{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "083a71f8-352c-498c-a6d2-e0a53ce3e900",
          "code": "B05XB01",
          "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|BLOOD SUBSTITUTES AND PERFUSION SOLUTIONS|I.V. SOLUTION ADDITIVES|Amino acids|arginine hydrochloride",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=B05XB01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "166d5d70-c708-43ee-ad68-93ddc6e84abc",
          "code": "QB05XB01",
          "comments": "VATC|BLOOD SUBSTITUTES AND PERFUSION SOLUTIONS|I.V. SOLUTION ADDITIVES|Amino acids|arginine hydrochloride",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB05XB01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "5b932b8f-8767-4594-b3c0-a9209f142cab",
          "code": "1119-34-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1119-34-2",
          "code_system": "CAS",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049",
            "8faf756b-930a-4367-9194-4370be0c3416"
          ]
        },
        {
          "uuid": "2b7af21d-4d14-49d3-8d6a-8fcc406f5f81",
          "code": "C29606",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29606",
          "code_system": "NCI_THESAURUS",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "b7cf30d3-87c7-4ab2-8d8c-14910c40509f",
          "code": "21 CFR 172.320",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart D--Special Dietary and Nutritional Additives|Sec. 172.320 Amino acids.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.320",
          "code_system": "CFR",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "d03c73e5-4ebf-43a9-9dd6-4bb6cf0a425f",
          "code": "214-275-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.978",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "96878774-d8e8-40eb-a05d-da394992002d",
          "code": "89918",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/89918/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "51150414-d1d5-4357-9cd6-b81fd5d07146",
          "code": "m2040",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2040?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "d74fde39-5d28-493b-abfe-429d85aa709e",
          "code": "SUB30001",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "b76be491-3ccd-413d-830c-0facbd41117a",
          "code": "SUB00579MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "70fbe86d-bf44-4531-812e-79972772004e",
          "code": "SUB22706",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "23a27272-93fe-4124-aeb2-1eb8542a62ad",
          "code": "CHEMBL1200381",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200381",
          "code_system": "ChEMBL",
          "references": [
            "56f36871-90d8-433a-b334-4ea768797049"
          ]
        },
        {
          "uuid": "c21b1528-e9b5-9ec7-d10b-ec9288e02c4b",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a8ad1b79-42fa-0e32-a82a-da98728c4ead"
          ]
        },
        {
          "uuid": "ee2df7fc-3c1e-f1fe-bc78-41ef0a9ae722",
          "code": "C231",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Amino Acid, Peptide, or Protein[C232]|Amino Acid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C231",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a8ad1b79-42fa-0e32-a82a-da98728c4ead"
          ]
        },
        {
          "uuid": "aad4389f-bb80-a9e7-5814-ec8dabc8e2ab",
          "code": "66250",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66250",
          "code_system": "PUBCHEM",
          "references": [
            "b1f1d116-0c1c-d3f2-ac60-230883a5f26d"
          ]
        },
        {
          "uuid": "7e398c70-b16d-0706-493d-68649b20f6d9",
          "code": "1549",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1549",
          "code_system": "DRUG CENTRAL",
          "references": [
            "a8ad1b79-42fa-0e32-a82a-da98728c4ead"
          ]
        },
        {
          "uuid": "68a7d25a-2a33-0172-cb8d-d1878c8ab17b",
          "code": "DBSALT000869",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DBSALT000869",
          "code_system": "DRUG BANK",
          "references": [
            "a8ad1b79-42fa-0e32-a82a-da98728c4ead"
          ]
        },
        {
          "uuid": "4c58976e-488c-4e3f-bd10-c57444cc18fa",
          "code": "F7LTH1E20Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "327bd469-068e-0fd4-3296-d4272bd2a1e7",
