{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "19306abf-86bc-455c-bfa4-343a09c23639",
          "code": "A05AA03",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|BILE AND LIVER THERAPY|BILE THERAPY|Bile acid preparations|cholic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A05AA03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "bc833917-d121-4ba5-a36c-45b41fdf566f",
          "code": "QA05AA03",
          "comments": "VATC|BILE AND LIVER THERAPY|BILE THERAPY|Bile acid preparations|cholic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA05AA03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "cc7964b3-eae0-4aa5-8c3b-e30672893927",
          "code": "81-25-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=81-25-4",
          "code_system": "CAS",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5",
            "339c4a9e-c6e2-4362-917e-d7f01b469726"
          ]
        },
        {
          "uuid": "632652be-f6fc-4f3c-946e-1a661af9cb71",
          "code": "C91035",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C91035",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "0b7c6beb-52eb-4534-881a-17517754fdde",
          "code": "D019826",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68019826",
          "code_system": "MESH",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "6f723c2c-e2d0-4252-8d07-095503261ea6",
          "code": "CHOLIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cholic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "8f0c58c8-cbba-4744-82ed-91f5b7aaea20",
          "code": "ORPHACOL (AUTHORIZED:",
          "type": "PRIMARY",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "7d7ebabc-cc4b-4d2d-a6e0-127309acf0cf",
          "code": "609",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=609",
          "code_system": "IUPHAR",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "1fa78cbb-0a6d-452d-8cb0-4cf111289678",
          "code": "1440856",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1440856/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "63ba92b1-e679-4e81-b104-c3450c2c439b",
          "code": "m3480",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3480?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "a110cfcf-8a4a-4209-8b93-eec26621a40e",
          "code": "DB02659",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB02659",
          "code_system": "DRUG BANK",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "46f4ea89-b4ec-4a41-a06c-072eb5036909",
          "code": "KOLBAM (AUTHORIZED: METABOLISM, INBORN ERRORS)",
          "comments": "EMA EMPR|DISEASES|CONGENITAL, HEREDITARY, AND NEONATAL DISESES AND ABNORMALITIES|GENETIC DISEASES, INBORN|METABOLISM, INBORN ERRORS",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/002081/human_med_001718.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "ae1216bb-2ce6-481d-9683-6ec1708a23bb",
          "code": "SUB13348MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "b86215f2-2f64-4824-8ee3-4ffca9a49885",
          "code": "CHEMBL205596",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL205596",
          "code_system": "ChEMBL",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "6b9a7ea6-b8ad-4a02-8c71-7e410162db00",
          "code": "201-337-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.217",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "4456bb40-a9a9-4f80-bc64-de56a78638d7",
          "code": "221493",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/221493",
          "code_system": "PUBCHEM",
          "references": [
            "a04f7012-68b2-4154-ad46-49022d448aa5"
          ]
        },
        {
          "uuid": "6c9cdb28-82c0-1e23-02c4-0382e10857e4",
          "code": "982",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/982",
          "code_system": "HSDB",
          "references": [
            "c0000725-1087-cfb2-eb77-12a5b08d2ef9"
          ]
        },
        {
          "uuid": "4d883cd8-b472-2f85-9baf-56d9b1e481eb",
          "code": "DTXSID6040660",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6040660",
          "code_system": "EPA CompTox",
          "references": [
            "ba2d2b18-3581-66be-38e0-bbde90d586e0"
          ]
        },
        {
          "uuid": "317da9cc-958d-70a6-e1f6-6e63c8e492de",
          "code": "170503",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of inborn errors of cholesterol and bile acid synthesis and metabolism",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=170503",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "83619f5f-9d02-4cbb-a319-f72657deb6f4",
