{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "86075e61-2c66-4cba-93f9-42820cb62751",
          "code": "C475883",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67475883",
          "code_system": "MESH",
          "references": [
            "cac3f30a-65f1-4b4c-b6c9-fc234f67a29f"
          ]
        },
        {
          "uuid": "eda2777c-e684-4da5-9331-bea6a14efef9",
          "code": "SILAFLUOFEN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Silafluofen",
          "code_system": "WIKIPEDIA",
          "references": [
            "cac3f30a-65f1-4b4c-b6c9-fc234f67a29f"
          ]
        },
        {
          "uuid": "ea9c8464-61c3-4bdb-8a20-dd4dad0cee4a",
          "code": "92430",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92430",
          "code_system": "PUBCHEM",
          "references": [
            "cac3f30a-65f1-4b4c-b6c9-fc234f67a29f"
          ]
        },
        {
          "uuid": "a615fd37-1758-4fcd-a56e-17fde8b6d3c6",
          "code": "105024-66-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=105024-66-6",
          "code_system": "CAS",
          "references": [
            "cac3f30a-65f1-4b4c-b6c9-fc234f67a29f",
            "c796c63c-c981-420c-af65-4040fd8479d3"
          ]
        },
        {
          "uuid": "cb9b8a9b-f2d1-cff7-ce6c-44fcb55d375f",
          "code": "DTXSID4057924",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4057924",
          "code_system": "EPA CompTox",
          "references": [
            "8d708fe6-e589-25f0-71ba-4d14784190a0"
          ]
        },
        {
          "uuid": "97cba255-44ab-4f5f-8246-329eb0a8444f",
          "code": "F4SX221ILG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e976b038-bfd7-67d7-c595-663286280736",
          "code": "silafluofen",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/silafluofen.html",
          "code_system": "ALANWOOD",
          "references": [
            "ff0d640a-c7ae-49c4-b54b-20fc6bd00a92"
          ]
        },
        {
          "uuid": "7fdcf708-0fef-a348-95db-2b0cec9d7cb6",
          "code": "300000053574",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "73dbdd69-f116-ab36-dc13-9e04d5cf3282"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e4bc4f54-d869-4e4f-86a5-d38feb50172b",
          "name": "(4-ETHOXYPHENYL)(3-(4-FLUORO-3-PHENOXYPHENYL)PROPYL)(DIMETHYL)SILANE",
          "stdName": "(4-ETHOXYPHENYL)(3-(4-FLUORO-3-PHENOXYPHENYL)PROPYL)(DIMETHYL)SILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22562d4b-b90d-47da-8b0d-3eba16f9eeb9",
            "d9c819bf-d4a1-4516-b76c-d71ffc703dcf"
          ],
          "display_name": false
        },
        {
          "uuid": "0f1f7209-03e6-4582-a3b6-124bb1385eeb",
          "name": "(4-ETHOXYPHENYL)(3-(4-FLUORO-3-PHENOXYPHENYL)PROPYL)DIMETHYLSILANE",
          "stdName": "(4-ETHOXYPHENYL)(3-(4-FLUORO-3-PHENOXYPHENYL)PROPYL)DIMETHYLSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22562d4b-b90d-47da-8b0d-3eba16f9eeb9",
            "562470c0-94cb-4337-8dbd-d56382bf8fde"
          ],
          "display_name": false
        },
        {
          "uuid": "7da8fccc-1b78-4083-a9ed-6da0fe64ac5a",
          "name": "SILAFLUOFEN",
          "stdName": "SILAFLUOFEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b14b44ef-5b10-4071-a1e7-9a3020133bbc",
            "4902f11e-6639-40d8-963e-d048c6be8945",
            "2b5c500a-15c2-410b-a11e-5e76ceea7a25",
            "02cbb64c-bf45-4562-81db-03ae0c4f7ecb"
          ],
          "display_name": true
        },
        {
          "uuid": "690218d4-f0cd-4003-8c55-75eaa03d45a9",
          "name": "SILAFLUOFEN [ISO]",
          "stdName": "SILAFLUOFEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4902f11e-6639-40d8-963e-d048c6be8945",
            "02cbb64c-bf45-4562-81db-03ae0c4f7ecb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b14b44ef-5b10-4071-a1e7-9a3020133bbc",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "22562d4b-b90d-47da-8b0d-3eba16f9eeb9",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9c819bf-d4a1-4516-b76c-d71ffc703dcf",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "562470c0-94cb-4337-8dbd-d56382bf8fde",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4902f11e-6639-40d8-963e-d048c6be8945",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02cbb64c-bf45-4562-81db-03ae0c4f7ecb",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cac3f30a-65f1-4b4c-b6c9-fc234f67a29f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2a0b535-0c79-4c5e-bd77-bd2bc8d6d605",
          "citation": "SRS import [F4SX221ILG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F4SX221ILG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e497e94-4281-4023-8b87-1bae3374f827",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b5c500a-15c2-410b-a11e-5e76ceea7a25",
          "citation": "SILAFLUOFEN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d708fe6-e589-25f0-71ba-4d14784190a0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=105024-66-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ff0d640a-c7ae-49c4-b54b-20fc6bd00a92",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "c796c63c-c981-420c-af65-4040fd8479d3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "73dbdd69-f116-ab36-dc13-9e04d5cf3282",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c209b635-dd08-4f64-868d-89db3ea526c0",