          "code": "1042601",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1042601",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "a8ad1b79-42fa-0e32-a82a-da98728c4ead"
          ]
        },
        {
          "uuid": "eecd56a0-aa93-a542-ba38-62ec131ac1a9",
          "code": "100000085170",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f64f9e09-a72f-ec84-3abe-2872045f7b9d"
          ]
        },
        {
          "uuid": "123bb21c-4f2d-1098-0ceb-89aec5e879b4",
          "code": "7914",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7914",
          "code_system": "NSC",
          "references": [
            "f0299086-e8df-c8eb-5fea-8da5a6e7f505"
          ]
        },
        {
          "uuid": "fcb342d7-095c-bd7b-7d52-26c9a430167a",
          "code": "F7LTH1E20Y",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=F7LTH1E20Y",
          "code_system": "DAILYMED",
          "references": [
            "77cc8f70-9df2-b855-db2a-3a3da6c5f030"
          ]
        },
        {
          "uuid": "3a877a4b-4681-b348-5b3d-94287db3c2ff",
          "code": "DTXSID20883650",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20883650",
          "code_system": "EPA CompTox",
          "references": [
            "a8ad1b79-42fa-0e32-a82a-da98728c4ead"
          ]
        },
        {
          "uuid": "62e78c62-bb32-42a4-bcc0-150cbfaf899f",
          "code": "203450",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=203450",
          "code_system": "NSC",
          "references": [
            "f0299086-e8df-c8eb-5fea-8da5a6e7f505"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cf8a3d58-a88c-4e72-ba6e-5407114b13dc",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "645601f9-bc99-4e8c-8616-fc20296e8dd2",
            "refuuid": "24d940bc-1e16-44c1-841a-40740861e06f",
            "name": "ARGININE",
            "unii": "94ZLA3W45F",
            "linking_id": "94ZLA3W45F",
            "ref_pname": "ARGININE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e8e80ef3-7b92-49f2-a5f7-3131bfc0f7c0",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "085bc217-d95a-44f2-8457-86dd5504fb12",
            "refuuid": "24d940bc-1e16-44c1-841a-40740861e06f",
            "name": "ARGININE",
            "unii": "94ZLA3W45F",
            "linking_id": "94ZLA3W45F",
            "ref_pname": "ARGININE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3e5fac7a-47fe-4dd7-9b47-92e6bfddfcb8",
          "name": "ARGININE HCL",
          "stdName": "ARGININE HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "003104eb-d10e-4b55-a3ee-f8e7c4a33b9e",
            "b6d63b2c-afe5-4b4b-93a6-d97b0aae1fb7",
            "72457998-8035-4fa5-b61a-4986d316e9bb"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "794b3a34-5842-45ee-bf98-432810aceacb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3ae47590-eaa1-4e7a-b7de-a7f5c0a26fef",
          "name": "ARGININE HYDROCHLORIDE",
          "stdName": "ARGININE HYDROCHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e53c2dc-e41e-425c-a827-81da37a36436",
            "3808995c-ede3-461f-b2ec-8bc93108dfe1",
            "d313cacb-3eff-4e27-8b40-c221bf66ff41",
            "5d5e4dc9-091d-413d-b04f-91d944e444aa",
            "f153cc67-f97f-4f89-97bc-f4dcc06406c1",
            "5359f984-7e97-4cd2-8c25-6fbfd3eb9c95",
            "4dd1ab8f-3066-47cd-b828-1dee5d96e760",
            "af8b64b7-7ec0-4350-9a65-8f45a20ac0c1",
            "3d606ec4-c457-438c-8ce7-1539c0fa7eb8",
            "eb04c139-aa54-407a-9718-23d3a714c721",
            "2fac9aae-9cc6-4140-9948-4ed9ad991671",
            "a4e08065-5a75-4100-8926-7119888a2fee",
            "aabd4221-dcf1-4576-bebf-84989d14a29d",
            "24d1be78-345a-43f4-b34b-d13fe434424d",
            "5ada1e21-029f-435e-9e65-87b689f5d195",
            "d91ed2f7-0d5e-48df-8436-c27226e29a48",
            "25a815fc-9b5f-4ee4-9ded-1356c5df4f79"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "fb0579c1-6c13-4c14-9f6d-8ea777ec0c15",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "f612d44e-dacf-e782-0d8f-86500a48b7ac",
          "name": "ARGININE HYDROCHLORIDE [EP MONOGRAPH]",
          "stdName": "ARGININE HYDROCHLORIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "863d667f-8df9-8ef2-18b1-25aafe008afd"
          ],
          "display_name": false
        },
        {
          "uuid": "cb755944-b290-42c9-ad83-c49fee14a429",
