{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "368f1d34-eb79-4b1c-aead-8110145653aa",
          "code": "QP53AF09",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Organophosphorous compounds|propetamphos",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AF09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "3dc6bfb2-b5a7-4b77-bda4-839a31cfde9e"
          ]
        },
        {
          "uuid": "a9be19d3-c44d-4007-8273-47fed52d0919",
          "code": "31218-83-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=31218-83-4",
          "code_system": "CAS",
          "references": [
            "3dc6bfb2-b5a7-4b77-bda4-839a31cfde9e",
            "21dac602-0cdc-480d-9445-ac08a9330eaa"
          ]
        },
        {
          "uuid": "41358378-b42e-4c9a-a44e-0e89d87d69cf",
          "code": "C035967",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67035967",
          "code_system": "MESH",
          "references": [
            "3dc6bfb2-b5a7-4b77-bda4-839a31cfde9e"
          ]
        },
        {
          "uuid": "d4105f8d-f81b-4327-b8ac-0348c55377ab",
          "code": "113601",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3605",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "3dc6bfb2-b5a7-4b77-bda4-839a31cfde9e"
          ]
        },
        {
          "uuid": "3fef79f4-39b8-4cb4-8d90-b4a467685d83",
          "code": "C76878",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76878",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3dc6bfb2-b5a7-4b77-bda4-839a31cfde9e"
          ]
        },
        {
          "uuid": "74847300-e964-4192-bfd5-ee548a04b1e1",
          "code": "m9199",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9199?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3dc6bfb2-b5a7-4b77-bda4-839a31cfde9e"
          ]
        },
        {
          "uuid": "71be2363-7752-49d0-bbd0-8743aaaee7b0",
          "code": "CHEMBL1875667",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1875667",
          "code_system": "ChEMBL",
          "references": [
            "3dc6bfb2-b5a7-4b77-bda4-839a31cfde9e"
          ]
        },
        {
          "uuid": "0e701ac5-85f2-4ed8-ab86-9355ebdbb2fe",
          "code": "250-517-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.910",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3dc6bfb2-b5a7-4b77-bda4-839a31cfde9e"
          ]
        },
        {
          "uuid": "701dd5bb-db62-383d-e8ad-3d3abe25df51",
          "code": "5372405",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5372405",
          "code_system": "PUBCHEM",
          "references": [
            "f34b1725-09fa-9105-aca3-311fd6fcbef3"
          ]
        },
        {
          "uuid": "c7a99458-f5b5-44fc-bd65-caaebd7b9618",
          "code": "6985",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6985",
          "code_system": "HSDB",
          "references": [
            "7332e5f8-f947-4ee8-562f-3c8c665511d5"
          ]
        },
        {
          "uuid": "53da4617-674d-7805-a19d-8db57259d13d",
          "code": "DTXSID7032470",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7032470",
          "code_system": "EPA CompTox",
          "references": [
            "915fb2ca-b845-d8fb-53ab-9d186cffdcfc"
          ]
        },
        {
          "uuid": "665e47a6-af8a-594a-5a63-5217d615e15a",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6ed48546-077a-e544-dc76-45e7b8dbc03a"
          ]
        },
        {
          "uuid": "b617632a-45ff-48c2-b564-6fa96fce819b",
          "code": "G4A07F635U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "20be93a1-65c3-6b56-c209-0fc790ee888a",
          "code": "Propetamphos",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Propetamphos",
          "code_system": "WIKIPEDIA",
          "references": [
            "a7996ad6-373e-583f-a7d9-f1d0a80c7d0c"
          ]
        },
        {
          "uuid": "9a533dd6-a13a-4829-8f24-ca489e7267a9",
          "code": "300000029415",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8b302c1f-4208-d713-83b0-97eb7de0eac3"
          ]
        },
        {
          "uuid": "7be11e99-cb05-b4f4-f684-ca3d8698208d",
          "code": "propetamphos",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/propetamphos.html",
          "code_system": "ALANWOOD",
          "references": [
            "b406548d-3032-5705-639d-e2a2923056d9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6cb8df92-de86-412b-a73f-a943ac436a1b",
          "name": "(±)-PROPETAMPHOS",
          "stdName": "(+/-)-PROPETAMPHOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b5b0ef4-b2fa-4b8e-93f5-1a5c6b4f5289",
            "2c2a5928-5b61-42bf-a676-6aac031bc495"
          ],
          "display_name": false
        },
        {
          "uuid": "3e2d492c-11b0-4d8e-ac43-63879a982962",
          "name": "PROPETAMPHOS",
          "stdName": "PROPETAMPHOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c2a5928-5b61-42bf-a676-6aac031bc495",
            "557abaef-1823-48f4-bdd2-360931727195",
            "3242ab00-75bc-4358-a626-de31f59fae77",
            "72f470f2-090f-44d7-918d-3aab1ce9186a",
            "f72d2c56-d83b-49c6-acc0-129f551fc473",
            "e0d0c542-43ee-4131-9d20-179b623e6513",
            "2cec7ceb-3e83-4763-a712-bef40a21fea1",
            "0c788127-6c9c-46cf-b07f-1f71500a1952"
          ],
          "display_name": true
        },
        {
          "uuid": "41356c01-38bf-4772-80bf-474d639b0345",
          "name": "PROPETAMPHOS [HSDB]",
          "stdName": "PROPETAMPHOS [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c2a5928-5b61-42bf-a676-6aac031bc495",
            "e0d0c542-43ee-4131-9d20-179b623e6513"
          ],
          "display_name": false
        },
        {
          "uuid": "149df661-66b4-4e8d-827c-2087d1eea39f",
          "name": "PROPETAMPHOS [JAN]",
          "stdName": "PROPETAMPHOS [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ba56347-11a9-56a7-5daa-e6a79e894d5c"
          ],
          "display_name": false
        },
        {
          "uuid": "1c546b04-75cd-47fe-90c2-56ccaef54cfe",
          "name": "PROPETAMPHOS [MART.]",
          "stdName": "PROPETAMPHOS [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f72d2c56-d83b-49c6-acc0-129f551fc473"
