{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "052125a4-8464-45c5-aa0e-90e85ff87a3f",
          "code": "3031-94-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3031-94-5",
          "code_system": "CAS",
          "references": [
            "fee199e6-46ac-4081-a642-09f90ce9d005",
            "9e1afcf2-44d3-4360-bd15-15a9227c0e54"
          ]
        },
        {
          "uuid": "5470fb32-8c86-42ad-b07b-2a7a91783e5f",
          "code": "C031143",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67031143",
          "code_system": "MESH",
          "references": [
            "fee199e6-46ac-4081-a642-09f90ce9d005"
          ]
        },
        {
          "uuid": "4052060e-bb1a-4c1c-8e13-18d48073d38e",
          "code": "AICA RIBONUCLEOTIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/AICA_ribonucleotide",
          "code_system": "WIKIPEDIA",
          "references": [
            "fee199e6-46ac-4081-a642-09f90ce9d005"
          ]
        },
        {
          "uuid": "e634fdc0-b199-4577-927a-4970012ce4e4",
          "code": "221-212-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.285",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fee199e6-46ac-4081-a642-09f90ce9d005"
          ]
        },
        {
          "uuid": "eaa3488f-8b79-4830-a7b7-eba94b1c4f3e",
          "code": "65110",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65110",
          "code_system": "PUBCHEM",
          "references": [
            "fee199e6-46ac-4081-a642-09f90ce9d005"
          ]
        },
        {
          "uuid": "73466726-04a2-e950-2d71-23033c5fef22",
          "code": "DB01700",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01700",
          "code_system": "DRUG BANK",
          "references": [
            "5e03b336-24af-a418-4616-797075b2379e"
          ]
        },
        {
          "uuid": "61d0e837-9f8a-49de-898c-7d5befc94d11",
          "code": "F0X88YW0YK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "218e7214-0a9e-0c78-f395-0cbf465b49be",
          "code": "18406",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18406",
          "code_system": "CHEBI",
          "references": [
            "5e03b336-24af-a418-4616-797075b2379e"
          ]
        },
        {
          "uuid": "f8c35482-953c-24fb-ac22-b5d4f0312bc9",
          "code": "28498",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28498",
          "code_system": "CHEBI",
          "references": [
            "5e03b336-24af-a418-4616-797075b2379e"
          ]
        },
        {
          "uuid": "708b4c6d-cc0c-95a6-5b98-a677c77292d9",
          "code": "DTXSID10904363",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10904363",
          "code_system": "EPA CompTox",
          "references": [
            "5e03b336-24af-a418-4616-797075b2379e"
          ]
        },
        {
          "uuid": "de6026f8-32a4-4c16-60b7-cbe82e3c3e17",
          "code": "292227",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=292227",
          "code_system": "NSC",
          "references": [
            "1d511a09-8f85-3bed-ba00-92588023428f"
          ]
        },
        {
          "uuid": "dce10303-68e3-ec5a-2b83-f6fe25f72406",
          "code": "283955",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=283955",
          "code_system": "NSC",
          "references": [
            "1d511a09-8f85-3bed-ba00-92588023428f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f6d42cdb-fbcf-47d4-91e0-56eca0fde410",
          "name": "AICA RIBONUCLEOTIDE",
          "stdName": "AICA RIBONUCLEOTIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63f6fbb0-750d-4a32-9237-81ff2ce3f575",
            "b88def7e-b685-471a-ba34-b9e197cb3da4"
          ],
          "display_name": false
        },
        {
          "uuid": "c3873749-7089-4583-a21b-58db17b404e5",
          "name": "AICAR",
          "stdName": "AICAR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35f678e0-b08f-439e-bc6c-c3b2d0a59369",
            "4477c0c0-5416-4dd3-b55f-fec1d936521a",
            "63f6fbb0-750d-4a32-9237-81ff2ce3f575",
            "310631ae-5d3a-4bd0-9e3b-da07f97fec74"
          ],
          "display_name": true
        },
        {
          "uuid": "da276d95-5d1f-4cee-a109-f629f630fa8f",
          "name": "AICAR [MART.]",
          "stdName": "AICAR [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "310631ae-5d3a-4bd0-9e3b-da07f97fec74"
          ],
          "display_name": false
        },
        {
          "uuid": "9614392e-9257-49da-89f9-a54683f028c9",
          "name": "AMINOIMIDAZOLE CARBOXAMIDE RIBONUCLEOTIDE",
          "stdName": "AMINOIMIDAZOLE CARBOXAMIDE RIBONUCLEOTIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63f6fbb0-750d-4a32-9237-81ff2ce3f575",
            "b88def7e-b685-471a-ba34-b9e197cb3da4"
          ],
          "display_name": false
        },
        {
          "uuid": "1acbc56a-358f-4d6b-a5f8-6e8b8c568504",
          "name": "NSC-283955",
          "stdName": "NSC-283955",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10eadd59-435f-4315-b69d-2cecbfeac148",
            "63f6fbb0-750d-4a32-9237-81ff2ce3f575"
          ],
          "display_name": false
        },
        {
          "uuid": "b21894e5-1026-4d9b-b511-bbf9e9a28042",
          "name": "NSC-292227",
          "stdName": "NSC-292227",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10eadd59-435f-4315-b69d-2cecbfeac148",
            "63f6fbb0-750d-4a32-9237-81ff2ce3f575"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "35f678e0-b08f-439e-bc6c-c3b2d0a59369",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "63f6fbb0-750d-4a32-9237-81ff2ce3f575",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b88def7e-b685-471a-ba34-b9e197cb3da4",
