{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a91023e7-1eeb-43fc-80f8-4c9fc67b352f", "code": "16068-37-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=16068-37-4", "code_system": "CAS", "references": [ "14a9ed2c-59a7-4ec1-861d-dca69f9712ec", "8407612f-753c-4368-9700-db8c8d4770ea" ] }, { "uuid": "a532d855-0082-4081-a07c-68460b42c38f", "code": "240-212-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.541", "code_system": "ECHA (EC/EINECS)", "references": [ "14a9ed2c-59a7-4ec1-861d-dca69f9712ec" ] }, { "uuid": "e4838433-3831-413c-898a-7f9e8ac5af7f", "code": "85266", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/85266", "code_system": "PUBCHEM", "references": [ "14a9ed2c-59a7-4ec1-861d-dca69f9712ec" ] }, { "uuid": "a6b5f5cc-8053-a67b-cdd8-e7eed4fb769f", "code": "DTXSID7051763", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7051763", "code_system": "EPA CompTox", "references": [ "c7b382d3-dee0-2dff-5679-40b483a7c551" ] }, { "uuid": "a4f208b9-e5aa-4c98-8eb5-30125c6a96cf", "code": "F57B935G98", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "f293bdbe-0455-40a0-8a51-bf4c487a790a", "name": "1,2-BIS(TRIETHOXYSILYL)ETHANE", "stdName": "1,2-BIS(TRIETHOXYSILYL)ETHANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2c11b13f-1a91-447f-9dda-72caf63cbfe5" ], "display_name": true }, { "uuid": "d69f0ff4-7652-41b0-845e-24c1f7711d0f", "name": "3,8-DIOXA-4,7-DISILADECANE, 4,4,7,7-TETRAETHOXY-", "stdName": "3,8-DIOXA-4,7-DISILADECANE, 4,4,7,7-TETRAETHOXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "615233af-0030-4130-ab07-0bbed69f8178" ], "display_name": false }, { "uuid": "969910a6-bc3e-4498-b580-254d244b273b", "name": "4,4,7,7-TETRAETHOXY-3,8-DIOXA-4,7-DISILADECANE", "stdName": "4,4,7,7-TETRAETHOXY-3,8-DIOXA-4,7-DISILADECANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "615233af-0030-4130-ab07-0bbed69f8178" ], "display_name": false } ], "references": [ { "uuid": "14a9ed2c-59a7-4ec1-861d-dca69f9712ec", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390315000, "tags": [ "NOMEN" ] }, { "uuid": "4d558734-c00e-4ded-b819-c8268c155a4c", "citation": "SRS import [F57B935G98]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F57B935G98", "doc_type": "SRS", "public_domain": true, "document_date": 1493390315000, "tags": [ "NOMEN" ] }, { "uuid": "2c11b13f-1a91-447f-9dda-72caf63cbfe5", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "615233af-0030-4130-ab07-0bbed69f8178", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c7b382d3-dee0-2dff-5679-40b483a7c551", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16068-37-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8407612f-753c-4368-9700-db8c8d4770ea", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b261aff4-808c-4c7d-8f10-4791ac94d824", "id": "b261aff4-808c-4c7d-8f10-4791ac94d824", "molfile": "\n Marvin 01132109142D \n\n 22 21 0 0 0 0 999 V2000\n 1.3184 -1.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6039 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1105 -1.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 -0.7145 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.7145 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5395 0.3020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2539 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9684 0.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2375 1.4289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0625 1.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4750 2.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1105 1.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6039 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3184 1.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5395 -0.3020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2539 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9684 -0.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2375 -1.4289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0625 -1.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4750 -2.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 17 1 0 0 0 0\n 4 20 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 11 1 0 0 0 0\n 7 14 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "CCO[Si](CC[Si](OCC)(OCC)OCC)(OCC)OCC", "formula": "C14H34O6Si2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "737f35ee-0a7c-431c-ba59-a6d0357120bd" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "354.5875", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "a6f3651f-8fbc-4c26-84ac-ee15b35c80e5", "version": "3", "structure": { "id": "26f1673b-2300-4b84-a147-f43b83ed0969", "molfile": "\n Marvin 01132102092D \n\n 22 21 0 0 0 0 999 V2000\n 1.3184 -1.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6039 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1105 -1.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 -0.7145 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.7145 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5395 0.3020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2539 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9684 0.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2375 1.4289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0625 1.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4750 2.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1105 1.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6039 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3184 1.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5395 -0.3020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2539 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9684 -0.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2375 -1.4289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0625 -1.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4750 -2.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 11 12 1 0 0 0 0\n 7 11 1 0 0 0 0\n 15 16 1 0 0 0 0\n 14 15 1 0 0 0 0\n 7 14 1 0 0 0 0\n 18 19 1 0 0 0 0\n 17 18 1 0 0 0 0\n 4 17 1 0 0 0 0\n 21 22 1 0 0 0 0\n 20 21 1 0 0 0 0\n 4 20 1 0 0 0 0\nM END", "smiles": "CCO[Si](CC[Si](OCC)(OCC)OCC)(OCC)OCC", "formula": "C14H34O6Si2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "354.5875", "optical_activity": "NONE", "references": [ "615233af-0030-4130-ab07-0bbed69f8178", "4d558734-c00e-4ded-b819-c8268c155a4c" ], "stereo_centers": 0 }, "unii": "F57B935G98" } ] }