{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f48aaf7a-57b1-4b33-84bf-aec3c3c730ce",
          "code": "70630-17-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=70630-17-0",
          "code_system": "CAS",
          "references": [
            "9d68442c-5470-4ec1-a4b9-10d5e80d7906",
            "a4325fa0-3076-46c4-a9ef-212e70d4c249"
          ]
        },
        {
          "uuid": "7e96b96f-4e42-404d-8b86-a16affda7c09",
          "code": "C473256",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67473256",
          "code_system": "MESH",
          "references": [
            "9d68442c-5470-4ec1-a4b9-10d5e80d7906"
          ]
        },
        {
          "uuid": "745d9223-2526-4452-ae2a-79150d12308a",
          "code": "113502",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2014",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "9d68442c-5470-4ec1-a4b9-10d5e80d7906"
          ]
        },
        {
          "uuid": "f51fa404-d3f4-4507-9c2a-db68eb006a70",
          "code": "m7263",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7263?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9d68442c-5470-4ec1-a4b9-10d5e80d7906"
          ]
        },
        {
          "uuid": "3d6468de-98e5-4859-b557-8d6cb3c9d24c",
          "code": "11150163",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11150163",
          "code_system": "PUBCHEM",
          "references": [
            "9d68442c-5470-4ec1-a4b9-10d5e80d7906"
          ]
        },
        {
          "uuid": "171ec66d-e52f-1e02-dad9-4a8a1566a61a",
          "code": "DTXSID8032671",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8032671",
          "code_system": "EPA CompTox",
          "references": [
            "2699b0f5-fa22-38e4-df1e-5c60653df447"
          ]
        },
        {
          "uuid": "09ddd9db-a8e9-5302-c298-51085239fe75",
          "code": "60607",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:60607",
          "code_system": "CHEBI",
          "references": [
            "87f6033e-df84-b594-100a-f575c0c8011a"
          ]
        },
        {
          "uuid": "3f317755-ff1b-4d22-80e6-15dfa1d1a627",
          "code": "F1Q54ONN4H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "45083445-2ad8-5642-943b-3564048766ad",
          "code": "metalaxyl-M",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/metalaxyl-M.html",
          "code_system": "ALANWOOD",
          "references": [
            "4de41577-6972-2e00-f5cf-186af2dcc4a1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "488e9632-2a22-43a4-af44-c641883ab340",
          "name": "(-)-(R)-METALAXYL",
          "stdName": "(-)-(R)-METALAXYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "fc547c87-bc33-42ea-ac3a-b81a20762c04"
          ],
          "display_name": false
        },
        {
          "uuid": "5cff749e-1a79-417e-9678-2993794161cb",
          "name": "APRON",
          "stdName": "APRON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "8de9d1c3-0daf-4f4b-820b-41ba915b887f"
          ],
          "display_name": false
        },
        {
          "uuid": "eaba3757-c9e6-4e18-893e-4b6e573c9620",
          "name": "CGA-329351",
          "stdName": "CGA-329351",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "8de9d1c3-0daf-4f4b-820b-41ba915b887f"
          ],
          "display_name": false
        },
        {
          "uuid": "f33c052b-6067-4c4d-a235-3dae98eebbf8",
          "name": "D-(-)-METALAXYL",
          "stdName": "D-(-)-METALAXYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "fc547c87-bc33-42ea-ac3a-b81a20762c04"
          ],
          "display_name": false
        },
        {
          "uuid": "443d83bc-8b84-4756-943d-525d9eb4cb49",
          "name": "D-ALANINE, N-(2,6-DIMETHYLPHENYL)-N-(2-METHOXYACETYL)-, METHYL ESTER",
          "stdName": "D-ALANINE, N-(2,6-DIMETHYLPHENYL)-N-(2-METHOXYACETYL)-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "fc547c87-bc33-42ea-ac3a-b81a20762c04"
          ],
          "display_name": false
        },
        {
          "uuid": "4731a6cf-abcf-43b5-a9ba-fb7bab48f8b4",
          "name": "MEFENOXAM",
          "stdName": "MEFENOXAM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "8de9d1c3-0daf-4f4b-820b-41ba915b887f"
          ],
          "display_name": false
        },
        {
          "uuid": "feea2e44-7655-45bc-8e92-43129c2ef760",
          "name": "METALAXYL R-FORM",
          "stdName": "METALAXYL R-FORM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e26cb87-7a62-4c38-904d-85343b3204b4",
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "f3a1cb45-2ec3-4f7c-9caa-5922a1a184ca"
          ],
          "display_name": false
        },
        {
          "uuid": "88733e36-b2d6-4e11-910e-4048bee31d19",
          "name": "METALAXYL R-FORM [MI]",
          "stdName": "METALAXYL R-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "f3a1cb45-2ec3-4f7c-9caa-5922a1a184ca"
          ],
          "display_name": false
        },
        {
          "uuid": "0735a0bd-e135-482d-a648-35ac898cbade",
          "name": "METALAXYL, (-)-",
          "stdName": "METALAXYL, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a5022fb-2a62-4250-b7a2-be8cd153578f",
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b"
          ],
          "display_name": false
        },
        {
          "uuid": "ba13cf61-a8b6-4602-ac91-d057ffc9ae45",
          "name": "METALAXYL-M",
          "stdName": "METALAXYL-M",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25d6f840-433f-488f-8e68-e2edd3428c53",
            "640da452-d3d1-489a-b923-db725e30c19d",
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "4a801695-eb3b-428b-bbe5-f036ff2e3856"
          ],
          "display_name": true
        },
        {
          "uuid": "bf882470-2578-4a72-b107-793f5c67e382",
          "name": "METALAXYL-M [ISO]",
          "stdName": "METALAXYL-M [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25d6f840-433f-488f-8e68-e2edd3428c53",
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b"
          ],
          "display_name": false
        },
        {
          "uuid": "e0176712-c594-443d-9b8f-e4ab9b52820c",
          "name": "METHYL N-(2,6-DIMETHYLPHENYL)-N-(METHOXYACETYL)-D-ALANINATE",
          "stdName": "METHYL N-(2,6-DIMETHYLPHENYL)-N-(METHOXYACETYL)-D-ALANINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3935d2af-e950-4e75-944b-216c13174691",
            "3e128eb9-66b7-4eba-ab54-9e819b200563"
          ],
          "display_name": false
        },
        {
          "uuid": "845f016c-dfd8-462a-a39a-f9714f1d3dfa",
          "name": "METHYL N-(METHOXYACETYL)-N-(2,6-XYLYL)-D-ALANINATE",
          "stdName": "METHYL N-(METHOXYACETYL)-N-(2,6-XYLYL)-D-ALANINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3935d2af-e950-4e75-944b-216c13174691",
