{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bce4a680-0a39-4648-9106-fbaae247eeec",
          "code": "29420-49-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=29420-49-3",
          "code_system": "CAS",
          "references": [
            "7440ce6e-8195-4d69-90fc-3ab89f1bea45",
            "81a8c35e-3339-464c-b008-16f76ff1f3cb"
          ]
        },
        {
          "uuid": "9d0082d6-a625-42ce-839f-81ac01bff22d",
          "code": "249-616-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.092",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7440ce6e-8195-4d69-90fc-3ab89f1bea45"
          ]
        },
        {
          "uuid": "e89546dc-dfcf-4b37-b056-17a696a39bda",
          "code": "23675274",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23675274",
          "code_system": "PUBCHEM",
          "references": [
            "7440ce6e-8195-4d69-90fc-3ab89f1bea45"
          ]
        },
        {
          "uuid": "129018cf-a387-4f99-686c-74c4a6b251cf",
          "code": "DTXSID3037707",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3037707",
          "code_system": "EPA CompTox",
          "references": [
            "eedc9af1-bd55-a5f0-972f-d9b5ad7bc267"
          ]
        },
        {
          "uuid": "5e842074-42f4-4221-967e-a7d1667d3a85",
          "code": "FJ9CR7RJSJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0e50112f-1d80-490b-a179-4f2367a38f58",
          "name": "1-BUTANESULFONIC ACID, 1,1,2,2,3,3,4,4,4-NONAFLUORO-, POTASSIUM SALT",
          "stdName": "1-BUTANESULFONIC ACID, 1,1,2,2,3,3,4,4,4-NONAFLUORO-, POTASSIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "9e809e03-7a17-4686-9dea-0240f3cd16ea",
          "name": "1-BUTANESULFONIC ACID, 1,1,2,2,3,3,4,4,4-NONAFLUORO-, POTASSIUM SALT (1:1)",
          "stdName": "1-BUTANESULFONIC ACID, 1,1,2,2,3,3,4,4,4-NONAFLUORO-, POTASSIUM SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "70d2c674-0b48-4cab-bdec-fbd7baf4d759",
          "name": "NANOFLUOROBUTANESULFONIC ACID POTASSIUM SALT",
          "stdName": "NANOFLUOROBUTANESULFONIC ACID POTASSIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "b05e9fc5-aed1-4544-8e28-3ad62adf72b9",
          "name": "NONAFLUORO-1-BUTANESULFONATE POTASSIUM SALT",
          "stdName": "NONAFLUORO-1-BUTANESULFONATE POTASSIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "a8942a64-20ef-4dd1-9cad-8b99d303d55c",
          "name": "NONAFLUOROBUTANESULFONIC ACID POTASSIUM SALT",
          "stdName": "NONAFLUOROBUTANESULFONIC ACID POTASSIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "0dc39a66-679d-4f3e-b56b-0b75068f4329",
          "name": "PERFLUOROBUTANESULFONIC ACID POTASSIUM SALT",
          "stdName": "PERFLUOROBUTANESULFONIC ACID POTASSIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "e9153331-6485-4e3a-8b72-d7619ae2f69d",
          "name": "PFBS-K",
          "stdName": "PFBS-K",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80833e3c-9f36-435b-9867-11749472ef0b"
          ],
          "display_name": false
        },
        {
          "uuid": "361910fd-dbe0-436c-96ed-2fd82d161f0e",
          "name": "PFBSA",
          "stdName": "PFBSA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "66991e6d-6468-4528-bdd0-4c75ec8d439d",
          "name": "POTASSIUM NONAFLATE",
          "stdName": "POTASSIUM NONAFLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "31c5bde4-be26-4223-aeb3-8c3a469f2409",
          "name": "POTASSIUM NONAFLUORO-1-BUTANESULFONATE",
          "stdName": "POTASSIUM NONAFLUORO-1-BUTANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb3fe514-1481-4674-a487-482ea489af75"
          ],
          "display_name": false
        },
        {
          "uuid": "f26d3851-76ac-4a48-bc59-f428490b3bc6",
          "name": "POTASSIUM NONAFLUOROBUTANESULFONATE",
          "stdName": "POTASSIUM NONAFLUOROBUTANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": true
        },
        {
          "uuid": "1d72df73-c9d7-4acc-b307-76b1ebf2e095",
          "name": "POTASSIUM PERFLUORO-1-BUTANESULFONATE",
          "stdName": "POTASSIUM PERFLUORO-1-BUTANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "4e9a1584-9bcc-4ca1-a251-d15643b74e93",
          "name": "POTASSIUM PERFLUOROBUTANESULFONATE",
          "stdName": "POTASSIUM PERFLUOROBUTANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "63191408-40cf-425f-a95a-066c6d462da7",
          "name": "POTASSIUM PERFLUOROBUTYLSULFONATE",
          "stdName": "POTASSIUM PERFLUOROBUTYLSULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "50370363-316f-418b-a5e4-8b1922b612df",
          "name": "PPBS",
          "stdName": "PPBS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        },
        {
          "uuid": "c00bc938-fea2-41eb-a699-74771fc577ff",
          "name": "PPFBS",
