{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "82c249f3-d949-4fe4-a823-4d94bd84ee6b",
          "code": "79-94-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79-94-7",
          "code_system": "CAS",
          "references": [
            "8ddaf762-632e-406e-ad1b-7df612e177b7",
            "ac743297-82fa-4070-9999-536ab2b3b5e2"
          ]
        },
        {
          "uuid": "b1dda3af-482f-4305-8726-5380b4bb2a7c",
          "code": "C020806",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67020806",
          "code_system": "MESH",
          "references": [
            "8ddaf762-632e-406e-ad1b-7df612e177b7"
          ]
        },
        {
          "uuid": "229bbe28-d4d8-46eb-ac01-22ab1f5f0405",
          "code": "TETRABROMOBISPHENOL A",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tetrabromobisphenol_A",
          "code_system": "WIKIPEDIA",
          "references": [
            "8ddaf762-632e-406e-ad1b-7df612e177b7"
          ]
        },
        {
          "uuid": "89e4aff6-a6b6-4c94-a878-7682e4f12f60",
          "code": "201-236-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.125",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8ddaf762-632e-406e-ad1b-7df612e177b7"
          ]
        },
        {
          "uuid": "ca6dd7a4-0c7c-46fd-a691-1519bbb0be9f",
          "code": "m10598",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10598?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8ddaf762-632e-406e-ad1b-7df612e177b7"
          ]
        },
        {
          "uuid": "03f5cbbb-6b42-44cc-8a18-0ad7c540989d",
          "code": "6618",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6618",
          "code_system": "PUBCHEM",
          "references": [
            "8ddaf762-632e-406e-ad1b-7df612e177b7"
          ]
        },
        {
          "uuid": "3aaebc80-c2fd-c14a-e396-48fd2479f65d",
          "code": "5232",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5232",
          "code_system": "HSDB",
          "references": [
            "fca4a94f-e8bb-7c5b-31b2-44c64433e26c"
          ]
        },
        {
          "uuid": "3e96abae-2936-3b79-03cb-63c018c9b6f7",
          "code": "DTXSID1026081",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1026081",
          "code_system": "EPA CompTox",
          "references": [
            "b07a9332-420d-9a13-2276-59ca370850e9"
          ]
        },
        {
          "uuid": "78679caa-afc7-4a38-a7c4-69ae7354519a",
          "code": "FQI02RFC3A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "04423d9e-baf8-1772-f5d2-cf998f02d3f9",
          "code": "33217",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33217",
          "code_system": "CHEBI",
          "references": [
            "231531ba-f5a4-34c4-2bea-f249eb97b088"
          ]
        },
        {
          "uuid": "a9514046-5447-4930-c7c5-326ae4d3a690",
          "code": "59775",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=59775",
          "code_system": "NSC",
          "references": [
            "4a9a03d1-3d6c-f8ce-18e2-c8b54831f8f1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4fe18a9e-3e86-4f09-8ec7-4b8bf55b7084",
          "name": "2,2',6,6'-TETRABROMOBISPHENOL A [HSDB]",
          "stdName": "2,2',6,6'-TETRABROMOBISPHENOL A [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecbf0fc0-3fa7-4c06-8eb8-06bc03465c37",
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f"
          ],
          "display_name": false
        },
        {
          "uuid": "5a1eba75-5503-4582-8fd0-439c6b07eed9",
          "name": "2,2-BIS(3,5-DIBROMO-4-HYDROXYPHENYL)PROPANE",
          "stdName": "2,2-BIS(3,5-DIBROMO-4-HYDROXYPHENYL)PROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1371dbc3-1742-4bc0-9036-35e08126775e",
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f"
          ],
          "display_name": false
        },
        {
          "uuid": "fd464c3c-02cc-4d6a-ba85-b9a73dece846",
          "name": "3,3',5,5'-TETRABROMOBISPHENOL A",
          "stdName": "3,3',5,5'-TETRABROMOBISPHENOL A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b57f4061-2951-478e-8a95-204c95da41fa",
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f"
          ],
          "display_name": false
        },
        {
          "uuid": "389e9730-f698-49bb-bbee-95e3af4afa3b",
          "name": "4,4'-(1-METHYLETHYLIDENE)BIS(2,6-DIBROMOPHENOL)",
          "stdName": "4,4'-(1-METHYLETHYLIDENE)BIS(2,6-DIBROMOPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1371dbc3-1742-4bc0-9036-35e08126775e",
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f"
          ],
          "display_name": false
        },
        {
          "uuid": "c8d11cdf-1c62-46b8-a3bf-8e3c834bef7b",
          "name": "4,4'-ISOPROPYLIDENEBIS(2,6-DIBROMOPHENOL)",
          "stdName": "4,4'-ISOPROPYLIDENEBIS(2,6-DIBROMOPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19bef839-74e5-4da6-bcd7-94df0f334b27",
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f"
          ],
          "display_name": false
        },
        {
          "uuid": "9de3817d-8f7f-4020-9834-39b070880fe3",
          "name": "CP-2000",
          "stdName": "CP-2000",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1371dbc3-1742-4bc0-9036-35e08126775e",
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f"
          ],
          "display_name": false
        },
        {
          "uuid": "37ed0ec5-4bce-4c9f-b354-6be4ed473b9c",
          "name": "NSC-59775",
          "stdName": "NSC-59775",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbc5f940-c9a6-4444-9005-390ae3ae35e8",
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f"
          ],
          "display_name": false
        },
        {
          "uuid": "1ac9823d-9e0e-4e57-9f2a-c0a3c409fb59",
          "name": "TBBPA",
          "stdName": "TBBPA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1371dbc3-1742-4bc0-9036-35e08126775e",
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f"
          ],
          "display_name": false
        },
        {
          "uuid": "583ba129-9c18-45c3-989a-852d0d1e78d5",
          "name": "TETRABROMOBISPHENOL A",
          "stdName": "TETRABROMOBISPHENOL A",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1371dbc3-1742-4bc0-9036-35e08126775e",
            "1fe91bcb-84a3-42fc-8ce4-1cda7ca57fde",
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f",
            "aa02fff1-da11-4e28-85ed-4e62af225efe"
          ],
          "display_name": true
        },
        {
          "uuid": "8b81642b-851e-7e10-7eed-bee0cdf5cecf",
          "name": "TETRABROMOBISPHENOL A [IARC]",
          "stdName": "TETRABROMOBISPHENOL A [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62fff8fc-8045-5666-0f43-d226da6ee0cc"
          ],
          "display_name": false