            "59aa2444-9e31-462e-9fa7-689ebf8172ef"
          ],
          "display_name": false
        },
        {
          "uuid": "8e2df098-758e-4035-9f71-afea8688da39",
          "name": "RIDOMIL GOLD",
          "stdName": "RIDOMIL GOLD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "8de9d1c3-0daf-4f4b-820b-41ba915b887f"
          ],
          "display_name": false
        },
        {
          "uuid": "881f89a5-a123-4c77-ba63-3c271fe72a24",
          "name": "SUBDUE",
          "stdName": "SUBDUE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
            "8de9d1c3-0daf-4f4b-820b-41ba915b887f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3935d2af-e950-4e75-944b-216c13174691",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "59aa2444-9e31-462e-9fa7-689ebf8172ef",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e128eb9-66b7-4eba-ab54-9e819b200563",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a801695-eb3b-428b-bbe5-f036ff2e3856",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8de9d1c3-0daf-4f4b-820b-41ba915b887f",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f75f8cc-ad4c-412b-8e47-cb051576bf5b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc547c87-bc33-42ea-ac3a-b81a20762c04",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a5022fb-2a62-4250-b7a2-be8cd153578f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25d6f840-433f-488f-8e68-e2edd3428c53",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3a1cb45-2ec3-4f7c-9caa-5922a1a184ca",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d68442c-5470-4ec1-a4b9-10d5e80d7906",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390978000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1fe5718-d87a-4970-8e6a-ef5683d53516",
          "citation": "SRS import [F1Q54ONN4H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F1Q54ONN4H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390978000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "539f304f-0af6-496e-815f-cd5d8b75ea6b",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "640da452-d3d1-489a-b923-db725e30c19d",
          "citation": "METALAXYL-M [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e26cb87-7a62-4c38-904d-85343b3204b4",
          "citation": "METALAXYL R-FORM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2699b0f5-fa22-38e4-df1e-5c60653df447",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=70630-17-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4de41577-6972-2e00-f5cf-186af2dcc4a1",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "a4325fa0-3076-46c4-a9ef-212e70d4c249",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "87f6033e-df84-b594-100a-f575c0c8011a",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "86afd037-de88-4968-8334-7eddbfc0e5b0",
          "id": "86afd037-de88-4968-8334-7eddbfc0e5b0",
          "molfile": "\n  Marvin  01132106592D          \n\n 20 20  0  0  1  0            999 V2000\n    6.3855   -4.5581    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.6708   -4.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3855   -5.3865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1004   -5.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1004   -6.6221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8152   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5302   -5.7983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2404   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6708   -5.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9559   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9559   -4.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2410   -5.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2410   -6.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9559   -7.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6708   -6.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3855   -7.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1004   -4.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1004   -3.3226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8152   -4.5581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5302   -4.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 17  1  0  0  0  0\n  4  3  1  0  0  0  0\n  9  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 15  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "Cc1cccc(C)c1N([C@H](C)C(=O)OC)C(=O)COC",
          "formula": "C15H21NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b797bba7-e9e1-41e1-ad27-7f3082deb4ab"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "279.3321",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "63799d2c-3a52-4e6d-89f3-33cab7978259",
      "version": "5",
      "structure": {
        "id": "1adcfd99-cb38-4323-abb2-6c6aceccff62",
        "molfile": "\n  Marvin  01132101342D          \n\n 20 20  0  0  1  0            999 V2000\n    6.3855   -5.3865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6708   -5.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6708   -6.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9559   -7.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2410   -6.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2410   -5.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9559   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9559   -4.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3855   -7.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1004   -5.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1004   -6.6221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8152   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5302   -5.7983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2404   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3855   -4.5581    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1004   -4.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1004   -3.3226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8152   -4.5581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5302   -4.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6708   -4.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15  1  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 15 20  1  6  0  0  0\nM  END",
        "smiles": "Cc1cccc(C)c1N([C@H](C)C(=O)OC)C(=O)COC",
        "formula": "C15H21NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "279.3321",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e1fe5718-d87a-4970-8e6a-ef5683d53516",
          "539f304f-0af6-496e-815f-cd5d8b75ea6b"
        ],
        "stereo_centers": 1
      },
      "unii": "F1Q54ONN4H"
    }
  ]
}