{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7f09a0b2-f640-4a29-8b3c-f361f6154ef1", "code": "34231-26-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=34231-26-0", "code_system": "CAS", "references": [ "5509833c-1ba0-409a-a79a-79ec25e87dca", "c5c4c6c5-f5be-477f-ae16-11804cd726c7" ] }, { "uuid": "b0823451-6eca-4c82-b130-4b907a1e0c43", "code": "251-889-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.157", "code_system": "ECHA (EC/EINECS)", "references": [ "5509833c-1ba0-409a-a79a-79ec25e87dca" ] }, { "uuid": "a598f29c-f12c-4b12-b96e-fcaf75a759e9", "code": "118617", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118617", "code_system": "PUBCHEM", "references": [ "5509833c-1ba0-409a-a79a-79ec25e87dca" ] }, { "uuid": "874130d8-b4b8-b8eb-1f35-d987751c2be0", "code": "DTXSID7067823", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7067823", "code_system": "EPA CompTox", "references": [ "e668e5c2-122b-cf20-4568-83fc96b2196f" ] }, { "uuid": "be7fbede-d5dc-4455-aea5-6dd1bed52b2f", "code": "F3BZ273UUS", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "c5c4c6c5-f5be-477f-ae16-11804cd726c7" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e0e3171d-1c82-4629-a9aa-4c2e1c6c665d", "name": "1-Amino-4-hydroxy-2-(6-hydroxyhexanoxy)anthraquinone", "stdName": "1-AMINO-4-HYDROXY-2-(6-HYDROXYHEXANOXY)ANTHRAQUINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5c4c6c5-f5be-477f-ae16-11804cd726c7" ], "display_name": false }, { "uuid": "102138bd-df8b-45ef-956f-17c816ddc7d9", "name": "1-Amino-4-hydroxy-2-(6-hydroxyhexyloxy)anthraquinone", "stdName": "1-AMINO-4-HYDROXY-2-(6-HYDROXYHEXYLOXY)ANTHRAQUINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5c4c6c5-f5be-477f-ae16-11804cd726c7" ], "display_name": true }, { "uuid": "93cdbcb1-83f9-4133-9fe7-98514d681fa4", "name": "1-Amino-4-hydroxy-2-[(6-hydroxyhexyl)oxy]-9,10-anthracenedione", "stdName": "1-AMINO-4-HYDROXY-2-((6-HYDROXYHEXYL)OXY)-9,10-ANTHRACENEDIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5c4c6c5-f5be-477f-ae16-11804cd726c7" ], "display_name": false }, { "uuid": "9f3de653-062e-4f61-b8c4-8bd7e669170b", "name": "2-(6-Hydroxyhexyloxy)-1-amino-4-hydroxyanthraquinone", "stdName": "2-(6-HYDROXYHEXYLOXY)-1-AMINO-4-HYDROXYANTHRAQUINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5c4c6c5-f5be-477f-ae16-11804cd726c7" ], "display_name": false }, { "uuid": "6c8f51da-a2f6-4ce4-a91d-5d22566153f6", "name": "9,10-Anthracenedione, 1-amino-4-hydroxy-2-[(6-hydroxyhexyl)oxy]-", "stdName": "9,10-ANTHRACENEDIONE, 1-AMINO-4-HYDROXY-2-((6-HYDROXYHEXYL)OXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e41126aa-7a38-412a-af84-965ab65583d1", "69735c3f-6766-4cd4-9f34-56cb03ea928b" ], "display_name": false }, { "uuid": "ea2969e6-f1e7-46b7-886d-f013732375e1", "name": "Anthraquinone, 1-amino-4-hydroxy-2-[(6-hydroxyhexyl)oxy]-", "stdName": "ANTHRAQUINONE, 1-AMINO-4-HYDROXY-2-((6-HYDROXYHEXYL)OXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5c4c6c5-f5be-477f-ae16-11804cd726c7" ], "display_name": false } ], "references": [ { "uuid": "69735c3f-6766-4cd4-9f34-56cb03ea928b", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e41126aa-7a38-412a-af84-965ab65583d1", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5509833c-1ba0-409a-a79a-79ec25e87dca", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393788000, "tags": [ "NOMEN" ] }, { "uuid": "e668e5c2-122b-cf20-4568-83fc96b2196f", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=34231-26-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c5c4c6c5-f5be-477f-ae16-11804cd726c7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ad6f18f2-4929-43fc-80c8-76bffbcff730", "id": "ad6f18f2-4929-43fc-80c8-76bffbcff730", "molfile": "\n Marvin 01132109002D \n\n 26 28 0 0 0 0 999 V2000\n 4.1405 -2.5675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8640 -2.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8758 -1.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1606 -0.9198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4371 -1.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7239 -0.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9969 -1.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2816 -0.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5581 -1.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1551 -0.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8785 -1.3425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6029 -0.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3145 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0416 -0.9166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3043 -2.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0159 -2.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7430 -2.1489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0076 -3.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7172 -3.7951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7091 -4.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9819 -5.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2666 -4.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2806 -3.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5653 -3.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8419 -3.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5772 -2.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 26 2 0 0 0 0\n 4 3 1 0 0 0 0\n 3 12 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 26 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 23 18 2 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 2 0 0 0 0\n 24 26 1 0 0 0 0\nM END", "smiles": "C(CCCOc1cc(c2c(c1N)C(=O)c3ccccc3C2=O)O)CCO", "formula": "C20H21NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b6e87371-2258-42d0-a993-1460f891440e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "355.3852", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "ae80b95a-6bda-4bf7-a361-de78e6417e75", "version": "5", "structure": { "id": "c03ab4bf-0ac5-4384-8a08-3d79d1d65c35", "molfile": "\n Marvin 01132109562D \n\n 26 28 0 0 0 0 999 V2000\n 6.3043 -2.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5772 -2.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0159 -2.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5653 -3.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0076 -3.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2806 -3.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3145 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8640 -2.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6029 -0.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8758 -1.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8419 -3.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7430 -2.1489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1405 -2.5675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0416 -0.9166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1606 -0.9198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7172 -3.7951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2666 -4.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8785 -1.3425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4371 -1.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1551 -0.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5581 -1.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7239 -0.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2816 -0.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9969 -1.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7091 -4.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9819 -5.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 1 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 3 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 1 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 4 2 0 0 0 0\n 12 3 2 0 0 0 0\n 13 8 1 0 0 0 0\n 14 7 1 0 0 0 0\n 15 10 1 0 0 0 0\n 16 5 1 0 0 0 0\n 17 6 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 15 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 23 1 0 0 0 0\n 22 19 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 22 1 0 0 0 0\n 25 16 2 0 0 0 0\n 26 25 1 0 0 0 0\n 8 10 2 0 0 0 0\n 4 6 1 0 0 0 0\n 26 17 2 0 0 0 0\nM END", "smiles": "C(CCCOc1cc(c2c(c1N)C(=O)c3ccccc3C2=O)O)CCO", "formula": "C20H21NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "355.3852", "optical_activity": "NONE", "references": [ "69735c3f-6766-4cd4-9f34-56cb03ea928b" ], "stereo_centers": 0 }, "unii": "F3BZ273UUS" } ] }