{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "044b5e5b-38c8-4176-a782-1d8d599c2bf5",
          "code": "68367-52-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68367-52-2",
          "code_system": "CAS",
          "references": [
            "32e98bf5-bb03-4bcb-b2b1-ddd709b373de",
            "a5c5c91b-7820-42d1-95db-e255d878f4b9"
          ]
        },
        {
          "uuid": "041a40df-5e0a-439a-b9e4-2bc605fc1603",
          "code": "C97357",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C97357",
          "code_system": "NCI_THESAURUS",
          "references": [
            "32e98bf5-bb03-4bcb-b2b1-ddd709b373de"
          ]
        },
        {
          "uuid": "a5edb2e2-7b21-4bac-a672-0cbb258703b7",
          "code": "SUB10596MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "32e98bf5-bb03-4bcb-b2b1-ddd709b373de"
          ]
        },
        {
          "uuid": "cb4fb57a-a9af-48c3-95be-2b95c65daffb",
          "code": "4703",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4703",
          "code_system": "INN",
          "references": [
            "32e98bf5-bb03-4bcb-b2b1-ddd709b373de"
          ]
        },
        {
          "uuid": "9d132b70-cb4e-471a-8082-af4f876a2ee7",
          "code": "m10119",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10119?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "32e98bf5-bb03-4bcb-b2b1-ddd709b373de"
          ]
        },
        {
          "uuid": "757c1b45-d917-46db-b8f4-077e8ca0865c",
          "code": "CHEMBL266497",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL266497",
          "code_system": "ChEMBL",
          "references": [
            "32e98bf5-bb03-4bcb-b2b1-ddd709b373de"
          ]
        },
        {
          "uuid": "9faaa2ba-dbef-4cb0-a685-015909efa201",
          "code": "337359",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/337359",
          "code_system": "PUBCHEM",
          "references": [
            "32e98bf5-bb03-4bcb-b2b1-ddd709b373de"
          ]
        },
        {
          "uuid": "2ab1cc6f-b124-514a-6c7e-0541805f9897",
          "code": "DTXSID0023587",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0023587",
          "code_system": "EPA CompTox",
          "references": [
            "d1e7b94d-666b-4bd0-3bb2-bc0b253f7961"
          ]
        },
        {
          "uuid": "e306b647-ea9c-c60a-6f91-48d1bec53731",
          "code": "C72880",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Aldose Reductase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72880",
          "code_system": "NCI_THESAURUS",
          "references": [
            "69198d0d-384f-c658-c417-788b73c2c0c6"
          ]
        },
        {
          "uuid": "fec8afab-ca8e-45c9-beab-976747184714",
          "code": "G4186B906P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "af71e03c-0102-8158-4b8b-6f1ea925233f",
          "code": "DB02712",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02712",
          "code_system": "DRUG BANK",
          "references": [
            "69198d0d-384f-c658-c417-788b73c2c0c6"
          ]
        },
        {
          "uuid": "bf47f66b-258f-b9d0-8dec-b6aa602f08ee",
          "code": "102029",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:102029",
          "code_system": "CHEBI",
          "references": [
            "69198d0d-384f-c658-c417-788b73c2c0c6"
          ]
        },
        {
          "uuid": "87beaebd-a564-66dc-9e0f-62d7887e36f9",
          "code": "Sorbinil",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sorbinil",
          "code_system": "WIKIPEDIA",
          "references": [
            "2045807d-63fb-695c-0029-e0693da6e18d"
          ]
        },
        {
          "uuid": "62a5f56c-a506-6902-7227-afb8649827e4",
          "code": "100000083791",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5b225197-ecce-8f53-9205-dbd18f83d803"
          ]
        },
        {
          "uuid": "1d2c4024-e3b8-fbca-a595-b6d717bd06ca",
          "code": "355082",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=355082",
          "code_system": "NSC",
          "references": [
            "c059e493-5a67-1e12-3489-b1bb98c9b740"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3ee5e5ab-32c6-430a-87ab-6a9098f8d25e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "fe5f119d-8970-4ca8-ab25-734d8d14c06b",
            "refuuid": "85e25497-174e-4ad1-a54b-640c6b8d98c7",
            "name": "SORBINIL",
            "unii": "G4186B906P",
            "linking_id": "G4186B906P",
            "ref_pname": "SORBINIL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1d746d0b-ce13-487d-ba6d-403b8387cd3b",
          "name": "(S)-6-FLUOROSPIRO(CHROMAN-4,4'-IMIDAZOLIDINE)-2',5'-DIONE",
          "stdName": "(S)-6-FLUOROSPIRO(CHROMAN-4,4'-IMIDAZOLIDINE)-2',5'-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54012dd9-4fb5-4f63-b9e5-1a48cdfa7845"
          ],
          "display_name": false
        },
        {
          "uuid": "90d8b462-29fa-44ca-8a32-294bf44127dc",
