{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0cc479d2-eeb7-4165-b90a-94060afe78d4",
          "code": "39807-15-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=39807-15-3",
          "code_system": "CAS",
          "references": [
            "13fa2204-1728-4fe2-b59e-7d2d67d0e014",
            "8f8fc8fc-6f85-4bc8-b593-d53094346e9b"
          ]
        },
        {
          "uuid": "7c3730d0-193d-4143-8a73-2d2e950e9316",
          "code": "C547731",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67547731",
          "code_system": "MESH",
          "references": [
            "13fa2204-1728-4fe2-b59e-7d2d67d0e014"
          ]
        },
        {
          "uuid": "8de74684-756f-401c-8e95-8a687bfecefa",
          "code": "254-637-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.049.652",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "13fa2204-1728-4fe2-b59e-7d2d67d0e014"
          ]
        },
        {
          "uuid": "aeca7940-2eaf-467d-aedb-3ddc3289bfc6",
          "code": "m8274",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8274?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "13fa2204-1728-4fe2-b59e-7d2d67d0e014"
          ]
        },
        {
          "uuid": "c27d6ddb-98f9-42af-963c-490419938078",
          "code": "94498",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94498",
          "code_system": "PUBCHEM",
          "references": [
            "13fa2204-1728-4fe2-b59e-7d2d67d0e014"
          ]
        },
        {
          "uuid": "81395b36-cd83-33d0-7917-968090dcbca1",
          "code": "DTXSID8058085",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8058085",
          "code_system": "EPA CompTox",
          "references": [
            "93d208d6-7a5f-1908-790b-cdc0a008d827"
          ]
        },
        {
          "uuid": "15ae7bb4-7dd3-4cab-a2ea-d8621bcb9e8b",
          "code": "F33159G4WG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f7e70735-37cf-84f8-3eb2-09fdcc804a88",
          "code": "oxadiargyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/oxadiargyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "e7f5e4e8-9db9-4f20-943e-beecf3860281"
          ]
        },
        {
          "uuid": "140cbef2-7372-a3b6-1a46-cf345448392d",
          "code": "300000053528",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cbee35e7-0b3f-5566-d055-704e8df9a4fb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7eb2efa1-0ecf-498d-83f9-b900b75e7fe0",
          "name": "3-(2,4-DICHLORO-5-(2-PROPYNYLOXY)PHENYL)-5-(1,1-DIMETHYLETHYL)-1,3,4-OXADIAZOL-2(3H)-ONE",
          "stdName": "3-(2,4-DICHLORO-5-(2-PROPYNYLOXY)PHENYL)-5-(1,1-DIMETHYLETHYL)-1,3,4-OXADIAZOL-2(3H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee208b02-184e-4b4b-95e7-8a32546c5154",
            "70e53015-7ce9-4a4e-9be4-b9594186e129"
          ],
          "display_name": false
        },
        {
          "uuid": "c329a894-3152-4974-972d-91fcc6633683",
          "name": "5-TERT-BUTYL-3-(2,4-DICHLORO-5-(PROP-2-YNYLOXY)PHENYL)-1,3,4-OXADIAZOL-2(3H)-ONE",
          "stdName": "5-TERT-BUTYL-3-(2,4-DICHLORO-5-(PROP-2-YNYLOXY)PHENYL)-1,3,4-OXADIAZOL-2(3H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fba16d26-bbcb-4c23-afc7-115bfa3496ef",
            "70e53015-7ce9-4a4e-9be4-b9594186e129"
          ],
          "display_name": false
        },
        {
          "uuid": "fcc50bee-e5e5-408f-bdc4-e5ef3cb12442",
          "name": "OXADIARGYL",
          "stdName": "OXADIARGYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "452d33c9-18fb-4949-bb2d-7815f99d2729",
            "96fa4178-073f-4381-b7d1-25c3e006a3f0",
            "e254b490-89b7-42bd-816a-6d6cc6d384da",
            "8ae561e5-6661-4d51-829b-f708dc45eb60",
            "2f33b7ee-df31-46b8-a87e-0c86ac81c181",
            "e5d3c266-cac1-4a04-8ad0-5ef22f23519e"
          ],
          "display_name": true
        },
        {
          "uuid": "3b6a2a7c-7b8e-4aef-9673-6e8387271850",
          "name": "OXADIARGYL [ISO]",
          "stdName": "OXADIARGYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "452d33c9-18fb-4949-bb2d-7815f99d2729",
            "8ae561e5-6661-4d51-829b-f708dc45eb60"
          ],
          "display_name": false
        },
        {
          "uuid": "a58e2d9d-25da-481b-adcf-490a6d2c7701",
          "name": "OXADIARGYL [MI]",
          "stdName": "OXADIARGYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ae561e5-6661-4d51-829b-f708dc45eb60",
            "e5d3c266-cac1-4a04-8ad0-5ef22f23519e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2f33b7ee-df31-46b8-a87e-0c86ac81c181",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "70e53015-7ce9-4a4e-9be4-b9594186e129",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fba16d26-bbcb-4c23-afc7-115bfa3496ef",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee208b02-184e-4b4b-95e7-8a32546c5154",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5d3c266-cac1-4a04-8ad0-5ef22f23519e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ae561e5-6661-4d51-829b-f708dc45eb60",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "452d33c9-18fb-4949-bb2d-7815f99d2729",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13fa2204-1728-4fe2-b59e-7d2d67d0e014",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f24df67-693d-415c-be70-0d59668c26d2",
