{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aa7f46d4-ddbb-41be-9d64-3d20c9e5d074",
          "code": "N0000175864",
          "comments": "Established Pharmacologic Class [EPC]|Contrast Agent for Ultrasound Imaging [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175864",
          "code_system": "NDF-RT",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "0c5a521e-38e9-4e87-b26b-8d547c8cea2f",
          "code": "N0000010259",
          "comments": "Cellular or Molecular Interactions [MoA]|Physiochemical Activity [MoA]|Imaging Contrast Activity [MoA]|Ultrasound Contrast Activity [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000010259",
          "code_system": "NDF-RT",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "8d6c0907-27ca-42d7-b1a3-367526c415b8",
          "code": "355-42-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=355-42-0",
          "code_system": "CAS",
          "references": [
            "27400355-3f30-41b7-898c-533655039557",
            "76cbc424-250e-4867-8acd-b5b2f986fd81"
          ]
        },
        {
          "uuid": "d021470e-e4bc-48dc-ba50-6b92f0c572d0",
          "code": "C47663",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47663",
          "code_system": "NCI_THESAURUS",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "5875a98a-4972-42b8-a4ff-26bf8a99bb4d",
          "code": "PERFLUOROHEXANE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Perfluorohexane",
          "code_system": "WIKIPEDIA",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "360465e7-49d7-45cb-924b-fc7734d79d9f",
          "code": "21 CFR 173.342",
          "comments": "PART 173 -- SECONDARY DIRECT FOOD ADDITIVES PERMITTED IN FOOD FOR HUMAN CONSUMPTION|Subpart D--Specific Usage Additives|Sec. 173.342 Chlorofluorocarbon 113 and perfluorohexane.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=173.342",
          "code_system": "CFR",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "43255f9d-9126-49b6-b493-f92c19a39963",
          "code": "SUB33239",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "1ab67d06-b0d3-407d-a445-76bbeb63f4e3",
          "code": "C078626",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67078626",
          "code_system": "MESH",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "c53f494f-4d0c-492f-864e-3689c0b16cc0",
          "code": "206-585-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.987",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "2a2f3395-7a13-4357-972c-5ea29438d955",
          "code": "1540828",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1540828/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "894bc3cc-af49-444a-b9dc-fc29e4ae9787",
          "code": "m8541",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8541?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "a0ff3a95-cefc-4809-86c4-c679d06c6a6c",
          "code": "CHEMBL1200607",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200607",
          "code_system": "ChEMBL",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "6bcf8607-531a-418a-94c3-becb16a1db3d",
          "code": "9639",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9639",
          "code_system": "PUBCHEM",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "9a278f64-2caf-45d1-9afc-ace980f48b0f",
          "code": "7917",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7917",
          "code_system": "INN",
          "references": [
            "27400355-3f30-41b7-898c-533655039557"
          ]
        },
        {
          "uuid": "8c613250-ba27-d72e-6404-4c0a925b75b6",
          "code": "7871",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7871",
          "code_system": "HSDB",
          "references": [
            "486ddb87-e708-4dce-ab12-a66ea36be197"
          ]
        },
        {
          "uuid": "9f3c0744-d21f-158c-d231-78be70e49ca3",
          "code": "DTXSID7046548",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7046548",
          "code_system": "EPA CompTox",
          "references": [
            "f68f17e4-3be5-a807-bbdb-e337dbb20184"
          ]
        },
        {
          "uuid": "b534a245-b272-af68-a338-87e964585f79",
          "code": "C1937",
          "comments": "Industrial Aid[C45678]|Reagent[C802]|Diagnostic Reagent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1937",
          "code_system": "NCI_THESAURUS",
          "references": [
            "37e5adb9-01da-f795-cb75-84d78aa11c58"
          ]
        },
        {
          "uuid": "7b522b38-8495-43d8-b800-3d6d33abbfb0",
          "code": "FX3WJ41CMX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "85961b26-330b-d4ce-d740-8d7e7186f4bc",