          ],
          "display_name": false
        },
        {
          "uuid": "37a0c8e3-434f-43db-9b49-24a8109f85f8",
          "name": "PROPETAMPHOS [MI]",
          "stdName": "PROPETAMPHOS [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c2a5928-5b61-42bf-a676-6aac031bc495",
            "3242ab00-75bc-4358-a626-de31f59fae77"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "72f470f2-090f-44d7-918d-3aab1ce9186a",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f72d2c56-d83b-49c6-acc0-129f551fc473",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3242ab00-75bc-4358-a626-de31f59fae77",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c2a5928-5b61-42bf-a676-6aac031bc495",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0d0c542-43ee-4131-9d20-179b623e6513",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b5b0ef4-b2fa-4b8e-93f5-1a5c6b4f5289",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dc6bfb2-b5a7-4b77-bda4-839a31cfde9e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bcebb6bb-a0f3-447c-95e7-11a79cacdf2e",
          "citation": "SRS import [G4A07F635U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G4A07F635U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fa33fe8-8e2b-4e2f-a62a-2ffefcbf5acd",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2cec7ceb-3e83-4763-a712-bef40a21fea1",
          "citation": "PROPETAMPHOS [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "557abaef-1823-48f4-bdd2-360931727195",
          "citation": "PROPETAMPHOS [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0c788127-6c9c-46cf-b07f-1f71500a1952",
          "citation": "PROPETAMPHOS [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8ba56347-11a9-56a7-5daa-e6a79e894d5c",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7332e5f8-f947-4ee8-562f-3c8c665511d5",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+31218-83-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "915fb2ca-b845-d8fb-53ab-9d186cffdcfc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31218-83-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6ed48546-077a-e544-dc76-45e7b8dbc03a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a7996ad6-373e-583f-a7d9-f1d0a80c7d0c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "21dac602-0cdc-480d-9445-ac08a9330eaa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b406548d-3032-5705-639d-e2a2923056d9",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "f34b1725-09fa-9105-aca3-311fd6fcbef3",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "8b302c1f-4208-d713-83b0-97eb7de0eac3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "906c8040-b621-4283-a0f5-a2f82654322b",
          "id": "906c8040-b621-4283-a0f5-a2f82654322b",
          "molfile": "\n  Marvin  01132107292D          \n\n 17 16  0  0  0  0            999 V2000\n   10.3357   -4.8602    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5107   -4.8602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0982   -5.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2732   -5.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8607   -6.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2732   -7.0036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8607   -7.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0357   -7.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2732   -8.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0357   -6.2891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5107   -6.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3357   -4.0352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0502   -3.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0502   -2.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3357   -5.6852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0502   -6.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1607   -4.8602    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 12  1  0  0  0  0\n  1 15  1  0  0  0  0\n  1 17  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3 11  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "CCNP(=S)(OC)O/C(=C/C(=O)OC(C)C)/C",
          "formula": "C10H20NO4PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "99f15908-9010-4bef-8306-2c2d88bc38ff"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "281.3103",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "faaab108-32c7-4269-92e7-1247cb5a76d3",
      "version": "13",
      "structure": {
        "id": "b14a6d77-5858-47fd-a0a8-0ee4f749ee4f",
        "molfile": "\n  Marvin  01132109112D          \n\n 17 16  0  0  0  0            999 V2000\n   14.5475   -3.3151    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7225   -3.3151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3099   -4.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4849   -4.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0725   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4849   -5.4585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0725   -6.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2475   -6.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4849   -6.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2475   -4.7440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7225   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5475   -2.4901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2619   -2.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2619   -1.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5475   -4.1401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2619   -4.5526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3725   -3.3151    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  3 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  1 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  1 17  2  0  0  0  0\nM  END",
        "smiles": "CCNP(=S)(OC)O/C(=C/C(=O)OC(C)C)/C",
        "formula": "C10H20NO4PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "281.3103",
        "optical_activity": "( + / - )",
        "references": [
          "3fa33fe8-8e2b-4e2f-a62a-2ffefcbf5acd",
          "bcebb6bb-a0f3-447c-95e7-11a79cacdf2e"
        ],
        "stereo_centers": 0
      },
      "unii": "G4A07F635U"
    }
  ]
}