{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3035b37a-aed5-4dde-8f22-09f623d48b3f",
          "code": "5462-60-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5462-60-2",
          "code_system": "CAS",
          "references": [
            "a9a9b5fa-1b05-4717-bdab-7685ec7660cd",
            "027d6311-52a0-4cf7-a9e4-e8e5973f1bd6"
          ]
        },
        {
          "uuid": "e016264f-ff1c-4439-b808-316d173f2260",
          "code": "226-752-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.320",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a9a9b5fa-1b05-4717-bdab-7685ec7660cd"
          ]
        },
        {
          "uuid": "f6173927-5e17-49ab-811b-1e8bc3072747",
          "code": "79586",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/79586",
          "code_system": "PUBCHEM",
          "references": [
            "a9a9b5fa-1b05-4717-bdab-7685ec7660cd"
          ]
        },
        {
          "uuid": "25298013-e69c-d38a-09d1-e9dc0be1d85e",
          "code": "DTXSID7063920",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7063920",
          "code_system": "EPA CompTox",
          "references": [
            "7143d3e4-a9b2-f32e-2b25-5032a16b07c6"
          ]
        },
        {
          "uuid": "4e96ef61-af53-4001-8d3a-6d938a3a4dc8",
          "code": "F641J04Q03",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fff749f2-dfdd-c490-6fdc-ce071140b264",
          "code": "19191",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=19191",
          "code_system": "NSC",
          "references": [
            "2c742dfe-6ea7-b929-27c8-6ded9dfaa491"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fd932144-4833-4388-b97f-9c5b62881ad3",
          "name": "ACETIC ACID, 2-SULFO-, SODIUM SALT (1:2)",
          "stdName": "ACETIC ACID, 2-SULFO-, SODIUM SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "154755f6-5cda-4b90-97ea-805832011e5e",
            "1eba5e56-97d3-47e7-a676-b4a25b0d2aa0"
          ],
          "display_name": false
        },
        {
          "uuid": "9847170f-1577-4207-a9dc-3c02986edc60",
          "name": "DISODIUM SULFOACETATE",
          "stdName": "DISODIUM SULFOACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83f90278-fcda-4be3-9d04-7c06bd1bd5df",
            "12414e59-cd58-4267-adf5-938738072adc",
            "154755f6-5cda-4b90-97ea-805832011e5e",
            "1eba5e56-97d3-47e7-a676-b4a25b0d2aa0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "54b5221a-fb7f-4544-a195-47c39ca237d4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0a9cf5bd-f0f4-4cd6-9198-936608d66dfc",
          "name": "NSC-19191",
          "stdName": "NSC-19191",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ce411f1-4864-4601-a582-7759761ff8d8",
            "1eba5e56-97d3-47e7-a676-b4a25b0d2aa0"
          ],
          "display_name": false
        },
        {
          "uuid": "3803174c-f0d3-4a49-bf55-0832b4153f62",
          "name": "SULFOACETIC ACID DISODIUM SALT",
          "stdName": "SULFOACETIC ACID DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "154755f6-5cda-4b90-97ea-805832011e5e",
            "1eba5e56-97d3-47e7-a676-b4a25b0d2aa0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "12414e59-cd58-4267-adf5-938738072adc",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1eba5e56-97d3-47e7-a676-b4a25b0d2aa0",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "154755f6-5cda-4b90-97ea-805832011e5e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ce411f1-4864-4601-a582-7759761ff8d8",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9a9b5fa-1b05-4717-bdab-7685ec7660cd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391104000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e59f437c-bfd0-4e27-96ab-d9548e2c0984",
          "citation": "SRS import [F641J04Q03]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F641J04Q03",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391104000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "882fb363-47d8-480b-92c1-f79ae2dac83b",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83f90278-fcda-4be3-9d04-7c06bd1bd5df",
          "citation": "DISODIUM SULFOACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7143d3e4-a9b2-f32e-2b25-5032a16b07c6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5462-60-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "027d6311-52a0-4cf7-a9e4-e8e5973f1bd6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2c742dfe-6ea7-b929-27c8-6ded9dfaa491",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f5093617-181e-441a-aea7-5b650f1ec4b2",
          "id": "f5093617-181e-441a-aea7-5b650f1ec4b2",
          "molfile": "\n  Marvin  01132112422D          \n\n  1  0  0  0  0  0            999 V2000\n    4.2497   -4.8486    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "70f665e8-fcad-43f6-826f-c0d5518b1e6b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2bd9d120-d74d-4e3a-be15-e64f047479a7",
          "id": "2bd9d120-d74d-4e3a-be15-e64f047479a7",
          "molfile": "\n  Marvin  01132102222D          \n\n  8  7  0  0  0  0            999 V2000\n    9.3870   -3.8399    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.8771   -4.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1965   -5.2488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0607   -4.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5508   -5.0093    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1921   -5.5165    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.9094   -4.5070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0408   -5.6582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  5  2  0  0  0  0\nM  CHG  2   1  -1   6  -1\nM  END",
          "smiles": "C(C(=O)[O-])S(=O)(=O)[O-]",
          "formula": "C2H2O5S",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "af2562b6-4e29-4721-bc23-136e2fd2d121"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "138.1005",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c79d0bf1-6ed0-415a-a543-54f573b65344",
      "version": "5",
      "structure": {
        "id": "46200ff6-8e36-47f3-8188-41f9568ba040",
        "molfile": "\n  Marvin  01132103412D          \n\n 10  7  0  0  0  0            999 V2000\n    7.5508   -5.0093    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0607   -4.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8771   -4.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3870   -3.8399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1965   -5.2488    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1921   -5.5165    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.9094   -4.5070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0408   -5.6582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2494   -4.8483    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    4.2494   -4.8483    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  2  0  0  0  0\n  8  1  2  0  0  0  0\nM  CHG  4   5  -1   6  -1   9   1  10   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2   9  10\nM  SPA   1  1   9\nM  SDI   1  4    3.8294   -5.2683    3.8294   -4.4283\nM  SDI   1  4    4.6694   -4.4283    4.6694   -5.2683\nM  SMT   1 2\nM  END",
        "smiles": "C(C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]",
        "formula": "C2H2O5S.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "184.08",
        "optical_activity": "NONE",
        "references": [
          "882fb363-47d8-480b-92c1-f79ae2dac83b",
          "e59f437c-bfd0-4e27-96ab-d9548e2c0984"
        ],
        "stereo_centers": 0
      },
      "unii": "F641J04Q03"
    }
  ]
}