{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7f346536-5ecf-4e1b-9917-f8d0e2707920",
          "code": "A10BB09",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS USED IN DIABETES|BLOOD GLUCOSE LOWERING DRUGS, EXCL. INSULINS|Sulfonamides, urea derivatives|gliclazide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A10BB09&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "60e1fd6e-71e2-4bfa-8a0f-c7c78b75e9f6",
          "code": "QA10BB09",
          "comments": "VATC|DRUGS USED IN DIABETES|BLOOD GLUCOSE LOWERING DRUGS, EXCL. INSULINS|Sulfonamides, urea derivatives|gliclazide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA10BB09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "8f1ad517-9ce2-45af-8b5e-8536e58fdccc",
          "code": "21187-98-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=21187-98-4",
          "code_system": "CAS",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece",
            "8f769712-73d0-4006-81aa-d2c488d95448"
          ]
        },
        {
          "uuid": "2c4e8b7f-d4e0-454d-bde2-e7a6b2a9b0f0",
          "code": "D005907",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005907",
          "code_system": "MESH",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "5ef5a885-3e8e-43fa-a13e-66c054e5b042",
          "code": "GLICLAZIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Gliclazide",
          "code_system": "WIKIPEDIA",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "3c3879b1-79c3-434f-8725-ca5d2c560843",
          "code": "SUB07921MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "d2750c0c-6043-40aa-b377-7bd3fc81ae75",
          "code": "3056",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3056",
          "code_system": "INN",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "6a7a7772-5286-4a2e-9b80-06698eb81c64",
          "code": "C87618",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87618",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "6a5d1950-3f3d-429a-9ff3-6c6da8bb56a9",
          "code": "4816",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4816/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "e2050a82-e65f-4a88-ba2e-502fbbf493cb",
          "code": "m5744",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5744?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "c1a49913-8895-4d6c-98f3-cfd1f24e84e1",
          "code": "DB01120",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01120",
          "code_system": "DRUG BANK",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "f20c58c7-3de9-4c17-8b34-1f4fa81b5fdf",
          "code": "CHEMBL427216",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL427216",
          "code_system": "ChEMBL",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "07c78713-53aa-4975-8c9a-7c0685104d4b",
          "code": "244-260-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.040.221",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "40cc906f-1203-45a4-b993-2529af948c9c",
          "code": "667431",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/667431",
          "code_system": "PUBCHEM",
          "references": [
            "8dfafeeb-7adc-41e6-b573-be40806baece"
          ]
        },
        {
          "uuid": "82bc570c-2568-1786-fbf6-34c70f964309",
          "code": "DTXSID9023095",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9023095",
          "code_system": "EPA CompTox",
          "references": [
            "81a37300-ccce-6f07-9ee0-272abe9d7755"
          ]
        },
        {
          "uuid": "27f43dcf-f943-8f8d-206e-913bd3c48331",
          "code": "C97936",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Anti-diabetic Agent[C29711]|Sulfonylurea Antidiabetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C97936",
          "code_system": "NCI_THESAURUS",
          "references": [
            "63b26818-c063-ff9e-3e12-97775076f000"
          ]
        },
        {
          "uuid": "2191b910-b7d1-432a-a9ab-24ca1cbe05f9",
          "code": "G4PX8C4HKV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "51c7765d-b306-e051-172c-71b8c06371c1",
          "code": "1299",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1299",
          "code_system": "DRUG CENTRAL",
