{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "87204be7-562e-4a76-a0c2-10f306232da3", "code": "31274-51-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=31274-51-8", "code_system": "CAS", "references": [ "b50d1d93-1a71-4ff5-8893-525d24aec771", "a6748dbf-1a58-4a4f-ab2f-a721dc3f327c" ] }, { "uuid": "e38a73ed-90e0-4f68-b7cb-b5088b4ee550", "code": "11628027", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11628027", "code_system": "PUBCHEM", "references": [ "b50d1d93-1a71-4ff5-8893-525d24aec771" ] }, { "uuid": "2adea2f8-a1f8-6245-9205-e1297286ae1c", "code": "DTXSID30185197", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30185197", "code_system": "EPA CompTox", "references": [ "61ccd47f-d355-ddcd-73d0-e18e340a46f2" ] }, { "uuid": "0cb918e2-3d3b-4578-bef9-bd7464c86442", "code": "FQK9A410YB", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "490b746a-55ca-4fbb-b701-8df4f5654e76", "name": "1,3,5-TRIAZINE, 2,4,6-TRIS((1,1'-BIPHENYL)-4-YL)-", "stdName": "1,3,5-TRIAZINE, 2,4,6-TRIS((1,1'-BIPHENYL)-4-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "524d4a48-7160-4ff5-b365-c88f7d96fd4b", "aeda5265-22bf-4040-bebb-e03accec14d0" ], "display_name": false }, { "uuid": "84dcd473-74e5-4a3d-9493-17ffcc31a662", "name": "2,4,6-TRIS(P-BIPHENYLYL)-S-TRIAZINE", "stdName": "2,4,6-TRIS(P-BIPHENYLYL)-S-TRIAZINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "524d4a48-7160-4ff5-b365-c88f7d96fd4b", "aeda5265-22bf-4040-bebb-e03accec14d0" ], "display_name": false }, { "uuid": "6e78d413-acfb-4c40-ba67-1ff9f6aaa1f8", "name": "S-TRIAZINE, 2,4,6-TRI-4-BIPHENYLYL-", "stdName": "S-TRIAZINE, 2,4,6-TRI-4-BIPHENYLYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "524d4a48-7160-4ff5-b365-c88f7d96fd4b", "aeda5265-22bf-4040-bebb-e03accec14d0" ], "display_name": false }, { "uuid": "8e31ca6b-f772-4ec0-bc86-5505eef37cfb", "name": "TINOSORB A2B", "stdName": "TINOSORB A2B", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "524d4a48-7160-4ff5-b365-c88f7d96fd4b", "4d27b2ad-8d8d-4ff1-8266-6a8d00c9fdc0" ], "display_name": false }, { "uuid": "d2c469a7-16f3-4faa-a1e9-1f49d629ef39", "name": "TRIS-BIPHENYL TRIAZINE", "stdName": "TRIS-BIPHENYL TRIAZINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "524d4a48-7160-4ff5-b365-c88f7d96fd4b", "4d27b2ad-8d8d-4ff1-8266-6a8d00c9fdc0", "5532856e-97dc-4059-ae29-85a5bd701232" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "3e9bd7cd-34ef-421a-a357-ba6523ed6257", "name_org": "INCI" } ] } ], "references": [ { "uuid": "4d27b2ad-8d8d-4ff1-8266-6a8d00c9fdc0", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "524d4a48-7160-4ff5-b365-c88f7d96fd4b", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aeda5265-22bf-4040-bebb-e03accec14d0", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b50d1d93-1a71-4ff5-8893-525d24aec771", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391634000, "tags": [ "NOMEN" ] }, { "uuid": "1a9d84e0-a7eb-4156-87af-7be6d86ac9a1", "citation": "SRS import [FQK9A410YB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FQK9A410YB", "doc_type": "SRS", "public_domain": true, "document_date": 1493391634000, "tags": [ "NOMEN" ] }, { "uuid": "5532856e-97dc-4059-ae29-85a5bd701232", "citation": "TRIS-BIPHENYL TRIAZINE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "61ccd47f-d355-ddcd-73d0-e18e340a46f2", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31274-51-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a6748dbf-1a58-4a4f-ab2f-a721dc3f327c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "10b02ded-e546-4157-a716-7032c1135e45", "id": "10b02ded-e546-4157-a716-7032c1135e45", "molfile": "\n Marvin 01132101052D \n\n 42 48 0 0 0 0 999 V2000\n 15.0337 -1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3187 -0.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6037 -1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6037 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3187 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0337 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8887 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8887 -3.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1737 -3.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4587 -3.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4587 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1737 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -3.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -3.0837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -3.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -4.3212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -4.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -4.3212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -5.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -5.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -7.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -5.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -8.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -8.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -9.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -9.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -9.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -8.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6262 -3.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6262 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9112 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1962 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1962 -3.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9112 -3.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4812 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7662 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0512 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0512 -1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7662 -0.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4812 -1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 1 6 2 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 7 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 12 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 13 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 18 13 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 15 31 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 17 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 19 24 2 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 25 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 30 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 31 36 2 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 34 35 2 0 0 0 0\n 34 37 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 42 2 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2ccc(cc2)-c3nc(-c4ccc(cc4)-c5ccccc5)nc(-c6ccc(cc6)-c7ccccc7)n3", "formula": "C39H27N3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8b1d6483-7b8f-4f4c-bbb8-69b8bee189b6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "537.6532", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "7979d9e9-f791-49b9-b697-7da01c4dd452", "version": "4", "structure": { "id": "5a26a2fd-4210-4543-80d3-00653ce5278a", "molfile": "\n Marvin 01132104402D \n\n 42 48 0 0 0 0 999 V2000\n 10.7437 -4.3212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -4.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -4.3212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -3.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -3.0837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -3.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4587 -3.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1737 -3.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8887 -3.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8887 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1737 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4587 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6037 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6037 -1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3187 -0.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0337 -1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0337 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3187 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6262 -3.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6262 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9112 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1962 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1962 -3.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9112 -3.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4812 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7662 -2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0512 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0512 -1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7662 -0.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4812 -1.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -5.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -5.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -7.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -5.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -8.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -8.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7437 -9.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0562 -9.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -9.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3412 -8.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 7 12 2 0 0 0 0\n 12 11 1 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 13 18 2 0 0 0 0\n 4 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 19 24 2 0 0 0 0\n 24 23 1 0 0 0 0\n 22 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 25 30 2 0 0 0 0\n 2 31 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 34 35 2 0 0 0 0\n 31 36 2 0 0 0 0\n 36 35 1 0 0 0 0\n 34 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 37 42 2 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2ccc(cc2)-c3nc(-c4ccc(cc4)-c5ccccc5)nc(-c6ccc(cc6)-c7ccccc7)n3", "formula": "C39H27N3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "537.6532", "optical_activity": "NONE", "references": [ "4d27b2ad-8d8d-4ff1-8266-6a8d00c9fdc0", "1a9d84e0-a7eb-4156-87af-7be6d86ac9a1" ], "stereo_centers": 0 }, "unii": "FQK9A410YB" } ] }