{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6aa0fcb5-a2dc-4f23-a984-6143d3f8c104", "code": "7545-50-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=7545-50-8", "code_system": "CAS", "references": [ "250efaa0-531e-4cc3-97f0-4d90c8e9264c", "545f1be2-da77-4b12-893c-4c9e51a6fcaa" ] }, { "uuid": "303bda71-bd5e-4cdf-b26d-a4dbf83dbf33", "code": "231-428-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.572", "code_system": "ECHA (EC/EINECS)", "references": [ "250efaa0-531e-4cc3-97f0-4d90c8e9264c" ] }, { "uuid": "1a1eea81-426a-4c73-960a-2ee7286c2ec7", "code": "82047", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82047", "code_system": "PUBCHEM", "references": [ "250efaa0-531e-4cc3-97f0-4d90c8e9264c" ] }, { "uuid": "c4f381b1-f6a6-9067-8e8f-63dcece4c3a1", "code": "DTXSID40226383", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40226383", "code_system": "EPA CompTox", "references": [ "287a0ed5-28a3-251d-fefb-eaf015705c4e" ] }, { "uuid": "25476a07-f18e-4397-845a-5afc920599cd", "code": "155173", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=155173", "code_system": "NSC", "references": [ "d384ee04-464b-7c12-59d8-6c00a1eabe89" ] }, { "uuid": "dc28666f-b2a7-4afc-8ba6-21ad40708b8d", "code": "FWR6XZJ9EA", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "545f1be2-da77-4b12-893c-4c9e51a6fcaa" ] } ], "substance_class": "chemical", "names": [ { "uuid": "49448a0f-5712-473d-a6a7-7aa2de011f99", "name": "3,3′-Diamino-4,4′-dihydroxydiphenyl sulfone", "stdName": "3,3'-DIAMINO-4,4'-DIHYDROXYDIPHENYL SULFONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "545f1be2-da77-4b12-893c-4c9e51a6fcaa" ], "display_name": false }, { "uuid": "5f3c5edb-0e90-432e-b4a1-c7bc26e353db", "name": "4,4′-Sulfonylbis[2-aminophenol]", "stdName": "4,4'-SULFONYLBIS(2-AMINOPHENOL)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3ced7c30-9971-4df7-9741-0a3dedf5db5d", "8a2a2ae9-a98a-4c06-8835-1c7a45f437dc" ], "display_name": true }, { "uuid": "ba7e398e-92a9-ed96-cca5-3ac1c8d643e1", "name": "NSC-155173", "stdName": "NSC-155173", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "d384ee04-464b-7c12-59d8-6c00a1eabe89" ], "display_name": false }, { "uuid": "518366ba-ab30-48b7-8db9-e949fb306b9e", "name": "Phenol, 4,4′-sulfonylbis[2-amino-", "stdName": "PHENOL, 4,4'-SULFONYLBIS(2-AMINO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "545f1be2-da77-4b12-893c-4c9e51a6fcaa" ], "display_name": false } ], "references": [ { "uuid": "8a2a2ae9-a98a-4c06-8835-1c7a45f437dc", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3ced7c30-9971-4df7-9741-0a3dedf5db5d", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "250efaa0-531e-4cc3-97f0-4d90c8e9264c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394000000, "tags": [ "NOMEN" ] }, { "uuid": "287a0ed5-28a3-251d-fefb-eaf015705c4e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7545-50-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d384ee04-464b-7c12-59d8-6c00a1eabe89", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "545f1be2-da77-4b12-893c-4c9e51a6fcaa", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c68ddb41-ba69-402d-86cc-703b8ac916b2", "id": "c68ddb41-ba69-402d-86cc-703b8ac916b2", "molfile": "\n Marvin 01132110162D \n\n 19 20 0 0 0 0 999 V2000\n 6.9350 8.9387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6462 8.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6462 7.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3530 7.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0599 7.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0599 8.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3530 8.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3530 9.7710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3530 6.4331 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1854 6.4331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3530 5.6008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5207 6.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1024 7.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2700 7.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8518 6.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0194 6.4331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2700 5.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8518 5.0194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1024 5.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 4 9 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 9 2 0 0 0 0\n 12 9 1 0 0 0 0\n 13 12 1 0 0 0 0\n 19 12 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 17 2 0 0 0 0\n 18 17 1 0 0 0 0\n 17 19 1 0 0 0 0\nM END", "smiles": "c1cc(c(cc1S(=O)(=O)c2ccc(c(c2)N)O)N)O", "formula": "C12H12N2O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d2799182-1bf8-4d9a-9edd-3135d7454193" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "280.3012", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "34c65a62-e174-4771-9a33-4d5f3c13f492", "version": "7", "structure": { "id": "e9ec3227-7919-45ae-8a37-6bfb8b74aaef", "molfile": "\n Marvin 01132112062D \n\n 19 20 0 0 0 0 999 V2000\n 8.3530 6.4331 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3530 7.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5207 6.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1024 5.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6462 7.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2700 5.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6462 8.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1854 6.4331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3530 5.6008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8518 6.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3530 8.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1024 7.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0599 7.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0599 8.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2700 7.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9350 8.9387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8518 5.0194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0194 6.4331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3530 9.7710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 2 2 0 0 0 0\n 6 4 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 1 2 0 0 0 0\n 9 1 2 0 0 0 0\n 10 15 1 0 0 0 0\n 11 14 1 0 0 0 0\n 12 3 1 0 0 0 0\n 13 2 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 12 2 0 0 0 0\n 16 7 1 0 0 0 0\n 17 6 1 0 0 0 0\n 18 10 1 0 0 0 0\n 19 11 1 0 0 0 0\n 10 6 2 0 0 0 0\n 11 7 2 0 0 0 0\nM END", "smiles": "c1cc(c(cc1S(=O)(=O)c2ccc(c(c2)N)O)N)O", "formula": "C12H12N2O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "280.3012", "optical_activity": "NONE", "references": [ "8a2a2ae9-a98a-4c06-8835-1c7a45f437dc" ], "stereo_centers": 0 }, "unii": "FWR6XZJ9EA" } ] }