{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dd12525e-b8b2-4c18-9e83-a895edd17f0e",
          "code": "96-76-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=96-76-4",
          "code_system": "CAS",
          "references": [
            "e09530b9-4555-4f07-8230-659d3f5a0697",
            "bdf91097-1715-4289-8ce3-b442df74561d"
          ]
        },
        {
          "uuid": "73f7f3cb-df35-4305-bc82-bf957b445ab8",
          "code": "202-532-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.303",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e09530b9-4555-4f07-8230-659d3f5a0697"
          ]
        },
        {
          "uuid": "b1df4fa0-6ada-464f-933c-54559a791d23",
          "code": "7311",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7311",
          "code_system": "PUBCHEM",
          "references": [
            "e09530b9-4555-4f07-8230-659d3f5a0697"
          ]
        },
        {
          "uuid": "b0db2bdc-eaef-39b6-b1fc-7a324f8d448d",
          "code": "DTXSID2026602",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2026602",
          "code_system": "EPA CompTox",
          "references": [
            "86c69d5b-0234-710a-c996-601bf495672a"
          ]
        },
        {
          "uuid": "3708e95e-5fa0-41cd-a872-3b9665a2ac1e",
          "code": "FOB94G6HZT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "397b8286-6277-6519-be3c-6d4e496ceaef",
          "code": "89188",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:89188",
          "code_system": "CHEBI",
          "references": [
            "02d8aa01-5a89-a921-1597-a07ac94ac773"
          ]
        },
        {
          "uuid": "78199479-174e-8281-3c78-356805c157cf",
          "code": "174502",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=174502",
          "code_system": "NSC",
          "references": [
            "d0401c80-1443-0abd-2e50-55c246071242"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "43dc52d6-a548-436b-9bb6-3260aab0568e",
          "name": "1-HYDROXY-2,4-DI-TERT-BUTYLBENZENE",
          "stdName": "1-HYDROXY-2,4-DI-TERT-BUTYLBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b88c08d-2268-4b97-a845-811a250d0990",
            "95eea172-0ae9-4868-b21d-ee41ab979022"
          ],
          "display_name": false
        },
        {
          "uuid": "c973e387-d24f-4c82-a587-e7dbfa14bb7f",
          "name": "2,4-DI-TERT-BUTYLHYDROXYBENZENE",
          "stdName": "2,4-DI-TERT-BUTYLHYDROXYBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7ee1a2c-2022-4573-b6b2-ef79b2ae03df",
            "95eea172-0ae9-4868-b21d-ee41ab979022"
          ],
          "display_name": false
        },
        {
          "uuid": "4307055b-6b75-4b53-a189-c4996ef9936f",
          "name": "2,4-DI-TERT-BUTYLPHENOL",
          "stdName": "2,4-DI-TERT-BUTYLPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b88c08d-2268-4b97-a845-811a250d0990",
            "95eea172-0ae9-4868-b21d-ee41ab979022"
          ],
          "display_name": true
        },
        {
          "uuid": "c68d977c-cdb4-4b22-adda-f5f2a0c3b651",
          "name": "AGIDOL 10",
          "stdName": "AGIDOL 10",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7ee1a2c-2022-4573-b6b2-ef79b2ae03df",
            "95eea172-0ae9-4868-b21d-ee41ab979022"
          ],
          "display_name": false
        },
        {
          "uuid": "056f12ff-634f-4cee-9e92-15030c1ee2cf",
          "name": "ANTIOXIDANT NO. 33",
          "stdName": "ANTIOXIDANT NO. 33",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b88c08d-2268-4b97-a845-811a250d0990",
            "95eea172-0ae9-4868-b21d-ee41ab979022"
          ],
          "display_name": false
        },
        {
          "uuid": "6ff74164-7f10-4633-9b45-7150eeb0b113",
          "name": "NSC-174502",
          "stdName": "NSC-174502",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b88c08d-2268-4b97-a845-811a250d0990",
            "95eea172-0ae9-4868-b21d-ee41ab979022"
          ],
          "display_name": false
        },
        {
          "uuid": "9dec0e50-03ef-43f0-af11-33448cec8342",
          "name": "PHENOL, 2,4-BIS(1,1-DIMETHYLETHYL)-",
          "stdName": "PHENOL, 2,4-BIS(1,1-DIMETHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b88c08d-2268-4b97-a845-811a250d0990",
            "95eea172-0ae9-4868-b21d-ee41ab979022"
          ],
          "display_name": false
        },
        {
          "uuid": "d43706e3-149d-419d-9b40-117245a7c14b",
          "name": "PHENOL, 2,4-DI-TERT-BUTYL-",
          "stdName": "PHENOL, 2,4-DI-TERT-BUTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b88c08d-2268-4b97-a845-811a250d0990",
            "95eea172-0ae9-4868-b21d-ee41ab979022"
          ],
          "display_name": false
        },
        {
          "uuid": "4114c110-216f-4763-947b-c98f6476cfa5",
          "name": "PRODOX 146",
          "stdName": "PRODOX 146",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b88c08d-2268-4b97-a845-811a250d0990",
            "95eea172-0ae9-4868-b21d-ee41ab979022"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3b88c08d-2268-4b97-a845-811a250d0990",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "95eea172-0ae9-4868-b21d-ee41ab979022",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7ee1a2c-2022-4573-b6b2-ef79b2ae03df",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e09530b9-4555-4f07-8230-659d3f5a0697",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdcfa4d0-acd2-4422-80d0-148ae4adac9c",
          "citation": "SRS import [FOB94G6HZT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FOB94G6HZT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86c69d5b-0234-710a-c996-601bf495672a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=96-76-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "02d8aa01-5a89-a921-1597-a07ac94ac773",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d0401c80-1443-0abd-2e50-55c246071242",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bdf91097-1715-4289-8ce3-b442df74561d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8c4cb9e3-63e7-4b60-9788-173a5594b3e2",
          "id": "8c4cb9e3-63e7-4b60-9788-173a5594b3e2",
          "molfile": "\n  Marvin  01132107172D          \n\n 15 15  0  0  0  0            999 V2000\n   -0.0213   -1.6591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7304   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7410   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4501   -1.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7197   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4288    0.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4182    0.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6984    1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6878    2.0623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0106    0.8157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7304    1.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4501    1.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4395    0.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7410    2.0439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(c(c1)C(C)(C)C)O",
          "formula": "C14H22O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "62e2ba27-3c94-4061-af31-2d8f9810085f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "206.3244",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "665bc0d4-9b2d-47a2-9c58-699fe576ebde",
      "version": "8",
      "structure": {
        "id": "bfa6f3f6-b3f2-495a-a43d-fbdea11a53c0",
        "molfile": "\n   JSDraw204122418182D\n\n 15 15  0  0  0  0              0 V2000\n   27.4280   -8.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6482   -6.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9992   -6.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8684   -5.4597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2971   -7.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2966   -9.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9451   -9.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5942   -9.1523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5947   -7.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9462   -6.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2437   -6.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0237   -5.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8928   -6.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4637   -8.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2431   -9.9320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  5 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n  8 15  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(c(c1)C(C)(C)C)O",
        "formula": "C14H22O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "206.3244",
        "optical_activity": "NONE",
        "references": [
          "3b88c08d-2268-4b97-a845-811a250d0990",
          "fdcfa4d0-acd2-4422-80d0-148ae4adac9c"
        ],
        "stereo_centers": 0
      },
      "unii": "FOB94G6HZT"
    }
  ]
}