          "name": "ARGININE HYDROCHLORIDE [MART.]",
          "stdName": "ARGININE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25a815fc-9b5f-4ee4-9ded-1356c5df4f79"
          ],
          "display_name": false
        },
        {
          "uuid": "52781a7d-e663-49ba-a0a0-b5d269ed6a84",
          "name": "ARGININE HYDROCHLORIDE [MI]",
          "stdName": "ARGININE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3808995c-ede3-461f-b2ec-8bc93108dfe1"
          ],
          "display_name": false
        },
        {
          "uuid": "bc692c8d-2500-4b3d-927b-3790b7d29679",
          "name": "ARGININE HYDROCHLORIDE [ORANGE BOOK]",
          "stdName": "ARGININE HYDROCHLORIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4e08065-5a75-4100-8926-7119888a2fee"
          ],
          "display_name": false
        },
        {
          "uuid": "2db1a487-a9f3-4c5e-96ba-8eecbb1528ee",
          "name": "ARGININE HYDROCHLORIDE [USAN]",
          "stdName": "ARGININE HYDROCHLORIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d606ec4-c457-438c-8ce7-1539c0fa7eb8"
          ],
          "display_name": false
        },
        {
          "uuid": "5d440f43-1365-c7d0-c08f-768f99e29d26",
          "name": "ARGININE HYDROCHLORIDE [USP MONOGRAPH]",
          "stdName": "ARGININE HYDROCHLORIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8af220f9-538e-7fdd-eded-8b8549ecc0c6"
          ],
          "display_name": false
        },
        {
          "uuid": "c93f0f28-4b03-985d-42d1-c04fa1dbb01e",
          "name": "ARGININE HYDROCHLORIDE [USP-RS]",
          "stdName": "ARGININE HYDROCHLORIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4abb75e4-7db5-6356-bc4f-eef2589ef7b7"
          ],
          "display_name": false
        },
        {
          "uuid": "fb52dec9-faeb-4703-8897-6aa40fc312aa",
          "name": "ARGININE HYDROCHLORIDE [VANDF]",
          "stdName": "ARGININE HYDROCHLORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af8b64b7-7ec0-4350-9a65-8f45a20ac0c1"
          ],
          "display_name": false
        },
        {
          "uuid": "6e838bf0-338e-4bd9-b05f-3bec9bac546d",
          "name": "ARGININE, L-, HYDROCHLORIDE",
          "stdName": "ARGININE, L-, HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7430c379-d137-4580-ac79-827294c6958f"
          ],
          "display_name": false
        },
        {
          "uuid": "0ec755d4-1ab0-41ad-d018-77319aa5b32d",
          "name": "Arginine hydrochloride [WHO-DD]",
          "stdName": "ARGININE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37266803-50f2-f55c-66d5-d79255dc055d"
          ],
          "display_name": false
        },
        {
          "uuid": "880cac75-7696-4f21-8776-14fa8c7d67a0",
          "name": "L-(+)-ARGININE MONOHYDROCHLORIDE",
          "stdName": "L-(+)-ARGININE MONOHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29863951-43b5-4821-b055-ba3144e9de6d"
          ],
          "display_name": false
        },
        {
          "uuid": "c777d535-cec8-4717-ba62-2553254213dd",
          "name": "L-ARGININE HCL",
          "stdName": "L-ARGININE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15516c4c-8838-49b0-ae4c-e0c93deb0892"
          ],
          "display_name": false
        },
        {
          "uuid": "d9782aed-c30d-4bfc-9265-90bc8adf3778",
          "name": "L-ARGININE HYDROCHLORIDE",
          "stdName": "L-ARGININE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1696db9f-8be2-4787-a892-3c15efa29820"
          ],
          "display_name": false
        },
        {
          "uuid": "f8dadbfa-5736-4d18-9b74-a777b07b4832",
          "name": "L-ARGININE HYDROCHLORIDE [JAN]",
          "stdName": "L-ARGININE HYDROCHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16414a0-417c-cc78-e1cc-781f2dfca64e"
          ],
          "display_name": false
        },
        {
          "uuid": "56bf7fd0-9f3e-4276-814d-393d3674ce75",
          "name": "L-ARGININE MONOHYDROCHLORIDE",
          "stdName": "L-ARGININE MONOHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "703e0e5d-c3cd-4044-a06d-93c94663f7b8",
            "29863951-43b5-4821-b055-ba3144e9de6d",
            "ae3a1fb9-3fd5-4cf3-b0cb-78e99b107691"
          ],
          "display_name": false
        },
        {
          "uuid": "516409b0-c8c5-49aa-a861-816007ad89f9",
          "name": "L-ARGININE MONOHYDROCHLORIDE [FCC]",
