{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fc1c48b7-0af5-4c93-93a8-8d0e2769c81a",
          "code": "163702-06-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=163702-06-5",
          "code_system": "CAS",
          "references": [
            "5bed1431-3933-437d-bdd5-362bec5609e9",
            "00feb4ac-f67c-4c3e-8c97-1d309dd1ad0d"
          ]
        },
        {
          "uuid": "aabe0662-bda4-4dd0-a096-6fefb6595774",
          "code": "1541247",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1541247/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5bed1431-3933-437d-bdd5-362bec5609e9"
          ]
        },
        {
          "uuid": "a3ad0322-0bd6-41ee-ad3e-52d1f572646e",
          "code": "205999",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/205999",
          "code_system": "PUBCHEM",
          "references": [
            "5bed1431-3933-437d-bdd5-362bec5609e9"
          ]
        },
        {
          "uuid": "31e6aaed-bf68-5543-5ea5-e03b5c8cee55",
          "code": "DTXSID5073119",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5073119",
          "code_system": "EPA CompTox",
          "references": [
            "189113af-5cda-7a47-ea96-9824f3f40a67"
          ]
        },
        {
          "uuid": "553f658e-cb01-42fa-90aa-76f7f346b15a",
          "code": "G60AS0OTNS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "379ac47a-17bb-ec71-b41b-ce0bef800a4a",
          "code": "G60AS0OTNS",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=G60AS0OTNS",
          "code_system": "DAILYMED",
          "references": [
            "0723219a-3704-8334-337e-06e5979041b7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c8def70c-655d-415f-816e-9ec26da06d0b",
          "name": "2-(ETHOXYDIFLUOROMETHYL)-1,1,1,2,3,3,3-HEPTAFLUOROPROPANE",
          "stdName": "2-(ETHOXYDIFLUOROMETHYL)-1,1,1,2,3,3,3-HEPTAFLUOROPROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60316d82-0b5f-449b-9e6a-ee2169c256d0",
            "3f9b4833-8b01-4ede-a466-b6bd39a2a278"
          ],
          "display_name": false
        },
        {
          "uuid": "34ee9c17-3241-4e07-b8d8-68dee0800d3b",
          "name": "ETHYL NONAFLUOROISOBUTYL ETHER",
          "stdName": "ETHYL NONAFLUOROISOBUTYL ETHER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60316d82-0b5f-449b-9e6a-ee2169c256d0",
            "3f9b4833-8b01-4ede-a466-b6bd39a2a278"
          ],
          "display_name": false
        },
        {
          "uuid": "c03899bf-7eac-481f-835e-60051ee40618",
          "name": "ETHYL PERFLUOROISOBUTYL ETHER",
          "stdName": "ETHYL PERFLUOROISOBUTYL ETHER",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c561f60c-8c8a-4e9c-9c95-cd12193a9783",
            "fe3e9ddb-5769-406f-b56a-6e40de78fe2b",
            "3f9b4833-8b01-4ede-a466-b6bd39a2a278"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "464b5f4c-1b6a-4496-ad51-1f52caa3466c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ff59b6c7-c950-43e0-85b6-dfe7325e8971",
          "name": "PROPANE, 2-(ETHOXYDIFLUOROMETHYL)-1,1,1,2,3,3,3-HEPTAFLUORO-",
          "stdName": "PROPANE, 2-(ETHOXYDIFLUOROMETHYL)-1,1,1,2,3,3,3-HEPTAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60316d82-0b5f-449b-9e6a-ee2169c256d0",
            "3f9b4833-8b01-4ede-a466-b6bd39a2a278"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fe3e9ddb-5769-406f-b56a-6e40de78fe2b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3f9b4833-8b01-4ede-a466-b6bd39a2a278",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60316d82-0b5f-449b-9e6a-ee2169c256d0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bed1431-3933-437d-bdd5-362bec5609e9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391504000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57732974-8018-4578-bed9-689c28d1f638",
          "citation": "SRS import [G60AS0OTNS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G60AS0OTNS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391504000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c561f60c-8c8a-4e9c-9c95-cd12193a9783",
          "citation": "ETHYL PERFLUOROISOBUTYL ETHER [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "189113af-5cda-7a47-ea96-9824f3f40a67",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=163702-06-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "00feb4ac-f67c-4c3e-8c97-1d309dd1ad0d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0723219a-3704-8334-337e-06e5979041b7",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "483a4862-0ae4-4c95-b38f-23c4fd45120f",
          "id": "483a4862-0ae4-4c95-b38f-23c4fd45120f",
          "molfile": "\n  Marvin  01132103472D          \n\n 16 15  0  0  0  0            999 V2000\n    5.6087   -6.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3167   -6.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0268   -6.2586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0268   -5.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5704   -4.7300    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1284   -5.1986    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7389   -5.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3481   -4.2205    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1073   -4.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7977   -4.7096    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7622   -3.5248    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4355   -3.5166    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4388   -5.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1727   -6.2423    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8398   -6.1931    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1343   -5.0254    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 13  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\nM  END",
          "smiles": "CCOC(C(C(F)(F)F)(C(F)(F)F)F)(F)F",
          "formula": "C6H5F9O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2d0e3f1f-dea9-4f5a-8c85-7b5a8d88aa63"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "264.0892",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "11c01d3a-1257-441b-8912-1eefed670a07",
      "version": "5",
      "structure": {
        "id": "eb6cb11b-84bd-453f-83f5-cc8e1148b7e4",
        "molfile": "\n  Marvin  01132112112D          \n\n 16 15  0  0  0  0            999 V2000\n    5.6087   -6.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3167   -6.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7977   -4.7096    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7622   -3.5248    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4355   -3.5166    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5704   -4.7300    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1284   -5.1986    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0268   -6.2586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1727   -6.2423    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8398   -6.1931    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1073   -4.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3481   -4.2205    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0268   -5.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4388   -5.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7389   -5.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1343   -5.0254    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n 11  3  1  0  0  0  0\n 11  4  1  0  0  0  0\n 11  5  1  0  0  0  0\n 13  6  1  0  0  0  0\n 13  7  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  9  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15 12  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 11  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
        "smiles": "CCOC(C(C(F)(F)F)(C(F)(F)F)F)(F)F",
        "formula": "C6H5F9O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "264.0892",
        "optical_activity": "NONE",
        "references": [
          "60316d82-0b5f-449b-9e6a-ee2169c256d0",
          "57732974-8018-4578-bed9-689c28d1f638"
        ],
        "stereo_centers": 0
      },
      "unii": "G60AS0OTNS"
    }
  ]
}