          "references": [
            "63b26818-c063-ff9e-3e12-97775076f000"
          ]
        },
        {
          "uuid": "b95a5786-8c22-a192-c8af-7057e92d8135",
          "code": "31654",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31654",
          "code_system": "CHEBI",
          "references": [
            "63b26818-c063-ff9e-3e12-97775076f000"
          ]
        },
        {
          "uuid": "9e67bd25-b388-a517-8bc7-a6925ae3a183",
          "code": "100000090151",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "43489156-30b3-1e5c-4c95-433346861671"
          ]
        },
        {
          "uuid": "b70f5366-8f5a-6611-a192-e82631710a6a",
          "code": "758673",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758673",
          "code_system": "NSC",
          "references": [
            "179eb0fa-3361-68b4-1901-cbe1dd9b9e97"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5df6846c-6e6a-49e2-8d9a-774f54d3a2b1",
          "amount": {
            "uuid": "07d85331-25c2-4815-8f99-902b17cb2004"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9e65f242-146f-40c2-99ad-993691753f0f",
            "refuuid": "9e012caa-f1b3-445a-81d6-f5830f43a96b",
            "name": "GLICLAZIDE",
            "unii": "G4PX8C4HKV",
            "linking_id": "G4PX8C4HKV",
            "ref_pname": "GLICLAZIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b4765053-d0d7-47a9-a4a6-718e6d5837f8",
          "amount": {
            "uuid": "d033b9b7-a545-41ba-b635-d344656c4efb"
          },
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "6f1f740f-15b4-4412-b66f-190e63a53f6d",
            "refuuid": "011edec4-cdaf-4dec-a307-c234223b211c",
            "name": "ATP-BINDING CASSETTE SUB-FAMILY C MEMBER 8",
            "unii": "8RT5G5EY5Z",
            "linking_id": "8RT5G5EY5Z",
            "ref_pname": "ATP-BINDING CASSETTE SUB-FAMILY C MEMBER 8"
          }
        },
        {
          "uuid": "8b10c3d8-372a-4acc-b826-fba312154742",
          "amount": {
            "uuid": "ad88e9fd-8c80-415b-9fca-6f7ee8e9d992"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "a7c24278-b7be-4daa-b160-3d1c5ab61422"
          ],
          "related_substance": {
            "uuid": "edb9f114-2994-40ac-b7fd-9018950ed590",
            "refuuid": "8d09284b-aee4-4daa-b40a-1f499610b734",
            "name": "Ethyl tosylcarbamate",
            "unii": "P83946FTE5",
            "linking_id": "P83946FTE5",
            "ref_pname": "Ethyl tosylcarbamate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c867701-d145-4c1f-a8cd-c00f2136478a",
          "amount": {
            "uuid": "d992ea61-cc7c-408f-9e53-6fcf02ce9783"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "2d4c5d40-b6ad-40df-8f1e-ccde55af92fb"
          ],
          "related_substance": {
            "uuid": "1bd97128-9c8e-4f87-81c6-e69ee280eec3",
            "refuuid": "61e9f634-4b00-4fd8-b435-5e4aab9d7be8",
            "name": "ortho-Gliclazide",
            "unii": "MMV5P87V3A",
            "linking_id": "MMV5P87V3A",
            "ref_pname": "ortho-Gliclazide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "913b5342-9ad6-448e-a6c8-f4af031892ec",
          "amount": {
            "uuid": "67c9422c-db5d-45b1-84f0-a02b7920cc31"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "dca3a81d-b433-407f-9fcf-80543c56dcea"
          ],
          "related_substance": {
            "uuid": "69ec73fa-70ad-4764-ad5f-4d194236da7f",
            "refuuid": "6811f092-4063-40d4-b007-a7191b2af1ea",
            "name": "rel-4-Methyl-N-[[[(3aR,6aS)-3,3a,4,6a-tetrahydrocyclopenta[c]pyrrol-2(1H)-yl]amino]carbonyl]benzenesulfonamide",
            "unii": "SWM78SDK2G",
            "linking_id": "SWM78SDK2G",
            "ref_pname": "rel-4-Methyl-N-[[[(3aR,6aS)-3,3a,4,6a-tetrahydrocyclopenta[c]pyrrol-2(1H)-yl]amino]carbonyl]benzenesulfonamide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f392de1f-b81c-488c-8af4-f62f5aec34e3",
          "amount": {
            "uuid": "0751adb9-4806-4354-8c81-cd972b42b883"
          },
          "comments": "Clearance of gliclazide in CYP2C9*2 and *3 was significantly reduced compared to the wild-type. ",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "7c84ab85-e57d-4717-be2b-bfd1bb445736"
          ],