          "stdName": "PPFBS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bb3fe514-1481-4674-a487-482ea489af75",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5084aee2-7f4d-442d-b3b4-ccf8b62fdbf6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80833e3c-9f36-435b-9867-11749472ef0b",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7440ce6e-8195-4d69-90fc-3ab89f1bea45",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392272000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f9132ef-9742-4dee-ae12-908a0d4bfcbd",
          "citation": "SRS import [FJ9CR7RJSJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FJ9CR7RJSJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392272000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eedc9af1-bd55-a5f0-972f-d9b5ad7bc267",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=29420-49-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "81a8c35e-3339-464c-b008-16f76ff1f3cb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6f13977d-7474-432b-8e5d-796384bc371e",
          "id": "6f13977d-7474-432b-8e5d-796384bc371e",
          "molfile": "\n  Marvin  01132105462D          \n\n  1  0  0  0  0  0            999 V2000\n    8.5700   -6.7675    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e6f0c497-dcad-459b-9c1a-bcbe64d99e55"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b709d94b-a711-42a0-956e-644e3ee21ad5",
          "id": "b709d94b-a711-42a0-956e-644e3ee21ad5",
          "molfile": "\n  Marvin  01132109282D          \n\n 17 16  0  0  0  0            999 V2000\n    9.3563   -6.9143    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.1687   -6.7710    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0255   -5.9585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3120   -7.5835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9812   -6.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1245   -7.4402    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7565   -6.9099    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2634   -5.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2634   -5.0274    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5489   -5.4400    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0885   -5.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8030   -5.4400    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0885   -5.0274    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5009   -6.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9135   -7.2814    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0885   -7.2814    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3260   -6.5669    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(C(F)(F)F)(F)F",
          "formula": "C4F9O3S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1048dd4f-d9d0-4911-a678-376bfff847d1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "299.0929",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b1c3e179-d068-4613-a67f-a118cd278070",
      "version": "3",
      "structure": {
        "id": "7d01fa92-ad09-4b6d-bb7d-92494b6b8e0b",
        "molfile": "\n  Marvin  01132106292D          \n\n 18 16  0  0  0  0            999 V2000\n   10.9812   -6.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1245   -7.4402    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7565   -6.9099    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1687   -6.7710    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0255   -5.9585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3563   -6.9143    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.3120   -7.5835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2634   -5.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2634   -5.0274    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5489   -5.4400    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0885   -5.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8030   -5.4400    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0885   -5.0274    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5009   -6.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9135   -7.2814    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0885   -7.2814    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3260   -6.5669    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5700   -6.7675    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\nM  CHG  2   6  -1  18   1\nM  END",
        "smiles": "C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(C(F)(F)F)(F)F.[K+]",
        "formula": "C4F9O3S.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "338.1912",
        "optical_activity": "NONE",
        "references": [
          "2f9132ef-9742-4dee-ae12-908a0d4bfcbd",
          "bb3fe514-1481-4674-a487-482ea489af75"
        ],
        "stereo_centers": 0
      },
      "unii": "FJ9CR7RJSJ"
    }
  ]
}