{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a6546b2f-9bfe-4b78-98c4-8306c41c8f5b", "code": "71033-08-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=71033-08-4", "code_system": "CAS", "references": [ "f9fa0ac4-bcf9-4a03-9f40-580043c51cdb", "5cccbc90-8e9a-4412-9b69-04c4dd746fcc" ] }, { "uuid": "ae963813-ddd0-433c-b1c0-d4c54e3a8bca", "code": "275-143-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.068.291", "code_system": "ECHA (EC/EINECS)", "references": [ "f9fa0ac4-bcf9-4a03-9f40-580043c51cdb" ] }, { "uuid": "7d10f531-b03a-499d-aad7-6962da91c859", "code": "5362575", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5362575", "code_system": "PUBCHEM", "references": [ "f9fa0ac4-bcf9-4a03-9f40-580043c51cdb" ] }, { "uuid": "27cacd50-839c-cff1-d3b1-b0440204e009", "code": "DTXSID6052455", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6052455", "code_system": "EPA CompTox", "references": [ "47ef725b-aa1c-b951-49e5-916a08948fa3" ] }, { "uuid": "ce3ea7b9-8f45-4fe4-a4df-c0d88680d0dd", "code": "FKA36X2P6C", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "1e0a743b-6903-45fa-b709-d433ff6942af", "name": "2,2'-((1-METHYLETHYLIDENE)BIS(4,1-PHENYLENEOXY(1-(BUTOXYMETHYL)-2,1-ETHANEDIYL)OXYMETHYLENE))BIS(OXIRANE)", "stdName": "2,2'-((1-METHYLETHYLIDENE)BIS(4,1-PHENYLENEOXY(1-(BUTOXYMETHYL)-2,1-ETHANEDIYL)OXYMETHYLENE))BIS(OXIRANE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "011f3c17-cc9c-4f42-a9b3-c0a626854cd7", "54313015-ed94-4504-af35-9c810aaec4fc" ], "display_name": false }, { "uuid": "148c8e55-a85f-4676-a07e-620f8c7f197f", "name": "2,2'-((1-METHYLETHYLIDENE)BIS(4,1-PHENYLENEOXY(1-(BUTOXYMETHYL)-2,1-ETHANEDIYL)OXYMETHYLENE))BISOXIRANE", "stdName": "2,2'-((1-METHYLETHYLIDENE)BIS(4,1-PHENYLENEOXY(1-(BUTOXYMETHYL)-2,1-ETHANEDIYL)OXYMETHYLENE))BISOXIRANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5576761c-4bc6-424b-a917-d9ab30da88ab", "54313015-ed94-4504-af35-9c810aaec4fc" ], "display_name": true }, { "uuid": "61e6311f-b2e5-400f-9c66-22745a1349e0", "name": "2,2-BIS(P-(2-GLYCIDYLOXY-3-BUTOXYPROPYLOXY)PHENYL)PROPANE", "stdName": "2,2-BIS(P-(2-GLYCIDYLOXY-3-BUTOXYPROPYLOXY)PHENYL)PROPANE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "54313015-ed94-4504-af35-9c810aaec4fc", "c5b8e6ab-6066-413e-a6cb-9e20a77aa013" ], "display_name": false }, { "uuid": "649f1b14-5476-4e69-8069-2803d1d675da", "name": "ARALDITE XU GY 376", "stdName": "ARALDITE XU GY 376", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "011f3c17-cc9c-4f42-a9b3-c0a626854cd7", "54313015-ed94-4504-af35-9c810aaec4fc" ], "display_name": false }, { "uuid": "7d95b0b9-e3f5-4056-a082-ad4d60512742", "name": "OXIRANE, 2,2'-((1-METHYLETHYLIDENE)BIS(4,1-PHENYLENEOXY(1-(BUTOXYMETHYL)-2,1-ETHANEDIYL)OXYMETHYLENE))BIS-", "stdName": "OXIRANE, 2,2'-((1-METHYLETHYLIDENE)BIS(4,1-PHENYLENEOXY(1-(BUTOXYMETHYL)-2,1-ETHANEDIYL)OXYMETHYLENE))BIS-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "54313015-ed94-4504-af35-9c810aaec4fc", "e278b7ae-5f3f-4156-8d0c-efd4e1fd3939" ], "display_name": false } ], "references": [ { "uuid": "c5b8e6ab-6066-413e-a6cb-9e20a77aa013", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "54313015-ed94-4504-af35-9c810aaec4fc", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "011f3c17-cc9c-4f42-a9b3-c0a626854cd7", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5576761c-4bc6-424b-a917-d9ab30da88ab", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e278b7ae-5f3f-4156-8d0c-efd4e1fd3939", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f9fa0ac4-bcf9-4a03-9f40-580043c51cdb", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391925000, "tags": [ "NOMEN" ] }, { "uuid": "af0ed885-35cd-4471-8f02-4f30627eb2eb", "citation": "SRS import [FKA36X2P6C]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FKA36X2P6C", "doc_type": "SRS", "public_domain": true, "document_date": 1493391925000, "tags": [ "NOMEN" ] }, { "uuid": "47ef725b-aa1c-b951-49e5-916a08948fa3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=71033-08-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5cccbc90-8e9a-4412-9b69-04c4dd746fcc", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9435c770-9db9-4580-a741-f525e25267c4", "id": "9435c770-9db9-4580-a741-f525e25267c4", "molfile": "\n Marvin 01132107412D \n\n 43 46 0 0 0 0 999 V2000\n 5.7158 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.4289 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1270 1.