          "code": "1426483",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426483/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0b1d5a19-762d-e7fc-4ca1-ecca81833026"
          ]
        },
        {
          "uuid": "a1abbe8f-e070-63eb-c726-e3531876c3f5",
          "code": "C66913",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Cholagogues or Choleretic Agents",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66913",
          "code_system": "NCI_THESAURUS",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "83a58b87-79ff-b714-bb07-a8e58fef1c7f",
          "code": "N0000175802",
          "comments": "Established Pharmacologic Class [EPC]|Bile Acid [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175802",
          "code_system": "NDF-RT",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "2bb6c66b-7fe3-ea4b-201f-5dd1573bdc43",
          "code": "EU/3/09/683",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of inborn errors in primary bile acid synthesis responsive to treatment with cholic acid",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu309683",
          "code_system": "EU-Orphan Drug",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "e922c6db-5bee-3de9-0ab9-c366b5fac66a",
          "code": "30518-5",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Cholate [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/30518-5/",
          "code_system": "LOINC",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "2405c678-f1ae-0d69-6395-d2253e369bb9",
          "code": "2080-0",
          "comments": "LOINC|DISCOURAGED|CHEM|Ser|Cholate [Mass/volume] in Serum",
          "type": "PRIMARY",
          "url": "https://loinc.org/2080-0/",
          "code_system": "LOINC",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "f1ae37c4-cc04-1b60-283b-b5a467e1feb7",
          "code": "353 (Number of products:3)",
          "comments": "Dietary Supplement Label Database|Chemical|cholic acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=353&item=cholic acid",
          "code_system": "DSLD",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "5a118121-c1a5-318e-d77a-e161e79bb9cd",
          "code": "3096",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3096",
          "code_system": "DRUG CENTRAL",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "21e67ae9-5968-4f4e-8134-033f608ed8f1",
          "code": "G1JO7801AE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7fe3e33e-b4ae-df21-c662-f5be2712089b",
          "code": "16359",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16359",
          "code_system": "CHEBI",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "4e821d99-95d9-e71b-7286-5e0d7636d124",
          "code": "29747",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:29747",
          "code_system": "CHEBI",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "2e172917-e6ac-58fa-c039-228ee5b34fa4",
          "code": "1133503",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1133503",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "214545bf-7c6a-b7f3-ba63-eea5ed895465"
          ]
        },
        {
          "uuid": "41075d51-4443-1f9f-f733-511138e797ae",
          "code": "100000080100",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6e73b87d-3bdb-5c11-59fc-a4d91c483638"
          ]
        },
        {
          "uuid": "cf3c08df-f13c-6308-5dfc-0245b440af56",
          "code": "BC-106",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/BC-106/relevant/1/",
          "code_system": "USAN",
          "references": [
            "7413b60b-231f-db08-4f23-9322b72bc225"
          ]
        },
        {
          "uuid": "6134345e-53f5-26ad-dc6e-1afb2759c596",
          "code": "6135",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6135",
          "code_system": "NSC",
          "references": [
            "a0520538-128d-4c5e-33d8-ee87c46c9c69"
          ]
        },
        {
          "uuid": "f3088fb2-7f1d-06eb-0fc9-edfecc6cd5b5",
          "code": "G1JO7801AE",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=G1JO7801AE",
          "code_system": "DAILYMED",
          "references": [
            "81f1d007-5e30-adff-4dfa-8edae2c2448c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "42bc9f71-a352-4e4c-b942-be892b9c5667",
          "amount": {
            "uuid": "64dde4f6-4f33-4afd-a9cc-6738ce25c1c2"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "499a8071-0195-4782-b28a-ee478b9a314f",