          "name": "CP-45,634",
          "stdName": "CP-45,634",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54012dd9-4fb5-4f63-b9e5-1a48cdfa7845"
          ],
          "display_name": false
        },
        {
          "uuid": "e477d73f-62df-4f4f-91f2-40be0f1fdf1f",
          "name": "CP-45634",
          "stdName": "CP-45634",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e748d07a-d92d-441b-a56c-ce0a36f1fb3e"
          ],
          "display_name": false
        },
        {
          "uuid": "01753a17-56ff-4732-a329-b895402c7c94",
          "name": "NSC-355082",
          "stdName": "NSC-355082",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46f0514c-9ef6-4b8c-b1f3-0faef15f01d4"
          ],
          "display_name": false
        },
        {
          "uuid": "e483cf67-0181-478d-aedd-9dc33950a419",
          "name": "SORBINIL",
          "stdName": "SORBINIL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d009239f-d22d-4922-b4d5-35781f76e8ca",
            "86233486-f2dd-4d8b-92a1-82a5c2668bc8",
            "e39cc052-c11a-489f-8660-631f69463507",
            "1047f170-3ac7-480a-a41c-e674255ffe51",
            "1b8dbad8-ade0-428e-99d7-a87624b36beb",
            "378ff828-db4e-4056-bbe0-fcf29d29f4c0",
            "7d356fe0-f7fe-4b3f-8e67-6ee79e2b704d",
            "5592c224-f85c-415c-a3d5-64c477f3aeb9",
            "3524d944-b1ef-4a5d-b6a9-9d838e1be07f",
            "ec1a69a9-7d66-46d1-bbe6-4cd110ff134f",
            "918b5a41-13cb-4d04-a918-636e68c2fc8b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "3d4566cb-1469-4152-8db2-19cfebe60d2b",
              "name_org": "INN"
            },
            {
              "uuid": "abc7ae02-0029-4d49-9b7b-898316798d0c",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "5cd22a7d-c00f-4cba-a247-8191a7d50a4e",
          "name": "SORBINIL [MART.]",
          "stdName": "SORBINIL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1047f170-3ac7-480a-a41c-e674255ffe51"
          ],
          "display_name": false
        },
        {
          "uuid": "da004312-0e0e-4dc9-82ad-0d3fa0930056",
          "name": "SORBINIL [MI]",
          "stdName": "SORBINIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b8dbad8-ade0-428e-99d7-a87624b36beb"
          ],
          "display_name": false
        },
        {
          "uuid": "6d59f13a-0a5d-4f23-bedb-711c896694c2",
          "name": "SORBINIL [USAN]",
          "stdName": "SORBINIL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5592c224-f85c-415c-a3d5-64c477f3aeb9"
          ],
          "display_name": false
        },
        {
          "uuid": "d4009e29-baf7-4231-b4a5-10bcde966529",
          "name": "SPIRO(4H-1-BENZOPYRAN-4,4'-IMIDAZOLIDINE)-2',5'-DIONE, 6-FLUORO-2,3-DIHYDRO-, (S)-",
          "stdName": "SPIRO(4H-1-BENZOPYRAN-4,4'-IMIDAZOLIDINE)-2',5'-DIONE, 6-FLUORO-2,3-DIHYDRO-, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54012dd9-4fb5-4f63-b9e5-1a48cdfa7845"
          ],
          "display_name": false
        },
        {
          "uuid": "3092fb78-953a-7c4c-9692-373437134070",
          "name": "Sorbinil [WHO-DD]",
          "stdName": "SORBINIL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3f269c2-aa38-8877-b1ba-a165baba8457"
          ],
          "display_name": false
        },
        {
          "uuid": "deddcfca-c9fc-451f-bbc7-04e4725808d4",
          "name": "sorbinil [INN]",
          "stdName": "SORBINIL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86233486-f2dd-4d8b-92a1-82a5c2668bc8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e39cc052-c11a-489f-8660-631f69463507",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "54012dd9-4fb5-4f63-b9e5-1a48cdfa7845",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e748d07a-d92d-441b-a56c-ce0a36f1fb3e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86233486-f2dd-4d8b-92a1-82a5c2668bc8",
          "citation": "INN Proposed List 53",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL53.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5592c224-f85c-415c-a3d5-64c477f3aeb9",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1047f170-3ac7-480a-a41c-e674255ffe51",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b8dbad8-ade0-428e-99d7-a87624b36beb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3524d944-b1ef-4a5d-b6a9-9d838e1be07f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46f0514c-9ef6-4b8c-b1f3-0faef15f01d4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32e98bf5-bb03-4bcb-b2b1-ddd709b373de",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22433498-e19d-41f3-9e8b-39eefe369dac",
          "citation": "SRS import [G4186B906P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G4186B906P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec1a69a9-7d66-46d1-bbe6-4cd110ff134f",
          "citation": "SORBINIL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "918b5a41-13cb-4d04-a918-636e68c2fc8b",
          "citation": "SORBINIL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d009239f-d22d-4922-b4d5-35781f76e8ca",
