{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8246298c-c257-437d-bbd8-bae1f66a504e",
          "code": "51-18-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51-18-3",
          "code_system": "CAS",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e",
            "a8a25110-61ac-4751-8c89-2cca73dedb78"
          ]
        },
        {
          "uuid": "05a2995f-cea2-4f0e-99ab-7f25ec583e1a",
          "code": "C29858",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29858",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e"
          ]
        },
        {
          "uuid": "b2b765b0-b351-4bc7-8884-8162086e735c",
          "code": "D014265",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014265",
          "code_system": "MESH",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e"
          ]
        },
        {
          "uuid": "15df6e1e-8115-4243-b905-978c424c5341",
          "code": "TRIETHYLENEMELAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Triethylenemelamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e"
          ]
        },
        {
          "uuid": "23b6fa85-7601-4977-971b-6c371927f429",
          "code": "329",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=329",
          "code_system": "INN",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e"
          ]
        },
        {
          "uuid": "4ef1e33d-b795-4cd7-be66-20668d09c877",
          "code": "m11106",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11106?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e"
          ]
        },
        {
          "uuid": "a5ebe45a-3bba-4709-9919-686f8089545f",
          "code": "SUB11243MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e"
          ]
        },
        {
          "uuid": "35a5d1b8-cf59-4cad-beae-798fe76e96d5",
          "code": "CHEMBL502384",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL502384",
          "code_system": "ChEMBL",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e"
          ]
        },
        {
          "uuid": "1a9423e5-cb72-4474-9753-2d7adf8ba355",
          "code": "5799",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5799",
          "code_system": "PUBCHEM",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e"
          ]
        },
        {
          "uuid": "49e19a35-9a27-462b-9b07-bb983ed99db4",
          "code": "200-083-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.076",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f1b0ffb8-4ecc-4657-922b-a3ecec60435e"
          ]
        },
        {
          "uuid": "ce354f20-837b-eba4-8144-23968b03405d",
          "code": "4000",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4000",
          "code_system": "HSDB",
          "references": [
            "3af2502f-77fb-e48f-c33a-ba5514c30a82"
          ]
        },
        {
          "uuid": "88e8fe74-a1c1-9c8d-7e70-1c3d109296ca",
          "code": "DTXSID3026225",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3026225",
          "code_system": "EPA CompTox",
          "references": [
            "3971d001-f272-78ce-574c-30627efdc7cb"
          ]
        },
        {
          "uuid": "06392de5-961e-31cb-5cec-c71480af8939",
          "code": "C292",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Alkylating Agent[C1590]|Ethylenimine Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C292",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a3343a8d-5fb6-5fdf-b6f9-5fe007667055"
          ]
        },
        {
          "uuid": "22747831-b3ee-4d00-a1f5-0b3601c4b98c",
          "code": "F7IY6HZG9D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b28e2d80-754b-c903-054f-72f0dffd9bb1",
          "code": "2739",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2739",
          "code_system": "DRUG CENTRAL",
          "references": [
            "a3343a8d-5fb6-5fdf-b6f9-5fe007667055"
          ]
        },
        {
          "uuid": "06fe7997-06ad-f1b1-e1f8-b3731e51d606",
          "code": "DB14031",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14031",
          "code_system": "DRUG BANK",
          "references": [
            "a3343a8d-5fb6-5fdf-b6f9-5fe007667055"
          ]
        },
        {
          "uuid": "1ae4d75e-6291-6444-6150-5073329599ff",
          "code": "27919",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27919",
          "code_system": "CHEBI",
          "references": [
            "a3343a8d-5fb6-5fdf-b6f9-5fe007667055"
          ]
        },
        {
          "uuid": "cef36e02-b507-d40c-3132-6556a5e42939",
          "code": "100000077506",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "66bd4128-61b2-b3a9-82f1-8042919c0535"
          ]
        },
        {
          "uuid": "76ee9a4e-488c-d9fe-6ad5-9d7c672e6532",
          "code": "9706",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9706",
          "code_system": "NSC",
          "references": [
            "26c6e7e7-c6df-1a27-eee2-00287c10592f"
          ]
        },
        {
          "uuid": "f5e6a9c2-6fa3-b712-b862-3ccd64cf6dca",
          "code": "tretamine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tretamine.html",
          "code_system": "ALANWOOD",
          "references": [
            "dceadd9d-5f05-6b9e-79f3-084012473ec1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "382db50e-1a31-4ed6-8a0f-45f623d3b63f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4176acfb-3864-4a8f-b817-df455a1f3f25",
            "refuuid": "bd5aa35b-a47c-48f2-90c7-96353d39dbb6",
            "name": "TRIETHYLENEMELAMINE",
            "unii": "F7IY6HZG9D",
            "linking_id": "F7IY6HZG9D",
