{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "485cb317-70b6-49bd-b2b9-00f50409f883",
          "code": "20018-09-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20018-09-1",
          "code_system": "CAS",
          "references": [
            "b56483db-6e93-4994-bfd8-df189eed3eab",
            "41527fa5-36ff-43ef-9367-809e83e12a0e"
          ]
        },
        {
          "uuid": "815c33dc-e791-4d12-8e1d-5c3c5de2fd5d",
          "code": "C076281",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67076281",
          "code_system": "MESH",
          "references": [
            "b56483db-6e93-4994-bfd8-df189eed3eab"
          ]
        },
        {
          "uuid": "f8ed866b-c987-47bb-9ca8-bd21d288c18b",
          "code": "101002",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2151",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b56483db-6e93-4994-bfd8-df189eed3eab"
          ]
        },
        {
          "uuid": "7c2716b0-6c9d-4e62-942b-9bbc504fe157",
          "code": "243-468-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.039.502",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b56483db-6e93-4994-bfd8-df189eed3eab"
          ]
        },
        {
          "uuid": "bfa86f6a-b6b0-435f-bc16-6dbfccc1ff14",
          "code": "62738",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62738",
          "code_system": "PUBCHEM",
          "references": [
            "b56483db-6e93-4994-bfd8-df189eed3eab"
          ]
        },
        {
          "uuid": "d03a7898-9ce9-8001-a3eb-f87c6fc8f3de",
          "code": "8033",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8033",
          "code_system": "HSDB",
          "references": [
            "fe3188a4-2bc6-f110-c0a3-d630b9733a30"
          ]
        },
        {
          "uuid": "b7e4cf67-aaf3-5b30-264b-54e9fa7c170d",
          "code": "DTXSID3032541",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3032541",
          "code_system": "EPA CompTox",
          "references": [
            "e84d0aef-335d-6a5c-6ec7-7f6148e52acb"
          ]
        },
        {
          "uuid": "86a6aa3d-4a98-abbb-f111-8c56107f1e70",
          "code": "21 CFR 176.300",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.300",
          "code_system": "CFR",
          "references": [
            "f0a7895b-f943-fe1b-6a72-642d5e6d6e3c"
          ]
        },
        {
          "uuid": "97be604f-3672-433b-a55a-774ae3d4bad9",
          "code": "FDJ36QMI3H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b2cd3700-ea70-a569-625e-f410a14ff6a4",
          "name": "4-(DIIODOMETHYLSULFONYL) TOLUENE",
          "stdName": "4-(DIIODOMETHYLSULFONYL) TOLUENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9dbf6f09-c97b-45c7-b697-035c448e5203"
          ],
          "display_name": false
        },
        {
          "uuid": "366a0b8d-d181-44ff-93a3-9e44cd55a20e",
          "name": "4-(DIIODOMETHYLSULFONYL)TOLUENE",
          "stdName": "4-(DIIODOMETHYLSULFONYL)TOLUENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7340844-06ee-4bb9-9730-12430ef62276",
            "c734738d-1273-48f2-a23a-2b29198ee000"
          ],
          "display_name": false
        },
        {
          "uuid": "b92eb23e-b98b-47ab-a6ee-4ce488657322",
          "name": "4-TOLYL DIIODOMETHYL SULFONE",
          "stdName": "4-TOLYL DIIODOMETHYL SULFONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7340844-06ee-4bb9-9730-12430ef62276",
            "bb86b74c-0d88-461b-93d9-bd28e67d112f"
          ],
          "display_name": false
        },
        {
          "uuid": "cce36e18-514c-4647-9f9f-bbd702000b5d",
          "name": "BENZENE, 1-((DIIODOMETHYL)SULFONYL)-4-METHYL-",
          "stdName": "BENZENE, 1-((DIIODOMETHYL)SULFONYL)-4-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7340844-06ee-4bb9-9730-12430ef62276",
            "bb86b74c-0d88-461b-93d9-bd28e67d112f"
          ],
          "display_name": false
        },
        {
          "uuid": "69dae1a2-ba96-491d-9192-c326bac09367",
          "name": "DIIODOMETHYL 4-METHYLPHENYL SULFONE",
          "stdName": "DIIODOMETHYL 4-METHYLPHENYL SULFONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7340844-06ee-4bb9-9730-12430ef62276",
            "56ed5790-e6ea-44c3-be78-8112fda2d33f"
          ],
          "display_name": false
        },
        {
          "uuid": "839ddbc2-d809-4fcf-a675-ab69df438d8d",
          "name": "DIIODOMETHYL 4-TOLYL SULFONE",
          "stdName": "DIIODOMETHYL 4-TOLYL SULFONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7340844-06ee-4bb9-9730-12430ef62276",
            "bb86b74c-0d88-461b-93d9-bd28e67d112f"
          ],
          "display_name": false
        },
        {
          "uuid": "d314280e-4982-4584-b33c-cdc37054a4af",
          "name": "DIIODOMETHYL P-TOLYL SULFONE",
          "stdName": "DIIODOMETHYL P-TOLYL SULFONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4d2a5ed1-0a38-497d-a535-366298c2939d"
          ],
          "display_name": false
        },
        {
          "uuid": "46a0a98a-cfb8-45f3-b537-a2834eae01c8",
          "name": "DIIODOMETHYL P-TOLYL SULPHONE",
          "stdName": "DIIODOMETHYL P-TOLYL SULPHONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9dbf6f09-c97b-45c7-b697-035c448e5203"
          ],
          "display_name": false
        },
        {
