{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "432cfcc6-e50c-4499-b592-5697ca4bd4d9",
          "code": "G03CX01",
          "comments": "ATC|GENITO URINARY SYSTEM AND SEX HORMONES|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|ESTROGENS|Other estrogens|tibolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=G03CX01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "7b46d9c3-fbc4-4387-bd85-08305c6d5b9a",
          "code": "QG03CX01",
          "comments": "VATC|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|ESTROGENS|Other estrogens|tibolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QG03CX01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "286f1614-40fb-4fd8-bef9-739c0c198f7c",
          "code": "5630-53-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5630-53-5",
          "code_system": "CAS",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104",
            "30fc5e36-03b3-421e-838a-7b0920d87a4b"
          ]
        },
        {
          "uuid": "3ad8f4e7-76b8-4b71-a883-a0d951a57760",
          "code": "NBK548180",
          "comments": "LiverTox|Endocrine|Menopausal symptoms|Estrogen analogue",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548180/",
          "code_system": "LIVERTOX",
          "references": [
            "60dfafd8-376d-fd0c-a480-aa6ec72851c6"
          ]
        },
        {
          "uuid": "a09d1903-1ede-4567-98d2-bd9a69dfcaed",
          "code": "C027385",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67027385",
          "code_system": "MESH",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "88ebdc23-04a5-487c-9f47-2771309e69ab",
          "code": "TIBOLONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tibolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "b1eec80e-7ab3-48b8-8922-4b409129688c",
          "code": "SUB11022MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "2d8012fa-1522-4145-8b2a-bf7184cc8676",
          "code": "2777",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2777",
          "code_system": "INN",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "e328a8d2-a541-4b8f-acf2-1270141718da",
          "code": "227-069-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.609",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "0ecb0ce3-008a-4dcc-a7f0-89463bd02bb9",
          "code": "C66955",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66955",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "70803636-7dc6-4711-9322-6e51b6e4881e",
          "code": "38260",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/38260/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "2cb9d276-1d14-49b9-827a-6b869c9eaeed",
          "code": "m10852",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10852?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "8d48a417-5dad-451e-9f4e-9c8a002eaa99",
          "code": "CHEMBL2103774",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2103774",
          "code_system": "ChEMBL",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "9728a112-a1f9-4e2a-bc07-07786d4918ab",
          "code": "444008",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/444008",
          "code_system": "PUBCHEM",
          "references": [
            "fdf575d9-ef47-4f40-911a-678d37ad8104"
          ]
        },
        {
          "uuid": "f5813503-45d9-d9a0-1cfd-4f871408f4b6",
          "code": "DTXSID5023667",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5023667",
          "code_system": "EPA CompTox",
          "references": [
            "981d344f-f7ac-c37e-b015-7e354d1ae6f2"
          ]
        },
        {
          "uuid": "3410e4b7-b126-60bc-e2e8-d76bfc3a133d",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "60dfafd8-376d-fd0c-a480-aa6ec72851c6"
          ]
        },
        {
          "uuid": "c2a4d17c-e3ad-4cd6-a540-b165b42d1014",
          "code": "FF9X0205V2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "25223a68-3391-7d60-d5cc-d0c80dc881c2",
          "code": "2655",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2655",
          "code_system": "DRUG CENTRAL",
          "references": [
            "60dfafd8-376d-fd0c-a480-aa6ec72851c6"
          ]
        },
        {
          "uuid": "7c5ef262-4250-f0ee-ab64-60dc7b5011db",
          "code": "DB09070",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB09070",
          "code_system": "DRUG BANK",
          "references": [
            "60dfafd8-376d-fd0c-a480-aa6ec72851c6"
          ]
        },
        {
          "uuid": "a5a28b48-9a12-61cf-caa1-196e4466276f",
          "code": "32223",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:32223",
          "code_system": "CHEBI",
          "references": [
            "60dfafd8-376d-fd0c-a480-aa6ec72851c6"
          ]
        },
        {
          "uuid": "dcd20b69-5529-dc17-5d05-9612e99eea33",
          "code": "100000092534",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cb107909-a5ef-6cf2-a0ea-30922fd354f5"