            "refuuid": "b87da8a0-2644-433d-814a-8e1f3c5cd45f",
            "name": "CHOLIC ACID",
            "unii": "G1JO7801AE",
            "linking_id": "G1JO7801AE",
            "ref_pname": "CHOLIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "18802c79-c086-4a20-af96-bf2255afd7eb",
          "amount": {
            "uuid": "789a07c4-f8de-4f61-a995-6c07459ccdc9"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "278c7938-d56e-4006-86c2-01deab63501c",
            "refuuid": "a936b3a8-4dc7-4bfb-b617-fcef7d9628fa",
            "name": "SODIUM CHOLATE",
            "unii": "NU3Y4CCH8Z",
            "linking_id": "NU3Y4CCH8Z",
            "ref_pname": "SODIUM CHOLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e6c382fb-3434-440d-a648-5525a06e31b7",
          "amount": {
            "uuid": "53cd7daf-4f61-43ab-bd75-a978f70002a9"
          },
          "type": "LABELED->NON-LABELED",
          "references": [
            "ecc61c00-e77c-41dc-82d0-a7fc8c2a36ea"
          ],
          "related_substance": {
            "uuid": "c64b0dd1-1595-4a5d-8bbf-d7de57096724",
            "refuuid": "b8b6f7b5-44af-8ef8-ab8f-431dd4b457e1",
            "name": "CHOLIC ACID, 24-C-13",
            "unii": "5Z5T260AYI",
            "linking_id": "5Z5T260AYI",
            "ref_pname": "CHOLIC ACID, 24-C-13"
          }
        },
        {
          "uuid": "9f81d0c4-8552-44ad-a331-f187e4bcab0f",
          "amount": {
            "uuid": "f28cfe67-579d-40b8-9c7f-31824656fcf3",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ddd1044d-692a-f3bf-1629-017a71a6ce40"
          ],
          "related_substance": {
            "uuid": "d2dd502f-2c71-4ecb-88fb-0798898d61d4",
            "refuuid": "2d863d83-dd6a-47f2-a515-88c3e8b0bc9a",
            "name": "URSODIOL",
            "unii": "724L30Y2QR",
            "linking_id": "724L30Y2QR",
            "ref_pname": "URSODIOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "faf4d5e2-5133-4ede-8a43-52b8cfd56b1b",
          "type": "METABOLITE->PARENT",
          "references": [
            "7cb333af-3b45-42c1-b8e3-f430877f17aa"
          ],
          "related_substance": {
            "uuid": "48d2da06-29b2-4f23-9177-0ab795c0d236",
            "refuuid": "97ee60c7-932d-4d3c-8e82-a2561fc75e38",
            "name": "CHOLIC ACID 3-O-GLUCURONIDE",
            "unii": "EBS4S6OAM3",
            "linking_id": "EBS4S6OAM3",
            "ref_pname": "CHOLIC ACID 3-O-GLUCURONIDE"
          }
        },
        {
          "uuid": "58c5daf5-284d-4b81-a072-9a12a63f8e9f",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "MAJOR",
          "references": [
            "d808168f-d2d8-b1e9-cddf-7d127995664b"
          ],
          "related_substance": {
            "uuid": "894e9029-51e7-4a84-accf-0099a84d3e9a",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c4862c65-76c8-48a3-867c-66b72c8b62a6",
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "mediator_substance": {
            "uuid": "068ace9e-bae7-49a9-b512-618b7bc8fad9",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          },
          "references": [
            "7302e2d1-8900-44d0-af9d-b78e60a1a6d7"
          ],
          "related_substance": {
            "uuid": "7ce5571e-c284-4602-84af-3b5994daa871",
            "refuuid": "f22323fa-5258-4775-a932-5f515b8760db",
            "name": "3-DEHYDROCHOLIC ACID",
            "unii": "NFU5ZM6X6V",
            "linking_id": "NFU5ZM6X6V",
            "ref_pname": "3-DEHYDROCHOLIC ACID"
          }
        },
        {
          "uuid": "6f35fbfb-8a53-4903-8734-59936c45eeed",
          "comments": "IN VITRO",
          "type": "PARENT->METABOLITE",
          "interaction_type": "MINOR",
          "references": [
            "43beaa82-d7f4-b07d-443f-ef1e21a58bc7"
          ],
          "related_substance": {
            "uuid": "2ed32fec-d665-4ae2-a75d-944c774996cd",
            "refuuid": "75e0299d-d7e5-4e08-b5cf-03553f99919a",
            "name": "CHENODIOL",
            "unii": "0GEI24LG0J",
            "linking_id": "0GEI24LG0J",
            "ref_pname": "CHENODIOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3d0a1e22-3d69-48c6-a93b-7147885ed268",
          "type": "LABELED->NON-LABELED",
          "references": [
            "14935bbe-516c-4bf0-af40-984b90aa8a3e",
            "b6320913-3961-48d2-ac2b-6b39fcebd7d3"
          ],
          "related_substance": {
            "uuid": "923daef8-5068-4d45-8237-6bfda77c3c28",
            "refuuid": "7734bf59-8c1e-4ee6-bd44-9540dffd7e25",
            "name": "CHOLIC ACID, 24-C-14",
