{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b374ed25-b03e-4c64-8945-bb2f24b48e07",
          "code": "19130-96-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19130-96-2",
          "code_system": "CAS",
          "references": [
            "8feb75c9-ce90-4066-8981-3f7991db473e",
            "3fdb412b-e51a-4756-8456-eb3ab108293a"
          ]
        },
        {
          "uuid": "dea14c1a-c77d-4ec4-87c0-fe0b4a1d0208",
          "code": "C87373",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87373",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8feb75c9-ce90-4066-8981-3f7991db473e"
          ]
        },
        {
          "uuid": "22a98c9b-fd37-4a6a-8d56-ab1a25b5bab7",
          "code": "9192",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=9192",
          "code_system": "INN",
          "references": [
            "8feb75c9-ce90-4066-8981-3f7991db473e"
          ]
        },
        {
          "uuid": "100f946f-35a3-4ded-b913-d8e32f0fce9b",
          "code": "m4176",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4176?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8feb75c9-ce90-4066-8981-3f7991db473e"
          ]
        },
        {
          "uuid": "31506029-05cb-4082-85bb-35ccd6117516",
          "code": "CHEMBL307429",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL307429",
          "code_system": "ChEMBL",
          "references": [
            "8feb75c9-ce90-4066-8981-3f7991db473e"
          ]
        },
        {
          "uuid": "21c7e3bc-dc3e-4d0d-9a1f-7d578d35f094",
          "code": "29435",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/29435",
          "code_system": "PUBCHEM",
          "references": [
            "8feb75c9-ce90-4066-8981-3f7991db473e"
          ]
        },
        {
          "uuid": "796ceae8-7492-0e62-918e-231573d03f63",
          "code": "DTXSID70172647",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70172647",
          "code_system": "EPA CompTox",
          "references": [
            "64542e44-0ab6-61fd-0a3a-9c827303287a"
          ]
        },
        {
          "uuid": "aa78fefb-182b-fd8f-ef99-0edd9d99e101",
          "code": "C87006",
          "comments": "Pharmacologic Substance[C1909]|Pharmacological Chaperone",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87006",
          "code_system": "NCI_THESAURUS",
          "references": [
            "050a4e6e-1380-9ebb-be76-e59d2271e94b"
          ]
        },
        {
          "uuid": "994dc743-230a-4ca9-87cf-e358d5ce5974",
          "code": "FZ56898FLE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ebb8fd49-4c73-e4a0-ff73-22a544c67e61",
          "code": "1116 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|Chemical|1-deoxynojirimycin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1116&item=1-deoxynojirimycin",
          "code_system": "DSLD",
          "references": [
            "050a4e6e-1380-9ebb-be76-e59d2271e94b"
          ]
        },
        {
          "uuid": "d67801f8-d69b-bd87-46bb-b84daf9d6ee2",
          "code": "DB03206",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03206",
          "code_system": "DRUG BANK",
          "references": [
            "050a4e6e-1380-9ebb-be76-e59d2271e94b"
          ]
        },
        {
          "uuid": "14e4fd5f-5c98-3a81-ee30-1ef42cfec68f",
          "code": "44369",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:44369",
          "code_system": "CHEBI",
          "references": [
            "050a4e6e-1380-9ebb-be76-e59d2271e94b"
          ]
        },
        {
          "uuid": "57b6a61b-ba09-7b7e-65fd-f1b261c87947",
          "code": "1-Deoxynojirimycin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/1-Deoxynojirimycin",
          "code_system": "WIKIPEDIA",
          "references": [
            "6de3ea7e-2b79-6320-ab90-a46b404c372f"
          ]
        },
        {
          "uuid": "916ff36b-cea3-b37f-20e0-e9d21fe67048",
          "code": "UU-168",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/UU-168/relevant/1/",
          "code_system": "USAN",
          "references": [
            "74000cf8-b76a-95e8-53fa-32d758eba89e"
          ]
        },
        {
