{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4690cdbb-6d35-425f-aa0e-4cd3504abd5a",
          "code": "111555-53-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=111555-53-4",
          "code_system": "CAS",
          "references": [
            "11091a83-8907-4370-a821-6d0a51769be9",
            "c5847f68-b20b-4a7b-a14d-ace3d9e66fcb"
          ]
        },
        {
          "uuid": "96c625c7-c938-40c7-8c69-cac9c26a9c1f",
          "code": "5497186",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5497186",
          "code_system": "PUBCHEM",
          "references": [
            "11091a83-8907-4370-a821-6d0a51769be9"
          ]
        },
        {
          "uuid": "54524d08-4263-df33-0dce-65f70d71f8ad",
          "code": "Naltrindole",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Naltrindole",
          "code_system": "WIKIPEDIA",
          "references": [
            "aa476ed3-b1a3-4f09-9b4f-3d66c15d0b33"
          ]
        },
        {
          "uuid": "7daefcc3-132e-81a6-e77b-a81d04383b40",
          "code": "DTXSID60912216",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60912216",
          "code_system": "EPA CompTox",
          "references": [
            "77f39ad8-3a9d-a0b7-1109-d4545d3c7d9e"
          ]
        },
        {
          "uuid": "60e25361-12bc-4a41-8c13-d820c27203ce",
          "code": "G167Z38QA4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "597ec153-a8f5-4b9c-b7cf-e71a145ff300",
          "citation": "Madar, Igal, et al. \"Imaging of δ opioid receptors in human brain by N1′‐([11C] methyl) naltrindole and PET.\" Synapse 24.1 (1996): 19-28.",
          "url": "https://onlinelibrary.wiley.com/doi/abs/10.1002/(SICI)1098-2396(199609)24:1%3C19::AID-SYN3%3E3.0.CO;2-J",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "POT"
          ]
        },
        {
          "uuid": "bb871710-cdd0-4747-9646-83a483962ce9",
          "citation": "Lever, John R. \"PET and SPECT imaging of the opioid system: receptors, radioligands and avenues for drug discovery and development.\" Current pharmaceutical design 13.1 (2007): 33-49.",
          "url": "https://www.ingentaconnect.com/content/ben/cpd/2007/00000013/00000001/art00006#",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "POT"
          ]
        },
        {
          "uuid": "3fcd1521-7aa8-4740-9d05-96ccb527a2dd",
          "citation": "Lever, John R., et al. \"Synthesis of N1′‐([11C] methyl) naltrindole ([11C] MeNTI): A radioligand for positron emission tomographic studies of delta opioid receptors.\" Journal of Labelled Compounds and Radiopharmaceuticals 36.2 (1995): 137-145.",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/jlcr.2580360206/epdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "560ec6d1-7749-470d-a808-606d480b1ffb",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e591c382-9534-4c9e-9f45-9570296e5422",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11091a83-8907-4370-a821-6d0a51769be9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392572000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5385087d-f342-4272-90f0-884712a66828",
          "citation": "SRS import [G167Z38QA4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=G167Z38QA4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392572000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05ca6af7-5439-4def-ae3f-fd06dc2c6844",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa476ed3-b1a3-4f09-9b4f-3d66c15d0b33",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Naltrindole",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "39f2ac8e-7963-4526-8c20-8cc4a9e39075",
          "citation": "https://en.wikipedia.org/wiki/Naltrindole",
          "url": "https://en.wikipedia.org/wiki/Naltrindole",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "c5847f68-b20b-4a7b-a14d-ace3d9e66fcb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "77f39ad8-3a9d-a0b7-1109-d4545d3c7d9e",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "63c211c5-2093-4205-b25b-21dc956e2963",
          "id": "63c211c5-2093-4205-b25b-21dc956e2963",
          "molfile": "\n  Marvin  01132105112D          \n\n 31 38  0  0  1  0            999 V2000\n    6.9815   -4.6461    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.3550   -3.7216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2423   -3.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2867   -4.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0223   -4.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0666   -5.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3753   -6.2057    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.4197   -7.0294    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    8.0462   -7.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4965   -8.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2321   -8.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5408   -9.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1109   -6.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3310   -5.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5954   -5.0084    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.6397   -5.8322    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.6625   -6.6569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9259   -6.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2333   -5.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3184   -4.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5642   -4.6423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0130   -5.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1880   -5.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7765   -5.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1901   -6.6862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0150   -6.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4265   -5.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7136   -4.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6692   -3.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9336   -3.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8892   -2.4601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1 15  1  0  0  0  0\n  1 20  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 30  2  0  0  0  0\n  4  5  2  0  0  0  0\n 15  4  1  6  0  0  0\n  6  5  1  0  0  0  0\n  5 28  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n 16  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 19 27  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 27 22  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 29  2  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c3C[C@]4([C@H]5Cc6ccc(c7c6[C@@]4(CCN5CC8CC8)[C@H](c3[nH]2)O7)O)O",
