{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0ca687ee-eb0b-4468-8025-323d3dd7268c",
          "code": "850032-68-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=850032-68-7",
          "code_system": "CAS",
          "references": [
            "db20d507-e6a4-43b4-8001-c14aeef271a4",
            "39979a1f-99de-4cda-add4-07b7f4e37e5e"
          ]
        },
        {
          "uuid": "afd59b2d-ca2d-4792-ab41-bc3bb90475f5",
          "code": "ETHYLPROPYLTRYPTAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ethylpropyltryptamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "db20d507-e6a4-43b4-8001-c14aeef271a4"
          ]
        },
        {
          "uuid": "847585a7-72ba-2461-4ac4-728928916e90",
          "code": "DTXSID101336291",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID101336291",
          "code_system": "EPA CompTox",
          "references": [
            "7d8d05a3-5910-9842-1b20-fe2fd734db66"
          ]
        },
        {
          "uuid": "9ea5ebf5-c18f-435c-80be-56b856682ed4",
          "code": "FRE36KL4BD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9a393a6d-af39-224a-11b8-22f6c8720199",
          "code": "74405184",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/74405184",
          "code_system": "PUBCHEM",
          "references": [
            "b5711361-cd0d-b9b9-b1a7-914d7a89b557"
          ]
        },
        {
          "uuid": "54e47acb-76ef-b744-5710-989986c2062f",
          "code": "Designer-drugs-Ethylpropyltryptamine",
          "comments": "Wikipedia|List of designer drugs|Psychedelics|Tryptamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "5f299e1e-cf73-40e9-7a8a-3c52c2a86f79"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "17841c3b-7af9-437f-ab7e-4a3183a9dd29",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "bedfdc68-103a-49d5-9dfc-4c10da1f714c",
            "refuuid": "0413ac11-217d-41e3-88a5-66ee9109a4d2",
            "name": "ETHYLPROPYLTRYPTAMINE",
            "unii": "FRE36KL4BD",
            "linking_id": "FRE36KL4BD",
            "ref_pname": "ETHYLPROPYLTRYPTAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d143f75d-496b-45ec-bb2e-b178bec94250",
          "name": "1H-INDOLE-3-ETHANAMINE, N-ETHYL-N-PROPYL-",
          "stdName": "1H-INDOLE-3-ETHANAMINE, N-ETHYL-N-PROPYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a1e4e88-0979-43c7-acfe-a62fd1820a1d"
          ],
          "display_name": false
        },
        {
          "uuid": "361e566e-ce6c-4022-a7a9-b42ca67f2388",
          "name": "EPT",
          "stdName": "EPT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b95f9c4-247a-43b2-81dd-5c1248c79fe1"
          ],
          "display_name": false
        },
        {
          "uuid": "913b14c4-92ca-4208-9366-8b6ee72fc43e",
          "name": "ETHYLPROPYLTRYPTAMINE",
          "stdName": "ETHYLPROPYLTRYPTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fffe7805-478b-40b1-9c8c-69b1d8bbcbf9"
          ],
          "display_name": true
        },
        {
          "uuid": "733920f7-d383-445f-92d5-e0bea0076457",
          "name": "N-ETHYL-N-(2-(1H-INDOL-3-YL)ETHYL)PROPAN-1-AMINE",
          "stdName": "N-ETHYL-N-(2-(1H-INDOL-3-YL)ETHYL)PROPAN-1-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3d36f93-0181-4daa-92ad-66c183463f81"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fffe7805-478b-40b1-9c8c-69b1d8bbcbf9",
          "citation": "Said IOUGHLISSEN-French ANSM; 2/17/2016 E-Mail List",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b95f9c4-247a-43b2-81dd-5c1248c79fe1",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3d36f93-0181-4daa-92ad-66c183463f81",
          "citation": "https://isomerdesign.com/PiHKAL/explore.php?domain=tk&id=5075",
          "url": "https://isomerdesign.com/PiHKAL/explore.php?domain=tk&id=5075",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a1e4e88-0979-43c7-acfe-a62fd1820a1d",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db20d507-e6a4-43b4-8001-c14aeef271a4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391620000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39979a1f-99de-4cda-add4-07b7f4e37e5e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b5711361-cd0d-b9b9-b1a7-914d7a89b557",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5f299e1e-cf73-40e9-7a8a-3c52c2a86f79",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7d8d05a3-5910-9842-1b20-fe2fd734db66",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4238b3ab-cd10-4bb8-ad9c-170cd6f8717e",
          "id": "4238b3ab-cd10-4bb8-ad9c-170cd6f8717e",
          "molfile": "\n  Marvin  01132103302D          \n\n 17 18  0  0  0  0            999 V2000\n    8.7992   -2.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2159   -3.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4190   -2.9416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8357   -3.5250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0388   -3.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8253   -2.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0491   -4.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6367   -5.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8502   -5.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6043   -6.1731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5140   -6.9953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7042   -7.1635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2896   -7.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4646   -7.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0543   -7.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4690   -6.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2939   -6.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 17  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 17  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCCN(CC)CCc1c[nH]c2ccccc12",
          "formula": "C15H22N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0c600f5c-beda-452c-9740-a99a71d85546"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "230.3491",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0413ac11-217d-41e3-88a5-66ee9109a4d2",
      "version": "7",
      "structure": {
        "id": "14ad05dd-369f-4ce2-8eb9-de585b7bf893",
        "molfile": "\n  Marvin  01132101162D          \n\n 17 18  0  0  0  0            999 V2000\n    5.4690   -6.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0543   -7.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4646   -7.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2896   -7.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7042   -7.1635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2939   -6.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5140   -6.9953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8502   -5.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6043   -6.1731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6367   -5.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0491   -4.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8357   -3.5250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0388   -3.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8253   -2.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4190   -2.9416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2159   -3.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7992   -2.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9  7  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
        "smiles": "CCCN(CC)CCc1c[nH]c2ccccc12",
        "formula": "C15H22N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "230.3491",
        "optical_activity": "NONE",
        "references": [
          "fffe7805-478b-40b1-9c8c-69b1d8bbcbf9",
          "e3d36f93-0181-4daa-92ad-66c183463f81"
        ],
        "stereo_centers": 0
      },
      "unii": "FRE36KL4BD"
    }
  ]
}