          "citation": "SORBINIL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "378ff828-db4e-4056-bbe0-fcf29d29f4c0",
          "citation": "SORBINIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d356fe0-f7fe-4b3f-8e67-6ee79e2b704d",
          "citation": "SORBINIL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1e7b94d-666b-4bd0-3bb2-bc0b253f7961",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68367-52-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "69198d0d-384f-c658-c417-788b73c2c0c6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2045807d-63fb-695c-0029-e0693da6e18d",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "a5c5c91b-7820-42d1-95db-e255d878f4b9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c059e493-5a67-1e12-3489-b1bb98c9b740",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e3f269c2-aa38-8877-b1ba-a165baba8457",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5b225197-ecce-8f53-9205-dbd18f83d803",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c69436e5-ce90-4414-9f14-0fa68524e5c0",
          "id": "c69436e5-ce90-4414-9f14-0fa68524e5c0",
          "molfile": "\n  Marvin  01132110162D          \n\n 17 19  0  0  1  0            999 V2000\n   -3.3878   -2.1284    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6714   -2.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6714   -3.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9577   -3.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2465   -3.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5379   -3.7810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1837   -3.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1837   -2.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5379   -2.1284    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -1.2051   -1.6474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9491   -0.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4301   -0.2017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1189   -0.8638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1345   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9129   -1.9034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2465   -2.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9577   -2.1284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 17  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 16  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n  9 14  1  0  0  0  0\n 16  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "c1cc2c(cc1F)[C@@]3(CCO2)C(=O)NC(=O)N3",
          "formula": "C11H9FN2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ccebaf8c-f759-452d-907b-9186fe498252"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "236.1996",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "85e25497-174e-4ad1-a54b-640c6b8d98c7",
      "version": "13",
      "structure": {
        "id": "f244a3f9-b263-4d3e-b2d3-68c961657a61",
        "molfile": "\n  Marvin  01132112342D          \n\n 17 19  0  0  1  0            999 V2000\n   -0.5379   -2.1284    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.1189   -0.8638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1345   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9491   -0.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2465   -2.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2051   -1.6474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2465   -3.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9577   -2.1284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9129   -1.9034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4301   -0.2017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5379   -3.7810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1837   -2.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9577   -3.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6714   -2.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1837   -3.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6714   -3.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3878   -2.1284    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  1  3  1  6  0  0  0\n  4  6  1  0  0  0  0\n  5  1  1  0  0  0  0\n  1  6  1  1  0  0  0\n  7  5  2  0  0  0  0\n  8  5  1  0  0  0  0\n  9  3  2  0  0  0  0\n 10  4  2  0  0  0  0\n 11 15  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14  8  2  0  0  0  0\n 15 12  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 14  1  0  0  0  0\n  4  2  1  0  0  0  0\n 11  7  1  0  0  0  0\n 16 13  2  0  0  0  0\nM  END",
        "smiles": "c1cc2c(cc1F)[C@@]3(CCO2)C(=O)NC(=O)N3",
        "formula": "C11H9FN2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "236.1996",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "22433498-e19d-41f3-9e8b-39eefe369dac",
          "54012dd9-4fb5-4f63-b9e5-1a48cdfa7845",
          "86233486-f2dd-4d8b-92a1-82a5c2668bc8"
        ],
        "stereo_centers": 1
      },
      "unii": "G4186B906P"
    }
  ]
}