          "related_substance": {
            "uuid": "340eea07-a45a-4a95-aab0-ba06d79192c7",
            "refuuid": "50fbc0e6-a35d-4d72-849b-84bfc9d44cd5",
            "name": "CYTOCHROME P450 2C9",
            "unii": "L9DP834D1P",
            "linking_id": "L9DP834D1P",
            "ref_pname": "CYTOCHROME P450 2C9",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "66129e04-8baa-4528-9329-a4feba38e2bb",
          "amount": {
            "uuid": "9348edad-14c9-4fbe-a708-c06cfffb6a9a"
          },
          "comments": "Compared with the OATP1B1*1a, mutants OATP1B1*5 and OATP1B1*15 showed significantly decreased transport capacity. ",
          "type": "TRANSPORTER->SUBSTRATE",
          "references": [
            "7c84ab85-e57d-4717-be2b-bfd1bb445736"
          ],
          "related_substance": {
            "uuid": "420a5bca-01d4-48eb-991d-09ae9e35fc81",
            "refuuid": "7d2225e6-e467-47fb-b130-4ce9ed30684e",
            "name": "OATP1B1",
            "unii": "AIN96D6SGL",
            "linking_id": "AIN96D6SGL",
            "ref_pname": "OATP1B1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d3c1b86f-2bb7-4e03-8a4e-c31f716aed9e",
          "amount": {
            "uuid": "4b055129-4713-4cc9-a72d-368ace88c72a"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "a6702859-0264-4aec-b2d8-944c5ff41692"
          ],
          "related_substance": {
            "uuid": "97e6522d-9950-4602-8c8b-24ae65b278bf",
            "refuuid": "22199ab1-581d-4a68-a07f-1ae1058bffdd",
            "name": "Hexahydro-N-[(4-methylphenyl)sulfonyl]cyclopenta[c]pyrrole-2(1H)-carboxamide",
            "unii": "88P67223SH",
            "linking_id": "88P67223SH",
            "ref_pname": "Hexahydro-N-[(4-methylphenyl)sulfonyl]cyclopenta[c]pyrrole-2(1H)-carboxamide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "36abbe64-8470-40d7-83d1-3d8b35f2fc24",
          "amount": {
            "uuid": "62af8853-e546-4374-bb36-c077c813e8f3"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "944e92ed-ca92-42c0-a24e-7a46bc28363b"
          ],
          "related_substance": {
            "uuid": "f6c29a9f-3ed6-48d9-b1d9-52ef3d8e513f",
            "refuuid": "e99307d4-6103-460e-aa3e-632931148396",
            "name": "P-TOLUENESULFONAMIDE",
            "unii": "I8266RI90M",
            "linking_id": "I8266RI90M",
            "ref_pname": "P-TOLUENESULFONAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f5b5e07e-fb20-4fd5-a432-02c1bb1b7264",
          "amount": {
            "uuid": "1d2d445c-11a5-4006-a48f-892cb6f48da0"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "8573147e-9bca-4854-a8da-4c2dd1842d15"
          ],
          "related_substance": {
            "uuid": "d37b4da4-846e-4dea-949a-e16f85a8c889",
            "refuuid": "c0be533a-c1ce-40b4-895b-35fbf5761501",
            "name": "Hydroxy Gliclazide",
            "unii": "22WWT9N6C3",
            "linking_id": "22WWT9N6C3",
            "ref_pname": "Hydroxy Gliclazide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fb9b77c0-6b43-4583-84fe-cbdd1066ab97",
          "amount": {
            "uuid": "0af0a84c-f341-4baa-ad91-8506379c37e3"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "9c7371a6-f219-4835-9724-f52bc7926bc2"
          ],
          "related_substance": {
            "uuid": "81b992b9-946f-4467-a843-122ad57a9b35",
            "refuuid": "fbba36e3-7641-4664-98e1-24d46accd2ba",
            "name": "N-[(4-methylbenzene-1-sulfonyl)-1,4a,5,6,7,7a-hexahydro-2H-cyclopenta[d]pyridazine-2-carboxamide",
            "unii": "4X6FUA7Z62",
            "linking_id": "4X6FUA7Z62",
            "ref_pname": "N-[(4-methylbenzene-1-sulfonyl)-1,4a,5,6,7,7a-hexahydro-2H-cyclopenta[d]pyridazine-2-carboxamide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7c7905f6-2e30-4b4c-886c-ed4ed82aeeec",
          "amount": {
            "uuid": "6ff61b74-df7f-45e4-bd40-55dcadc554f2"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "b2ddda8d-e195-42c3-890f-180a2062a6d7"
          ],
          "related_substance": {
            "uuid": "d3f4c4b7-e3fe-4050-aea0-108acd4f1c24",
            "refuuid": "090a63ca-360e-4882-ab0b-4a4440c1b807",
            "name": "Carboxy Gliclazide",
            "unii": "76FTS44XK2",
            "linking_id": "76FTS44XK2",
