{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6f64e512-42c1-45c2-843a-67b3953b9fc4", "code": "4130-35-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4130-35-2", "code_system": "CAS", "references": [ "2d38bc30-880e-405a-b2c3-7441e644ee7d", "5906eb69-1a6e-41cc-91e4-c93886371da7" ] }, { "uuid": "3815b141-e11b-4038-bf07-0f6bb05dd91b", "code": "70225-05-7", "type": "NO STRUCTURE GIVEN", "url": "https://commonchemistry.cas.org/detail?cas_rn=70225-05-7", "code_system": "CAS", "references": [ "2d38bc30-880e-405a-b2c3-7441e644ee7d", "805c7ed4-5015-430f-a853-21bd407fecfc" ] }, { "uuid": "413ceebe-e895-4c56-b0d9-fe9f610ff614", "code": "223-944-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.768", "code_system": "ECHA (EC/EINECS)", "references": [ "2d38bc30-880e-405a-b2c3-7441e644ee7d" ] }, { "uuid": "27fc03b2-6d7a-4f4b-8f0b-f69f29b21801", "code": "1426289", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426289/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "2d38bc30-880e-405a-b2c3-7441e644ee7d" ] }, { "uuid": "525b93b9-31c7-4a2c-bb8c-bb3b995a9c54", "code": "61333", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61333", "code_system": "PUBCHEM", "references": [ "2d38bc30-880e-405a-b2c3-7441e644ee7d" ] }, { "uuid": "87b32884-148e-4c65-9bb2-8decdf2a23b9", "code": "FY36J270ES", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "e7abeda9-6a19-be59-a962-4c0ca7f9a85f", "code": "DTXSID50863324", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50863324", "code_system": "EPA CompTox" }, { "uuid": "9445a619-d780-d89b-326a-e63da35b3074", "code": "FY36J270ES", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=FY36J270ES", "code_system": "DAILYMED", "references": [ "2d8af029-2d67-bc5f-ec4c-138d2c59e2a3" ] }, { "uuid": "1b9fb087-8d9b-0449-0d52-c4dd179300da", "code": "100000177746", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "01599964-ecb1-50d6-ca34-63d470fb7831" ] } ], "substance_class": "chemical", "names": [ { "uuid": "389d3b60-3547-4769-9b51-6a261cb8c71a", "name": "1,2,4-BENZENETRICARBOXYLIC ACID, TRITRIDECYL ESTER", "stdName": "1,2,4-BENZENETRICARBOXYLIC ACID, TRITRIDECYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b132479b-899f-4e7a-9de2-976d9269011d", "b7e71e8d-e266-4d36-8762-a5b70d681f50" ], "display_name": false }, { "uuid": "a24bbf78-670f-400b-a22b-1107edeec4e9", "name": "HATCOL 5103", "stdName": "HATCOL 5103", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b132479b-899f-4e7a-9de2-976d9269011d", "b7e71e8d-e266-4d36-8762-a5b70d681f50" ], "display_name": false }, { "uuid": "be615943-64c8-4b88-80f7-eda7520dbb65", "name": "PELEMOL TDTM", "stdName": "PELEMOL TDTM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b132479b-899f-4e7a-9de2-976d9269011d", "b7e71e8d-e266-4d36-8762-a5b70d681f50" ], "display_name": false }, { "uuid": "b1975e7f-8ab3-4635-9d40-d23349d76fb2", "name": "TRIDECYL TRIMELLITATE", "stdName": "TRIDECYL TRIMELLITATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "b132479b-899f-4e7a-9de2-976d9269011d", "3ac2b6f1-d1b2-4a32-bd17-1eeb8bfbc76f", "78c76ee6-b967-425f-badc-80269ed4245d", "a561846f-17e1-4bd8-9795-32ef3ef2873b", "b7e71e8d-e266-4d36-8762-a5b70d681f50" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "8dd0f462-0a45-403f-a269-0267c3839273", "name_org": "INCI" } ] } ], "references": [ { "uuid": "b7e71e8d-e266-4d36-8762-a5b70d681f50", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "78c76ee6-b967-425f-badc-80269ed4245d", "citation": "CTFA DL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b132479b-899f-4e7a-9de2-976d9269011d", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a561846f-17e1-4bd8-9795-32ef3ef2873b", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2d38bc30-880e-405a-b2c3-7441e644ee7d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390967000, "tags": [ "NOMEN" ] }, { "uuid": "6c1f7531-abe8-4d20-9c47-6e07936fc1d4", "citation": "SRS import [FY36J270ES]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FY36J270ES", "doc_type": "SRS", "public_domain": true, "document_date": 1493390967000, "tags": [ "NOMEN" ] }, { "uuid": "3ac2b6f1-d1b2-4a32-bd17-1eeb8bfbc76f", "citation": "TRIDECYL TRIMELLITATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5906eb69-1a6e-41cc-91e4-c93886371da7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "805c7ed4-5015-430f-a853-21bd407fecfc", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "2d8af029-2d67-bc5f-ec4c-138d2c59e2a3", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "01599964-ecb1-50d6-ca34-63d470fb7831", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3bfc113b-5912-437d-86ac-c73f7afeb1ee", "id": "3bfc113b-5912-437d-86ac-c73f7afeb1ee", "molfile": "\n Marvin 01132103112D \n\n 45 45 0 0 0 0 999 V2000\n 0.0000 -10.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7539 -9.6587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4085 -10.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1467 -9.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8509 -10.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5917 -9.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2802 -10.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0184 -9.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7071 -10.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4269 -9.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0973 -10.4489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9215 -9.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8683 -10.5011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9058 -9.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1677 -8.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1833 -7.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9058 -7.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8902 -6.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1468 -6.2208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5762 -6.2052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5397 -5.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2439 -4.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2282 -4.