          "code": "DB09531",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB09531",
          "code_system": "DRUG BANK",
          "references": [
            "37e5adb9-01da-f795-cb75-84d78aa11c58"
          ]
        },
        {
          "uuid": "b6a46e3a-9829-2b76-11fa-3a835e513f28",
          "code": "3429",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3429",
          "code_system": "DRUG CENTRAL",
          "references": [
            "37e5adb9-01da-f795-cb75-84d78aa11c58"
          ]
        },
        {
          "uuid": "1ed8987a-4a1d-d74e-5d0c-e8153cf5264c",
          "code": "39427",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:39427",
          "code_system": "CHEBI",
          "references": [
            "37e5adb9-01da-f795-cb75-84d78aa11c58"
          ]
        },
        {
          "uuid": "460f9e05-a4a4-3b05-2979-e9fa660fe9f0",
          "code": "FX3WJ41CMX",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=FX3WJ41CMX",
          "code_system": "DAILYMED",
          "references": [
            "ea21ba29-7227-cd1a-860d-ec8679adba68"
          ]
        },
        {
          "uuid": "68a10c5f-3a1d-25fb-241d-36648bb8690c",
          "code": "100000126369",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "76671511-c37f-942e-4431-8e85fef9d630"
          ]
        },
        {
          "uuid": "a2cbbe65-b1ac-6158-8ce0-152a42415155",
          "code": "KK-122",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/KK-122/relevant/1/",
          "code_system": "USAN",
          "references": [
            "e49e766e-9c09-3f4e-cb91-1a3f36c3f683"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8a166a80-339e-4fc3-a907-76090861db1b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d2e06df7-f91a-4a12-aa81-49967a38a134",
            "refuuid": "8816b310-90bd-4ee9-8623-a0966c1ca1ba",
            "name": "PERFLEXANE",
            "unii": "FX3WJ41CMX",
            "linking_id": "FX3WJ41CMX",
            "ref_pname": "PERFLEXANE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2022efa5-8032-4fb9-b62a-97b426e1d18f",
          "name": "AF-0150",
          "stdName": "AF-0150",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4b1a075-337a-4f7d-a400-7f9043ca85e1"
          ],
          "display_name": false
        },
        {
          "uuid": "8bc9218a-aa46-4fa4-86a0-4c0fa2ad7b9c",
          "name": "AF0150",
          "stdName": "AF0150",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7dd1f50a-0ac9-4d8b-8a94-e82b2b82f0b9"
          ],
          "display_name": false
        },
        {
          "uuid": "936a089f-40b7-4ece-a7eb-d9597cc1ebab",
          "name": "HEXANE, TETRADECAFLUORO-",
          "stdName": "HEXANE, TETRADECAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7dd1f50a-0ac9-4d8b-8a94-e82b2b82f0b9"
          ],
          "display_name": false
        },
        {
          "uuid": "3d488154-03e6-4ebe-9c7d-600318b1464d",
          "name": "PERFLEXANE",
          "stdName": "PERFLEXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b92ec95-f888-4ab6-baa5-81a9d55be7e4",
            "fb18cece-c98e-47f8-ac2a-c5c6de1afe6f",
            "7dd1f50a-0ac9-4d8b-8a94-e82b2b82f0b9",
            "2b4dafe6-c737-48e5-b98b-e0513301f955",
            "eef71e38-2009-475b-8d31-ecd33c3cc709",
            "393374d2-5426-4a1f-96da-fb0036fd5280",
            "9d1bd8a9-e360-4297-a7ed-1dce46aff3fb",
            "007f3f7a-45c4-419a-b6f8-8f45ff62118e",
            "241ca9f6-4353-4c56-8f7e-c6d7e0bdd644",
            "122fca0c-8642-4fba-a200-1b0f7a88e62e",
            "95a2a0ca-4687-40c3-8234-ee0390600ce1",
            "95f99d8d-5662-4d65-9739-9c4705ba18f1",
            "9d32ab54-a72c-4a00-83e3-018f2d2033d1"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "8a2ffc72-5d38-4590-9ce4-49404d90d04d",
              "name_org": "USAN"
            },
            {
              "uuid": "b5422028-abd5-4e3f-b1ce-6ee1dc479ec1",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "23b32412-7819-4cf6-9c41-ecc844e19384",
          "name": "PERFLEXANE [MART.]",
          "stdName": "PERFLEXANE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95a2a0ca-4687-40c3-8234-ee0390600ce1"
          ],
          "display_name": false
        },
        {
          "uuid": "1023326b-f5b6-40a4-9866-047b56540c7a",
          "name": "PERFLEXANE [ORANGE BOOK]",
          "stdName": "PERFLEXANE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "122fca0c-8642-4fba-a200-1b0f7a88e62e"
          ],
          "display_name": false
        },
        {
          "uuid": "b69ab0cf-aeaa-404c-84af-984d3d50cbe9",
          "name": "PERFLEXANE [USAN]",