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5395 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 2.2687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -4.2868 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7158 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7158 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 3.0938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -3.2704 5.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4454 5.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -4.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -1.1270 -5.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5395 -4.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 39 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 16 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 19 38 2 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 22 37 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 32 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 38 37 1 0 0 0 0\n 40 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 43 41 1 0 0 0 0\n 43 42 1 0 0 0 0\nM END", "smiles": "CCCCOCC(COc1ccc(cc1)C(C)(C)c2ccc(cc2)OCC(COCCCC)OCC3CO3)OCC4CO4", "formula": "C35H52O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b484e3e7-27b1-49ea-8e84-ca0a52b48237" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "600.7839", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "2ab5b946-3236-4655-b87d-e42cf4fb6df5", "version": "3", "structure": { "id": "e6300a42-e8bf-440c-b9ba-57c4e7b0599e", "molfile": "\n Marvin 01132111552D \n\n 43 46 0 0 0 0 999 V2000\n 0.7145 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1270 1.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5395 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -4.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -2.6812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 3.0938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7158 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7158 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 2.2687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5395 -4.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1270 -5.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4454 5.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2704 5.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 6 7 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 9 10 1 0 0 0 0\n 8 9 1 0 0 0 0\n 6 8 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 15 20 2 0 0 0 0\n 14 15 1 0 0 0 0\n 7 14 1 0 0 0 0\n 5 6 1 0 0 0 0\n 4 5 1 0 0 0 0\n 1 18 1 0 0 0 0\n 23 24 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 26 27 1 0 0 0 0\n 25 26 1 0 0 0 0\n 23 25 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 32 37 2 0 0 0 0\n 31 32 1 0 0 0 0\n 24 31 1 0 0 0 0\n 22 23 1 0 0 0 0\n 21 22 1 0 0 0 0\n 1 35 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 38 40 1 0 0 0 0\n 4 39 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 41 43 1 0 0 0 0\n 21 42 1 0 0 0 0\nM END", "smiles": "CCCCOCC(COc1ccc(cc1)C(C)(C)c2ccc(cc2)OCC(COCCCC)OCC3CO3)OCC4CO4", "formula": "C35H52O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "600.7839", "optical_activity": "UNSPECIFIED", "references": [ "af0ed885-35cd-4471-8f02-4f30627eb2eb", "e278b7ae-5f3f-4156-8d0c-efd4e1fd3939" ], "stereo_centers": 4 }, "unii": "FKA36X2P6C" } ] }