{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c13005d2-c55e-4243-b784-ceb0237ca6fb",
          "code": "81486-22-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=81486-22-8",
          "code_system": "CAS",
          "references": [
            "55c86ccc-4458-4762-8162-362b5cd1ab57",
            "09fdfda8-2ab7-4896-aa53-2ba88834f0f8"
          ]
        },
        {
          "uuid": "3d412174-28ad-4bd6-83d8-90120a0e93d0",
          "code": "C76555",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76555",
          "code_system": "NCI_THESAURUS",
          "references": [
            "55c86ccc-4458-4762-8162-362b5cd1ab57"
          ]
        },
        {
          "uuid": "82bc1e62-9f01-4f32-a8fb-fc4887c242e7",
          "code": "C036089",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67036089",
          "code_system": "MESH",
          "references": [
            "55c86ccc-4458-4762-8162-362b5cd1ab57"
          ]
        },
        {
          "uuid": "afa577fa-6bdd-4912-a229-cdfc4fb1b92b",
          "code": "SUB12423MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "55c86ccc-4458-4762-8162-362b5cd1ab57"
          ]
        },
        {
          "uuid": "fbe63ae2-e972-4f11-9bfb-f5f9547b40a8",
          "code": "5348",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5348",
          "code_system": "INN",
          "references": [
            "55c86ccc-4458-4762-8162-362b5cd1ab57"
          ]
        },
        {
          "uuid": "bb219a1a-d9c2-4867-bbd7-3408de47a6bb",
          "code": "m7918",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7918?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "55c86ccc-4458-4762-8162-362b5cd1ab57"
          ]
        },
        {
          "uuid": "6f15c04d-9426-48eb-a9a2-41ab7e7953b8",
          "code": "CHEMBL155622",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL155622",
          "code_system": "ChEMBL",
          "references": [
            "55c86ccc-4458-4762-8162-362b5cd1ab57"
          ]
        },
        {
          "uuid": "991f7021-0504-4e45-ae4f-901318532770",
          "code": "72006",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72006",
          "code_system": "PUBCHEM",
          "references": [
            "55c86ccc-4458-4762-8162-362b5cd1ab57"
          ]
        },
        {
          "uuid": "f917da62-525e-0552-a653-f059b50c59f3",
          "code": "Nipradilol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Nipradilol",
          "code_system": "WIKIPEDIA",
          "references": [
            "25846ebf-f436-a943-cdda-90ec1ff514e2"
          ]
        },
        {
          "uuid": "0a85e362-1f39-bbb9-3510-f9fd8c4ae238",
          "code": "C29576",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Antagonist[C72900]|Beta-Adrenergic Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29576",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0a01236d-a96f-9e28-324b-b8821d066388"
          ]
        },
        {
          "uuid": "9d886676-74df-4deb-904a-305f54903022",
          "code": "FVM336I71Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "35042c36-3783-fa2f-20c1-476b507cfd7a",
          "code": "1940",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1940",
          "code_system": "DRUG CENTRAL",
          "references": [
            "0a01236d-a96f-9e28-324b-b8821d066388"
          ]
        },
        {
          "uuid": "95c7e3ea-6300-8f4e-cded-b9e24748a7f8",
          "code": "DTXSID30868615",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30868615",
          "code_system": "EPA CompTox",
          "references": [
            "0a01236d-a96f-9e28-324b-b8821d066388"
          ]
        },
        {
          "uuid": "3e32fd51-cce3-8843-3dc3-f2264d802284",
          "code": "100000078727",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7aed6ae7-7975-2c84-df34-955bb7541ecb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "50ec9a18-6766-42de-b1b8-e8782a823d41",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "24e60996-3f69-4a90-a84c-16363015eb15",
            "refuuid": "67ed9e54-480b-4393-81c2-ec483eb23fa9",
            "name": "NIPRADILOL",
            "unii": "FVM336I71Y",
            "linking_id": "FVM336I71Y",
            "ref_pname": "NIPRADILOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "85012223-651c-40c3-a707-aee843fb163c",
          "name": "8-(2-HYDROXY-3-(ISOPROPYLAMINO)PROPOXY)-3-CHROMANOL, 3-NITRATE",
          "stdName": "8-(2-HYDROXY-3-(ISOPROPYLAMINO)PROPOXY)-3-CHROMANOL, 3-NITRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "097be2dd-bdd3-44ac-ae83-55d174449e66"
          ],
          "display_name": false
        },
        {
          "uuid": "28c21425-2fbb-4d9c-bcd2-3e043d865e9b",
          "name": "HYPADIL",
          "stdName": "HYPADIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10cb7889-6f0f-480d-a232-1e7917b1ff9f",
            "fbe8d32c-5aeb-4aba-b993-0a806d36a174"
          ],
          "display_name": false
        },
        {