          "stdName": "PERFLEXANE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "393374d2-5426-4a1f-96da-fb0036fd5280"
          ],
          "display_name": false
        },
        {
          "uuid": "aab46494-fdaf-4fba-8f89-c5742ea907cd",
          "name": "PERFLEXANE [VANDF]",
          "stdName": "PERFLEXANE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95f99d8d-5662-4d65-9739-9c4705ba18f1"
          ],
          "display_name": false
        },
        {
          "uuid": "b20b1f32-7ffc-4e90-9dd1-8cb218a67c80",
          "name": "PERFLUOROHEXANE",
          "stdName": "PERFLUOROHEXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "82fbc24a-8f97-4ebb-ba08-e22405f8a0ac",
            "5dbe6ccb-ff8a-4def-9911-0320cdb53ec7",
            "5db1dba0-bc14-401d-bc82-1c1f7b8bd7c1",
            "95f99d8d-5662-4d65-9739-9c4705ba18f1",
            "915b7c94-3f83-4b4f-8bb6-3d32954404cb"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8f554672-b22b-4692-b4fa-171f1bef606d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "14248f24-1557-4680-8a39-3fbf2dfacb72",
          "name": "PERFLUOROHEXANE [MI]",
          "stdName": "PERFLUOROHEXANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82fbc24a-8f97-4ebb-ba08-e22405f8a0ac"
          ],
          "display_name": false
        },
        {
          "uuid": "a05b0732-0326-7bce-32a0-8eb03bef49dd",
          "name": "Perflexane [WHO-DD]",
          "stdName": "PERFLEXANE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d448b7-9a4a-df37-eb58-a3d598bb6f3a"
          ],
          "display_name": false
        },
        {
          "uuid": "6eda9b5a-ed70-4b8c-bb54-62a881ff8743",
          "name": "Tetradecafluorohexane",
          "stdName": "TETRADECAFLUOROHEXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7dd1f50a-0ac9-4d8b-8a94-e82b2b82f0b9"
          ],
          "display_name": false
        },
        {
          "uuid": "5b74a376-e1b6-4ec9-b718-4e6ae77b92e1",
          "name": "perflexane [INN]",
          "stdName": "PERFLEXANE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eef71e38-2009-475b-8d31-ecd33c3cc709"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7dd1f50a-0ac9-4d8b-8a94-e82b2b82f0b9",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "95f99d8d-5662-4d65-9739-9c4705ba18f1",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "393374d2-5426-4a1f-96da-fb0036fd5280",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eef71e38-2009-475b-8d31-ecd33c3cc709",
          "citation": "INN Proposed List 82",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL82.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "122fca0c-8642-4fba-a200-1b0f7a88e62e",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95a2a0ca-4687-40c3-8234-ee0390600ce1",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82fbc24a-8f97-4ebb-ba08-e22405f8a0ac",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5db1dba0-bc14-401d-bc82-1c1f7b8bd7c1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "241ca9f6-4353-4c56-8f7e-c6d7e0bdd644",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4b1a075-337a-4f7d-a400-7f9043ca85e1",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27400355-3f30-41b7-898c-533655039557",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390009000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28642576-d095-44a4-955c-ec4fe33ea2c5",
          "citation": "SRS import [FX3WJ41CMX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FX3WJ41CMX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390009000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "007f3f7a-45c4-419a-b6f8-8f45ff62118e",
          "citation": "PERFLEXANE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b92ec95-f888-4ab6-baa5-81a9d55be7e4",
          "citation": "PERFLEXANE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d1bd8a9-e360-4297-a7ed-1dce46aff3fb",
          "citation": "PERFLEXANE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fb18cece-c98e-47f8-ac2a-c5c6de1afe6f",
          "citation": "PERFLEXANE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5dbe6ccb-ff8a-4def-9911-0320cdb53ec7",
          "citation": "PERFLUOROHEXANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "915b7c94-3f83-4b4f-8bb6-3d32954404cb",
          "citation": "PERFLUOROHEXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b4dafe6-c737-48e5-b98b-e0513301f955",
          "citation": "PERFLEXANE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d32ab54-a72c-4a00-83e3-018f2d2033d1",