            "ref_pname": "Carboxy Gliclazide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "efc6d13e-834a-459e-b8c1-988f66986e9b",
          "amount": {
            "uuid": "47a5a04a-df31-4589-a7ce-68dcd45a9338"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "d09d45f1-ad41-4bbc-bdc5-2dbc9ed2a8c1"
          ],
          "related_substance": {
            "uuid": "57238c19-c8db-4174-8fce-106e7644efaf",
            "refuuid": "1645660d-ae3f-43bb-9904-b2034a9bfd6b",
            "name": "Octahydro-2-nitrosocyclopenta[c]pyrrole",
            "unii": "6WSV699NCC",
            "linking_id": "6WSV699NCC",
            "ref_pname": "Octahydro-2-nitrosocyclopenta[c]pyrrole",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d176778d-1001-476c-a23f-ce85d4ae047a",
          "name": "1-(3-AZABICYCLO(3.3.0)OCT-3-YL)-3-(P-TOLYLSULFONYL)UREA",
          "stdName": "1-(3-AZABICYCLO(3.3.0)OCT-3-YL)-3-(P-TOLYLSULFONYL)UREA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50ad6923-76fa-4b41-9f3e-f7d303d89c20"
          ],
          "display_name": false
        },
        {
          "uuid": "1298e934-9c51-42b8-99f3-6c5b9eeff693",
          "name": "BENZENESULFONAMIDE, N-(((HEXAHYDROCYCLOPENTA(C)PYRROL-2(1H)-YL)AMINO)CARBONYL)-4-METHYL-",
          "stdName": "BENZENESULFONAMIDE, N-(((HEXAHYDROCYCLOPENTA(C)PYRROL-2(1H)-YL)AMINO)CARBONYL)-4-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35eda164-93f8-4b7d-837e-a0556ba2681e",
            "7229453f-7472-4489-9857-a579cf6987f5"
          ],
          "display_name": false
        },
        {
          "uuid": "92f8573b-b126-43eb-b9f4-a48513a40aba",
          "name": "DIAMICRON",
          "stdName": "DIAMICRON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5debaa2-543c-475f-86f2-89e7db3d5e1e",
            "6d8a887f-8574-4990-86a3-37f32a0da3ff"
          ],
          "display_name": false
        },
        {
          "uuid": "b1889bee-0829-49a0-a41b-a947ae28f877",
          "name": "GLICLAZIDE",
          "stdName": "GLICLAZIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "538128c7-0464-4a9f-a256-e5e36795d168",
            "2a7913d4-e233-491a-9127-fc5697b722d1",
            "b55a5137-64b8-4723-ab7e-9eb571fb8639",
            "7229453f-7472-4489-9857-a579cf6987f5",
            "91d983b4-90e7-4033-a1c0-077701fb37ed",
            "bd0037ef-f817-400d-8759-95dad722b430",
            "93457f99-eb0d-47a4-8890-5ad6ba90b01c",
            "76b27710-db47-4e24-8102-ed1bd1879d62",
            "e64a1777-faa4-4083-80f5-771faae2a695",
            "21562938-3bec-48f8-986a-39a589b08412",
            "792f9356-effb-42d9-b89d-5c52981b188c",
            "50ad6923-76fa-4b41-9f3e-f7d303d89c20",
            "717f9899-0489-4cb0-8f67-ce4839a15853",
            "f2d6e7ff-486b-46d1-ac5d-e61760092024"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e26f031e-da82-4e00-90f9-bcac2ab5c44a",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "86c40ecc-3979-b5cf-d65a-14e5945b8ce0",
          "name": "GLICLAZIDE [EP MONOGRAPH]",
          "stdName": "GLICLAZIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8fdca864-c935-c5fd-9bff-54e7c7aac4ca"
          ],
          "display_name": false
        },
        {
          "uuid": "aca0920d-2330-4c4a-96e8-2c006de0624e",
          "name": "GLICLAZIDE [JAN]",
          "stdName": "GLICLAZIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e64a1777-faa4-4083-80f5-771faae2a695",
            "7229453f-7472-4489-9857-a579cf6987f5"
          ],
          "display_name": false
        },
        {
          "uuid": "e22c3e80-97c9-411f-b617-8d3500a787dd",
          "name": "GLICLAZIDE [MART.]",
          "stdName": "GLICLAZIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "717f9899-0489-4cb0-8f67-ce4839a15853"
          ],
          "display_name": false
        },
        {
          "uuid": "25b600a4-b647-4ead-894a-a15786515ace",
          "name": "GLICLAZIDE [MI]",
          "stdName": "GLICLAZIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a7913d4-e233-491a-9127-fc5697b722d1",
            "7229453f-7472-4489-9857-a579cf6987f5"
          ],
          "display_name": false
        },
        {
          "uuid": "d6b95203-40ae-4af0-b0e1-1a84787a1833",
          "name": "GLIMICRON",