          "uuid": "5f979db9-3ff4-dacc-41eb-043f14c9e23d",
          "code": "300000034137",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "852b94bf-c1ac-47bb-8207-1ef9d47ffc37"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2738fb1a-09c0-4b87-a8d8-6c939c772b35",
          "amount": {
            "uuid": "2bb7f886-8722-4829-802d-a587dd538656"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f89118bf-d717-49a5-9dab-dfebca71ce75",
            "refuuid": "86b33d3e-d1ce-49c3-add6-16316b2a8b23",
            "name": "Duvoglustat",
            "unii": "FZ56898FLE",
            "linking_id": "FZ56898FLE",
            "ref_pname": "Duvoglustat",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2db4da48-fbe9-4383-8fa3-5072e3a973a7",
          "amount": {
            "uuid": "458c820e-9f52-41f9-bc27-3234fcb10532"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "32737b43-41a0-4454-83d8-4813cacfda53",
            "refuuid": "f911fbc7-bbb9-468a-a9f3-ad2534146d7e",
            "name": "DUVOGLUSTAT HYDROCHLORIDE",
            "unii": "0RN23C42QR",
            "linking_id": "0RN23C42QR",
            "ref_pname": "DUVOGLUSTAT HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bad7eee5-5775-4146-aaed-e607cd41524c",
          "amount": {
            "uuid": "8f66ae2f-70cf-4a78-b925-7d9867104dd1"
          },
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "189f783c-c1ce-4f1e-a208-f7c3c19ac4b9",
            "refuuid": "d7a5b76d-844f-477f-bd2d-e1174c856736",
            "name": "ALGLUCOSIDASE ALFA",
            "unii": "DTI67O9503",
            "linking_id": "DTI67O9503",
            "ref_pname": "ALGLUCOSIDASE ALFA",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5b0bde03-3ce6-4217-8a4c-0c864903124b",
          "name": "(2R,3R,4R,5S)-2-(Hydroxymethyl)piperidine-3,4,5-triol",
          "stdName": "(2R,3R,4R,5S)-2-(HYDROXYMETHYL)PIPERIDINE-3,4,5-TRIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04646d86-8d87-452b-9d0e-79e1e2dd9420"
          ],
          "display_name": false
        },
        {
          "uuid": "f6452ecb-b1fb-4a7c-8432-bfb900ad2102",
          "name": "1 DEOXYNOJIRIMYCIN",
          "stdName": "1 DEOXYNOJIRIMYCIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d75373e-3838-4fab-808a-87aa30e55484",
            "df172b99-d2a0-4d10-9636-b69fbdbba15e"
          ],
          "display_name": false
        },
        {
          "uuid": "cee0e0c0-5d88-4a3f-b855-ed84f2b2a02c",
          "name": "1,5-DIDEOXY-1,5-IMINO-",
          "stdName": "1,5-DIDEOXY-1,5-IMINO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "15204feb-b929-4c2a-bfd8-1908ab0cac8a",
          "name": "1,5-DIDEOXY-1,5-IMINO-D-GLUCITOL",
          "stdName": "1,5-DIDEOXY-1,5-IMINO-D-GLUCITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "e641ce83-3b39-49f3-a773-ac8d67786474",
          "name": "1-DEOXYNOJIRIMYCIN [MI]",
          "stdName": "1-DEOXYNOJIRIMYCIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "a0082e26-4cf0-44ec-83bc-4279f550fefe"
          ],
          "display_name": false
        },
        {
          "uuid": "632bc569-9cab-4fbc-b800-d6dc78c7daab",
          "name": "1-DNJ",
          "stdName": "1-DNJ",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92fc52f5-2ca6-4844-9b04-01f2d9ead5cf"
          ],
          "display_name": false
        },
        {
          "uuid": "9e27e1a4-901f-44ee-9b12-f07e3474438d",
          "name": "3,4,5-PIPERIDINETRIOL, 2-(HYDROXYMETHYL)-, (2R,3R,4R,5S)-",
          "stdName": "3,4,5-PIPERIDINETRIOL, 2-(HYDROXYMETHYL)-, (2R,3R,4R,5S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04646d86-8d87-452b-9d0e-79e1e2dd9420"
          ],
          "display_name": false
        },
        {
          "uuid": "b7421dbe-22b5-4b1d-86c4-b8e4d7c2ba80",
          "name": "3,4,5-PIPERIDINETRIOL, 2-(HYDROXYMETHYL)-, (2R-(2.ALPHA.,3.BETA.,4.ALPHA.,5.BETA.))-",
          "stdName": "3,4,5-PIPERIDINETRIOL, 2-(HYDROXYMETHYL)-, (2R-(2.ALPHA.,3.BETA.,4.ALPHA.,5.BETA.))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "1afc6656-f950-4bb3-be9e-3600223e2e2e",
          "name": "5-AMINO-1,5-DIDEOXY-D-GLUCOPYRANOSE",
          "stdName": "5-AMINO-1,5-DIDEOXY-D-GLUCOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "257925c4-c530-4ea5-969a-b6a79a1f8ae9",