          "citation": "PERFLEXANE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "486ddb87-e708-4dce-ab12-a66ea36be197",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+355-42-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f68f17e4-3be5-a807-bbdb-e337dbb20184",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=355-42-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "37e5adb9-01da-f795-cb75-84d78aa11c58",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "76cbc424-250e-4867-8acd-b5b2f986fd81",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e49e766e-9c09-3f4e-cb91-1a3f36c3f683",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "92d448b7-9a4a-df37-eb58-a3d598bb6f3a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ea21ba29-7227-cd1a-860d-ec8679adba68",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "76671511-c37f-942e-4431-8e85fef9d630",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d12cf4c7-a6b4-4228-a1aa-0d5015e98232",
          "id": "d12cf4c7-a6b4-4228-a1aa-0d5015e98232",
          "molfile": "\n  Marvin  01132110492D          \n\n 20 19  0  0  0  0            999 V2000\n    4.9372   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9372   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9372    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7467   -0.8122    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1122   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1122   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1122    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3000   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3000    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3000   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4699   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4699   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4699    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6372   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6372    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6372   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8276   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8276   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8122    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8276    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  5  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n  8 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 17  1  0  0  0  0\nM  END",
          "smiles": "C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F",
          "formula": "C6F14",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "81af6a75-769b-402c-b4d5-c28d547c7215"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "338.0421",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8816b310-90bd-4ee9-8623-a0966c1ca1ba",
      "version": "19",
      "structure": {
        "id": "c02037b3-c479-4a75-b22c-e99605330553",
        "molfile": "\n  Marvin  01132109562D          \n\n 20 19  0  0  0  0            999 V2000\n    2.4699   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3000   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6372   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1122   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9372   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8276   -0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3000    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3000   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4699   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4699    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1122   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1122    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6372    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6372   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9372   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9372    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8276   -1.6372    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8122    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8276    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7467   -0.8122    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  5  1  0  0  0  0\n 17  6  1  0  0  0  0\n 18  6  1  0  0  0  0\n 19  6  1  0  0  0  0\n 20  5  1  0  0  0  0\nM  END",
        "smiles": "C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F",
        "formula": "C6F14",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "338.0421",
        "optical_activity": "NONE",
        "references": [
          "28642576-d095-44a4-955c-ec4fe33ea2c5",
          "7dd1f50a-0ac9-4d8b-8a94-e82b2b82f0b9",
          "eef71e38-2009-475b-8d31-ecd33c3cc709"
        ],
        "stereo_centers": 0
      },
      "unii": "FX3WJ41CMX"
    }
  ]
}