{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6309ccfb-d6b3-9774-0111-522dbb6c28ce",
          "code": "2571661",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2571661/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "88ef505e-75f4-f826-04cd-6b3300d3f8fc"
          ]
        },
        {
          "uuid": "f43cc079-73db-1d1c-735d-c6fc4cc337c8",
          "code": "25196074",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25196074",
          "code_system": "PUBCHEM",
          "references": [
            "6a8d5517-b868-bef0-e1d2-23b7e1181330"
          ]
        },
        {
          "uuid": "b92a94c7-4057-3be7-f13f-36f148478681",
          "code": "DTXSID801035692",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801035692",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "cf2ad380-052c-4da7-ac01-dc740bc0b0f8",
          "code": "G2MB8B7PSM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2d7f753f-761e-4887-aa1b-f3762a91cd42",
          "code": "1122460-01-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1122460-01-8",
          "code_system": "CAS",
          "references": [
            "50ab47af-ca1b-4420-8dcb-2703423615e0"
          ]
        },
        {
          "uuid": "55b4908d-c25b-edc1-68db-06ae8b2acf56",
          "code": "G2MB8B7PSM",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=G2MB8B7PSM",
          "code_system": "DAILYMED",
          "references": [
            "a5dd84e0-ecea-59cf-2f04-cc72e0e04cab"
          ]
        },
        {
          "uuid": "40ce156c-7624-59fd-e815-b6ac7d332c34",
          "code": "300000054038",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "302aff58-c611-142d-4ae0-889f5c840728"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4bf4d033-25c1-45ed-a283-e4ebe3b9b4f4",
          "name": "(1R,2S,5R)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL 2-(ETHYLAMINO)-2-OXOACETATE",
          "stdName": "(1R,2S,5R)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL 2-(ETHYLAMINO)-2-OXOACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1520bc6a-b23a-485d-9457-801cf252848e"
          ],
          "display_name": false
        },
        {
          "uuid": "f3b3f275-a9de-4cbe-856e-8475124b0892",
          "name": "ACETIC ACID, 2-(ETHYLAMINO)-2-OXO-, (1R,2S,5R)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL ESTER",
          "stdName": "ACETIC ACID, 2-(ETHYLAMINO)-2-OXO-, (1R,2S,5R)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1520bc6a-b23a-485d-9457-801cf252848e"
          ],
          "display_name": false
        },
        {
          "uuid": "f57025a8-0bb3-4aa3-ac27-12c2b4d4c4a4",
          "name": "FRESCOLAT X-COOL",
          "stdName": "FRESCOLAT X-COOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2fdc336-2da2-4120-9d76-4401b5a06563",
            "1520bc6a-b23a-485d-9457-801cf252848e"
          ],
          "display_name": false
        },
        {
          "uuid": "63685e94-6254-4db6-abb3-c6b85575cfc8",
          "name": "MENTHYL ETHYLAMIDO OXALATE",
          "stdName": "MENTHYL ETHYLAMIDO OXALATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2fdc336-2da2-4120-9d76-4401b5a06563"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "539d0e68-7030-483a-a800-2ba620454a65",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "88ef505e-75f4-f826-04cd-6b3300d3f8fc",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "1520bc6a-b23a-485d-9457-801cf252848e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c2fdc336-2da2-4120-9d76-4401b5a06563",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "50ab47af-ca1b-4420-8dcb-2703423615e0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6a8d5517-b868-bef0-e1d2-23b7e1181330",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "a5dd84e0-ecea-59cf-2f04-cc72e0e04cab",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "302aff58-c611-142d-4ae0-889f5c840728",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0eae3dd8-36cc-47f5-aaa1-924cc8c1c542",
          "id": "0eae3dd8-36cc-47f5-aaa1-924cc8c1c542",
          "molfile": "\n  Marvin  08312116562D          \n\n 18 18  0  0  1  0            999 V2000\n    5.0013    0.4125    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7157    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4290    1.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    1.2375    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.2868    1.6500    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7157    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7157    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    2.8875    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n 13  1  1  1  0  0  0\n  4  5  1  0  0  0  0\n 14  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 18 12  1  6  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCNC(=O)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C",
          "formula": "C14H25NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c6c2312c-bb63-451a-8ddf-8e144aefe170"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "255.3537",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "391695b8-43dc-4c29-83f2-23b304ab3e55",
      "version": "8",
      "structure": {
        "id": "63661ccc-70c0-4fb7-b720-223973008031",
        "molfile": "(1R,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexyl 2-(ethylamino)-2-oxoacetate\n   JSDraw208312116562D\n\n 18 18  0  0  1  0              0 V2000\n   29.2211  -10.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5720  -11.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8700  -11.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190   -8.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8170   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -6.5260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4661   -8.0860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8170  -10.4260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1150   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7640   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2211   -4.1860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2211   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8700   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5720   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8700   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5720   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2211   -5.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n 13  1  1  1  0  0  0\n  4  5  1  0  0  0  0\n 14  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 18 12  1  6  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
        "smiles": "CCNC(=O)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C",
        "formula": "C14H25NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "255.3537",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "1520bc6a-b23a-485d-9457-801cf252848e",
          "c2fdc336-2da2-4120-9d76-4401b5a06563"
        ],
        "stereo_centers": 3
      },
      "unii": "G2MB8B7PSM"
    }
  ]
}