          "stdName": "GLIMICRON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50e00b74-41b7-4582-b337-c0621966e6d5",
            "e64a1777-faa4-4083-80f5-771faae2a695"
          ],
          "display_name": false
        },
        {
          "uuid": "59f93f05-92a3-e238-3276-12ddd17ded93",
          "name": "Gliclazide [WHO-DD]",
          "stdName": "GLICLAZIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44d11fb9-8e55-bad9-74f0-84bb4e606598"
          ],
          "display_name": false
        },
        {
          "uuid": "3c84c85c-175c-4696-9dc8-41bdaa2b80de",
          "name": "J3.151H",
          "stdName": "J3.151H",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d8a887f-8574-4990-86a3-37f32a0da3ff",
            "7229453f-7472-4489-9857-a579cf6987f5"
          ],
          "display_name": false
        },
        {
          "uuid": "72599add-f82e-a508-f239-04db5f96682d",
          "name": "NSC-758673",
          "stdName": "NSC-758673",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "179eb0fa-3361-68b4-1901-cbe1dd9b9e97"
          ],
          "display_name": false
        },
        {
          "uuid": "6afa4db2-7a18-4813-af4e-5c2616055ca5",
          "name": "S-1702",
          "stdName": "S-1702",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35eda164-93f8-4b7d-837e-a0556ba2681e",
            "7229453f-7472-4489-9857-a579cf6987f5"
          ],
          "display_name": false
        },
        {
          "uuid": "8ca53750-a0ee-47f9-a211-d2b70a61b90d",
          "name": "S-852",
          "stdName": "S-852",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35eda164-93f8-4b7d-837e-a0556ba2681e",
            "7229453f-7472-4489-9857-a579cf6987f5"
          ],
          "display_name": false
        },
        {
          "uuid": "010a40b5-15cf-419d-b2da-9c1158aaf659",
          "name": "SE 1702",
          "stdName": "SE 1702",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce4b9e87-0a50-400c-9654-a47fca12bb45",
            "7229453f-7472-4489-9857-a579cf6987f5"
          ],
          "display_name": false
        },
        {
          "uuid": "12fee16c-5ab2-4e29-af37-fcbc72992bd0",
          "name": "SE-1702",
          "stdName": "SE-1702",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35eda164-93f8-4b7d-837e-a0556ba2681e",
            "7229453f-7472-4489-9857-a579cf6987f5"
          ],
          "display_name": false
        },
        {
          "uuid": "2405e8ce-9aeb-466a-b43f-91220e93658d",
          "name": "gliclazide [INN]",
          "stdName": "GLICLAZIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "538128c7-0464-4a9f-a256-e5e36795d168"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "50ad6923-76fa-4b41-9f3e-f7d303d89c20",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6d8a887f-8574-4990-86a3-37f32a0da3ff",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J3.151H",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J3.151H",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5debaa2-543c-475f-86f2-89e7db3d5e1e",
          "citation": "NEGWER",
          "doc_type": "JAPAN CHEMICAL SUBSTANCE DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "538128c7-0464-4a9f-a256-e5e36795d168",
          "citation": "INN Proposed List 25",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL25.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "76b27710-db47-4e24-8102-ed1bd1879d62",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e64a1777-faa4-4083-80f5-771faae2a695",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7229453f-7472-4489-9857-a579cf6987f5",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "717f9899-0489-4cb0-8f67-ce4839a15853",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a7913d4-e233-491a-9127-fc5697b722d1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50e00b74-41b7-4582-b337-c0621966e6d5",
          "citation": "D01599",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b55a5137-64b8-4723-ab7e-9eb571fb8639",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35eda164-93f8-4b7d-837e-a0556ba2681e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce4b9e87-0a50-400c-9654-a47fca12bb45",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8dfafeeb-7adc-41e6-b573-be40806baece",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390969000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "445782bd-7571-45d5-a8de-b69abbec331d",