            "unii": "97GF9FY7AE",
            "linking_id": "97GF9FY7AE",
            "ref_pname": "CHOLIC ACID, 24-C-14"
          }
        },
        {
          "uuid": "d4141d8a-1e95-48d8-8b8e-1ddd3e4adc7f",
          "type": "LABELED->NON-LABELED",
          "references": [
            "8f94dea7-0431-4882-891f-85a38406f449",
            "6ce1a122-db7f-462f-8ff2-05b5fe9218e3"
          ],
          "related_substance": {
            "uuid": "a9d1d678-1495-4774-aec3-dff1c7fef98d",
            "refuuid": "69381b39-71da-4c1f-99d6-d32fd5d568f0",
            "name": "CHOLIC ACID-2,2,4,4-D4",
            "unii": "88X15G5Z03",
            "linking_id": "88X15G5Z03",
            "ref_pname": "CHOLIC ACID-2,2,4,4-D4"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0b5f9dda-5146-412d-9156-dea06d51bd0d",
          "name": "3,7,12-TRIHYDROXYCHOLANIC ACID",
          "stdName": "3,7,12-TRIHYDROXYCHOLANIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a056a386-2dee-4f30-b042-4639deea3547",
            "1bc3f418-ef59-4446-9245-e7e59bde16bf"
          ],
          "display_name": false
        },
        {
          "uuid": "006290d0-ed5d-4463-e539-0ac4676bc11e",
          "name": "3α,7α,12α-Trihydroxy-5β-cholan-24-oic acid",
          "stdName": "3.ALPHA.,7.ALPHA.,12.ALPHA.-TRIHYDROXY-5.BETA.-CHOLAN-24-OIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddd1044d-692a-f3bf-1629-017a71a6ce40"
          ],
          "display_name": false
        },
        {
          "uuid": "17d4d622-a0a8-4a39-b428-d835f0255fc4",
          "name": "CHOLALIC ACID",
          "stdName": "CHOLALIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a056a386-2dee-4f30-b042-4639deea3547",
            "1bc3f418-ef59-4446-9245-e7e59bde16bf"
          ],
          "display_name": false
        },
        {
          "uuid": "36531d6e-f9bc-43bb-808d-04e720ac0ac0",
          "name": "CHOLAN-24-OIC ACID, 3,7,12-TRIHYDROXY-, (3-.ALPHA.,5-.BETA.,7-.ALPHA.,12-.ALPHA.)-",
          "stdName": "CHOLAN-24-OIC ACID, 3,7,12-TRIHYDROXY-, (3-.ALPHA.,5-.BETA.,7-.ALPHA.,12-.ALPHA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a056a386-2dee-4f30-b042-4639deea3547",
            "bf962494-3a41-4242-87b9-99e7fcf6c6f9"
          ],
          "display_name": false
        },
        {
          "uuid": "3f0c63ed-7554-4e14-9471-2f783df3e3e7",
          "name": "CHOLAN-24-OIC ACID, 3,7,12-TRIHYDROXY-, (3.ALPHA.,5.BETA.,7.ALPHA.,12.ALPHA.)-",
          "stdName": "CHOLAN-24-OIC ACID, 3,7,12-TRIHYDROXY-, (3.ALPHA.,5.BETA.,7.ALPHA.,12.ALPHA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a056a386-2dee-4f30-b042-4639deea3547",
            "bf962494-3a41-4242-87b9-99e7fcf6c6f9"
          ],
          "display_name": false
        },
        {
          "uuid": "bf687db2-6eb1-4a33-b4a7-15baba55c2f6",
          "name": "CHOLBAM",
          "stdName": "CHOLBAM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be3e918e-d552-4969-81ca-8d40e6c74e82",
            "a056a386-2dee-4f30-b042-4639deea3547"
          ],
          "display_name": false
        },
        {
          "uuid": "7d8ab27b-21be-480d-8507-3d2c7dac306a",
          "name": "CHOLIC ACID",
          "stdName": "CHOLIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f1d8014-9ca9-4f14-8201-5e1de095eaaf",
            "d46dc85d-b941-4536-92ef-a866b507a28e",
            "20f15b53-d00f-4656-925d-80ccb5ac27e9",
            "06824a8b-ddbf-4448-a5af-ecf37431946e",
            "a0be9074-fabc-4098-986c-4b1d3ef04c48",
            "5c0d9294-0f8a-42b0-997b-14deb8c8b090",
            "a056a386-2dee-4f30-b042-4639deea3547",
            "135958fd-0fb8-4e9d-b196-4f1c020759fd",
            "cac0a968-eab9-421a-8267-86f85d491269",
            "be3e918e-d552-4969-81ca-8d40e6c74e82",
            "032ed2e1-96c4-4cc0-ad3c-885355f2dc11",
            "1bc3f418-ef59-4446-9245-e7e59bde16bf",
            "6b6b0711-6eda-43f4-89b7-e75feebf1aae",
            "7b9c2cff-fd28-4acc-8aa4-0c3ea4ca0868",
            "f45a5c00-b365-4174-8bb5-ff380a79437e",
            "1338cb52-3947-4f72-baf8-a92e3ce7d951"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "2769ccc3-65fa-4c5a-aea9-9de865e3fdb4",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "b71d4d1e-bff7-4656-8696-577f4a746c48",
          "name": "CHOLIC ACID [EMA EPAR]",
          "stdName": "CHOLIC ACID [EMA EPAR]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d46dc85d-b941-4536-92ef-a866b507a28e",
            "a056a386-2dee-4f30-b042-4639deea3547"
          ],
          "display_name": false
        },
