{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "de6037ff-a6f3-4276-be63-5f68cc6c0ac2", "code": "1035330-36-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1035330-36-9", "code_system": "CAS", "references": [ "338d6f16-1eda-43e1-ba13-f2caf145b344", "1c154b5f-8d64-4458-9787-fd7cf53473c5" ] }, { "uuid": "5347bbc4-2698-4f0c-b63f-668a52b95b6a", "code": "629086", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:29183", "code_system": "EPA PESTICIDE CODE", "references": [ "338d6f16-1eda-43e1-ba13-f2caf145b344" ] }, { "uuid": "ef305ee8-410d-46c8-b834-f7d1ab6cef6c", "code": "86278326", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86278326", "code_system": "PUBCHEM", "references": [ "338d6f16-1eda-43e1-ba13-f2caf145b344" ] }, { "uuid": "032502be-0807-4cc4-aaa5-c62ffcc0dd98", "code": "F90927PAPU", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "028f162a-ae3e-fef3-6c5d-ddef565f6c19", "code": "DTXSID5037602", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5037602", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "9bc0d6cb-9176-443a-81de-55a57bfb8ded", "name": "2-(TERT-BUTYL)PYRIMIDIN-5-YL ETHYL ISOPROPYL PHOSPHATE", "stdName": "2-(TERT-BUTYL)PYRIMIDIN-5-YL ETHYL ISOPROPYL PHOSPHATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "42dd0fe9-b64a-4e6f-9e05-599c546e2169", "1c8d9938-7797-4e7e-b9a2-3abd15a53081" ], "display_name": true }, { "uuid": "d025c19d-91a5-45d3-bcb8-e7ece4e434e0", "name": "PHOSPHORIC ACID, 2-(1,1-DIMETHYLETHYL)-5-PYRIMIDINYL ETHYL 1-METHYLETHYL ESTER", "stdName": "PHOSPHORIC ACID, 2-(1,1-DIMETHYLETHYL)-5-PYRIMIDINYL ETHYL 1-METHYLETHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a9f2936f-52d8-47cb-8422-ba7d35a303b0", "1c8d9938-7797-4e7e-b9a2-3abd15a53081" ], "display_name": false } ], "references": [ { "uuid": "a9f2936f-52d8-47cb-8422-ba7d35a303b0", "citation": "EPA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "1c8d9938-7797-4e7e-b9a2-3abd15a53081", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "42dd0fe9-b64a-4e6f-9e05-599c546e2169", "citation": "CD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "338d6f16-1eda-43e1-ba13-f2caf145b344", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392625000, "tags": [ "NOMEN" ] }, { "uuid": "3f4b36b5-8385-4f79-a677-7d6028a8f33c", "citation": "SRS import [F90927PAPU]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F90927PAPU", "doc_type": "SRS", "public_domain": true, "document_date": 1493392625000, "tags": [ "NOMEN" ] }, { "uuid": "661f7543-a6e4-4d0f-b950-d1ee61eeb71b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1c154b5f-8d64-4458-9787-fd7cf53473c5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7f15f01f-f9bd-4e2e-a496-bd3874023a2b", "id": "7f15f01f-f9bd-4e2e-a496-bd3874023a2b", "molfile": "\n Marvin 01132106362D \n\n 20 20 0 0 0 0 999 V2000\n -2.8579 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 1.2375 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 4 10 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 16 2 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 17 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 17 20 1 0 0 0 0\nM END", "smiles": "CCOP(=O)(OC(C)C)Oc1cnc(C(C)(C)C)nc1", "formula": "C13H23N2O4P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "93e21e8a-739b-4d56-be8c-44b5b3342654" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "302.307", "optical_activity": "NONE", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "15b2b782-11c1-46de-a7ea-0fcfa30d3350", "version": "3", "structure": { "id": "d83f61f8-f1f0-4015-b84f-9a759b2a8c45", "molfile": "\n Marvin 01132111122D \n\n 20 20 0 0 0 0 999 V2000\n -0.7145 1.2375 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 6 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 12 15 1 0 0 0 0\n 6 12 1 0 0 0 0\n 3 9 1 0 0 0 0\n 16 17 1 0 0 0 0\n 4 16 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 5 18 1 0 0 0 0\nM END", "smiles": "CCOP(=O)(OC(C)C)Oc1cnc(C(C)(C)C)nc1", "formula": "C13H23N2O4P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "302.307", "optical_activity": "NONE", "references": [ "3f4b36b5-8385-4f79-a677-7d6028a8f33c", "661f7543-a6e4-4d0f-b950-d1ee61eeb71b" ], "stereo_centers": 1 }, "unii": "F90927PAPU" } ] }