          "id": "c209b635-dd08-4f64-868d-89db3ea526c0",
          "molfile": "\n  Marvin  01132110022D          \n\n 29 31  0  0  0  0            999 V2000\n    2.8201   -5.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5321   -5.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2486   -5.5221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9662   -5.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9662   -6.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6791   -7.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3974   -6.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3974   -5.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6736   -5.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1137   -7.1611    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.5548   -6.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6227   -7.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8612   -7.6319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5848   -7.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2995   -7.5523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0159   -7.1374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7342   -7.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4382   -7.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4382   -6.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1514   -5.8834    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7264   -5.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7199   -5.0664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7199   -4.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0233   -3.8066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0233   -2.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7474   -2.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4396   -3.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4396   -3.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0159   -6.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 29 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 29  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n 23 28  2  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  2  0  0  0  0\n 28 27  1  0  0  0  0\nM  END",
          "smiles": "CCOc1ccc(cc1)[Si](C)(C)CCCc2ccc(c(c2)Oc3ccccc3)F",
          "formula": "C25H29FO2Si",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c4698512-8b60-419e-90af-c1aeaf7d0119"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "408.5813",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "150ed813-e69c-4291-9bee-dd88f12abb2c",
      "version": "6",
      "structure": {
        "id": "62b447ff-b864-4151-bd5c-5d29385edd9f",
        "molfile": "\n  Marvin  01132105072D          \n\n 29 31  0  0  0  0            999 V2000\n   11.4396   -3.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7199   -4.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0233   -3.8066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0233   -2.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7474   -2.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4396   -3.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7199   -5.0664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7264   -5.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0159   -6.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0159   -7.1374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2995   -7.5523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5848   -7.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8612   -7.6319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1137   -7.1611    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.3974   -6.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6791   -7.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9662   -6.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9662   -5.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6736   -5.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3974   -5.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2486   -5.5221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5321   -5.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8201   -5.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5548   -6.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6227   -7.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7342   -7.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4382   -7.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4382   -6.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1514   -5.8834    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 15 20  2  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 14 24  1  0  0  0  0\n 14 25  1  0  0  0  0\n 10 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28  8  2  0  0  0  0\nM  END",
        "smiles": "CCOc1ccc(cc1)[Si](C)(C)CCCc2ccc(c(c2)Oc3ccccc3)F",
        "formula": "C25H29FO2Si",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "408.5813",
        "optical_activity": "NONE",
        "references": [
          "e2a0b535-0c79-4c5e-bd77-bd2bc8d6d605",
          "9e497e94-4281-4023-8b87-1bae3374f827"
        ],
        "stereo_centers": 0
      },
      "unii": "F4SX221ILG"
    }
  ]
}