          "stdName": "L-ARGININE MONOHYDROCHLORIDE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "703e0e5d-c3cd-4044-a06d-93c94663f7b8"
          ],
          "display_name": false
        },
        {
          "uuid": "323321b8-b2bb-419e-8cfb-82fafe109275",
          "name": "NSC-203450",
          "stdName": "NSC-203450",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ed413d1-8b7c-4f6a-a5ef-962a6de4ef96"
          ],
          "display_name": false
        },
        {
          "uuid": "553aa403-92b5-4d41-91f4-5d66175212db",
          "name": "NSC-7914",
          "stdName": "NSC-7914",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ed413d1-8b7c-4f6a-a5ef-962a6de4ef96"
          ],
          "display_name": false
        },
        {
          "uuid": "bfb4d232-0c7f-4e12-ae86-486c6f281497",
          "name": "R-GENE 10",
          "stdName": "R-GENE 10",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29863951-43b5-4821-b055-ba3144e9de6d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2e53c2dc-e41e-425c-a827-81da37a36436",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "29863951-43b5-4821-b055-ba3144e9de6d",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72457998-8035-4fa5-b61a-4986d316e9bb",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d606ec4-c457-438c-8ce7-1539c0fa7eb8",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f153cc67-f97f-4f89-97bc-f4dcc06406c1",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aabd4221-dcf1-4576-bebf-84989d14a29d",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1696db9f-8be2-4787-a892-3c15efa29820",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4e08065-5a75-4100-8926-7119888a2fee",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25a815fc-9b5f-4ee4-9ded-1356c5df4f79",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "703e0e5d-c3cd-4044-a06d-93c94663f7b8",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "003104eb-d10e-4b55-a3ee-f8e7c4a33b9e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7430c379-d137-4580-ac79-827294c6958f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d5e4dc9-091d-413d-b04f-91d944e444aa",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af8b64b7-7ec0-4350-9a65-8f45a20ac0c1",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3808995c-ede3-461f-b2ec-8bc93108dfe1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ed413d1-8b7c-4f6a-a5ef-962a6de4ef96",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56f36871-90d8-433a-b334-4ea768797049",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389712000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddbc1885-ebf7-4e91-a666-a3bb3356c18d",
          "citation": "SRS import [F7LTH1E20Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F7LTH1E20Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389712000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24d1be78-345a-43f4-b34b-d13fe434424d",
          "citation": "ARGININE HYDROCHLORIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5359f984-7e97-4cd2-8c25-6fbfd3eb9c95",
          "citation": "ARGININE HYDROCHLORIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4dd1ab8f-3066-47cd-b828-1dee5d96e760",
          "citation": "ARGININE HYDROCHLORIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5ada1e21-029f-435e-9e65-87b689f5d195",
          "citation": "ARGININE HYDROCHLORIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d313cacb-3eff-4e27-8b40-c221bf66ff41",
          "citation": "ARGININE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae3a1fb9-3fd5-4cf3-b0cb-78e99b107691",
          "citation": "L-ARGININE MONOHYDROCHLORIDE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b6d63b2c-afe5-4b4b-93a6-d97b0aae1fb7",
          "citation": "ARGININE HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d91ed2f7-0d5e-48df-8436-c27226e29a48",
          "citation": "ARGININE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2fac9aae-9cc6-4140-9948-4ed9ad991671",
          "citation": "ARGININE HYDROCHLORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb04c139-aa54-407a-9718-23d3a714c721",
          "citation": "ARGININE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b16414a0-417c-cc78-e1cc-781f2dfca64e",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "a8ad1b79-42fa-0e32-a82a-da98728c4ead",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8faf756b-930a-4367-9194-4370be0c3416",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "81451cad-6587-5874-eb1e-817b404a1d0f",