          "citation": "SRS import [F33159G4WG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F33159G4WG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6201d0b2-85eb-49a7-a252-0f5ae5682dc7",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96fa4178-073f-4381-b7d1-25c3e006a3f0",
          "citation": "OXADIARGYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e254b490-89b7-42bd-816a-6d6cc6d384da",
          "citation": "OXADIARGYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "93d208d6-7a5f-1908-790b-cdc0a008d827",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=39807-15-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e7f5e4e8-9db9-4f20-943e-beecf3860281",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "8f8fc8fc-6f85-4bc8-b593-d53094346e9b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cbee35e7-0b3f-5566-d055-704e8df9a4fb",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c3043127-e2cb-4f03-ac33-f295c34453c3",
          "id": "c3043127-e2cb-4f03-ac33-f295c34453c3",
          "molfile": "\n  Marvin  01132110052D          \n\n 22 23  0  0  0  0            999 V2000\n    4.1447   -4.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4772   -3.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8050   -2.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7223   -2.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2276   -3.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3953   -4.4869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2252   -4.4869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6369   -5.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4630   -5.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8784   -5.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7045   -5.9130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1128   -6.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9389   -6.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7650   -6.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4679   -6.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8818   -7.3352    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.6418   -6.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2310   -5.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4049   -5.9186    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.5577   -3.7320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3627   -3.5596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9361   -3.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  2  0  0  0  0\n 22  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 20  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 18  2  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 15 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  3  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
          "smiles": "C#CCOc1cc(c(cc1Cl)Cl)-n2c(=O)oc(C(C)(C)C)n2",
          "formula": "C15H14Cl2N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "18403548-65ad-4530-91e3-0870b0b2347b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "341.1897",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "22ad889b-e16a-46c5-afb8-c8bb41b38d5f",
      "version": "6",
      "structure": {
        "id": "ea267c29-da0a-4da6-8e8e-33f6df2b9392",
        "molfile": "\n  Marvin  01132112072D          \n\n 22 23  0  0  0  0            999 V2000\n    7.3627   -3.5596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5577   -3.7320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9361   -3.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2276   -3.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3953   -4.4869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2252   -4.4869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6369   -5.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2310   -5.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6418   -6.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4679   -6.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8784   -5.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7045   -5.9130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1128   -6.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9389   -6.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7650   -6.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4630   -5.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8818   -7.3352    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4049   -5.9186    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4772   -3.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1447   -4.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8050   -2.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7223   -2.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  2  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  3  0  0  0  0\n 11 16  1  0  0  0  0\n 16  7  2  0  0  0  0\n 10 17  1  0  0  0  0\n  8 18  1  0  0  0  0\n  4 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\nM  END",
        "smiles": "C#CCOc1cc(c(cc1Cl)Cl)-n2c(=O)oc(C(C)(C)C)n2",
        "formula": "C15H14Cl2N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "341.1897",
        "optical_activity": "NONE",
        "references": [
          "6201d0b2-85eb-49a7-a252-0f5ae5682dc7",
          "8f24df67-693d-415c-be70-0d59668c26d2"
        ],
        "stereo_centers": 0
      },
      "unii": "F33159G4WG"
    }
  ]
}