{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ee051a19-b343-48fd-835d-3a8c678ce357",
          "code": "11415328",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11415328",
          "code_system": "PUBCHEM",
          "references": [
            "dd832f4c-3ed4-465f-85e1-61e5755be065"
          ]
        },
        {
          "uuid": "f476e6b9-2613-4605-812f-412545c13e84",
          "code": "109403-64-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=109403-64-7",
          "code_system": "CAS",
          "references": [
            "dd832f4c-3ed4-465f-85e1-61e5755be065",
            "e0ab56cc-98e9-4f0b-a0da-5cf8700d1a94"
          ]
        },
        {
          "uuid": "2c016036-f330-31c1-c67f-3cf44996dde8",
          "code": "DTXSID30911155",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30911155",
          "code_system": "EPA CompTox",
          "references": [
            "4270d4be-b7e0-a210-f592-9b09a79d4749"
          ]
        },
        {
          "uuid": "dc01c17b-1178-4fb8-a890-9b790d942b0d",
          "code": "FPU74MCG1O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bd937fe5-b008-44f8-aa14-550a7dabf086",
          "name": "9H-PURIN-6-AMINE, N-(2-FURANYLMETHYL)-9-(TETRAHYDRO-2H-PYRAN-2-YL)-",
          "stdName": "9H-PURIN-6-AMINE, N-(2-FURANYLMETHYL)-9-(TETRAHYDRO-2H-PYRAN-2-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb25e5c9-6e8e-463f-a695-6ab45ff12dad",
            "e94c2741-8a59-4e8d-906e-22c5b1e649c1"
          ],
          "display_name": false
        },
        {
          "uuid": "810ec434-04ca-4faf-a0ce-4d65604b9df7",
          "name": "ADENINE, N6-FURFURYL-9-(TETRAHYDROPYRAN-2-YL)-",
          "stdName": "ADENINE, N6-FURFURYL-9-(TETRAHYDROPYRAN-2-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb25e5c9-6e8e-463f-a695-6ab45ff12dad",
            "e94c2741-8a59-4e8d-906e-22c5b1e649c1"
          ],
          "display_name": false
        },
        {
          "uuid": "4a5a4717-910d-4828-9c9b-f55b05f092db",
          "name": "FURFURYL TETRAHYDROPYRANYLADENINE",
          "stdName": "FURFURYL TETRAHYDROPYRANYLADENINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "496bd1b8-6c55-4ac7-b7c7-ddaff2b3c400",
            "fb25e5c9-6e8e-463f-a695-6ab45ff12dad",
            "5491ecaa-6677-44cd-98ec-3b4c4d47409a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f9e33e76-6b43-483f-b3df-a4ee4724c732",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e84cc487-df19-4929-8143-6d31f086248e",
          "name": "PRK-124",
          "stdName": "PRK-124",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb25e5c9-6e8e-463f-a695-6ab45ff12dad",
            "5491ecaa-6677-44cd-98ec-3b4c4d47409a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5491ecaa-6677-44cd-98ec-3b4c4d47409a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fb25e5c9-6e8e-463f-a695-6ab45ff12dad",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e94c2741-8a59-4e8d-906e-22c5b1e649c1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd832f4c-3ed4-465f-85e1-61e5755be065",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42e2b753-f4b3-427e-aaf9-e92b6760e82e",
          "citation": "SRS import [FPU74MCG1O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FPU74MCG1O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "496bd1b8-6c55-4ac7-b7c7-ddaff2b3c400",
          "citation": "FURFURYL TETRAHYDROPYRANYLADENINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e0ab56cc-98e9-4f0b-a0da-5cf8700d1a94",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4270d4be-b7e0-a210-f592-9b09a79d4749",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "61b73e6a-86fe-4c2a-a01b-d3f507a98937",
          "id": "61b73e6a-86fe-4c2a-a01b-d3f507a98937",
          "molfile": "\n  Marvin  01132105042D          \n\n 22 25  0  0  0  0            999 V2000\n    3.3125   -4.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0247   -4.9792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0247   -5.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3102   -6.2138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3102   -7.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0265   -7.4503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7366   -7.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5212   -7.2935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0061   -6.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5212   -5.9585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7366   -6.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7348   -8.0905    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.1513   -8.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3649   -9.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1618   -9.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7452   -9.1009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5317   -8.3040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3125   -3.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6476   -3.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9016   -2.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7235   -2.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9775   -3.2626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 18  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n 11  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 11  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 17 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 22 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "C1CCOC(C1)n2cnc3c(NCc4ccco4)ncnc32",
          "formula": "C15H17N5O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ecc9016e-65f9-4bb7-b638-e3aba083b942"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "299.3284",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ca24dbf8-3b9d-492c-a614-7a0ec95f28dd",
      "version": "6",
      "structure": {
        "id": "71fe1191-e837-4831-89ee-c5efc77edd51",
        "molfile": "\n  Marvin  01132105552D          \n\n 22 25  0  0  0  0            999 V2000\n    3.3102   -6.2138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7366   -6.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0247   -5.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7366   -7.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3102   -7.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0265   -7.4503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5212   -5.9585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5212   -7.2935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0061   -6.6260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0247   -4.9792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3125   -4.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3125   -3.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9775   -3.2626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7235   -2.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9016   -2.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6476   -3.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7348   -8.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1513   -8.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3649   -9.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1618   -9.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7452   -9.1009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5317   -8.3040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  6  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  2  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  2  2  0  0  0  0\n  3  1  2  0  0  0  0\n  9  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  2  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 15 16  1  0  0  0  0\n 14 15  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 12  1  0  0  0  0\n 16 12  2  0  0  0  0\n  8 17  1  0  0  0  0\n 21 22  1  0  0  0  0\n 20 21  1  0  0  0  0\n 19 20  1  0  0  0  0\n 18 19  1  0  0  0  0\n 22 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
        "smiles": "C1CCOC(C1)n2cnc3c(NCc4ccco4)ncnc32",
        "formula": "C15H17N5O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "299.3284",
        "optical_activity": "( + / - )",
        "references": [
          "e94c2741-8a59-4e8d-906e-22c5b1e649c1",
          "42e2b753-f4b3-427e-aaf9-e92b6760e82e"
        ],
        "stereo_centers": 1
      },
      "unii": "FPU74MCG1O"
    }
  ]
}