{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e1f301b8-8fe5-456b-84cf-49cc9b048ef0", "code": "104516-97-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=104516-97-4", "code_system": "CAS", "references": [ "b2f4a8dd-b62b-4d28-b402-74d51fb66ce9", "7ac725ef-bc03-421d-8124-25ce2c4eb0c6" ] }, { "uuid": "e38bb07d-4f2d-429b-be12-f6fd4aa1a935", "code": "121494105", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/121494105", "code_system": "PUBCHEM", "references": [ "b2f4a8dd-b62b-4d28-b402-74d51fb66ce9" ] }, { "uuid": "6091dcdd-530d-44bc-8df5-f8426194add8", "code": "F7CS4Q315T", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f515704c-4c4d-e087-a528-29ee7fdf9841", "code": "DTXSID90869426", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90869426", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "3fede70c-a9cb-451e-bb60-94dc66e4d7d2", "name": "1,3-DIMETHYLBICYCLO(2.2.1)HEPTANE-2-CARBONITRILE", "stdName": "1,3-DIMETHYLBICYCLO(2.2.1)HEPTANE-2-CARBONITRILE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ec8269a8-e7c7-44b4-9e2d-789645af7af0", "8af6f0d0-e2cb-4b91-80da-af9f60a9f77b" ], "display_name": true }, { "uuid": "98a5b37d-079a-4c5a-a966-e3843252bf45", "name": "BICYCLO(2.2.1)HEPTANE-2-CARBONITRILE, 1,3-DIMETHYL-", "stdName": "BICYCLO(2.2.1)HEPTANE-2-CARBONITRILE, 1,3-DIMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8af6f0d0-e2cb-4b91-80da-af9f60a9f77b", "cb3efcd6-8094-449c-95a3-107ff3e64f6b" ], "display_name": false } ], "references": [ { "uuid": "ec8269a8-e7c7-44b4-9e2d-789645af7af0", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "8af6f0d0-e2cb-4b91-80da-af9f60a9f77b", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cb3efcd6-8094-449c-95a3-107ff3e64f6b", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b2f4a8dd-b62b-4d28-b402-74d51fb66ce9", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392628000, "tags": [ "NOMEN" ] }, { "uuid": "a0fc7f54-62d5-46d6-8379-5237e90132b4", "citation": "SRS import [F7CS4Q315T]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F7CS4Q315T", "doc_type": "SRS", "public_domain": true, "document_date": 1493392628000, "tags": [ "NOMEN" ] }, { "uuid": "7ac725ef-bc03-421d-8124-25ce2c4eb0c6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3d5d3528-f12e-4e86-a67e-6a9d52f09655", "id": "3d5d3528-f12e-4e86-a67e-6a9d52f09655", "molfile": "\n Marvin 01132103152D \n\n 11 12 0 0 0 0 999 V2000\n 7.6801 -5.3876 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.3946 -4.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3946 -4.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6801 -3.7376 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.6801 -2.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1564 -4.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9656 -4.1501 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.2512 -3.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5367 -3.3251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9656 -4.9751 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.2512 -5.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 6 1 1 0 0 0\n 10 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 1 0 0 0\n 4 6 1 0 0 0 0\n 7 4 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 10 1 0 0 0 0\n 8 9 3 0 0 0 0\n 10 11 1 0 0 0 0\nM END", "smiles": "CC1[C@H]2CC[C@](C)(C2)C1C#N", "formula": "C10H15N", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "714d22ca-6182-4a6e-a949-29759193c224" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "149.2332", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "caadba15-c34a-42ba-a8da-9e76ed098041", "version": "3", "structure": { "id": "7b9faa22-80cb-4189-b3d0-20833174f067", "molfile": "\n Marvin 01132106252D \n\n 11 12 0 0 1 0 999 V2000\n 6.9656 -4.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2512 -3.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5367 -3.3251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6801 -3.7376 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.6801 -2.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1564 -4.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6801 -5.3876 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.3946 -4.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3946 -4.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9656 -4.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2512 -5.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 3 0 0 0 0\n 1 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 1 0 0 0\n 7 6 1 1 0 0 0\n 7 8 1 0 0 0 0\n 9 4 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 7 1 0 0 0 0\n 1 10 1 0 0 0 0\n 10 11 1 0 0 0 0\nM END", "smiles": "CC1[C@H]2CC[C@](C)(C2)C1C#N", "formula": "C10H15N", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "149.2332", "optical_activity": "UNSPECIFIED", "references": [ "a0fc7f54-62d5-46d6-8379-5237e90132b4", "cb3efcd6-8094-449c-95a3-107ff3e64f6b" ], "stereo_centers": 4 }, "unii": "F7CS4Q315T" } ] }