          "uuid": "816f8278-47f4-46c0-9df6-7baa5bc58082",
          "name": "DIIODOMETHYLTOLYLSULFONE",
          "stdName": "DIIODOMETHYLTOLYLSULFONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d55ed5f8-ebfe-4dd0-979f-d4121ef8169d",
            "a7340844-06ee-4bb9-9730-12430ef62276",
            "f4a50a31-4259-4e11-8818-0577c10fe036"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0bf4f09e-7e9a-43bf-882f-6055c51bf922",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d28308a1-33ea-4702-9322-37c43c112bf7",
          "name": "SULFONE, DIIODOMETHYL P-TOLYL",
          "stdName": "SULFONE, DIIODOMETHYL P-TOLYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7340844-06ee-4bb9-9730-12430ef62276",
            "bb86b74c-0d88-461b-93d9-bd28e67d112f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9dbf6f09-c97b-45c7-b697-035c448e5203",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4d2a5ed1-0a38-497d-a535-366298c2939d",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d55ed5f8-ebfe-4dd0-979f-d4121ef8169d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7340844-06ee-4bb9-9730-12430ef62276",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb86b74c-0d88-461b-93d9-bd28e67d112f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c734738d-1273-48f2-a23a-2b29198ee000",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56ed5790-e6ea-44c3-be78-8112fda2d33f",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b56483db-6e93-4994-bfd8-df189eed3eab",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ef998c2-0b5e-491f-8d5f-e0ce9e5a2bb8",
          "citation": "SRS import [FDJ36QMI3H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FDJ36QMI3H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8ab238d-d859-43db-b6a1-2b6bc45cbc90",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4a50a31-4259-4e11-8818-0577c10fe036",
          "citation": "DIIODOMETHYLTOLYLSULFONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fe3188a4-2bc6-f110-c0a3-d630b9733a30",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+20018-09-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e84d0aef-335d-6a5c-6ec7-7f6148e52acb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=20018-09-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "41527fa5-36ff-43ef-9367-809e83e12a0e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f0a7895b-f943-fe1b-6a72-642d5e6d6e3c",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c4779d3b-80a5-43b7-b47d-e84d3c888049",
          "id": "c4779d3b-80a5-43b7-b47d-e84d3c888049",
          "molfile": "\n  Marvin  01132110092D          \n\n 13 13  0  0  0  0            999 V2000\n    6.8569   -7.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8569   -6.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1420   -6.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1420   -5.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8492   -4.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5671   -5.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5671   -6.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8492   -4.1207    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7637   -4.1207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9200   -4.1207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8492   -3.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5517   -2.8855    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1313   -2.8893    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)S(=O)(=O)C(I)I",
          "formula": "C8H8I2O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aa6778a0-e58c-4a6c-8619-6af022fa728f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "422.0233",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "516f19f8-dfa8-4c61-86da-c00727b3ba80",
      "version": "9",
      "structure": {
        "id": "b11d7e07-47b5-467c-8ba9-aeb2860e4ade",
        "molfile": "\n  Marvin  01132109112D          \n\n 13 13  0  0  0  0            999 V2000\n    6.8492   -4.1207    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8492   -4.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1420   -5.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1420   -6.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8569   -6.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8569   -7.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5671   -6.1843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5671   -5.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8492   -3.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5517   -2.8855    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1313   -2.8893    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7637   -4.1207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9200   -4.1207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  7  1  0  0  0  0\n  2  8  2  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  1 12  2  0  0  0  0\n  1 13  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)S(=O)(=O)C(I)I",
        "formula": "C8H8I2O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "422.0233",
        "optical_activity": "NONE",
        "references": [
          "2ef998c2-0b5e-491f-8d5f-e0ce9e5a2bb8",
          "a8ab238d-d859-43db-b6a1-2b6bc45cbc90"
        ],
        "stereo_centers": 0
      },
      "unii": "FDJ36QMI3H"
    }
  ]
}