          "citation": "USP43-NF38 - 371, Arginine Hydrochloride Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1f1d116-0c1c-d3f2-ac60-230883a5f26d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "15516c4c-8838-49b0-ae4c-e0c93deb0892",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true
        },
        {
          "uuid": "4abb75e4-7db5-6356-bc4f-eef2589ef7b7",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "863d667f-8df9-8ef2-18b1-25aafe008afd",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "8af220f9-538e-7fdd-eded-8b8549ecc0c6",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "f0299086-e8df-c8eb-5fea-8da5a6e7f505",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "77cc8f70-9df2-b855-db2a-3a3da6c5f030",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "37266803-50f2-f55c-66d5-d79255dc055d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f64f9e09-a72f-ec84-3abe-2872045f7b9d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "34935ca1-4891-4fe5-928a-391a129f1e4f",
          "id": "34935ca1-4891-4fe5-928a-391a129f1e4f",
          "molfile": "\n  Marvin  01132102482D          \n\n  1  0  0  0  1  0            999 V2000\n    3.6191   -3.2455    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9e875386-e1ac-426e-b59b-757740d47f6d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "d9206ec1-1eff-4605-8b39-b4825f296d3f",
          "id": "d9206ec1-1eff-4605-8b39-b4825f296d3f",
          "molfile": "\n  Marvin  01132111152D          \n\n 12 11  0  0  1  0            999 V2000\n   -1.8497   -3.1988    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -1.8575   -4.0238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1415   -2.7967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4099   -3.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2906   -2.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0066   -3.2377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7382   -2.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7382   -1.9873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4387   -3.2455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5736   -2.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5736   -1.9613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2896   -3.1703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  END",
          "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N",
          "formula": "C6H14N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5950e0ea-3209-42ef-8298-c61c83120a1a"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "174.2012",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "087057d4-af24-4a18-9433-d4cb55072565",
      "version": "31",
      "structure": {
        "id": "297121a6-951c-486c-a948-78ce695a9fd7",
        "molfile": "\n  Marvin  01132102162D          \n\n 13 11  0  0  1  0            999 V2000\n   16.8370   -3.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5251   -3.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8370   -3.0650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5251   -3.0390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1053   -4.3154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2489   -4.2765    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   17.5375   -4.3232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8090   -4.2480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2411   -5.1015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3893   -3.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9572   -3.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6889   -4.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3780   -4.6807    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6 11  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  6  9  1  6  0  0  0\n 10  5  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 10  1  0  0  0  0\nM  END",
        "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N.Cl",
        "formula": "C6H14N4O2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "210.6621",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2e53c2dc-e41e-425c-a827-81da37a36436",
          "ddbc1885-ebf7-4e91-a666-a3bb3356c18d"
        ],
        "stereo_centers": 1
      },
      "unii": "F7LTH1E20Y"
    }
  ]
}