          "formula": "C26H26N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b20cea02-8790-4d28-ae49-ff5ef53f120d"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "414.4972",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "adda1fc2-7315-4936-a7a6-1aff8366cec2",
      "version": "8",
      "structure": {
        "id": "3c594093-aa23-4e90-ba19-dcee02aaae79",
        "molfile": "\n  Marvin  01132103122D          \n\n 32 39  0  0  1  0            999 V2000\n    5.5642   -4.6423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3184   -4.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9815   -4.6461    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4281   -4.3111    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5954   -5.0084    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3310   -5.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1109   -6.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4197   -7.0294    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3753   -6.2057    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.0666   -5.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0223   -4.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2867   -4.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2423   -3.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9336   -3.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6692   -3.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7136   -4.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8892   -2.4601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3550   -3.7216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6397   -5.8322    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9259   -6.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2333   -5.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4265   -5.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0150   -6.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1901   -6.6862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7765   -5.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1880   -5.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0130   -5.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6625   -6.6569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0462   -7.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4965   -8.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2321   -8.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5408   -9.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  5 12  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 11 16  1  0  0  0  0\n 16 15  2  0  0  0  0\n 14 17  1  0  0  0  0\n 18 13  1  0  0  0  0\n  3 18  1  0  0  0  0\n 19  9  1  0  0  0  0\n  5 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n  2 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 22 27  2  0  0  0  0\n  1 27  1  0  0  0  0\n 19 28  1  1  0  0  0\n  8 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 30  1  0  0  0  0\n 32 31  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c3C[C@]4([C@H]5Cc6ccc(c7c6[C@@]4(CCN5CC8CC8)[C@]([H])(c3[nH]2)O7)O)O",
        "formula": "C26H26N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "414.4972",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5385087d-f342-4272-90f0-884712a66828",
          "05ca6af7-5439-4def-ae3f-fd06dc2c6844"
        ],
        "stereo_centers": 4
      },
      "unii": "G167Z38QA4",
      "relationships": [
        {
          "uuid": "25353308-a629-4b22-afb2-b59833743456",
          "type": "DERIVATIVE->PARENT",
          "references": [
            "597ec153-a8f5-4b9c-b7cf-e71a145ff300",
            "bb871710-cdd0-4747-9646-83a483962ce9",
            "3fcd1521-7aa8-4740-9d05-96ccb527a2dd"
          ],
          "related_substance": {
            "uuid": "51763479-c394-41c4-b04c-75d6f8319797",
            "refuuid": "7871e044-c047-4cc8-b1a9-3bff1826a4dd",
            "name": "N-(C11)METHYLNALTRINDOLE",
            "unii": "YQ6D119I11",
            "linking_id": "YQ6D119I11",
            "ref_pname": "N-(C11)METHYLNALTRINDOLE"
          }
        },
        {
          "uuid": "9e009dfb-4429-4383-b74d-d385ac508696",
          "amount": {
            "uuid": "c4f8781b-869b-42d5-b2e1-285bf3526c29"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "39f2ac8e-7963-4526-8c20-8cc4a9e39075"
          ],
          "related_substance": {
            "uuid": "1579b6f9-b29e-4432-8def-04976eb173dc",
            "refuuid": "f7fdf82e-009b-4d48-8e86-35e9456cf4ef",
            "name": "DELTA-TYPE OPIOID RECEPTOR",
            "unii": "EV0PWK6TT6",
            "linking_id": "EV0PWK6TT6",
            "ref_pname": "DELTA-TYPE OPIOID RECEPTOR",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "786e6ae5-8e94-4234-b5a2-2654eeadaf6e",
          "name": "4,8-METHANOBENZOFURO(2,3-A)PYRIDO(4,3-B)CARBAZOLE-1,8A(9H)-DIOL, 7-(CYCLOPROPYLMETHYL)-5,6,7,8,14,14B-HEXAHYDRO-, (4BS,8R,8AS,14BR)-",
          "stdName": "4,8-METHANOBENZOFURO(2,3-A)PYRIDO(4,3-B)CARBAZOLE-1,8A(9H)-DIOL, 7-(CYCLOPROPYLMETHYL)-5,6,7,8,14,14B-HEXAHYDRO-, (4BS,8R,8AS,14BR)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "560ec6d1-7749-470d-a808-606d480b1ffb",
            "e591c382-9534-4c9e-9f45-9570296e5422"
          ],
          "display_name": false
        },
        {
          "uuid": "e55895cc-db56-4baa-b88a-f1f3077a248a",
          "name": "NALTRINDOLE",
          "stdName": "NALTRINDOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "560ec6d1-7749-470d-a808-606d480b1ffb",
            "e591c382-9534-4c9e-9f45-9570296e5422"
          ],
          "display_name": true
        },
        {
          "uuid": "8e759b1e-867d-4d02-a823-ceec907e3844",
          "name": "NTI",
          "stdName": "NTI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "560ec6d1-7749-470d-a808-606d480b1ffb",
            "e591c382-9534-4c9e-9f45-9570296e5422"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "3bf5d584-af4a-4875-89ff-5e80cc94be12"
      }
    }
  ]
}