        {
          "uuid": "9f825e43-508c-d501-be1f-2ce3d3008558",
          "name": "CHOLIC ACID [EP IMPURITY]",
          "stdName": "CHOLIC ACID [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddd1044d-692a-f3bf-1629-017a71a6ce40"
          ],
          "display_name": false
        },
        {
          "uuid": "202a4bde-fc0a-4eea-bdf2-ab6a0ebc02f5",
          "name": "CHOLIC ACID [FCC]",
          "stdName": "CHOLIC ACID [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a056a386-2dee-4f30-b042-4639deea3547",
            "1bc3f418-ef59-4446-9245-e7e59bde16bf"
          ],
          "display_name": false
        },
        {
          "uuid": "8e6b0b74-11d6-4f89-9fdd-d26e60006e45",
          "name": "CHOLIC ACID [HSDB]",
          "stdName": "CHOLIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a056a386-2dee-4f30-b042-4639deea3547",
            "1338cb52-3947-4f72-baf8-a92e3ce7d951"
          ],
          "display_name": false
        },
        {
          "uuid": "d7706fd0-b50a-829c-afeb-4a03e48391a5",
          "name": "CHOLIC ACID [JAN]",
          "stdName": "CHOLIC ACID [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697bdeec-1037-c95f-ee45-e4a4d7614778"
          ],
          "display_name": false
        },
        {
          "uuid": "8a5840a8-8e0c-498d-951a-8418b4a73a06",
          "name": "CHOLIC ACID [MI]",
          "stdName": "CHOLIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a056a386-2dee-4f30-b042-4639deea3547",
            "f45a5c00-b365-4174-8bb5-ff380a79437e"
          ],
          "display_name": false
        },
        {
          "uuid": "7444495c-3b00-a819-5949-b0e7f51ddae5",
          "name": "CHOLIC ACID [ORANGE BOOK]",
          "stdName": "CHOLIC ACID [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dab5d5db-90de-5cf3-8b1b-ad82ff8797e4"
          ],
          "display_name": false
        },
        {
          "uuid": "c494ce2e-1a50-4c5a-b815-c6587df7e2fe",
          "name": "CHOLIC ACID [USAN]",
          "stdName": "CHOLIC ACID [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be3e918e-d552-4969-81ca-8d40e6c74e82",
            "a056a386-2dee-4f30-b042-4639deea3547"
          ],
          "display_name": false
        },
        {
          "uuid": "718fd780-c7cb-428a-ba91-cce2465ab77c",
          "name": "CHOLIC ACID [USP-RS]",
          "stdName": "CHOLIC ACID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f1d8014-9ca9-4f14-8201-5e1de095eaaf",
            "a056a386-2dee-4f30-b042-4639deea3547"
          ],
          "display_name": false
        },
        {
          "uuid": "53a4437c-0e89-ac61-3109-b97c91c4e6ea",
          "name": "Cholic acid [WHO-DD]",
          "stdName": "CHOLIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f337841-b538-e7e0-3b9b-c0798d1dc672"
          ],
          "display_name": false
        },
        {
          "uuid": "dc4550d6-6ae1-4c74-bc86-eac1dbd1baf8",
          "name": "KOLBAM",
          "stdName": "KOLBAM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be3e918e-d552-4969-81ca-8d40e6c74e82",
            "a056a386-2dee-4f30-b042-4639deea3547"
          ],
          "display_name": false
        },
        {
          "uuid": "8c446644-872b-4345-8584-186b382c82e7",
          "name": "NSC-6135",
          "stdName": "NSC-6135",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb0734b9-76bd-4e3c-982e-3fc6f9e25037",
            "a056a386-2dee-4f30-b042-4639deea3547"
          ],
          "display_name": false
        },
        {
          "uuid": "6d7ba2fa-ebca-40e2-bd6b-f38aa967f7b2",
          "name": "ORPHACOL",
          "stdName": "ORPHACOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be3e918e-d552-4969-81ca-8d40e6c74e82",
            "a056a386-2dee-4f30-b042-4639deea3547"
          ],
          "display_name": false
        },
        {
          "uuid": "62dff232-20d8-fd93-956f-042f9f58dc4d",
          "name": "URSODEOXYCHOLIC ACID IMPURITY B [EP IMPURITY]",
          "stdName": "URSODEOXYCHOLIC ACID IMPURITY B [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ddd1044d-692a-f3bf-1629-017a71a6ce40"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "df378b7e-c401-d9a1-1588-875bbb767703",
          "citation": "orange book",
          "doc_type": "ORANGE BOOK",
          "public_domain": true
        },
        {
          "uuid": "ddd1044d-692a-f3bf-1629-017a71a6ce40",
          "citation": "European Pharmacopoeia Online 9.8, Ursodeoxycholic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1bc3f418-ef59-4446-9245-e7e59bde16bf",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a056a386-2dee-4f30-b042-4639deea3547",
