{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b9897c37-11fb-4e55-9078-d1f53a573a15",
          "code": "4024-81-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4024-81-1",
          "code_system": "CAS",
          "references": [
            "96d1a9ea-c9e2-4c9d-bc11-89aa60c67642",
            "e6dd57f7-162e-439a-a39d-375244addd8e"
          ]
        },
        {
          "uuid": "364f8c01-0bbc-40d3-954d-09a1ea540ed6",
          "code": "19936",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19936",
          "code_system": "PUBCHEM",
          "references": [
            "96d1a9ea-c9e2-4c9d-bc11-89aa60c67642"
          ]
        },
        {
          "uuid": "5feb47b5-5378-2dbb-834a-687e4efa05ff",
          "code": "DTXSID60193225",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60193225",
          "code_system": "EPA CompTox",
          "references": [
            "6ce95c2c-0ea8-e666-83e2-a34ee7dda760"
          ]
        },
        {
          "uuid": "cf7ae723-1312-411a-a709-a15bcad6841a",
          "code": "F66SE2O4G7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e74c4da8-5224-d5b7-8e85-cad32ebb81bf",
          "code": "OCH",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/OCH.html",
          "code_system": "ALANWOOD",
          "references": [
            "9984e54c-9ea3-d288-b161-9c96c3bcb846"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8c78cdf4-1f11-4380-88da-c619503ddb7c",
          "name": "2,3,4,4,5,5,6,6-OCTACHLORO-2-CYCLOHEXEN-1-ONE",
          "stdName": "2,3,4,4,5,5,6,6-OCTACHLORO-2-CYCLOHEXEN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ca9704d-0b00-41e6-9917-6097d2fb11ec",
            "6578b4c9-f7f7-4f70-a3c1-b3e1580edb6f"
          ],
          "display_name": false
        },
        {
          "uuid": "96117724-c5b2-4908-a687-d160b16d7438",
          "name": "OCH",
          "stdName": "OCH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42b7feda-b222-4990-b611-fdf08b668341"
          ],
          "display_name": false
        },
        {
          "uuid": "57e9429a-6791-4782-b5ae-562f035fa738",
          "name": "OCTACHLORO-2-CYCLOHEXENONE",
          "stdName": "OCTACHLORO-2-CYCLOHEXENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa78a691-f550-4682-8de7-4a27b4777090"
          ],
          "display_name": false
        },
        {
          "uuid": "8dacb70a-9b40-436e-96b7-2c232f46188d",
          "name": "OCTACHLOROCYCLOHEX-2-ENE-1-ONE",
          "stdName": "OCTACHLOROCYCLOHEX-2-ENE-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "132e4869-e8ca-41d0-8c27-35a401d1f5d0"
          ],
          "display_name": true
        },
        {
          "uuid": "af0d98ac-d0bd-46ba-9684-0659bdb0f059",
          "name": "PERCHLOROCYCLOHEX-2-EN-1-ONE",
          "stdName": "PERCHLOROCYCLOHEX-2-EN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46a0455f-259f-411b-a614-3d3f78112bb2",
            "1ca9704d-0b00-41e6-9917-6097d2fb11ec"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1ca9704d-0b00-41e6-9917-6097d2fb11ec",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "46a0455f-259f-411b-a614-3d3f78112bb2",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6578b4c9-f7f7-4f70-a3c1-b3e1580edb6f",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42b7feda-b222-4990-b611-fdf08b668341",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "132e4869-e8ca-41d0-8c27-35a401d1f5d0",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa78a691-f550-4682-8de7-4a27b4777090",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96d1a9ea-c9e2-4c9d-bc11-89aa60c67642",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390978000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acb2c154-54a8-44de-8c7c-eabb4d2d5f4f",
          "citation": "SRS import [F66SE2O4G7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F66SE2O4G7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390978000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fe0609f-1c23-432f-8f20-b618d71bef69",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ce95c2c-0ea8-e666-83e2-a34ee7dda760",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4024-81-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9984e54c-9ea3-d288-b161-9c96c3bcb846",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "e6dd57f7-162e-439a-a39d-375244addd8e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c1f1fe85-d40e-4ddc-b9d9-48a9af19d55c",
          "id": "c1f1fe85-d40e-4ddc-b9d9-48a9af19d55c",
          "molfile": "\n  Marvin  01132110012D          \n\n 15 15  0  0  0  0            999 V2000\n    5.4974   -4.4611    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1974   -4.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1974   -5.7322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4696   -6.1494    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9136   -6.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3158   -6.7829    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.3905   -6.7789    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.6298   -5.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3733   -5.7713    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9249   -6.4833    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.6298   -4.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7675   -4.2409    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3161   -4.7736    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9136   -4.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9136   -3.6508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n 14  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  5  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  2  0  0  0  0\nM  END",
          "smiles": "C1(=C(C(C(C(C1=O)(Cl)Cl)(Cl)Cl)(Cl)Cl)Cl)Cl",
          "formula": "C6Cl8O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8c17d396-f827-41ce-a40b-1a746df95ada"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "371.6873",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f65c732a-37c3-4ff3-854b-66f995cdae0d",
      "version": "4",
      "structure": {
        "id": "d3388433-fc05-46b0-b9dc-4ed2af524720",
        "molfile": "\n  Marvin  01132110552D          \n\n 15 15  0  0  0  0            999 V2000\n    7.6298   -5.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6298   -4.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9136   -4.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1974   -4.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4974   -4.4611    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1974   -5.7322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9136   -6.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3158   -6.7829    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.3905   -6.7789    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4696   -6.1494    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9136   -3.6508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7675   -4.2409    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3161   -4.7736    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3733   -5.7713    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9249   -6.4833    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n  3 11  2  0  0  0  0\n  2 12  1  0  0  0  0\n  2 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n  1 15  1  0  0  0  0\nM  END",
        "smiles": "C1(=C(C(C(C(C1=O)(Cl)Cl)(Cl)Cl)(Cl)Cl)Cl)Cl",
        "formula": "C6Cl8O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "371.6873",
        "optical_activity": "NONE",
        "references": [
          "acb2c154-54a8-44de-8c7c-eabb4d2d5f4f",
          "2fe0609f-1c23-432f-8f20-b618d71bef69"
        ],
        "stereo_centers": 0
      },
      "unii": "F66SE2O4G7"
    }
  ]
}