          "citation": "wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "310631ae-5d3a-4bd0-9e3b-da07f97fec74",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10eadd59-435f-4315-b69d-2cecbfeac148",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fee199e6-46ac-4081-a642-09f90ce9d005",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390872000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfcfe8cd-2d1a-402b-94fc-50afc03179dc",
          "citation": "SRS import [F0X88YW0YK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F0X88YW0YK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390872000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4477c0c0-5416-4dd3-b55f-fec1d936521a",
          "citation": "AICAR [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5e03b336-24af-a418-4616-797075b2379e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9e1afcf2-44d3-4360-bd15-15a9227c0e54",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1d511a09-8f85-3bed-ba00-92588023428f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "26f34e08-3986-4eb5-82b3-1cb679d76eb2",
          "id": "26f34e08-3986-4eb5-82b3-1cb679d76eb2",
          "molfile": "\n  Marvin  01132102092D          \n\n 22 23  0  0  1  0            999 V2000\n    6.8278   -3.0243    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.1125   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4037   -3.0205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6902   -2.6081    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6856   -3.4328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9722   -3.0160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6933   -1.7836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4977   -2.5341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1631   -3.0243    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.7440   -2.4368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4909   -1.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1563   -1.1627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8263   -1.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6111   -1.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2225   -1.9483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7845   -0.5896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5686   -2.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0512   -3.1054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9100   -3.8082    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.3130   -4.5216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0808   -3.8082    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.6591   -4.5216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  8  1  0  0  0  0\n 21  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 19  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 17  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 17 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  6  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@H]([C@H]([C@H](n2cnc(c2N)C(=O)N)O1)O)O)OP(=O)(O)O",
          "formula": "C9H15N4O8P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "06b03de7-e789-4f1d-9dd6-33df1a43fc63"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "338.2115",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "92725ec9-395b-4798-a5ea-f94565b6d26a",
      "version": "8",
      "structure": {
        "id": "3fc48f57-9b6d-4ffd-9281-0137c38ca439",
        "molfile": "\n  Marvin  01132103222D          \n\n 22 23  0  0  1  0            999 V2000\n    4.6856   -3.4328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6902   -2.6081    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6933   -1.7836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9722   -3.0160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4037   -3.0205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1125   -2.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8278   -3.0243    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0808   -3.8082    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6591   -4.5216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9100   -3.8082    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1631   -3.0243    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4977   -2.5341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7440   -2.4368    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4909   -1.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1563   -1.1627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8263   -1.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6111   -1.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7845   -0.5896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2225   -1.9483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5686   -2.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0512   -3.1054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3130   -4.5216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  7  1  0  0  0  0\n 11 13  1  1  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 20 16  2  0  0  0  0\n 20 21  1  0  0  0  0\n 13 20  1  0  0  0  0\n 10 22  1  6  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@H]([C@H]([C@H](n2cnc(c2N)C(=O)N)O1)O)O)OP(=O)(O)O",
        "formula": "C9H15N4O8P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "338.2115",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "dfcfe8cd-2d1a-402b-94fc-50afc03179dc",
          "35f678e0-b08f-439e-bc6c-c3b2d0a59369"
        ],
        "stereo_centers": 4
      },
      "unii": "F0X88YW0YK"
    }
  ]
}