          "citation": "SRS import [G4PX8C4HKV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G4PX8C4HKV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390969000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd0037ef-f817-400d-8759-95dad722b430",
          "citation": "GLICLAZIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f2d6e7ff-486b-46d1-ac5d-e61760092024",
          "citation": "GLICLAZIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "93457f99-eb0d-47a4-8890-5ad6ba90b01c",
          "citation": "GLICLAZIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "21562938-3bec-48f8-986a-39a589b08412",
          "citation": "GLICLAZIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "792f9356-effb-42d9-b89d-5c52981b188c",
          "citation": "GLICLAZIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "91d983b4-90e7-4033-a1c0-077701fb37ed",
          "citation": "GLICLAZIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "81a37300-ccce-6f07-9ee0-272abe9d7755",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=21187-98-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "63b26818-c063-ff9e-3e12-97775076f000",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8f769712-73d0-4006-81aa-d2c488d95448",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8fdca864-c935-c5fd-9bff-54e7c7aac4ca",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "179eb0fa-3361-68b4-1901-cbe1dd9b9e97",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "44d11fb9-8e55-bad9-74f0-84bb4e606598",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a7c24278-b7be-4daa-b160-3d1c5ab61422",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "621d0707-b302-39a3-ff05-122465f5617d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "43489156-30b3-1e5c-4c95-433346861671",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "2d4c5d40-b6ad-40df-8f1e-ccde55af92fb",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "944e92ed-ca92-42c0-a24e-7a46bc28363b",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a6702859-0264-4aec-b2d8-944c5ff41692",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d09d45f1-ad41-4bbc-bdc5-2dbc9ed2a8c1",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8573147e-9bca-4854-a8da-4c2dd1842d15",
          "citation": "Oida, T., et al. \"The metabolism of gliclazide in man.\" Xenobiotica 15.1 (1985): 87-96.",
          "url": "https://www.tandfonline.com/doi/epdf/10.3109/00498258509045338?needAccess=true&role=button",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "9c7371a6-f219-4835-9724-f52bc7926bc2",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b2ddda8d-e195-42c3-890f-180a2062a6d7",
          "citation": "Oida, T., et al. \"The metabolism of gliclazide in man.\" Xenobiotica 15.1 (1985): 87-96.",
          "url": "https://www.tandfonline.com/doi/epdf/10.3109/00498258509045338?needAccess=true&role=button",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "76f147cc-0e13-4000-a0b9-0c3cdc7e49ac",
          "citation": "Dyhring, Tino, et al. \"Pharmacological Profiling of KATP Channel Modulators: An Outlook for New Treatment Opportunities for Migraine.\" Pharmaceuticals 16.2 (2023): 225.",
          "url": "https://www.mdpi.com/1424-8247/16/2/225",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "dca3a81d-b433-407f-9fcf-80543c56dcea",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7c84ab85-e57d-4717-be2b-bfd1bb445736",
          "citation": "Yang, Fayou, et al. \"CYP2C9 and OATP1B1 genetic polymorphisms affect the metabolism and transport of glimepiride and gliclazide.\" Scientific reports 8.1 (2018): 10994.",
          "url": "https://www.nature.com/articles/s41598-018-29351-4",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "58e6bbb5-5724-4845-859d-96a6596715f7",
          "id": "58e6bbb5-5724-4845-859d-96a6596715f7",
