{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "db347815-4154-4252-90a9-3ef9edecbe6c", "code": "14513-34-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=14513-34-9", "code_system": "CAS", "references": [ "18e1d69d-49f7-4cd9-8c0a-9e51680777fb", "73bbe409-bea3-49c0-a84e-5b361825ded1" ] }, { "uuid": "e0c9897f-1512-ea20-359c-7c36355040d9", "code": "84485", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/84485", "code_system": "PUBCHEM", "references": [ "77187c12-9edb-280b-06bd-97e27a9149ba" ] }, { "uuid": "b7b23422-86ff-6817-9781-866fed049865", "code": "DTXSID30932502", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30932502", "code_system": "EPA CompTox" }, { "uuid": "d3195476-d2b3-4b4a-a0ca-1865eafe535a", "code": "FBA4MBY7DJ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "0603374f-6ad5-42e7-a17f-d9468b581faf", "name": "2-Propenoic acid, 2-methyl-, 3-(dimethoxymethylsilyl)propyl ester", "stdName": "2-PROPENOIC ACID, 2-METHYL-, 3-(DIMETHOXYMETHYLSILYL)PROPYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "73bbe409-bea3-49c0-a84e-5b361825ded1" ], "display_name": false }, { "uuid": "f3092a24-4fde-4e86-8145-645341a40d67", "name": "3-(Dimethoxymethylsilyl)propyl methacrylate", "stdName": "3-(DIMETHOXYMETHYLSILYL)PROPYL METHACRYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "18e1d69d-49f7-4cd9-8c0a-9e51680777fb" ], "display_name": true }, { "uuid": "8d992a45-5df9-4e5c-b29e-af3a12bc1e51", "name": "3-Methacryloxypropylmethyldimethoxysilane", "stdName": "3-METHACRYLOXYPROPYLMETHYLDIMETHOXYSILANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "73bbe409-bea3-49c0-a84e-5b361825ded1", "77187c12-9edb-280b-06bd-97e27a9149ba" ], "display_name": false } ], "references": [ { "uuid": "77187c12-9edb-280b-06bd-97e27a9149ba", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "18e1d69d-49f7-4cd9-8c0a-9e51680777fb", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "73bbe409-bea3-49c0-a84e-5b361825ded1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9c7c7360-a596-45bd-9271-0281b611c2e9", "id": "9c7c7360-a596-45bd-9271-0281b611c2e9", "molfile": "\n Marvin 01132108082D \n\n 15 14 0 0 0 0 999 V2000\n 4.3344 -5.9097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6319 -6.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9064 -6.2822 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3133 -5.0922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6549 -7.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0560 -6.3096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6280 -6.6821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5063 -7.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4822 -6.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1847 -5.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3083 -5.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9102 -5.9216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7605 -5.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3242 -7.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1175 -7.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 4 1 2 0 0 0 0\n 6 1 1 0 0 0 0\n 5 2 2 0 0 0 0\n 12 2 1 0 0 0 0\n 3 10 1 0 0 0 0\n 7 3 1 0 0 0 0\n 8 3 1 0 0 0 0\n 11 3 1 0 0 0 0\n 13 6 1 0 0 0 0\n 14 7 1 0 0 0 0\n 15 8 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 9 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OCCC[Si](C)(OC)OC", "formula": "C10H20O4Si", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1dec74e5-97ed-4266-a667-ed782dc472f1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "232.3492", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "a2235368-2588-415a-8320-9ed6d2896d3f", "version": "9", "structure": { "id": "e7b953ca-4a7f-475f-b896-2afd97a00f2a", "molfile": "\n JSDraw204142307522D\n\n 15 14 0 0 0 0 0 V2000\n 19.0829 -6.8397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3387 -7.7651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7681 -7.1403 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3929 -8.5698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4674 -9.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1974 -6.5155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4532 -7.4410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8828 -6.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1386 -7.7416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5679 -7.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8238 -8.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6502 -9.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2531 -7.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7415 -5.5664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1432 -5.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 10 14 2 0 0 0 0\n 3 15 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OCCC[Si](C)(OC)OC", "formula": "C10H20O4Si", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "232.3492", "optical_activity": "NONE", "references": [ "18e1d69d-49f7-4cd9-8c0a-9e51680777fb" ], "stereo_centers": 0 }, "modifications": { "uuid": "cd34ff97-51f0-4ea5-b78c-3d819a2afd29" }, "unii": "FBA4MBY7DJ" } ] }