{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "76bc0bdb-dddc-4642-8c59-f73ebc869016",
          "code": "183675-82-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=183675-82-3",
          "code_system": "CAS",
          "references": [
            "350a74c1-e3bc-437a-8fb7-a3853c4343c7",
            "f30bbf34-ab86-43bb-b1bd-f0031db7af6e"
          ]
        },
        {
          "uuid": "8377f377-7ee1-46a3-888e-5b40272561b2",
          "code": "1135441-67-6",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1135441-67-6",
          "code_system": "CAS",
          "references": [
            "350a74c1-e3bc-437a-8fb7-a3853c4343c7",
            "ebdabc01-3c57-4f7d-982a-30ac13f080a8"
          ]
        },
        {
          "uuid": "79ea52c5-e8e0-481d-b7ba-a46fcc2fd8d1",
          "code": "m8509",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8509?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "350a74c1-e3bc-437a-8fb7-a3853c4343c7"
          ]
        },
        {
          "uuid": "253810d8-e351-4775-b7a1-8206c66e74c1",
          "code": "11388558",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11388558",
          "code_system": "PUBCHEM",
          "references": [
            "350a74c1-e3bc-437a-8fb7-a3853c4343c7"
          ]
        },
        {
          "uuid": "9d6a209c-f484-941f-32bc-492d40d23b9d",
          "code": "DTXSID6058005",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6058005",
          "code_system": "EPA CompTox",
          "references": [
            "e75d842f-d0ff-a936-34bf-ad7488d6976a"
          ]
        },
        {
          "uuid": "83506070-6cbb-46a7-9074-2ae179f8cdc3",
          "code": "FAT7900E5H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8fbff4a6-8532-c5f8-f34d-4e16a5e17403",
          "code": "penthiopyrad",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/penthiopyrad.html",
          "code_system": "ALANWOOD",
          "references": [
            "540f6785-1b5b-141a-6414-e1e2e3a917bc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "78e9ffe1-71b8-40f0-9b8b-5ee1ae9b4c87",
          "name": "1H-PYRAZOLE-4-CARBOXAMIDE, N-(2-(1,3-DIMETHYLBUTYL)-3-THIENYL)-1-METHYL-3-(TRIFLUOROMETHYL)-",
          "stdName": "1H-PYRAZOLE-4-CARBOXAMIDE, N-(2-(1,3-DIMETHYLBUTYL)-3-THIENYL)-1-METHYL-3-(TRIFLUOROMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1deee7d3-4b66-4227-8e05-5ed849300763",
            "86dd799e-f1c0-4b08-9a8d-56d85fe256e1"
          ],
          "display_name": false
        },
        {
          "uuid": "0f395e4f-a68f-4d2a-a72c-954e6b46f65c",
          "name": "DPX-LEM 17",
          "stdName": "DPX-LEM 17",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1deee7d3-4b66-4227-8e05-5ed849300763",
            "86dd799e-f1c0-4b08-9a8d-56d85fe256e1"
          ],
          "display_name": false
        },
        {
          "uuid": "4474b50b-5326-4dc4-a4d3-7d0ca029132a",
          "name": "GAIA",
          "stdName": "GAIA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1deee7d3-4b66-4227-8e05-5ed849300763",
            "86dd799e-f1c0-4b08-9a8d-56d85fe256e1"
          ],
          "display_name": false
        },
        {
          "uuid": "86544904-eb77-4514-8b52-1b42cbbda618",
          "name": "MTF-753",
          "stdName": "MTF-753",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1deee7d3-4b66-4227-8e05-5ed849300763",
            "86dd799e-f1c0-4b08-9a8d-56d85fe256e1"
          ],
          "display_name": false
        },
        {
          "uuid": "431c2a71-0261-40eb-8f31-ff71f6f9fd9e",
          "name": "N-(2-(1,3-DIMETHYLBUTYL)-3-THIENYL)-1-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "stdName": "N-(2-(1,3-DIMETHYLBUTYL)-3-THIENYL)-1-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1deee7d3-4b66-4227-8e05-5ed849300763",
            "86dd799e-f1c0-4b08-9a8d-56d85fe256e1"
          ],
          "display_name": false
        },
        {
          "uuid": "bc96c0e0-cd44-49da-8a99-a1b52615f7fb",
          "name": "PENTHIOPYRAD",
          "stdName": "PENTHIOPYRAD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7597edb-b89d-49ad-90b7-1354216c9289",
            "f4171641-5680-49b8-b99e-13263c600030",
            "1deee7d3-4b66-4227-8e05-5ed849300763",
            "86dd799e-f1c0-4b08-9a8d-56d85fe256e1",
            "08158bf0-e3e3-41a6-9a5e-3dc5465e4a4f"
          ],
          "display_name": true
        },
        {
          "uuid": "0ae63c73-a831-45cc-86ae-fea047ffb73f",
          "name": "PENTHIOPYRAD [ISO]",
          "stdName": "PENTHIOPYRAD [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1deee7d3-4b66-4227-8e05-5ed849300763",
            "86dd799e-f1c0-4b08-9a8d-56d85fe256e1"
          ],
          "display_name": false
        },
        {
          "uuid": "7a99e215-df94-4892-acbf-7201c7d435c3",
          "name": "PENTHIOPYRAD [MI]",
          "stdName": "PENTHIOPYRAD [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86dd799e-f1c0-4b08-9a8d-56d85fe256e1",
            "08158bf0-e3e3-41a6-9a5e-3dc5465e4a4f"
          ],
          "display_name": false
        },
        {
          "uuid": "4f94ce77-2d84-421c-8634-5a3be0df04be",
          "name": "VERTISAN",
          "stdName": "VERTISAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1deee7d3-4b66-4227-8e05-5ed849300763",
            "86dd799e-f1c0-4b08-9a8d-56d85fe256e1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1deee7d3-4b66-4227-8e05-5ed849300763",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "86dd799e-f1c0-4b08-9a8d-56d85fe256e1",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08158bf0-e3e3-41a6-9a5e-3dc5465e4a4f",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "350a74c1-e3bc-437a-8fb7-a3853c4343c7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392625000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72a1880f-7798-4d19-93e2-34220fa43a4c",