          ]
        },
        {
          "uuid": "902a1a59-6396-4454-9050-7f364f30ca7e",
          "code": "759898",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759898",
          "code_system": "NSC",
          "references": [
            "83254022-a612-c9a7-74c1-f3ab828d24a8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b09799fa-e25d-4d9b-80a4-276994401a04",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "1004259d-4713-46a8-a2e7-92d96ab7e671",
            "refuuid": "4aa60738-1d7f-4e1f-9d2b-430ef4e77de7",
            "name": "TIBOLONE",
            "unii": "FF9X0205V2",
            "linking_id": "FF9X0205V2",
            "ref_pname": "TIBOLONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c5dc72f5-0dd7-4186-a3b5-b57ab11039d5",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "ca403bf5-44cd-4c2c-a548-0ec95cfdaf86",
            "refuuid": "4673cf81-dd46-4a8d-8696-823ccebce65d",
            "name": "ESTROGEN RECEPTOR",
            "unii": "SIDP85PFD6",
            "linking_id": "SIDP85PFD6",
            "ref_pname": "ESTROGEN RECEPTOR"
          }
        },
        {
          "uuid": "a875811f-6428-40e9-940e-533718d40490",
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "1e92a34e-548e-4d30-bd13-f5ba8e7361b4"
          ],
          "related_substance": {
            "uuid": "5822ae44-7ba0-4a10-aff6-e6cc91587e98",
            "refuuid": "e66dc501-2d13-4979-93de-7fa2616512a3",
            "name": "3.BETA.-HYDROXYTIBOLONE",
            "unii": "TEP8IU9GMR",
            "linking_id": "TEP8IU9GMR",
            "ref_pname": "3.BETA.-HYDROXYTIBOLONE"
          }
        },
        {
          "uuid": "ba604a89-96c6-41e4-b713-b0f5b0ff8392",
          "amount": {
            "uuid": "daadc0e4-8352-49e7-938f-9614bf20a9a2",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "399eab95-6925-4059-9d35-a1c9d8c4d8f8"
          ],
          "related_substance": {
            "uuid": "bbf895ef-3c37-43b8-9a0a-d979ae6bb854",
            "refuuid": "254bab21-99dd-41e7-801e-142b218415d9",
            "name": "3,3-DIMETHOXY-7.ALPHA.-METHYL-19-NOR-17.ALPHA.-PREGN-5(10)-EN-20-YN-17-OL",
            "unii": "JLW40677I6",
            "linking_id": "JLW40677I6",
            "ref_pname": "3,3-DIMETHOXY-7.ALPHA.-METHYL-19-NOR-17.ALPHA.-PREGN-5(10)-EN-20-YN-17-OL"
          }
        },
        {
          "uuid": "3ab3c442-70fc-4101-880f-bd4e69955aa1",
          "amount": {
            "uuid": "768e960b-27c9-46bd-a7a0-1c19f6bb734e",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "f3a4b11e-a171-41e6-8807-5caafc4179da"
          ],
          "related_substance": {
            "uuid": "ad025ef6-1f2c-4b25-b1aa-7070f7ea92ee",
            "refuuid": "ee755dd8-19d1-4d4a-8117-e744d930fc0a",
            "name": "17-HYDROXY-7.BETA.-METHYL-19-NOR-17.ALPHA.-PREGN-5(10)-EN-20-YN-3-ONE",
            "unii": "WAA8CM8G7H",
            "linking_id": "WAA8CM8G7H",
            "ref_pname": "17-HYDROXY-7.BETA.-METHYL-19-NOR-17.ALPHA.-PREGN-5(10)-EN-20-YN-3-ONE"
          }
        },
        {
          "uuid": "43aa26f4-740a-4b2a-9463-429906e3a1c7",
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "c1a758be-5c8f-43c4-9d09-b8a7553efc10"
          ],
          "related_substance": {
            "uuid": "a8f2ebbe-2a9f-4c33-9e45-e0884ea461a5",
            "refuuid": "2b81a4d7-c220-447a-b183-ca3a0be000aa",
            "name": "3.ALPHA.-HYDROXYTIBOLONE",
            "unii": "37T303O94A",
            "linking_id": "37T303O94A",
            "ref_pname": "3.ALPHA.-HYDROXYTIBOLONE"
          }
        },
        {
          "uuid": "b4d7d76b-19d2-4e11-9570-299ddeedc54d",
          "amount": {
            "uuid": "3e159be3-b5ab-4b05-b57f-ed886d1a0327"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "1c1ffdf8-7b13-4035-87c4-b7d6e45df30f"
          ],
          "related_substance": {
            "uuid": "5446e644-9f92-4415-bfff-4c438d44602a",
            "refuuid": "f49a0370-ae01-4d6a-872e-98771dbd9d16",
            "name": "ISOTIBOLONE",
            "unii": "LHZ8R2OW0M",
            "linking_id": "LHZ8R2OW0M",
            "ref_pname": "ISOTIBOLONE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5bdabb82-3489-4def-854f-1d24bf8708ef",
          "name": "17-Hydroxy-7α-methyl-19-nor-17α-pregn-5(10)-en-20-yn-3-one",
          "stdName": "17-HYDROXY-7.ALPHA.-METHYL-19-NOR-17.ALPHA.-PREGN-5(10)-EN-20-YN-3-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9fc6bb6-104f-4d09-a078-875fa5329872"
          ],
          "display_name": false
        },
        {
          "uuid": "5c0c1cb0-c121-4829-b2ee-15757397bc5c",
          "name": "19-NORPREGN-5(10)-EN-20-YN-3-ONE, 17-HYDROXY-7-METHYL-, (7.ALPHA.,17.ALPHA.)-",
          "stdName": "19-NORPREGN-5(10)-EN-20-YN-3-ONE, 17-HYDROXY-7-METHYL-, (7.ALPHA.,17.ALPHA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9fc6bb6-104f-4d09-a078-875fa5329872"
          ],
          "display_name": false
        },
        {
          "uuid": "80501d6e-94d1-8700-e8ee-48327380eb6c",
