{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e6dabbb3-9e96-83ac-a15c-7e27f468db80", "code": "118201", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118201", "code_system": "PUBCHEM", "references": [ "05e98fef-8484-a51c-4100-11ff8547814f" ] }, { "uuid": "76cdcfb7-9b23-4db6-9902-1803413bf5b5", "code": "35044-59-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=35044-59-8", "code_system": "CAS", "references": [ "8834ba69-0880-419b-dec8-34aea656f6fe" ] }, { "uuid": "ae8d87ac-8383-43df-9837-fbad5ea70378", "code": "FZ10F6BJB5", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "e914eaa5-069d-d387-9448-72eefd82b270", "code": "DTXSID6067884", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6067884", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "270a3b24-328b-0e23-4bc0-bb649140b16f", "name": "1,3-CYCLOHEXADIENE-1-CARBOXYLIC ACID, 2,6,6-TRIMETHYL-, ETHYL ESTER", "stdName": "1,3-CYCLOHEXADIENE-1-CARBOXYLIC ACID, 2,6,6-TRIMETHYL-, ETHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8834ba69-0880-419b-dec8-34aea656f6fe" ], "display_name": false }, { "uuid": "b8643e96-82c9-4405-0cef-b793e534abee", "name": "2,6,6-TRIMETHYL-1-(ETHOXYCARBONYL)CYCLOHEXA-1,3-DIENE", "stdName": "2,6,6-TRIMETHYL-1-(ETHOXYCARBONYL)CYCLOHEXA-1,3-DIENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8834ba69-0880-419b-dec8-34aea656f6fe" ], "display_name": false }, { "uuid": "84a2a07f-b2e9-8254-e162-690c4dee9112", "name": "ETHYL .BETA.-SAFRANATE", "stdName": "ETHYL .BETA.-SAFRANATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8834ba69-0880-419b-dec8-34aea656f6fe" ], "display_name": true }, { "uuid": "92b5446c-b5a4-48eb-6ae6-4a97f043a8c5", "name": "ETHYL 2,6,6-TRIMETHYLCYCLOHEXA-1,3-DIENE-1-CARBOXYLATE", "stdName": "ETHYL 2,6,6-TRIMETHYLCYCLOHEXA-1,3-DIENE-1-CARBOXYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8834ba69-0880-419b-dec8-34aea656f6fe" ], "display_name": false } ], "references": [ { "uuid": "05e98fef-8484-a51c-4100-11ff8547814f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "8834ba69-0880-419b-dec8-34aea656f6fe", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7ce18333-d0a7-0be3-7de5-697d77f34a82", "id": "7ce18333-d0a7-0be3-7de5-697d77f34a82", "molfile": "\n Marvin 01132106292D \n\n 14 14 0 0 0 0 999 V2000\n 15.2625 -3.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9769 -3.8887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6914 -3.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4059 -3.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2625 -2.6512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -3.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -4.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8302 -5.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3605 -4.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8335 -5.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -4.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -3.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8335 -3.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8335 -2.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 13 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\nM END", "smiles": "CCOC(=O)C1=C(C)C=CCC1(C)C", "formula": "C12H18O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a56c0f4c-a148-4406-8688-9199326f7474" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "194.2706", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2ed0f8de-8fd9-48b4-a357-d06553b1274f", "version": "5", "structure": { "id": "13a64a8b-1109-5bd7-b582-a2cfebc5995d", "molfile": "1,3-Cyclohexadiene-1-carboxylic acid, 2,6,6-trimethyl-, ethyl ester\n Marvin 01132101142D \n\n 14 14 0 0 0 0 999 V2000\n 15.2625 -3.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9769 -3.8887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6914 -3.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4059 -3.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2625 -2.6512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -3.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -4.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8302 -5.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3605 -4.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8335 -5.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -4.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -3.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8335 -3.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8335 -2.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 1 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 6 13 2 0 0 0 0\n 13 14 1 0 0 0 0\nM END", "smiles": "CCOC(=O)C1=C(C)C=CCC1(C)C", "formula": "C12H18O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "194.2706", "optical_activity": "NONE", "references": [ "8834ba69-0880-419b-dec8-34aea656f6fe" ], "stereo_centers": 0 }, "unii": "FZ10F6BJB5" } ] }