          "name": "BAY-H-5595",
          "stdName": "BAY-H-5595",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "6ad00c9b-2cf9-4e2f-9a2f-37d4a5668770",
          "name": "D-1-DEOXYNOJIRIMYCIN",
          "stdName": "D-1-DEOXYNOJIRIMYCIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "5fd09ea4-bd8c-4301-92fa-69922370b8ea",
          "name": "DEOXYNOJIRIMYCIN",
          "stdName": "DEOXYNOJIRIMYCIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "7daa9e48-2bc9-42bb-8df9-f3afdb8ccb3d"
          ],
          "display_name": false
        },
        {
          "uuid": "fa65b34b-505d-471b-9c75-9a48fe972561",
          "name": "DUVOGLUSTAT [USAN]",
          "stdName": "DUVOGLUSTAT [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d21af824-4a3c-4c87-9053-c0c9f8a88de9"
          ],
          "display_name": false
        },
        {
          "uuid": "c264224f-addb-46dc-a3d1-6c6e7b751a61",
          "name": "Duvoglustat",
          "stdName": "DUVOGLUSTAT",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d6005c9-ad7e-4c32-a79f-a45540614617",
            "fec6656e-6003-4aee-b2b2-f3ebf00445f0",
            "04646d86-8d87-452b-9d0e-79e1e2dd9420",
            "d21af824-4a3c-4c87-9053-c0c9f8a88de9",
            "cf3a446e-ad16-4b57-a78f-b932ffd03568"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "6661874f-a7b0-45af-92ad-1248203fe916",
              "name_org": "INN"
            },
            {
              "uuid": "741529f7-14d4-4cf9-b11f-f97937e76b3f",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "e4a1a98d-b5bd-457b-91db-8d1ce454b8f7",
          "name": "GLUCOPYRANOSE, 5-AMINO-1,5-DIDEOXY-, D-",
          "stdName": "GLUCOPYRANOSE, 5-AMINO-1,5-DIDEOXY-, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "77d6cd82-aa9d-4d7a-aa84-a02f7b0cc841",
          "name": "MORANOLIN",
          "stdName": "MORANOLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "64078f2d-a7ea-40cf-9f18-990e73023ffe",
          "name": "MORANOLINE",
          "stdName": "MORANOLINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "95f68eef-9f3b-4ee3-925b-22570c5891ea",
          "name": "NOJIRIMYCIN, 1-DEOXY-",
          "stdName": "NOJIRIMYCIN, 1-DEOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71f94178-c6c6-49c7-bff8-bb9c515941d8",
            "f15edb14-8beb-43d4-a58a-17b05d2313f4"
          ],
          "display_name": false
        },
        {
          "uuid": "50355123-7736-4014-9f46-c46f4e914200",
          "name": "duvoglustat [INN]",
          "stdName": "DUVOGLUSTAT [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d6005c9-ad7e-4c32-a79f-a45540614617"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "04646d86-8d87-452b-9d0e-79e1e2dd9420",
          "citation": "USAN COUN 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3d6005c9-ad7e-4c32-a79f-a45540614617",
          "citation": "INN Proposed List 102",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL102.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d21af824-4a3c-4c87-9053-c0c9f8a88de9",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0082e26-4cf0-44ec-83bc-4279f550fefe",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71f94178-c6c6-49c7-bff8-bb9c515941d8",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d75373e-3838-4fab-808a-87aa30e55484",
          "citation": "NLM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df172b99-d2a0-4d10-9636-b69fbdbba15e",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f15edb14-8beb-43d4-a58a-17b05d2313f4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7daa9e48-2bc9-42bb-8df9-f3afdb8ccb3d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8feb75c9-ce90-4066-8981-3f7991db473e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390766000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "863a7df2-215a-46fd-8245-f42afcee225d",
          "citation": "SRS import [FZ56898FLE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FZ56898FLE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390766000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98a9314c-2289-4f4e-bb7c-9603164dacc9",
          "citation": "USAN COUNCIL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fec6656e-6003-4aee-b2b2-f3ebf00445f0",