          "citation": "USP FOOD CHEMICALS CODEX",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf962494-3a41-4242-87b9-99e7fcf6c6f9",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f45a5c00-b365-4174-8bb5-ff380a79437e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1338cb52-3947-4f72-baf8-a92e3ce7d951",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f1d8014-9ca9-4f14-8201-5e1de095eaaf",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "032ed2e1-96c4-4cc0-ad3c-885355f2dc11",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d46dc85d-b941-4536-92ef-a866b507a28e",
          "citation": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/002081/human_med_001718.",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/002081/human_med_001718.",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be3e918e-d552-4969-81ca-8d40e6c74e82",
          "citation": "USAN COUN 2014",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb0734b9-76bd-4e3c-982e-3fc6f9e25037",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a04f7012-68b2-4154-ad46-49022d448aa5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d95e523-fa57-4354-af46-2f3cf1f427e3",
          "citation": "SRS import [G1JO7801AE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G1JO7801AE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20f15b53-d00f-4656-925d-80ccb5ac27e9",
          "citation": "CHOLIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "06824a8b-ddbf-4448-a5af-ecf37431946e",
          "citation": "CHOLIC ACID [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cac0a968-eab9-421a-8267-86f85d491269",
          "citation": "CHOLIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6b6b0711-6eda-43f4-89b7-e75feebf1aae",
          "citation": "CHOLIC ACID [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "135958fd-0fb8-4e9d-b196-4f1c020759fd",
          "citation": "CHOLIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5c0d9294-0f8a-42b0-997b-14deb8c8b090",
          "citation": "CHOLIC ACID [EMA EPAR]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7b9c2cff-fd28-4acc-8aa4-0c3ea4ca0868",
          "citation": "CHOLIC ACID [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a0be9074-fabc-4098-986c-4b1d3ef04c48",
          "citation": "CHOLIC ACID [DASH]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0000725-1087-cfb2-eb77-12a5b08d2ef9",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+81-25-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ba2d2b18-3581-66be-38e0-bbde90d586e0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=81-25-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "214545bf-7c6a-b7f3-ba63-eea5ed895465",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0b1d5a19-762d-e7fc-4ca1-ecca81833026",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "339c4a9e-c6e2-4362-917e-d7f01b469726",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e4d543ac-df8d-92df-70b3-4dd2a778dcc0",
          "citation": "USAN COUN 2014",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7cb333af-3b45-42c1-b8e3-f430877f17aa",
          "citation": "https://www.drugbank.ca/metabolites/DBMET00553",
          "url": "https://www.drugbank.ca/metabolites/DBMET00553",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dab5d5db-90de-5cf3-8b1b-ad82ff8797e4",
          "citation": "OB",
          "doc_type": "ORANGE BOOK",
          "public_domain": true
        },
        {
          "uuid": "8f94dea7-0431-4882-891f-85a38406f449",
          "citation": "https://www.chemblink.com/products/376608-71-8.htm",
          "url": "https://www.chemblink.com/products/376608-71-8.htm",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6ce1a122-db7f-462f-8ff2-05b5fe9218e3",
          "citation": "https://www.sigmaaldrich.com/catalog/product/aldrich/614149?lang=en&region=US",
          "url": "https://www.sigmaaldrich.com/catalog/product/aldrich/614149?lang=en&region=US",
          "doc_type": "SIGMA-ALDRICH",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "14935bbe-516c-4bf0-af40-984b90aa8a3e",
          "citation": "Norman, Arne. \"Faecal excretion products of cholic acid in man.\" British Journal of Nutrition 18.1 (1964): 173-186.",
          "url": "https://www.cambridge.org/core/journals/british-journal-of-nutrition/article/faecal-excretion-products-of-cholic-acid-in-man/DECA6697FFD6F62913A6FE7AC3EA47B0",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "CLIN",