          "uuid": "c9975f27-579f-4ec9-ae9b-037c2ee68ce9",
          "name": "NIPRADILOL",
          "stdName": "NIPRADILOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fbe8d32c-5aeb-4aba-b993-0a806d36a174",
            "5f940b5b-4448-4f52-b155-e06770b7d41e",
            "4ee469d3-14dd-4f10-ad6d-65ed2fdbb744",
            "aab3de6f-ccf8-4758-972c-705e90eac43d",
            "8cb0bb30-7480-408a-b5e7-e4bfef23aa6c",
            "097be2dd-bdd3-44ac-ae83-55d174449e66",
            "6c9891c8-f512-4b17-a010-1bd8253ba2a8",
            "326395ee-8124-43ef-bc4a-518c7f6db6fe",
            "92c1eee1-b49f-4e72-9823-776db96f7851",
            "770d53c5-60c1-4734-bab4-e0074eaf0ec7",
            "9c6f41bb-1070-4aa8-b979-0a57fbeb6dbd"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e9d45d17-2a44-47d6-a71c-886cfd3aaeb4",
              "name_org": "INN"
            },
            {
              "uuid": "97780214-ebfc-4bb4-889d-6a2a3c7295fc",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f5d360aa-5564-46ab-8ea2-224b030aa3c7",
          "name": "NIPRADILOL [JAN]",
          "stdName": "NIPRADILOL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fbe8d32c-5aeb-4aba-b993-0a806d36a174"
          ],
          "display_name": false
        },
        {
          "uuid": "96b1ae3b-e1fe-483b-9c79-526907086e7e",
          "name": "NIPRADILOL [MART.]",
          "stdName": "NIPRADILOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aab3de6f-ccf8-4758-972c-705e90eac43d"
          ],
          "display_name": false
        },
        {
          "uuid": "94ab721d-b948-4c12-860e-7f857ecf5bcb",
          "name": "NIPRADILOL [MI]",
          "stdName": "NIPRADILOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92c1eee1-b49f-4e72-9823-776db96f7851"
          ],
          "display_name": false
        },
        {
          "uuid": "6015c523-2daa-449b-b189-c70d26176759",
          "name": "NIPRADOLOL",
          "stdName": "NIPRADOLOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72e6bc00-74be-4b0d-b443-7e05652e4fc1",
            "d10d033a-6b6f-41e5-9c69-9d66977f9fdd"
          ],
          "display_name": false
        },
        {
          "uuid": "35a25231-0e01-3ef8-a5e6-de11101b9376",
          "name": "Nipradolol [WHO-DD]",
          "stdName": "NIPRADOLOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8242092-f767-8252-8432-60c9b3780a1a"
          ],
          "display_name": false
        },
        {
          "uuid": "08f3c633-18f3-443b-a1ab-1e7b4b2f0c0a",
          "name": "nipradilol [INN]",
          "stdName": "NIPRADILOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "770d53c5-60c1-4734-bab4-e0074eaf0ec7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "097be2dd-bdd3-44ac-ae83-55d174449e66",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "770d53c5-60c1-4734-bab4-e0074eaf0ec7",
          "citation": "INN Proposed List 50",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL50.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fbe8d32c-5aeb-4aba-b993-0a806d36a174",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aab3de6f-ccf8-4758-972c-705e90eac43d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92c1eee1-b49f-4e72-9823-776db96f7851",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10cb7889-6f0f-480d-a232-1e7917b1ff9f",
          "citation": "D01691",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c6f41bb-1070-4aa8-b979-0a57fbeb6dbd",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72e6bc00-74be-4b0d-b443-7e05652e4fc1",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55c86ccc-4458-4762-8162-362b5cd1ab57",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390688000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85274f5b-e0df-408a-b548-3fc0b6cdf5c1",
          "citation": "SRS import [FVM336I71Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FVM336I71Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390688000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c9891c8-f512-4b17-a010-1bd8253ba2a8",
          "citation": "NIPRADILOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8cb0bb30-7480-408a-b5e7-e4bfef23aa6c",
          "citation": "NIPRADILOL [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4ee469d3-14dd-4f10-ad6d-65ed2fdbb744",
          "citation": "NIPRADILOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "326395ee-8124-43ef-bc4a-518c7f6db6fe",
          "citation": "NIPRADILOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5f940b5b-4448-4f52-b155-e06770b7d41e",
          "citation": "NIPRADILOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d10d033a-6b6f-41e5-9c69-9d66977f9fdd",
          "citation": "NIPRADOLOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "25846ebf-f436-a943-cdda-90ec1ff514e2",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Nipradilol",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0a01236d-a96f-9e28-324b-b8821d066388",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "09fdfda8-2ab7-4896-aa53-2ba88834f0f8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d8242092-f767-8252-8432-60c9b3780a1a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7aed6ae7-7975-2c84-df34-955bb7541ecb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "58e53c97-e771-40a5-b290-7ae4fa61a06d",
