{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "99ff8b20-f0a4-4315-b76b-595f36a7c226", "code": "84-77-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=84-77-5", "code_system": "CAS", "references": [ "a475fe9a-2d61-4f62-81de-ddc3d1b43ac6", "f329562e-3050-4b48-8f1c-0195140ff8fd" ] }, { "uuid": "0fc9d5c6-b3c8-4570-a6fa-a076b579d7c2", "code": "201-561-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.419", "code_system": "ECHA (EC/EINECS)", "references": [ "a475fe9a-2d61-4f62-81de-ddc3d1b43ac6" ] }, { "uuid": "60b5e15d-972f-4b3d-93c2-b9a7bd81506c", "code": "6788", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6788", "code_system": "PUBCHEM", "references": [ "a475fe9a-2d61-4f62-81de-ddc3d1b43ac6" ] }, { "uuid": "2bbd34f4-368b-0fe8-2f60-ddc756ac673b", "code": "5248", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5248", "code_system": "HSDB", "references": [ "6b7ad827-6ef3-af3d-4d76-c55ffbde91a9" ] }, { "uuid": "41f8fac5-9481-e0c1-2aa2-a1ce329946c2", "code": "DTXSID3026512", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3026512", "code_system": "EPA CompTox", "references": [ "979c6e84-3a31-296b-5ee1-a25c77edfac2" ] }, { "uuid": "4a83e4d5-cc05-4b19-8509-286c1764ebf5", "code": "FI5FBN947Z", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ce87fc5b-1e24-845f-c953-79954c9ad4fe", "code": "15319", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=15319", "code_system": "NSC", "references": [ "268fa5bb-f521-8721-8076-286ad1f3cdcf" ] } ], "substance_class": "chemical", "names": [ { "uuid": "d84a466b-7df8-4c95-a3fe-0b849c92a812", "name": "DIDECYL PHTHALATE", "stdName": "DIDECYL PHTHALATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "20482bb1-87ec-4660-ac70-c5a945c32fed", "605d39f0-8e6a-4025-9a47-bf21d643acaf" ], "display_name": true }, { "uuid": "a41e748e-0b40-4224-bab6-4d1fd13c067a", "name": "NSC-15319", "stdName": "NSC-15319", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "20482bb1-87ec-4660-ac70-c5a945c32fed", "605d39f0-8e6a-4025-9a47-bf21d643acaf" ], "display_name": false } ], "references": [ { "uuid": "605d39f0-8e6a-4025-9a47-bf21d643acaf", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "20482bb1-87ec-4660-ac70-c5a945c32fed", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a475fe9a-2d61-4f62-81de-ddc3d1b43ac6", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391632000, "tags": [ "NOMEN" ] }, { "uuid": "fbf8be9b-5c16-4fef-8757-b7f887eb6765", "citation": "SRS import [FI5FBN947Z]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FI5FBN947Z", "doc_type": "SRS", "public_domain": true, "document_date": 1493391632000, "tags": [ "NOMEN" ] }, { "uuid": "5dbbcd94-0903-4b30-b008-f00ba11b7f9c", "citation": "CHEMID RECORD 84-77-5", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6b7ad827-6ef3-af3d-4d76-c55ffbde91a9", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+84-77-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "979c6e84-3a31-296b-5ee1-a25c77edfac2", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84-77-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f329562e-3050-4b48-8f1c-0195140ff8fd", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "268fa5bb-f521-8721-8076-286ad1f3cdcf", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "cb96e038-fbbb-4a68-9603-3689ccc5ca05", "id": "cb96e038-fbbb-4a68-9603-3689ccc5ca05", "molfile": "\n Marvin 01132110312D \n\n 32 32 0 0 0 0 999 V2000\n -7.5309 -1.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7102 -1.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2955 -0.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4832 -0.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0516 -0.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2224 -0.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8120 0.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9870 0.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5724 1.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7431 1.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2777 0.6643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6346 0.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2962 1.2185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2962 0.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6346 -0.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2962 -1.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3300 -1.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6515 -0.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3300 0.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6515 0.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3300 1.2185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2988 0.6643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7262 1.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5555 1.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9701 0.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7951 0.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2097 -0.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0390 -0.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4535 -0.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2828 -0.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6974 -1.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5224 -1.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 12 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 19 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCCC", "formula": "C28H46O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1094f929-16c2-4b4a-9f3a-e23b24fce320" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "446.6635", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "8cc65a11-14ce-4d7a-89ff-9b0f2116f35f", "version": "5", "structure": { "id": "1b2a24a3-5d44-4caa-ad70-3550deb9e526", "molfile": "\n Marvin 01132101352D \n\n 32 32 0 0 0 0 999 V2000\n -0.2962 0.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3300 0.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6346 0.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6346 -0.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6515 0.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6515 -0.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2777 0.6643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2962 1.2185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2962 -1.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2988 0.6643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3300 1.2185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3300 -1.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7431 1.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7262 1.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5724 1.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5555 1.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9870 0.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9701 0.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8120 0.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7951 0.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2224 -0.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2097 -0.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0516 -0.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0390 -0.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4832 -0.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4535 -0.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2955 -0.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2828 -0.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7102 -1.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6974 -1.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.5309 -1.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5224 -1.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 3 8 2 0 0 0 0\n 4 9 2 0 0 0 0\n 5 10 1 0 0 0 0\n 5 11 2 0 0 0 0\n 6 12 2 0 0 0 0\n 7 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 30 32 1 0 0 0 0\n 9 12 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCCC", "formula": "C28H46O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "446.6635", "optical_activity": "NONE", "references": [ "fbf8be9b-5c16-4fef-8757-b7f887eb6765", "5dbbcd94-0903-4b30-b008-f00ba11b7f9c" ], "stereo_centers": 0 }, "unii": "FI5FBN947Z" } ] }