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b6320913-3961-48d2-ac2b-6b39fcebd7d3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ecc61c00-e77c-41dc-82d0-a7fc8c2a36ea",
          "citation": "https://www.sigmaaldrich.com/catalog/product/aldrich/605883?lang=en&region=US",
          "url": "https://www.sigmaaldrich.com/catalog/product/aldrich/605883?lang=en&region=US",
          "doc_type": "SIGMA-ALDRICH",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "697bdeec-1037-c95f-ee45-e4a4d7614778",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "7413b60b-231f-db08-4f23-9322b72bc225",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "7302e2d1-8900-44d0-af9d-b78e60a1a6d7",
          "citation": "Deo, Anand K., and Stelvio M. Bandiera. \"Identification of human hepatic cytochrome p450 enzymes involved in the biotransformation of cholic and chenodeoxycholic acid.\" Drug metabolism and disposition 36.10 (2008): 1983-1991.",
          "url": "https://dmd.aspetjournals.org/content/dmd/36/10/1983.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43beaa82-d7f4-b07d-443f-ef1e21a58bc7",
          "citation": "Deo, Anand K., and Stelvio M. Bandiera. \"Identification of human hepatic cytochrome p450 enzymes involved in the biotransformation of cholic and chenodeoxycholic acid.\" Drug metabolism and disposition 36.10 (2008): 1983-1991.",
          "url": "https://dmd.aspetjournals.org/content/dmd/36/10/1983.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d808168f-d2d8-b1e9-cddf-7d127995664b",
          "citation": "Deo, Anand K., and Stelvio M. Bandiera. \"Identification of human hepatic cytochrome p450 enzymes involved in the biotransformation of cholic and chenodeoxycholic acid.\" Drug metabolism and disposition 36.10 (2008): 1983-1991.",
          "url": "https://dmd.aspetjournals.org/content/dmd/36/10/1983.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a0520538-128d-4c5e-33d8-ee87c46c9c69",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "81f1d007-5e30-adff-4dfa-8edae2c2448c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8f337841-b538-e7e0-3b9b-c0798d1dc672",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6e73b87d-3bdb-5c11-59fc-a4d91c483638",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "59fb0d7c-20d6-472e-9390-a38a6cbbcd6f",
          "id": "59fb0d7c-20d6-472e-9390-a38a6cbbcd6f",
          "molfile": "\n  Marvin  01132104402D          \n\n 29 32  0  0  1  0            999 V2000\n    5.2352   -2.6380    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.6776   -2.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0347   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2894   -1.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0991   -1.5151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3562   -0.7359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6491   -2.1262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9806   -3.4171    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.4542   -4.0741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9806   -4.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1887   -4.4942    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.4859   -4.9067    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.4859   -5.7317    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.1887   -6.1442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7678   -6.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0549   -5.7317    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.3368   -6.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6290   -5.7317    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.0891   -6.1442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6290   -4.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3368   -4.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0549   -4.9067    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.0549   -4.0741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7678   -4.4942    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.7678   -3.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4859   -3.2644    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.4859   -2.4368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1887   -3.6667    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.1887   -2.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  8  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  9  1  1  0  0  0\n 28  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  6  0  0  0\n 11 28  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 24  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  6  0  0  0\n 16 17  1  0  0  0  0\n 22 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  1  0  0  0\n 24 22  1  0  0  0  0\n 24 25  1  1  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  6  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  1  0  0  0\nM  END",