          "name": "NSC-759898",
          "stdName": "NSC-759898",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83254022-a612-c9a7-74c1-f3ab828d24a8"
          ],
          "display_name": false
        },
        {
          "uuid": "5a17ac39-3908-4124-9ba7-b0ea41186db0",
          "name": "ORG OD 14",
          "stdName": "ORG OD 14",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9fc6bb6-104f-4d09-a078-875fa5329872"
          ],
          "display_name": false
        },
        {
          "uuid": "9f9d4530-a5c7-4735-b5a9-800d33c3d901",
          "name": "ORG-OD 14",
          "stdName": "ORG-OD 14",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9fc6bb6-104f-4d09-a078-875fa5329872"
          ],
          "display_name": false
        },
        {
          "uuid": "6f9326d0-35f3-4a08-afe0-186d136be673",
          "name": "TIBOLONE",
          "stdName": "TIBOLONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a24fcc8-c9bf-4a61-9a61-78072c169d80",
            "4a106c1c-4572-4ef9-aa4a-f37b064fd6f9",
            "707d6c8d-d450-4559-ac67-6bdb8062fc7f",
            "6512acaf-dccd-4817-a595-a4154187985d",
            "3941c840-fdbd-4f0e-90c5-ed45e599e7c3",
            "750f9bbf-bfcc-488c-a8cc-6e139aa04a24",
            "d46889f1-8a6a-42a3-844d-458fb1a0d4ea",
            "8d7bb78e-7944-4ede-87ea-6530981c6478",
            "a2ed68d0-426a-4247-9f32-55611eba3d85",
            "e587e486-6a7a-436b-b6aa-9d60e84a4e3f",
            "00e6cdcd-b436-41ad-8973-2f805a19b6cd",
            "8002c894-fdc1-4b51-8e27-e246e584c73c",
            "bab71d4d-d190-4af9-a2d7-a46d6648d392",
            "814ffcdd-458d-492d-8cfc-ede9b1f509e8",
            "e6659f6c-c676-403b-baab-0d16edde6749",
            "6e4d6eab-e080-48a4-a47a-d68d6319ac4a",
            "a9b7e96f-d616-4191-9b5e-9367d303e978"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "adb8b8f4-5a70-4b3c-b750-e3fa2522dd45",
              "name_org": "INN"
            },
            {
              "uuid": "0e23220f-e8df-41cb-9185-7978ee665f71",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "02f67598-78bb-3d15-771e-4178aef8668f",
          "name": "TIBOLONE [EP IMPURITY]",
          "stdName": "TIBOLONE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3941c840-fdbd-4f0e-90c5-ed45e599e7c3"
          ],
          "display_name": false
        },
        {
          "uuid": "4e27ac2d-2e40-d081-3f10-1f9dd07d01b2",
          "name": "TIBOLONE [EP MONOGRAPH]",
          "stdName": "TIBOLONE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8394141-fbcc-7307-da20-c36f26e80ae4"
          ],
          "display_name": false
        },
        {
          "uuid": "cbbdb683-439b-447f-8cd4-84ca6c2b4644",
          "name": "TIBOLONE [JAN]",
          "stdName": "TIBOLONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8002c894-fdc1-4b51-8e27-e246e584c73c"
          ],
          "display_name": false
        },
        {
          "uuid": "dcc0f6fe-a9a3-481f-8a34-0b4893d1d369",
          "name": "TIBOLONE [MART.]",
          "stdName": "TIBOLONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d46889f1-8a6a-42a3-844d-458fb1a0d4ea"
          ],
          "display_name": false
        },
        {
          "uuid": "45f63b6f-5363-42a5-9e49-6e523d6e9454",
          "name": "TIBOLONE [MI]",
          "stdName": "TIBOLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bab71d4d-d190-4af9-a2d7-a46d6648d392"
          ],
          "display_name": false
        },
        {
          "uuid": "316301d2-6b05-4196-90a2-9b2cdc1b56b1",
          "name": "TIBOLONE [USAN]",
          "stdName": "TIBOLONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2ed68d0-426a-4247-9f32-55611eba3d85"
          ],
          "display_name": false
        },
        {
          "uuid": "e6c4dbda-b7a2-4dd1-a30b-64fb899ad54c",
          "name": "TIBOLONE [VANDF]",
          "stdName": "TIBOLONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "707d6c8d-d450-4559-ac67-6bdb8062fc7f"
          ],
          "display_name": false
        },
        {
          "uuid": "e70b74bb-995e-a02d-a0f9-1b2eebc78454",
          "name": "Tibolone [WHO-DD]",
          "stdName": "TIBOLONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4518b7dd-37e7-612e-44db-72ebe635c41e"
          ],
          "display_name": false
        },
        {
          "uuid": "21c1c170-d1fc-4641-a395-2b25a2729751",
          "name": "tibolone [INN]",
          "stdName": "TIBOLONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6512acaf-dccd-4817-a595-a4154187985d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6e4d6eab-e080-48a4-a47a-d68d6319ac4a",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b9fc6bb6-104f-4d09-a078-875fa5329872",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6512acaf-dccd-4817-a595-a4154187985d",
