{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9a4183ff-cb60-4c9d-a11d-1b557fe4de34",
          "code": "94313-91-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94313-91-4",
          "code_system": "CAS",
          "references": [
            "3cfc9a5d-80bb-4728-8a1e-b39b819badc3",
            "a8cac0d5-5ec5-4329-a83d-80e9e4a12ec0"
          ]
        },
        {
          "uuid": "129ded02-8d6b-4c05-94d1-fe1921d9555f",
          "code": "304-990-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.095.403",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3cfc9a5d-80bb-4728-8a1e-b39b819badc3"
          ]
        },
        {
          "uuid": "b56e08bc-e629-4bfc-ab64-bcfd919f9a50",
          "code": "3038532",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3038532",
          "code_system": "PUBCHEM",
          "references": [
            "3cfc9a5d-80bb-4728-8a1e-b39b819badc3"
          ]
        },
        {
          "uuid": "366f23a7-d087-2e83-bd1d-bef01d0c269c",
          "code": "DTXSID80241419",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80241419",
          "code_system": "EPA CompTox",
          "references": [
            "87b6370f-ad9f-a4f5-aa92-20fbda9a6cf6"
          ]
        },
        {
          "uuid": "5bee9226-f37e-4192-b33a-c11763f37f10",
          "code": "FV35JZ4A8M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "37390a60-2db8-4305-b0d8-776cacd0d8e6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cfc9a5d-80bb-4728-8a1e-b39b819badc3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87b6370f-ad9f-a4f5-aa92-20fbda9a6cf6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=94313-91-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a8cac0d5-5ec5-4329-a83d-80e9e4a12ec0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "46689ead-8d46-4050-8cc9-b05d0887f2f6",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d348db95-0386-45ba-a160-ad6f3cb36276",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "80650e61-c885-4ac3-84e1-67f467723118",
          "id": "80650e61-c885-4ac3-84e1-67f467723118",
          "molfile": "\n  Marvin  01132106402D          \n\n  6  5  0  0  0  0            999 V2000\n    8.0178    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8143   -0.2152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0294   -1.0224    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2447   -1.8188    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.8258   -0.8072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2331   -1.2377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "COS(=O)(=O)[O-]",
          "formula": "CH3O4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "592ee436-7577-4112-bd07-a710e0dc1cee"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "111.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "7f659103-b107-49e3-af4d-9c1b11cb3f46",
          "id": "7f659103-b107-49e3-af4d-9c1b11cb3f46",
          "molfile": "\n  Marvin  01132106372D          \n\n 20 19  0  0  0  0            999 V2000\n    9.5858   -1.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9929   -2.0243    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   10.7104   -1.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4105   -2.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2859   -2.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5684   -2.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8508   -2.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1439   -2.0243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4263   -2.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7086   -2.0243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4263   -3.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7086   -3.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0018   -3.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2841   -3.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5666   -3.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8597   -3.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1421   -3.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4352   -3.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7176   -3.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\nM  CHG  1   2   1\nM  END",
          "smiles": "C=CCCCCCCCCC(=O)NCCC[N+](C)(C)C",
          "formula": "C17H35N2O",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5f34c676-a9c1-4538-94d5-b8f31233daf8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "283.4732",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0f2bad60-2d56-4e9a-96b4-97e69ca9f20a",
      "version": "10",
      "structure": {
        "id": "5db17a27-27f4-4fe5-a63e-c0825009b29b",