            "ref_pname": "TRIETHYLENEMELAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6da27a19-7f7b-4dde-ae24-0770cd3e2ea2",
          "name": "1,3,5-TRIAZINE, 2,4,6-TRIS(1-AZIRIDINYL)-.",
          "stdName": "1,3,5-TRIAZINE, 2,4,6-TRIS(1-AZIRIDINYL)-.",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58f82e2d-5442-4b26-a9c9-88b703681482"
          ],
          "display_name": false
        },
        {
          "uuid": "7136d348-32e0-4c9e-8fd8-fef45835ea69",
          "name": "2,4,6-TRI(AZIRIDIN-1-YL)-1,3,5-TRIAZINE",
          "stdName": "2,4,6-TRI(AZIRIDIN-1-YL)-1,3,5-TRIAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c2f7ab6-9a18-48f6-86ce-4b05c4e73fe4",
            "228f1cc6-8fc0-4d5c-9e11-b88d3926490a"
          ],
          "display_name": false
        },
        {
          "uuid": "4243b40b-7ef3-426c-8a7f-1020cfd90319",
          "name": "2,4,6-TRIS(1-AZIRIDINYL)-1,3,5-TRIAZINE",
          "stdName": "2,4,6-TRIS(1-AZIRIDINYL)-1,3,5-TRIAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "228f1cc6-8fc0-4d5c-9e11-b88d3926490a",
            "ca53034d-3db9-441f-b510-fc81448b9e5e"
          ],
          "display_name": false
        },
        {
          "uuid": "0990b63f-4425-a2e6-4b8d-0af3bca5a113",
          "name": "2,4,6-TRIS(1-AZIRIDINYL)-S-TRIAZINE",
          "stdName": "2,4,6-TRIS(1-AZIRIDINYL)-S-TRIAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cced716-28ad-bf3b-103e-835d576c6127"
          ],
          "display_name": false
        },
        {
          "uuid": "10677192-e06f-8827-874f-e11b033a8f9f",
          "name": "2,4,6-TRIS(1-AZIRIDINYL)-S-TRIAZINE [IARC]",
          "stdName": "2,4,6-TRIS(1-AZIRIDINYL)-S-TRIAZINE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cced716-28ad-bf3b-103e-835d576c6127"
          ],
          "display_name": false
        },
        {
          "uuid": "d704f548-8e46-47e2-942d-ee1699018951",
          "name": "NSC-9706",
          "stdName": "NSC-9706",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58f82e2d-5442-4b26-a9c9-88b703681482"
          ],
          "display_name": false
        },
        {
          "uuid": "89e8366c-6b40-401d-b7f1-3ec8e6ee78b8",
          "name": "TRETAMINE",
          "stdName": "TRETAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74718b2e-dd25-4133-91ee-2b0d407156c8",
            "612501f6-1386-4dda-bb0b-7178b6c16153",
            "c28fa2ee-2c60-4534-86a6-523acb6f6e8a",
            "58f82e2d-5442-4b26-a9c9-88b703681482",
            "7dbc4035-10f9-4303-b031-94feeee40c4c",
            "cc7c1388-c584-454e-84a6-6f6734d3a05a",
            "5abfd289-7ccc-411e-b753-6eb30de1c48c"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "eda75d08-07df-421c-bc00-b99c34b32df2",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "69b4ece5-fc8e-4218-a4d4-5059da4f900c",
          "name": "TRETAMINE [MART.]",
          "stdName": "TRETAMINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7dbc4035-10f9-4303-b031-94feeee40c4c"
          ],
          "display_name": false
        },
        {
          "uuid": "2b707357-3986-4610-ab4f-e774373b1dc8",
          "name": "TRIETHYLENE MELAMINE",
          "stdName": "TRIETHYLENE MELAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d1dcdde-6b83-414b-aee4-dd66b244c3bb"
          ],
          "display_name": false
        },
        {
          "uuid": "d9eeb85a-442f-48b0-9b2b-3df2116b5bb5",
          "name": "TRIETHYLENEMELAMINE",
          "stdName": "TRIETHYLENEMELAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "455c1e57-059d-47e2-b713-f7ec76d5a337",
            "7e1c5bb9-7890-4711-a5f3-7a49eb75d6af",
            "acc7d54c-3c3a-468b-97de-08bf8b5df2ee",
            "29de7c23-5322-4541-8b3c-2dcea44f0d5a",
            "cefeb2ff-8c0f-431b-9764-514afb9cfc53"
          ],
          "display_name": true
        },
        {
          "uuid": "8b5da47d-c708-483a-97d4-51b5cba20d75",
          "name": "TRIETHYLENEMELAMINE [HSDB]",
          "stdName": "TRIETHYLENEMELAMINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acc7d54c-3c3a-468b-97de-08bf8b5df2ee"
          ],
          "display_name": false
        },
        {
          "uuid": "66edd250-cda3-4759-ab2b-289da217bb60",
          "name": "TRIETHYLENEMELAMINE [MI]",
          "stdName": "TRIETHYLENEMELAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "455c1e57-059d-47e2-b713-f7ec76d5a337"
          ],
          "display_name": false
        },
        {
          "uuid": "18dba272-d710-6ba4-a241-602ea6384223",
          "name": "Tretamine [WHO-DD]",
          "stdName": "TRETAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6ec9a28-266c-1d00-dab2-d5560277c2d5"
          ],
          "display_name": false
        },
        {
          "uuid": "8beccbeb-5c4d-4d57-8acc-990d0278c594",
          "name": "tretamine [INN]",
          "stdName": "TRETAMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c28fa2ee-2c60-4534-86a6-523acb6f6e8a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7e1c5bb9-7890-4711-a5f3-7a49eb75d6af",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "58f82e2d-5442-4b26-a9c9-88b703681482",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "228f1cc6-8fc0-4d5c-9e11-b88d3926490a",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c2f7ab6-9a18-48f6-86ce-4b05c4e73fe4",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca53034d-3db9-441f-b510-fc81448b9e5e",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c28fa2ee-2c60-4534-86a6-523acb6f6e8a",