          "citation": "INN Proposed List 22",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL22.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a2ed68d0-426a-4247-9f32-55611eba3d85",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3941c840-fdbd-4f0e-90c5-ed45e599e7c3",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8002c894-fdc1-4b51-8e27-e246e584c73c",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d46889f1-8a6a-42a3-844d-458fb1a0d4ea",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bab71d4d-d190-4af9-a2d7-a46d6648d392",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6659f6c-c676-403b-baab-0d16edde6749",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "707d6c8d-d450-4559-ac67-6bdb8062fc7f",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdf575d9-ef47-4f40-911a-678d37ad8104",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389715000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "279338f6-61b0-479f-9a2c-f3707c546be8",
          "citation": "SRS import [FF9X0205V2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FF9X0205V2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389715000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9b7e96f-d616-4191-9b5e-9367d303e978",
          "citation": "TIBOLONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "750f9bbf-bfcc-488c-a8cc-6e139aa04a24",
          "citation": "TIBOLONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4a106c1c-4572-4ef9-aa4a-f37b064fd6f9",
          "citation": "TIBOLONE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "00e6cdcd-b436-41ad-8973-2f805a19b6cd",
          "citation": "TIBOLONE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e587e486-6a7a-436b-b6aa-9d60e84a4e3f",
          "citation": "TIBOLONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9a24fcc8-c9bf-4a61-9a61-78072c169d80",
          "citation": "TIBOLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "814ffcdd-458d-492d-8cfc-ede9b1f509e8",
          "citation": "TIBOLONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d7bb78e-7944-4ede-87ea-6530981c6478",
          "citation": "TIBOLONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "981d344f-f7ac-c37e-b015-7e354d1ae6f2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5630-53-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "60dfafd8-376d-fd0c-a480-aa6ec72851c6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "30fc5e36-03b3-421e-838a-7b0920d87a4b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "399eab95-6925-4059-9d35-a1c9d8c4d8f8",
          "citation": "European Pharmacopoeia Online 9.8, Tibolone Monograph",
          "url": "http://online6.edqm.eu/ep908/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f3a4b11e-a171-41e6-8807-5caafc4179da",
          "citation": "European Pharmacopoeia Online 9.8, Tibolone Monograph",
          "url": "http://online6.edqm.eu/ep908/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1e92a34e-548e-4d30-bd13-f5ba8e7361b4",
          "citation": "Obach, R. Scott. \"Pharmacologically active drug metabolites: impact on drug discovery and pharmacotherapy.\" Pharmacological reviews 65.2 (2013): 578-640.",
          "url": "http://pharmrev.aspetjournals.org/content/65/2/578.short",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c1a758be-5c8f-43c4-9d09-b8a7553efc10",
          "citation": "Obach, R. Scott. \"Pharmacologically active drug metabolites: impact on drug discovery and pharmacotherapy.\" Pharmacological reviews 65.2 (2013): 578-640.",
          "url": "http://pharmrev.aspetjournals.org/content/65/2/578.short",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bfac6c83-3c70-4336-b279-b20898790340",
          "citation": "Obach, R. Scott. \"Pharmacologically active drug metabolites: impact on drug discovery and pharmacotherapy.\" Pharmacological reviews 65.2 (2013): 578-640.",
          "url": "http://pharmrev.aspetjournals.org/content/65/2/578.short",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1c1ffdf8-7b13-4035-87c4-b7d6e45df30f",
          "citation": "Obach, R. Scott. \"Pharmacologically active drug metabolites: impact on drug discovery and pharmacotherapy.\" Pharmacological reviews 65.2 (2013): 578-640.",
          "url": "http://pharmrev.aspetjournals.org/content/65/2/578.short",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "83254022-a612-c9a7-74c1-f3ab828d24a8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c8394141-fbcc-7307-da20-c36f26e80ae4",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "4518b7dd-37e7-612e-44db-72ebe635c41e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e733a7d4-05eb-6535-83f7-89d2677c9ac1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "cb107909-a5ef-6cf2-a0ea-30922fd354f5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bd7c3672-33c2-4312-af9a-850fbb348ca2",
          "id": "bd7c3672-33c2-4312-af9a-850fbb348ca2",