          "molfile": "\n  Marvin  01132104372D          \n\n 22 24  0  0  0  0            999 V2000\n    4.4661   -4.6443    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.7608   -4.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1251   -4.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4082   -5.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2573   -5.4424    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.9486   -5.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5983   -5.3589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2921   -4.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4104   -5.5724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9764   -4.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7676   -4.1850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7884   -5.1826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3732   -4.6072    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8463   -3.9204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7095   -4.0782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0970   -5.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0970   -5.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8254   -6.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5308   -5.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2732   -6.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5308   -5.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8070   -4.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  1  8  1  1  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  2  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\n 22 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 21  2  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)S(=O)(=O)NC(=O)NN2C[C@@H]3CCC[C@@H]3C2",
          "formula": "C15H21N3O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "003f4ad9-9f39-4332-b2c3-cff7588918ec"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "323.4122",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9e012caa-f1b3-445a-81d6-f5830f43a96b",
      "version": "31",
      "structure": {
        "id": "55b3c9ef-1ca9-4548-abdb-11078c2d5e53",
        "molfile": "\n  Marvin  01132104272D          \n\n 24 26  0  0  1  0            999 V2000\n    8.3732   -4.6072    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7884   -5.1826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9764   -4.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4104   -5.5724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5983   -5.3589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2921   -4.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4661   -4.6443    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.7608   -4.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1251   -4.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4082   -5.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2573   -5.4424    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.9486   -5.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0190   -6.3318    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7044   -3.7549    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7676   -4.1850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0970   -5.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0970   -5.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8254   -6.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5308   -5.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5308   -5.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8070   -4.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2732   -6.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8463   -3.9204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7095   -4.0782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  5  1  0  0  0  0\n 11  7  1  0  0  0  0\n 11 13  1  6  0  0  0\n  7 14  1  6  0  0  0\n 15  3  2  0  0  0  0\n 16  1  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 16  1  0  0  0  0\n 22 19  1  0  0  0  0\n 23  1  2  0  0  0  0\n 24  1  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)S(=O)(=O)NC(=O)NN2C[C@]3([H])CCC[C@]3([H])C2",
        "formula": "C15H21N3O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "323.4122",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "538128c7-0464-4a9f-a256-e5e36795d168",
          "445782bd-7571-45d5-a8de-b69abbec331d"
        ],
        "stereo_centers": 2
      },
      "unii": "G4PX8C4HKV"
    }
  ]
}