          "citation": "INN Proposed List 4",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL04.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7dbc4035-10f9-4303-b031-94feeee40c4c",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "455c1e57-059d-47e2-b713-f7ec76d5a337",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d1dcdde-6b83-414b-aee4-dd66b244c3bb",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acc7d54c-3c3a-468b-97de-08bf8b5df2ee",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5abfd289-7ccc-411e-b753-6eb30de1c48c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1b0ffb8-4ecc-4657-922b-a3ecec60435e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390726000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a4cddd2-1c1f-49b1-abbb-e3f3e7d05a7b",
          "citation": "SRS import [F7IY6HZG9D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F7IY6HZG9D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390726000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74718b2e-dd25-4133-91ee-2b0d407156c8",
          "citation": "TRETAMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "612501f6-1386-4dda-bb0b-7178b6c16153",
          "citation": "TRETAMINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cefeb2ff-8c0f-431b-9764-514afb9cfc53",
          "citation": "TRIETHYLENEMELAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "29de7c23-5322-4541-8b3c-2dcea44f0d5a",
          "citation": "TRIETHYLENEMELAMINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc7c1388-c584-454e-84a6-6f6734d3a05a",
          "citation": "TRETAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3af2502f-77fb-e48f-c33a-ba5514c30a82",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+51-18-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3971d001-f272-78ce-574c-30627efdc7cb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51-18-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6cced716-28ad-bf3b-103e-835d576c6127",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "a3343a8d-5fb6-5fdf-b6f9-5fe007667055",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a8a25110-61ac-4751-8c89-2cca73dedb78",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dceadd9d-5f05-6b9e-79f3-084012473ec1",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "26c6e7e7-c6df-1a27-eee2-00287c10592f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d6ec9a28-266c-1d00-dab2-d5560277c2d5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "66bd4128-61b2-b3a9-82f1-8042919c0535",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3902b38d-1fa2-4630-afc3-32b21858d19c",
          "id": "3902b38d-1fa2-4630-afc3-32b21858d19c",
          "molfile": "\n  Marvin  01132103022D          \n\n 15 18  0  0  0  0            999 V2000\n    0.0000   -3.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4000   -3.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8181   -3.1272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5532   -2.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2233   -3.1791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9635   -2.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9635   -1.9350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2623   -1.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5532   -1.9272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2623   -0.7662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7427    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8493    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6700   -3.2103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0518   -3.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4752   -3.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n 13  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "C1CN1c2nc(nc(n2)N3CC3)N4CC4",
          "formula": "C9H12N6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c71baf6b-0129-45f0-8db5-a8f8f221049c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "204.2321",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bd5aa35b-a47c-48f2-90c7-96353d39dbb6",
      "version": "18",
      "structure": {
        "id": "a2d373c8-a355-4bde-9a4a-a4bbee6ad267",
        "molfile": "\n  Marvin  01132108272D          \n\n 15 18  0  0  0  0            999 V2000\n    1.5532   -2.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9635   -2.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2623   -1.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5532   -1.9272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9635   -1.9350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2233   -3.1791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8181   -3.1272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6700   -3.2103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2623   -0.7662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0518   -3.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4752   -3.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4000   -3.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7427    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8493    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14  9  1  0  0  0  0\n 15  9  1  0  0  0  0\n 13 10  1  0  0  0  0\n  5  3  1  0  0  0  0\n 12 11  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
        "smiles": "C1CN1c2nc(nc(n2)N3CC3)N4CC4",
        "formula": "C9H12N6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "204.2321",
        "optical_activity": "NONE",
        "references": [
          "7e1c5bb9-7890-4711-a5f3-7a49eb75d6af",
          "9a4cddd2-1c1f-49b1-abbb-e3f3e7d05a7b",
          "c28fa2ee-2c60-4534-86a6-523acb6f6e8a"
        ],
        "stereo_centers": 0
      },
      "unii": "F7IY6HZG9D"
    }
  ]
}