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9012 -3.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9012 -2.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6367 -2.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6367 -1.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3618 -1.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3775 -0.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6101 -7.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6101 -8.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3508 -7.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2986 -6.5990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0707 -7.7337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7594 -7.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4271 -7.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1861 -7.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9059 -7.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5946 -7.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3353 -7.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0578 -7.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7778 -7.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4507 -7.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1863 -7.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 2 0 0 0 0\n 12 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 32 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 31 2 0 0 0 0\n 19 18 2 0 0 0 0\n 20 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 31 1 0 0 0 0\n 34 33 2 0 0 0 0\n 35 33 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 0 0 0 0\n 42 41 1 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCCOC(=O)c1ccc(c(c1)C(=O)OCCCCCCCCCC)C(=O)OCCCCCCCCCC", "formula": "C39H66O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d5b6d8ff-fe6f-4bb8-87b7-e9803a0c5c02" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "630.9392", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b4ae33c6-90c2-4558-8fde-6eead82fdb6e", "version": "6", "structure": { "id": "4c988cc3-7ab0-418a-ac41-ae66a8180be2", "molfile": "\n Marvin 01132104002D \n\n 45 45 0 0 0 0 999 V2000\n 8.6101 -7.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9058 -7.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6101 -8.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3508 -7.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8902 -6.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9058 -9.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9215 -9.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1833 -7.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1677 -8.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2986 -6.5990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1468 -6.2208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8683 -10.5011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0707 -7.7337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5762 -6.2052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0973 -10.4489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7594 -7.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4269 -9.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5397 -5.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7071 -10.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4271 -7.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2439 -4.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7539 -9.6587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4507 -7.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3775 -0.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4085 -10.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3618 -1.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7778 -7.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8509 -10.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1467 -9.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5946 -7.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3353 -7.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2282 -4.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9012 -3.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9012 -2.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6367 -2.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6367 -1.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0578 -7.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1861 -7.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9059 -7.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0184 -9.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2802 -10.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5917 -9.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -10.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1863 -7.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 2 0 0 0 0\n 4 1 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 3 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 2 2 0 0 0 0\n 9 6 2 0 0 0 0\n 10 4 2 0 0 0 0\n 11 5 2 0 0 0 0\n 12 7 2 0 0 0 0\n 13 4 1 0 0 0 0\n 14 5 1 0 0 0 0\n 15 7 1 0 0 0 0\n 16 13 1 0 0 0 0\n 17 15 1 0 0 0 0\n 18 14 1 0 0 0 0\n 19 17 1 0 0 0 0\n 20 16 1 0 0 0 0\n 21 18 1 0 0 0 0\n 22 25 1 0 0 0 0\n 23 27 1 0 0 0 0\n 24 26 1 0 0 0 0\n 25 29 1 0 0 0 0\n 26 36 1 0 0 0 0\n 27 37 1 0 0 0 0\n 28 42 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 39 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 21 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 31 1 0 0 0 0\n 38 20 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 19 1 0 0 0 0\n 41 40 1 0 0 0 0\n 42 41 1 0 0 0 0\n 43 22 1 0 0 0 0\n 44 23 1 0 0 0 0\n 45 24 1 0 0 0 0\n 9 8 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCCOC(=O)c1ccc(c(c1)C(=O)OCCCCCCCCCC)C(=O)OCCCCCCCCCC", "formula": "C39H66O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "630.9392", "optical_activity": "NONE", "references": [ "6c1f7531-abe8-4d20-9c47-6e07936fc1d4", "b7e71e8d-e266-4d36-8762-a5b70d681f50" ], "stereo_centers": 0 }, "unii": "FY36J270ES" } ] }