          "smiles": "C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@H]3[C@H](C[C@@H]([C@]12C)O)[C@@]4(C)CC[C@H](C[C@H]4C[C@H]3O)O",
          "formula": "C24H40O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eae60936-1f09-47fb-9e00-291f05dc7f19"
          },
          "defined_stereo": 11,
          "ez_centers": 0,
          "molecular_weight": "408.5723",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 11
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b87da8a0-2644-433d-814a-8e1f3c5cd45f",
      "version": "51",
      "structure": {
        "id": "14a50726-ea77-45cb-ab0b-f452ab566bff",
        "molfile": "\n  Marvin  01132101162D          \n\n 34 37  0  0  1  0            999 V2000\n    4.1887   -3.6667    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7678   -4.4942    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0549   -4.9067    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1887   -4.4942    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4859   -4.9067    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4859   -3.2644    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0549   -5.7317    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7678   -3.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4859   -5.7317    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.9806   -3.4171    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7678   -6.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9806   -4.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3368   -4.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4542   -4.0741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0991   -1.5151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3368   -6.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3562   -0.7359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2352   -2.6380    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0347   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4859   -2.4368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1887   -6.1442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2894   -1.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1887   -2.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6290   -4.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6290   -5.7317    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0549   -4.0741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6491   -2.1262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0891   -6.1442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6776   -2.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7602   -5.3243    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1887   -5.3040    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0498   -6.5542    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4859   -4.0741    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7776   -3.2033    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15 22  1  0  0  0  0\n 16  7  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 10  1  0  0  0  0\n 19 18  1  0  0  0  0\n  6 20  1  6  0  0  0\n  9 21  1  6  0  0  0\n 22 19  1  0  0  0  0\n  1 23  1  1  0  0  0\n 24 13  1  0  0  0  0\n 25 24  1  0  0  0  0\n  3 26  1  1  0  0  0\n 27 15  1  0  0  0  0\n 25 28  1  6  0  0  0\n 18 29  1  6  0  0  0\n  2 30  1  6  0  0  0\n  4 31  1  6  0  0  0\n  7 32  1  1  0  0  0\n  5 33  1  1  0  0  0\n 10 34  1  6  0  0  0\n 14 12  1  0  0  0  0\n  2  5  1  0  0  0  0\n  7 11  1  0  0  0  0\n 16 25  1  0  0  0  0\nM  END",
        "smiles": "C[C@H](CCC(=O)O)[C@@]1([H])CC[C@@]2([H])[C@@]3([H])[C@]([H])(C[C@@H]([C@]12C)O)[C@@]4(C)CC[C@H](C[C@@]4([H])C[C@H]3O)O",
        "formula": "C24H40O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 11,
        "ez_centers": 0,
        "molecular_weight": "408.5723",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6d95e523-fa57-4354-af46-2f3cf1f427e3",
          "1bc3f418-ef59-4446-9245-e7e59bde16bf"
        ],
        "stereo_centers": 11
      },
      "unii": "G1JO7801AE"
    }
  ]
}