{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ca66599c-b829-432f-8aec-cc1f6cbbb0e8", "code": "6408-72-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6408-72-6", "code_system": "CAS", "references": [ "4c1e6342-fd3c-491b-aab9-ced1b23d363a", "717b9845-0c6d-4e97-a090-e82a12eab36e" ] }, { "uuid": "f1604f1b-060a-4a9d-b01b-d6e875b9ab43", "code": "229-066-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.424", "code_system": "ECHA (EC/EINECS)", "references": [ "4c1e6342-fd3c-491b-aab9-ced1b23d363a" ] }, { "uuid": "ef949c9c-353d-460c-9ca7-1de82bdbc0ee", "code": "80839", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/80839", "code_system": "PUBCHEM", "references": [ "4c1e6342-fd3c-491b-aab9-ced1b23d363a" ] }, { "uuid": "d12ea11d-2784-11b8-2069-af25bdf6e4c6", "code": "DTXSID1064320", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1064320", "code_system": "EPA CompTox", "references": [ "7f7f08eb-a0e0-4061-3fa3-b266415734ae" ] }, { "uuid": "b979cd97-4323-4e61-bec9-4fb460592339", "code": "F8JPA86TBN", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "92eedc92-2f5d-43ba-bb67-c286f57749ef", "name": "1,4-Diamino-2,3-diphenoxy-9,10-anthracenedione", "stdName": "1,4-DIAMINO-2,3-DIPHENOXY-9,10-ANTHRACENEDIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "717b9845-0c6d-4e97-a090-e82a12eab36e" ], "display_name": true }, { "uuid": "d041fc95-0858-47f2-b696-d64f00ed9b68", "name": "9,10-Anthracenedione, 1,4-diamino-2,3-diphenoxy-", "stdName": "9,10-ANTHRACENEDIONE, 1,4-DIAMINO-2,3-DIPHENOXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fa5e933d-dab5-4b89-bd6c-812df09afa69", "6a6daa9e-1c90-4027-9cdf-961bdcdc307a" ], "display_name": false } ], "references": [ { "uuid": "fa5e933d-dab5-4b89-bd6c-812df09afa69", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6a6daa9e-1c90-4027-9cdf-961bdcdc307a", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4c1e6342-fd3c-491b-aab9-ced1b23d363a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393965000, "tags": [ "NOMEN" ] }, { "uuid": "7f7f08eb-a0e0-4061-3fa3-b266415734ae", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6408-72-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "717b9845-0c6d-4e97-a090-e82a12eab36e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "69dfda62-063f-4107-863c-85a52a22e910", "id": "69dfda62-063f-4107-863c-85a52a22e910", "molfile": "\n Marvin 01132105302D \n\n 32 36 0 0 0 0 999 V2000\n 4.3643 -5.5806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3535 -5.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0592 -4.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9271 -5.1346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9452 -5.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6706 -6.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6869 -7.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9820 -7.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2609 -7.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2403 -6.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0402 -3.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8857 -3.3159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8665 -2.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1404 -2.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1229 -1.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8271 -0.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5489 -1.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5706 -2.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3199 -3.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3097 -2.9427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6141 -3.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8916 -3.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8744 -2.6383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1838 -3.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4614 -3.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7598 -3.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7724 -4.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4950 -5.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2026 -4.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9252 -5.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9403 -5.9361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6289 -4.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 32 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 11 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 19 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 18 13 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 32 1 0 0 0 0\n 23 22 2 0 0 0 0\n 22 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 29 2 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)Oc2c(c3c(c(c2Oc4ccccc4)N)C(=O)c5ccccc5C3=O)N", "formula": "C26H18N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c710443b-ac22-4b10-b8d8-75edbdf51eb3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "422.4331", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c8ce91d0-02ef-4da7-8a2a-a8e0f420f5ee", "version": "5", "structure": { "id": "abe3045b-679c-4144-a722-96b77dae8227", "molfile": "\n Marvin 01132108552D \n\n 32 36 0 0 0 0 999 V2000\n 2.8744 -2.6383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8916 -3.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1838 -3.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2026 -4.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9252 -5.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9403 -5.9361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6289 -4.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3535 -5.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3643 -5.5806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0592 -4.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9271 -5.1346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9452 -5.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6706 -6.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6869 -7.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9820 -7.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2609 -7.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2403 -6.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0402 -3.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8857 -3.3159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8665 -2.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1404 -2.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1229 -1.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8271 -0.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5489 -1.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5706 -2.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3199 -3.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3097 -2.9427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6141 -3.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4950 -5.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7724 -4.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7598 -3.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4614 -3.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 12 2 0 0 0 0\n 10 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 20 2 0 0 0 0\n 18 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 28 2 1 0 0 0 0\n 28 7 2 0 0 0 0\n 4 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 3 2 0 0 0 0\nM END", "smiles": "c1ccc(cc1)Oc2c(c3c(c(c2Oc4ccccc4)N)C(=O)c5ccccc5C3=O)N", "formula": "C26H18N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "422.4331", "optical_activity": "NONE", "references": [ "fa5e933d-dab5-4b89-bd6c-812df09afa69" ], "stereo_centers": 0 }, "unii": "F8JPA86TBN" } ] }