          "id": "58e53c97-e771-40a5-b290-7ae4fa61a06d",
          "molfile": "\n  Marvin  01132104372D          \n\n 23 24  0  0  0  0            999 V2000\n   -0.4573    2.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4583    1.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1733    0.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2542    0.8166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9667    1.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6792    0.8166    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.6833   -0.0084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3917    1.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1042    0.8166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1104   -0.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3986   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3974   -1.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1122   -1.6652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8246   -1.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5376   -1.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2563   -1.2519    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.2574   -0.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5399   -0.0058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8258   -0.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9667   -1.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6792   -1.2459    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.3959   -1.6544    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.6746   -0.4209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 19 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 20  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  CHG  2  21   1  22  -1\nM  END",
          "smiles": "CC(C)NCC(COc1cccc2CC(COc21)O[N+](=O)[O-])O",
          "formula": "C15H22N2O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "58c89f60-4877-48c9-a393-7f85177f4f85"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "326.3456",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "67ed9e54-480b-4393-81c2-ec483eb23fa9",
      "version": "13",
      "structure": {
        "id": "7d759d7d-708c-4da2-8086-24afc7f7742e",
        "molfile": "\n  Marvin  01132106312D          \n\n 23 24  0  0  0  0            999 V2000\n    3.1042    0.8166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3917    1.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6792    0.8166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9667    1.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2542    0.8166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4583    1.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6833   -0.0084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4573    2.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1733    0.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3986   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3974   -1.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1122   -1.6652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1104   -0.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8258   -0.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8246   -1.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5376   -1.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2563   -1.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2574   -0.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5399   -0.0058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9667   -1.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6792   -1.2459    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.3959   -1.6544    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.6746   -0.4209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 12 15  2  0  0  0  0\n  1  2  1  0  0  0  0\n 14 13  2  0  0  0  0\n 13 10  1  0  0  0  0\n 14 15  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n  2  3  1  0  0  0  0\n 17 20  1  0  0  0  0\n 10 11  2  0  0  0  0\n 20 21  1  0  0  0  0\n  5  6  1  0  0  0  0\n 21 22  1  0  0  0  0\n 11 12  1  0  0  0  0\n 21 23  2  0  0  0  0\n 13  1  1  0  0  0  0\nM  CHG  2  21   1  22  -1\nM  END",
        "smiles": "CC(C)NCC(COc1cccc2CC(COc21)O[N+](=O)[O-])O",
        "formula": "C15H22N2O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "UNKNOWN",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "326.3456",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "097be2dd-bdd3-44ac-ae83-55d174449e66",
          "85274f5b-e0df-408a-b548-3fc0b6cdf5c1",
          "770d53c5-60c1-4734-bab4-e0074eaf0ec7"
        ],
        "stereo_centers": 2
      },
      "unii": "FVM336I71Y"
    }
  ]
}