0 0 0 0\n 5 31 1 1 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 6 0 0 0\n 10 8 1 0 0 0 0\n 26 8 1 0 0 0 0\n 10 11 2 0 0 0 0\n 28 10 1 6 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 1 0 0 0\n 13 14 1 0 0 0 0\n 13 26 1 0 0 0 0\n 14 15 1 1 0 0 0\n 14 16 1 0 0 0 0\n 14 23 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 1 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 23 20 1 1 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 1 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 1 0 0 0\n 31 32 2 0 0 0 0\n 31 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 35 40 2 0 0 0 0\n 37 36 2 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 2 0 0 0 0\n 40 39 1 0 0 0 0\nM END", "smiles": "C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@]43C)O)[C@@H]2[C@H]1C)C(=O)OCc6ccccc6", "formula": "C37H54O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c3e77f7e-1605-47aa-ab14-86fb29b79712" }, "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "546.8242", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "COMPLETE", "uuid": "3c4b0083-dc01-4637-bb4b-4179c139700e", "version": "5", "structure": { "id": "887102c9-0c96-461d-9f0b-0120dc64166b", "molfile": "\n Marvin 01132107052D \n\n 43 48 0 0 1 0 999 V2000\n 12.2099 -5.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4952 -5.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7810 -5.5706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7816 -4.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0675 -4.3326 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.7823 -3.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7829 -3.0956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0688 -2.6826 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.3540 -3.0946 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.3534 -3.9196 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.6386 -4.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6379 -5.1565 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.3521 -5.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0669 -5.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9232 -5.5685 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.2090 -5.1554 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.2096 -4.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9244 -3.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2083 -5.9804 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4942 -5.5674 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.4935 -6.3924 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.2077 -6.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9225 -6.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7788 -6.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0646 -6.3913 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.0653 -5.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7800 -5.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3498 -6.8033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1907 -7.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2480 -7.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4929 -7.2174 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4948 -4.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9238 -4.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6373 -5.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3527 -4.7446 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6398 -2.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0694 -1.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4964 -4.3337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2106 -4.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9254 -4.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6396 -4.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6389 -5.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9242 -5.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 1 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 5 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 5 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 12 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 11 18 2 0 0 0 0\n 18 17 1 0 0 0 0\n 16 19 1 6 0 0 0\n 16 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 15 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 21 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 20 27 1 0 0 0 0\n 27 26 1 0 0 0 0\n 25 28 1 1 0 0 0\n 24 29 1 0 0 0 0\n 24 30 1 0 0 0 0\n 21 31 1 6 0 0 0\n 20 32 1 1 0 0 0\n 15 33 1 1 0 0 0\n 12 34 1 6 0 0 0\n 10 35 1 1 0 0 0\n 9 36 1 1 0 0 0\n 8 37 1 6 0 0 0\n 4 38 2 0 0 0 0\n 39 1 2 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 2 0 0 0 0\n 42 41 1 0 0 0 0\n 43 42 2 0 0 0 0\n 1 43 1 0 0 0 0\nM END", "smiles": "C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)CC[C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O)[C@]2([H])[C@H]1C)C(=O)OCc6ccccc6", "formula": "C37H54O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "546.8242", "optical_activity": "UNSPECIFIED", "references": [ "253611b0-18e3-4583-b891-3100d66f3b31", "53f2b860-c7df-4ea9-b1bf-40c46ea04f35" ], "stereo_centers": 10 }, "unii": "G6IKF0I8B4" } ] }