        "molfile": "1-Propanaminium, N,N,N-trimethyl-3-[(1-oxo-10-undecen-1-yl)amino]-, methyl su...\n   JSDraw204022410582D\n\n 26 24  0  0  0  0              0 V2000\n   21.1149   -5.0705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7639   -5.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4659   -5.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4130   -5.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8170   -5.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4659   -7.4106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0618   -5.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1681   -5.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7109   -5.0705    0.0000 N   0  3  0  0  0  0  4  0  0  0  0  0\n   26.5190   -5.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3599   -4.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9309   -6.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4909   -3.7195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8702   -5.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2211   -5.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5721   -5.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.9231   -5.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.2742   -5.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   34.6252   -5.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   35.9761   -5.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4925  -10.3215    0.0000 S   0  0  0  0  0  0  6  0  0  0  0  0\n   25.8435  -11.1015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1416   -9.5415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2725   -8.9706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7125  -11.6725    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   27.1945  -10.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  4  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 21 24  2  0  0  0  0\n 21 25  1  0  0  0  0\n 22 26  1  0  0  0  0\nM  CHG  2   9   1  25  -1\nM  END",
        "smiles": "C=CCCCCCCCCC(=O)NCCC[N+](C)(C)C.COS(=O)(=O)[O-]",
        "formula": "C17H35N2O.CH3O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "394.5715",
        "optical_activity": "NONE",
        "references": [
          "37390a60-2db8-4305-b0d8-776cacd0d8e6",
          "a8cac0d5-5ec5-4329-a83d-80e9e4a12ec0"
        ],
        "stereo_centers": 0
      },
      "unii": "FV35JZ4A8M",
      "relationships": [
        {
          "uuid": "d23b33ce-d2b2-4e0c-87c7-9413d50bf612",
          "amount": {
            "uuid": "83dde405-eb1e-408e-933c-7f0f23e45c7b"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "d348db95-0386-45ba-a160-ad6f3cb36276"
          ],
          "related_substance": {
            "uuid": "2ec0efb0-955c-401f-b2bb-fbe048c0e275",
            "refuuid": "fa02a21f-36fc-48f6-a4ee-691037e23af0",
            "name": "OPRATONIUM",
            "unii": "L15GYZ71P1",
            "linking_id": "L15GYZ71P1",
            "ref_pname": "OPRATONIUM",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "f6cd9a8c-2444-4f34-a29b-d506e91cf035",
          "name": "1-Propanaminium, N,N,N-trimethyl-3-[(1-oxo-10-undecen-1-yl)amino]-, methyl sulfate (1:1)",
          "stdName": "1-PROPANAMINIUM, N,N,N-TRIMETHYL-3-((1-OXO-10-UNDECEN-1-YL)AMINO)-, METHYL SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8cac0d5-5ec5-4329-a83d-80e9e4a12ec0"
          ],
          "display_name": false
        },
        {
          "uuid": "f603f346-85dc-4b09-9cec-791764d7f06a",
          "name": "1-Propanaminium, N,N,N-trimethyl-3-[(1-oxo-10-undecenyl)amino]-, methyl sulfate",
          "stdName": "1-PROPANAMINIUM, N,N,N-TRIMETHYL-3-((1-OXO-10-UNDECENYL)AMINO)-, METHYL SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37390a60-2db8-4305-b0d8-776cacd0d8e6",
            "a8cac0d5-5ec5-4329-a83d-80e9e4a12ec0"
          ],
          "display_name": false
        },
        {
          "uuid": "472b0289-d78b-4092-930e-f8e810ff07ef",
          "name": "Noramium MU 50",
          "stdName": "NORAMIUM MU 50",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8cac0d5-5ec5-4329-a83d-80e9e4a12ec0"
          ],
          "display_name": false
        },
        {
          "uuid": "18339680-e9da-4aa8-93ca-4fe28c4ede48",
          "name": "OPRATONIUM METHOSULFATE",
          "stdName": "OPRATONIUM METHOSULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8cac0d5-5ec5-4329-a83d-80e9e4a12ec0"
          ],
          "display_name": true
        },
        {
          "uuid": "00ddd1a7-43ef-4419-ae4c-9d522fb290e1",
          "name": "Rewocid UTM 185",
          "stdName": "REWOCID UTM 185",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8cac0d5-5ec5-4329-a83d-80e9e4a12ec0"
          ],
          "display_name": false
        },
        {
          "uuid": "7dece4c7-e6f6-4f0a-81dc-ae09a105ef92",
          "name": "Undecylenamidopropyltrimonium Methosulfate",
          "stdName": "UNDECYLENAMIDOPROPYLTRIMONIUM METHOSULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "46689ead-8d46-4050-8cc9-b05d0887f2f6"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c4c6c4b5-1e62-4603-845a-c8d9b136460a",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "modifications": {
        "uuid": "26f61bb7-0089-4283-afe2-1c623a968501"
      }
    }
  ]
}