{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "388a1272-a453-42e5-8ea2-4b8b9b021deb",
          "code": "80-12-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80-12-6",
          "code_system": "CAS",
          "references": [
            "a709b657-6be8-470c-b5dc-f42e79a6c90f",
            "450939b8-6a6f-41a8-859e-53f05045b5d0"
          ]
        },
        {
          "uuid": "5c344913-e575-441c-bd05-06aae03891f5",
          "code": "m10644",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10644?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a709b657-6be8-470c-b5dc-f42e79a6c90f"
          ]
        },
        {
          "uuid": "3fd893ac-5c76-46e8-a7ee-adcff1345bfb",
          "code": "64148",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/64148",
          "code_system": "PUBCHEM",
          "references": [
            "a709b657-6be8-470c-b5dc-f42e79a6c90f"
          ]
        },
        {
          "uuid": "e7e8ee1e-0ab4-0ff5-55d1-6e0acb01c8fa",
          "code": "Tetramethylenedisulfotetramine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tetramethylenedisulfotetramine",
          "code_system": "WIKIPEDIA",
          "references": [
            "9f9defe4-65de-26d3-2a9e-7d2d8c9aca1e"
          ]
        },
        {
          "uuid": "94fef634-337d-bca8-d297-4f9306a613d7",
          "code": "DTXSID8040307",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8040307",
          "code_system": "EPA CompTox",
          "references": [
            "d6431df8-5a3c-e846-0c33-6cdcef8a8140"
          ]
        },
        {
          "uuid": "108b34a7-81ce-47d8-8d33-3add422f0492",
          "code": "F6TS3WME05",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8b786606-a8e7-0480-dcab-58377f83585f",
          "code": "172824",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=172824",
          "code_system": "NSC",
          "references": [
            "4cb2d466-0807-beeb-f805-9bb1a20137d4"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "581bc049-8013-4f5c-abd4-33c7c0a6a6dc",
          "name": "2,6-DITHIA-1,3,5,7-TETRAAZATRICYCLO(3.3.1.13,7)DECANE, 2,2,6,6-TETRAOXIDE",
          "stdName": "2,6-DITHIA-1,3,5,7-TETRAAZATRICYCLO(3.3.1.13,7)DECANE, 2,2,6,6-TETRAOXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a637a214-eb9a-4deb-b117-1bc038521168",
            "531dd23d-ae4b-4e06-a95d-c3bb4bc16451"
          ],
          "display_name": false
        },
        {
          "uuid": "11e43d5e-7d97-4943-8f4c-c01c778444c9",
          "name": "NSC-172824",
          "stdName": "NSC-172824",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a637a214-eb9a-4deb-b117-1bc038521168",
            "531dd23d-ae4b-4e06-a95d-c3bb4bc16451"
          ],
          "display_name": false
        },
        {
          "uuid": "1cfbb09f-ce30-49c2-ad56-6cf6c0d2c0d3",
          "name": "TETRAMETHYLENEDISULFOTETRAMINE",
          "stdName": "TETRAMETHYLENEDISULFOTETRAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29aa9949-c445-4275-9101-6d26a6f985ee",
            "1a2b0cb5-52f1-46a8-9acd-a33d0197a71d",
            "8d7fbc82-67b0-488a-a435-e1a4fd4a61c1",
            "531dd23d-ae4b-4e06-a95d-c3bb4bc16451"
          ],
          "display_name": true
        },
        {
          "uuid": "353dfcc9-9e6e-4cf3-a817-3903a6221f6e",
          "name": "TETRAMETHYLENEDISULFOTETRAMINE [MI]",
          "stdName": "TETRAMETHYLENEDISULFOTETRAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a2b0cb5-52f1-46a8-9acd-a33d0197a71d",
            "531dd23d-ae4b-4e06-a95d-c3bb4bc16451"
          ],
          "display_name": false
        },
        {
          "uuid": "fa77d0cb-4075-46e9-a81c-35510da60638",
          "name": "TETRAMETHYLENEDISULPHOTETRAMINE",
          "stdName": "TETRAMETHYLENEDISULPHOTETRAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a637a214-eb9a-4deb-b117-1bc038521168",
            "531dd23d-ae4b-4e06-a95d-c3bb4bc16451"
          ],
          "display_name": false
        },
        {
          "uuid": "e206b515-83e8-4562-bf41-284837381105",
          "name": "TETS",
          "stdName": "TETS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a637a214-eb9a-4deb-b117-1bc038521168",
            "531dd23d-ae4b-4e06-a95d-c3bb4bc16451"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8d7fbc82-67b0-488a-a435-e1a4fd4a61c1",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "531dd23d-ae4b-4e06-a95d-c3bb4bc16451",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a2b0cb5-52f1-46a8-9acd-a33d0197a71d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a637a214-eb9a-4deb-b117-1bc038521168",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a709b657-6be8-470c-b5dc-f42e79a6c90f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392571000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb2a040e-2a19-4dd6-bf6f-60d720d5f8e2",
          "citation": "SRS import [F6TS3WME05]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F6TS3WME05",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392571000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29aa9949-c445-4275-9101-6d26a6f985ee",
          "citation": "TETRAMETHYLENEDISULFOTETRAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9f9defe4-65de-26d3-2a9e-7d2d8c9aca1e",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Tetramethylenedisulfotetramine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d6431df8-5a3c-e846-0c33-6cdcef8a8140",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=80-12-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "450939b8-6a6f-41a8-859e-53f05045b5d0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4cb2d466-0807-beeb-f805-9bb1a20137d4",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "08993606-2fbe-48d0-9497-09f64cbf6292",
          "id": "08993606-2fbe-48d0-9497-09f64cbf6292",
          "molfile": "\n  Marvin  01132100432D          \n\n 14 16  0  0  0  0            999 V2000\n    4.4807   -1.0286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6990   -1.2912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6998   -0.4658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6904   -2.0027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9826   -2.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2234   -2.0298    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2233   -1.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0167   -1.0435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6163   -1.5717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6150   -2.6816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0916   -2.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7124   -2.6972    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8437   -2.8857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5637   -3.5374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  2  8  1  0  0  0  0\n  5  4  1  0  0  0  0\n 11  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 12  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
          "smiles": "C1N2CN3CN(CN1S3(=O)=O)S2(=O)=O",
          "formula": "C4H8N4O4S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7af0631d-d9a3-4d16-ab59-c6ee8af82c5f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "240.2631",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ab28c8cc-cb28-459a-97b7-290d0a574eab",
      "version": "5",
      "structure": {
        "id": "8ede0f4c-1c46-4e63-8f9d-02d0f1d225c7",
        "molfile": "\n  Marvin  01132107252D          \n\n 14 16  0  0  0  0            999 V2000\n    1.7124   -2.6972    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2234   -2.0298    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6150   -2.6816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9826   -2.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0916   -2.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6904   -2.0027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6163   -1.5717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0167   -1.0435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2233   -1.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6990   -1.2912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4807   -1.0286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6998   -0.4658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8437   -2.8857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5637   -3.5374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1 13  2  0  0  0  0\n  1 14  2  0  0  0  0\n  2  9  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  7  3  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
        "smiles": "C1N2CN3CN(CN1S3(=O)=O)S2(=O)=O",
        "formula": "C4H8N4O4S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "240.2631",
        "optical_activity": "NONE",
        "references": [
          "bb2a040e-2a19-4dd6-bf6f-60d720d5f8e2",
          "8d7fbc82-67b0-488a-a435-e1a4fd4a61c1"
        ],
        "stereo_centers": 0
      },
      "unii": "F6TS3WME05"
    }
  ]
}