          "citation": "DUVOGLUSTAT [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cf3a446e-ad16-4b57-a78f-b932ffd03568",
          "citation": "DUVOGLUSTAT [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "64542e44-0ab6-61fd-0a3a-9c827303287a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=19130-96-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "050a4e6e-1380-9ebb-be76-e59d2271e94b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8ee2626f-64f1-891a-15df-381f35114623",
          "citation": "USAN COUN 2009",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3fdb412b-e51a-4756-8456-eb3ab108293a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "74000cf8-b76a-95e8-53fa-32d758eba89e",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "6de3ea7e-2b79-6320-ab90-a46b404c372f",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "852b94bf-c1ac-47bb-8207-1ef9d47ffc37",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "92fc52f5-2ca6-4844-9b04-01f2d9ead5cf",
          "citation": "1-Deoxynojirimycin",
          "url": "https://en.wikipedia.org/wiki/1-Deoxynojirimycin",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c07c94f1-5976-031e-99b5-99fae9eb3b6b",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f4c51281-9c88-40c6-8c7c-137bff097b0e",
          "id": "f4c51281-9c88-40c6-8c7c-137bff097b0e",
          "molfile": "\n  Marvin  01132112412D          \n\n 11 11  0  0  1  0            999 V2000\n    1.1370    1.8375    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.1370    2.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8490    1.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8490    0.5958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1370    0.1875    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.1370   -0.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8515   -1.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4250    0.5958    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -0.2889    0.1823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4250    1.4208    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.2907    1.8312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  6  0  0  0\nM  END",
          "smiles": "C1[C@@H]([C@H]([C@@H]([C@@H](CO)N1)O)O)O",
          "formula": "C6H13NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c922aabb-2113-4aaa-a8d3-e56e57dc17de"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "163.172",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "86b33d3e-d1ce-49c3-add6-16316b2a8b23",
      "version": "22",
      "structure": {
        "id": "740b947e-4d28-4dd3-91d6-60d11afaaa51",
        "molfile": "\n  Marvin  01132106012D          \n\n 11 11  0  0  1  0            999 V2000\n    0.4250    1.4208    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.4250    0.5958    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.1370    0.1875    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.8490    0.5958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8490    1.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1370    1.8375    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.1370    2.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2889    0.1823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2907    1.8312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1370   -0.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8515   -1.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  1  2  1  0  0  0  0\n  2  8  1  1  0  0  0\n  1  6  1  0  0  0  0\n  1  9  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3 10  1  6  0  0  0\n  3  4  1  0  0  0  0\n 10 11  1  0  0  0  0\nM  END",
        "smiles": "C1[C@@H]([C@H]([C@@H]([C@@H](CO)N1)O)O)O",
        "formula": "C6H13NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "163.172",
        "optical_activity": "( + )",
        "references": [
          "98a9314c-2289-4f4e-bb7c-9603164dacc9",
          "863a7df2-215a-46fd-8245-f42afcee225d",
          "3d6005c9-ad7e-4c32-a79f-a45540614617"
        ],
        "stereo_centers": 4
      },
      "unii": "FZ56898FLE"
    }
  ]
}