          "citation": "SRS import [FAT7900E5H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=FAT7900E5H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392625000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7597edb-b89d-49ad-90b7-1354216c9289",
          "citation": "PENTHIOPYRAD [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f4171641-5680-49b8-b99e-13263c600030",
          "citation": "PENTHIOPYRAD [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e75d842f-d0ff-a936-34bf-ad7488d6976a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=183675-82-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "540f6785-1b5b-141a-6414-e1e2e3a917bc",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "ebdabc01-3c57-4f7d-982a-30ac13f080a8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f30bbf34-ab86-43bb-b1bd-f0031db7af6e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0581a78e-2431-46a9-9acb-485e221e569d",
          "id": "0581a78e-2431-46a9-9acb-485e221e569d",
          "molfile": "\n  Marvin  01132100352D          \n\n 24 25  0  0  0  0            999 V2000\n    6.1506   -6.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4361   -5.9351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7216   -6.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4361   -5.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7216   -4.6975    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.0072   -5.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7216   -3.8725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0542   -3.3876    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3092   -2.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1342   -2.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3891   -3.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1737   -3.6425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7868   -3.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6153   -2.2835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5714   -3.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2388   -2.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9063   -3.3455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6909   -3.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6514   -4.1301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8264   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3414   -4.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5210   -4.7113    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8565   -5.4650    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6770   -5.5512    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n 11  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 20  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CC(C)c1c(ccs1)NC(=O)c2cn(C)nc2C(F)(F)F",
          "formula": "C16H20F3N3OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e1577a38-7c44-4da4-bce8-549a1d6d9721"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "359.4114",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "db0d8978-1274-47f5-ab23-1d86dd652b5d",
      "version": "4",
      "structure": {
        "id": "4d71703d-e32c-4434-8f67-0f15e96c0d8d",
        "molfile": "\n  Marvin  01132104022D          \n\n 24 25  0  0  0  0            999 V2000\n    6.7868   -3.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1737   -3.6425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3891   -3.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7216   -3.8725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7216   -4.6975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4361   -5.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4361   -5.9351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1506   -6.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7216   -6.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0072   -5.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0542   -3.3876    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3092   -2.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1342   -2.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6153   -2.2835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5714   -3.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8264   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3414   -4.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5210   -4.7113    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8565   -5.4650    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6770   -5.5512    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6514   -4.1301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9063   -3.3455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2388   -2.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6909   -3.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  4 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n  3 13  1  0  0  0  0\n  1 14  2  0  0  0  0\n  1 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 16 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 15 23  2  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CC(C)c1c(ccs1)NC(=O)c2cn(C)nc2C(F)(F)F",
        "formula": "C16H20F3N3OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "359.4114",
        "optical_activity": "( + / - )",
        "references": [
          "72a1880f-7798-4d19-93e2-34220fa43a4c",
          "1deee7d3-4b66-4227-8e05-5ed849300763"
        ],
        "stereo_centers": 1
      },
      "unii": "FAT7900E5H"
    }
  ]
}