        },
        {
          "uuid": "c177ad60-b63d-449c-b933-a41d7eaa89aa",
          "name": "TETRABROMOBISPHENOL A [MI]",
          "stdName": "TETRABROMOBISPHENOL A [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ba5b3a5-7bcc-4842-b733-0bd3630f829f",
            "aa02fff1-da11-4e28-85ed-4e62af225efe"
          ],
          "display_name": false
        },
        {
          "uuid": "043255db-48e2-4e3e-8845-42ad36d62541",
          "name": "TETRABROMOBISPHENOL A, 3,3',5,5'-",
          "stdName": "TETRABROMOBISPHENOL A, 3,3',5,5'-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6947a90f-de95-4957-b500-90758fb51f60"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6947a90f-de95-4957-b500-90758fb51f60",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "aa02fff1-da11-4e28-85ed-4e62af225efe",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ba5b3a5-7bcc-4842-b733-0bd3630f829f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1371dbc3-1742-4bc0-9036-35e08126775e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecbf0fc0-3fa7-4c06-8eb8-06bc03465c37",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19bef839-74e5-4da6-bcd7-94df0f334b27",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b57f4061-2951-478e-8a95-204c95da41fa",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbc5f940-c9a6-4444-9005-390ae3ae35e8",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ddaf762-632e-406e-ad1b-7df612e177b7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0feec78f-4a07-482d-a512-df4840ce1eaf",
          "citation": "SRS import [FQI02RFC3A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FQI02RFC3A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbfb1cf9-aa4a-4d04-b971-00191b101e82",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fe91bcb-84a3-42fc-8ce4-1cda7ca57fde",
          "citation": "TETRABROMOBISPHENOL A [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fca4a94f-e8bb-7c5b-31b2-44c64433e26c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+79-94-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b07a9332-420d-9a13-2276-59ca370850e9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79-94-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62fff8fc-8045-5666-0f43-d226da6ee0cc",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "231531ba-f5a4-34c4-2bea-f249eb97b088",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ac743297-82fa-4070-9999-536ab2b3b5e2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4a9a03d1-3d6c-f8ce-18e2-c8b54831f8f1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "db9878b6-7536-41d9-950a-9b2daacadede",
          "id": "db9878b6-7536-41d9-950a-9b2daacadede",
          "molfile": "\n  Marvin  01132111232D          \n\n 21 22  0  0  0  0            999 V2000\n    7.0773   -4.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0773   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0773   -6.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2468   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8341   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0139   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5782   -3.7656    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5963   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7811   -5.2036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0139   -5.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5908   -6.6334    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.8341   -5.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9001   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3128   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1329   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5640   -3.7656    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5456   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3636   -5.2036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1329   -5.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5560   -6.6334    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3128   -5.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2 13  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 12  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 21  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(c1cc(c(c(c1)Br)O)Br)c2cc(c(c(c2)Br)O)Br",
          "formula": "C15H12Br4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4cd32abd-5c2d-42c2-8f77-969269eff636"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "543.8692",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4c5b8d8f-b441-4028-8fbb-cebe26610f8a",
      "version": "8",
      "structure": {
        "id": "634b7825-83b5-40c7-95cb-bbeb2e94cf79",
        "molfile": "\n  Marvin  01132105092D          \n\n 21 22  0  0  0  0            999 V2000\n    7.0773   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2468   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8341   -5.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0139   -5.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5963   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7811   -5.2036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0139   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8341   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5782   -3.7656    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5908   -6.6334    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9001   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3128   -5.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1329   -5.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5456   -5.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3636   -5.2036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1329   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3128   -4.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5640   -3.7656    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5560   -6.6334    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.0773   -4.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0773   -6.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  2  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  2  0  0  0  0\n 11 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 13 19  1  0  0  0  0\n  1 20  1  0  0  0  0\n  1 21  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(c1cc(c(c(c1)Br)O)Br)c2cc(c(c(c2)Br)O)Br",
        "formula": "C15H12Br4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "543.8692",
        "optical_activity": "NONE",
        "references": [
          "bbfb1cf9-aa4a-4d04-b971-00191b101e82",
          "0feec78f-4a07-482d-a512-df4840ce1eaf"
        ],
        "stereo_centers": 0
      },
      "unii": "FQI02RFC3A"
    }
  ]
}