{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1058df4c-9163-4b72-93ae-96803f5e080e", "code": "61135-33-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=61135-33-9", "code_system": "CAS", "references": [ "f8657765-4126-47a6-b5a8-263727e9870f", "ef67119c-1db3-4843-805b-74f81256eaea" ] }, { "uuid": "19875472-6431-4ddf-8158-08e95527c4e6", "code": "472172", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/472172", "code_system": "PUBCHEM", "references": [ "f8657765-4126-47a6-b5a8-263727e9870f" ] }, { "uuid": "6540dedc-05f9-d519-b3fd-25cc69f32732", "code": "5-Ethynyl-2'-deoxyuridine", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/5-Ethynyl-2'-deoxyuridine", "code_system": "WIKIPEDIA", "references": [ "ee7bf74c-47cb-4454-9088-771fe2037735" ] }, { "uuid": "6a58cd0e-3030-4631-bf88-7f9252e5f73a", "code": "G373S00W2J", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "66c67773-de02-05cc-ada0-b7eb594531b1", "code": "DTXSID20976652", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20976652", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "c7e76e54-4cc4-45e1-ab96-6c4d2cac4834", "name": "2'-DEOXY-5-ETHYNYLURIDINE", "stdName": "2'-DEOXY-5-ETHYNYLURIDINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "13c00a66-fcc1-44eb-a099-efcbe115cacd" ], "display_name": false }, { "uuid": "3be9de61-27bc-4f44-9d72-8539da6c35aa", "name": "5-ETHYNYL-2'-DEOXYURIDINE", "stdName": "5-ETHYNYL-2'-DEOXYURIDINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d90db031-3b85-43ee-a23e-2397deba7ea8" ], "display_name": true }, { "uuid": "77ef2fe4-4afe-437d-be0c-ef9a0a0bd4bd", "name": "URIDINE, 2'-DEOXY-5-ETHYNYL-", "stdName": "URIDINE, 2'-DEOXY-5-ETHYNYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "13c00a66-fcc1-44eb-a099-efcbe115cacd" ], "display_name": false } ], "references": [ { "uuid": "d90db031-3b85-43ee-a23e-2397deba7ea8", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "13c00a66-fcc1-44eb-a099-efcbe115cacd", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f8657765-4126-47a6-b5a8-263727e9870f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392075000, "tags": [ "NOMEN" ] }, { "uuid": "1ee5629c-6605-4d41-8cfc-f7ceb41cfd83", "citation": "SRS import [G373S00W2J]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G373S00W2J", "doc_type": "SRS", "public_domain": true, "document_date": 1493392075000, "tags": [ "NOMEN" ] }, { "uuid": "ee7bf74c-47cb-4454-9088-771fe2037735", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/5-Ethynyl-2'-deoxyuridine", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ef67119c-1db3-4843-805b-74f81256eaea", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c64c710e-490a-4ea5-9672-44698e9d43b5", "id": "c64c710e-490a-4ea5-9672-44698e9d43b5", "molfile": "\n Marvin 01132110152D \n\n 18 19 0 0 1 0 999 V2000\n 9.7723 -2.9053 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.1079 -2.1517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9653 -3.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8791 -3.8973 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.6328 -4.2329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1848 -3.6198 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 11.0053 -3.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4902 -3.0386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1646 -4.3099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1647 -5.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -5.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -6.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -7.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7357 -5.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0213 -5.5473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7357 -4.3099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -3.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -3.0723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 6 1 0 0 0 0\n 4 3 1 1 0 0 0\n 4 5 1 0 0 0 0\n 4 9 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 1 0 0 0\n 7 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 17 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 14 11 1 0 0 0 0\n 12 13 3 0 0 0 0\n 14 15 2 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\nM END", "smiles": "C#Cc1cn([C@H]2C[C@@H]([C@@H](CO)O2)O)c(=O)[nH]c1=O", "formula": "C11H12N2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a6f92e1d-c82c-4a6f-850c-6f13f6f41585" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "252.2238", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "3e73f70e-6061-4254-af6e-b8a50b486ccf", "version": "4", "structure": { "id": "c905f9ab-f76d-4bf7-9851-a7048717b7aa", "molfile": "\n Marvin 01132110232D \n\n 18 19 0 0 1 0 999 V2000\n 7.4502 -3.0723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -3.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7357 -4.3099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7357 -5.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0213 -5.5473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -5.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -6.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -7.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1647 -5.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1646 -4.3099 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 8.8791 -3.8973 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.9653 -3.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7723 -2.9053 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.1079 -2.1517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1848 -3.6198 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.0053 -3.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4902 -3.0386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6328 -4.2329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 3 0 0 0 0\n 9 6 2 0 0 0 0\n 10 9 1 0 0 0 0\n 2 10 1 0 0 0 0\n 11 10 1 1 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 6 0 0 0\n 15 13 1 0 0 0 0\n 15 16 1 1 0 0 0\n 16 17 1 0 0 0 0\n 18 15 1 0 0 0 0\n 11 18 1 0 0 0 0\nM END", "smiles": "C#Cc1cn([C@H]2C[C@@H]([C@@H](CO)O2)O)c(=O)[nH]c1=O", "formula": "C11H12N2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "252.2238", "optical_activity": "UNSPECIFIED", "references": [ "d90db031-3b85-43ee-a23e-2397deba7ea8", "1ee5629c-6605-4d41-8cfc-f7ceb41cfd83" ], "stereo_centers": 3 }, "unii": "G373S00W2J" } ] }