          "molfile": "\n  Marvin  01132109482D          \n\n 23 26  0  0  1  0            999 V2000\n    0.7804   -2.0671    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.5759   -2.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0620   -1.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6142   -0.9670    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.6142   -0.2609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5915   -0.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2055   -0.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7804   -1.2535    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.7804   -0.4324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0742   -0.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6242   -1.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6242   -2.0671    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -1.3379   -2.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3379   -3.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0593   -3.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7808   -3.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5047   -3.7326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7808   -2.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0593   -2.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6242   -3.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0742   -3.3130    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.7958   -3.7326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0742   -2.4789    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n  1  2  1  1  0  0  0\n  1  8  1  0  0  0  0\n 23  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  8  4  1  0  0  0  0\n  7  6  3  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 23 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 19 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 20 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  6  0  0  0\n 23 21  1  6  0  0  0\nM  END",
          "smiles": "C#C[C@@]1(CC[C@H]2[C@@H]3[C@H](C)CC4=C(CCC(=O)C4)[C@H]3CC[C@@]21C)O",
          "formula": "C21H28O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "95c746d1-f794-4590-babc-20456a47361f"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "312.4466",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4aa60738-1d7f-4e1f-9d2b-430ef4e77de7",
      "version": "30",
      "structure": {
        "id": "e1f17496-071c-47a8-81e1-e079d2acf5a6",
        "molfile": "\n  Marvin  01132111422D          \n\n 26 29  0  0  1  0            999 V2000\n   -1.3395   -2.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3395   -3.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7812   -1.2550    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.7812   -2.0695    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.6249   -2.0695    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.0743   -2.4818    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.6161   -0.9681    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.0743   -3.3168    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.6249   -3.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5945   -0.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0743   -0.8478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6249   -1.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5777   -2.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0617   -2.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2092   -0.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0617   -3.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0644   -1.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7840   -3.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5088   -3.7368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7840   -2.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6161   -0.2612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7812   -0.4329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7966   -3.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0743   -1.6622    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7812   -2.7636    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6249   -2.7636    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  2  1  0  0  0  0\n  7 10  1  6  0  0  0\n 11 12  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  1  1  0  0  0  0\n 15 10  3  0  0  0  0\n 16  2  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 14  1  0  0  0  0\n  7 21  1  1  0  0  0\n  3 22  1  1  0  0  0\n  8 23  1  6  0  0  0\n  6 24  1  1  0  0  0\n  4 25  1  6  0  0  0\n  5 26  1  6  0  0  0\n 20 18  1  0  0  0  0\n  6  8  1  0  0  0  0\n  3 11  1  0  0  0  0\n  7 17  1  0  0  0  0\nM  END",
        "smiles": "C#C[C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](C)CC4=C(CCC(=O)C4)[C@@]3([H])CC[C@@]21C)O",
        "formula": "C21H28O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "312.4466",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "279338f6-61b0-479f-9a2c-f3707c546be8",
          "6e4d6eab-e080-48a4-a47a-d68d6319ac4a",
          "6512acaf-dccd-4817-a595-a4154187985d"
        ],
        "stereo_centers": 6
      },
      "unii": "FF9X0205V2"
    }
  ]
}