{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8bb8bda6-ea81-48a0-b8fc-2546538e1712",
          "code": "22037-88-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22037-88-3",
          "code_system": "CAS",
          "references": [
            "69810c9b-0191-49c3-a642-417d72db51db",
            "a8e5fc6f-ad58-43e6-b45a-311a83779e4c"
          ]
        },
        {
          "uuid": "f254679c-1e42-404e-a5b0-ccd6a06e8440",
          "code": "117445",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/117445",
          "code_system": "PUBCHEM",
          "references": [
            "69810c9b-0191-49c3-a642-417d72db51db"
          ]
        },
        {
          "uuid": "b03dcf23-fcd5-451f-a75e-60cc66f477b9",
          "code": "244-745-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.040.663",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "69810c9b-0191-49c3-a642-417d72db51db"
          ]
        },
        {
          "uuid": "16b03f65-c1b6-44ff-9714-6b1357b97a32",
          "code": "G4HFM2Q6LL",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "a8e5fc6f-ad58-43e6-b45a-311a83779e4c"
          ]
        },
        {
          "uuid": "0cef7cb8-2e98-a0ec-07e3-716033ad1200",
          "code": "DTXSID80885190",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80885190",
          "code_system": "EPA CompTox",
          "references": [
            "5c81df78-44d0-aca5-91ab-bbd3f571278b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ddf406c7-c7c0-4697-8e6c-c8b40ea59e71",
          "name": "(2′R,3R,3aS,7R,8aS)-Octahydro-3,8,8-trimethylspiro[6H-3a,7-methanoazulene-6,2′-oxirane]",
          "stdName": "(2'R,3R,3AS,7R,8AS)-OCTAHYDRO-3,8,8-TRIMETHYLSPIRO(6H-3A,7-METHANOAZULENE-6,2'-OXIRANE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8e5fc6f-ad58-43e6-b45a-311a83779e4c"
          ],
          "display_name": false
        },
        {
          "uuid": "876011d6-14f0-4dc2-94c2-cfd2800f4fbd",
          "name": "8,15-Epoxycedrane",
          "stdName": "8,15-EPOXYCEDRANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c1de679-b393-4633-95e4-bc803352b12c"
          ],
          "display_name": true
        },
        {
          "uuid": "6244a704-e5e3-4d54-9fe6-9daf17f443d2",
          "name": "Cedrane, 8,15-epoxy-",
          "stdName": "CEDRANE, 8,15-EPOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8e5fc6f-ad58-43e6-b45a-311a83779e4c"
          ],
          "display_name": false
        },
        {
          "uuid": "acda4815-4413-4708-a31b-b4509bc94021",
          "name": "Spiro[6H-3a,7-methanoazulene-6,2′-oxirane], octahydro-3,8,8-trimethyl-, (2′R,3R,3aS,7R,8aS)-",
          "stdName": "SPIRO(6H-3A,7-METHANOAZULENE-6,2'-OXIRANE), OCTAHYDRO-3,8,8-TRIMETHYL-, (2'R,3R,3AS,7R,8AS)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3d60040-7154-45d3-9e82-1453f6f718b9"
          ],
          "display_name": false
        },
        {
          "uuid": "cd3581c8-3d4d-429f-9b73-a7f6d570bff9",
          "name": "Spiro[6H-3a,7-methanoazulene-6,2′-oxirane], octahydro-3,8,8-trimethyl-, [3R-(3α,3aβ,6β,7β,8aα)]-",
          "stdName": "SPIRO(6H-3A,7-METHANOAZULENE-6,2'-OXIRANE), OCTAHYDRO-3,8,8-TRIMETHYL-, (3R-(3.ALPHA.,3A.BETA.,6.BETA.,7.BETA.,8A.ALPHA.))-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8e5fc6f-ad58-43e6-b45a-311a83779e4c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b3d60040-7154-45d3-9e82-1453f6f718b9",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69810c9b-0191-49c3-a642-417d72db51db",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392015000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8e5fc6f-ad58-43e6-b45a-311a83779e4c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5c81df78-44d0-aca5-91ab-bbd3f571278b",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "1c1de679-b393-4633-95e4-bc803352b12c",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dd9eb2f4-edf1-4772-b000-4bc285d31080",
          "id": "dd9eb2f4-edf1-4772-b000-4bc285d31080",
          "molfile": "\n  Marvin  05102314232D          \n\n 18 21  0  0  1  0            999 V2000\n    1.6246    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1815    2.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0475    2.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3337    1.4412    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.6465    1.8976    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.4867    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2578    1.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1121    0.6464    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.3113    1.7954    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.0000    1.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8652    1.2343    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.5980    2.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2878    0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7540    1.5461    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.1666    0.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5790    1.5463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4352    2.6951    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3830    0.5919    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  8  1  1  6  0  0  0\n  2  9  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  1  0  0  0\n  4  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  9  1  1  0  0  0\n  5 10  1  0  0  0  0\n  5 17  1  0  0  0  0\n  6 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 11 18  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H]1CC[C@@]2([H])C(C)(C)[C@@]3([H])C[C@@]12CC[C@@]43CO4",
          "formula": "C15H24O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7459c147-81a9-4d10-9d5b-161e5256586c"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "220.351",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a540837b-5671-4189-8786-225bfd67cbd3",
      "version": "7",
      "structure": {
        "id": "9f1c636f-e170-490f-b62e-319c256c746f",
        "molfile": "(2'R,3R,3aS,7R,8aS)-Octahydro-3,8,8-trimethylspiro[6H-3a,7-methanoazulene-6,2...\n   JSDraw205102314232D\n\n 18 21  0  0  1  0              0 V2000\n   24.2323  -10.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3945   -5.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.0318   -6.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6823   -7.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3829   -6.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9715   -9.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4294   -6.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2632   -9.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6399   -6.8491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1605   -7.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6872   -7.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0727   -5.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7047   -9.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3676   -7.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1478   -8.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9275   -7.3203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9834   -5.1481    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6662   -9.1248    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  8  1  1  6  0  0  0\n  2  9  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  1  0  0  0\n  4  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  9  1  1  0  0  0\n  5 10  1  0  0  0  0\n  5 17  1  0  0  0  0\n  6 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 11 18  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1CC[C@@]2([H])C(C)(C)[C@@]3([H])C[C@@]12CC[C@@]43CO4",
        "formula": "C15H24O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "220.351",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b3d60040-7154-45d3-9e82-1453f6f718b9",
          "a8e5fc6f-ad58-43e6-b45a-311a83779e4c"
        ],
        "stereo_centers": 5
      },
      "unii": "G4HFM2Q6LL"
    }
  ]
}