{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "329f4d5c-9e97-41d0-b70c-7ba05cac165c",
          "code": "658066-35-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=658066-35-4",
          "code_system": "CAS",
          "references": [
            "5c5a1eb7-1938-401f-ac01-c709e55bb70b",
            "7834d303-e003-4905-8f1d-067b7c406b72"
          ]
        },
        {
          "uuid": "66fe69c8-89ca-431d-9e63-bff871ed00d7",
          "code": "C572868",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67572868",
          "code_system": "MESH",
          "references": [
            "5c5a1eb7-1938-401f-ac01-c709e55bb70b"
          ]
        },
        {
          "uuid": "08ae6eea-e658-44e0-9645-a4a34d3711a6",
          "code": "80302",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2400",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "5c5a1eb7-1938-401f-ac01-c709e55bb70b"
          ]
        },
        {
          "uuid": "1958eae5-429c-4690-8570-78ad4f42efb9",
          "code": "11158353",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11158353",
          "code_system": "PUBCHEM",
          "references": [
            "5c5a1eb7-1938-401f-ac01-c709e55bb70b"
          ]
        },
        {
          "uuid": "52b3f21c-051f-2635-5057-daad1a9e7fa6",
          "code": "DTXSID9058151",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9058151",
          "code_system": "EPA CompTox",
          "references": [
            "82262b6e-d53f-a70e-b0b1-a96aba8ae32c"
          ]
        },
        {
          "uuid": "b35e23e9-488a-4178-99ee-420bbb4c546f",
          "code": "F0VT7K5302",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "87159212-67f5-cb6b-c509-e53b2d90e4f8",
          "code": "Fluopyram",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fluopyram",
          "code_system": "WIKIPEDIA",
          "references": [
            "4421224c-f9d3-bcb0-fb98-35e87257c23f"
          ]
        },
        {
          "uuid": "005f6305-a342-f33a-0077-e4c2e7930a54",
          "code": "fluopyram",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fluopyram.html",
          "code_system": "ALANWOOD",
          "references": [
            "e72f4e05-b233-6c66-ff3d-2e24cbfab35f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3780829b-be9d-4466-9b9a-de621ff0ed84",
          "name": "FLUOPYRAM",
          "stdName": "FLUOPYRAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78d43589-6117-4da8-a7ed-3df93d3ea3c5",
            "681843af-2aa0-404e-947c-c4d5a55c30f7",
            "9b3be19e-29e9-45dc-8156-3b6aae4f3f3c",
            "8638e018-9e36-4692-af82-a24d7318464a"
          ],
          "display_name": true
        },
        {
          "uuid": "3fa5e360-b02e-4674-a914-af62fc843c8a",
          "name": "FLUOPYRAM [ISO]",
          "stdName": "FLUOPYRAM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "681843af-2aa0-404e-947c-c4d5a55c30f7",
            "8638e018-9e36-4692-af82-a24d7318464a"
          ],
          "display_name": false
        },
        {
          "uuid": "99ab9c03-8a4f-4283-99cc-9fb25ff8ffa2",
          "name": "N-(2-(3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDINYL)ETHYL)-2-(TRIFLUOROMETHYL)BENZAMIDE",
          "stdName": "N-(2-(3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDINYL)ETHYL)-2-(TRIFLUOROMETHYL)BENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31d56333-bcd9-44f4-9b1c-b0a9b737bbcb",
            "7781ef73-7404-49af-9bbc-5538510b812d"
          ],
          "display_name": false
        },
        {
          "uuid": "85d93695-eba1-44e8-8fa6-8ed4627519a2",
          "name": "N-(2-(3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDYL)ETHYL)-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-O-TOLUAMIDE",
          "stdName": "N-(2-(3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDYL)ETHYL)-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-O-TOLUAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "936d6038-d9d8-441e-9abd-0ed139a93967",
            "31d56333-bcd9-44f4-9b1c-b0a9b737bbcb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "31d56333-bcd9-44f4-9b1c-b0a9b737bbcb",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7781ef73-7404-49af-9bbc-5538510b812d",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "936d6038-d9d8-441e-9abd-0ed139a93967",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78d43589-6117-4da8-a7ed-3df93d3ea3c5",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8638e018-9e36-4692-af82-a24d7318464a",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "681843af-2aa0-404e-947c-c4d5a55c30f7",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c5a1eb7-1938-401f-ac01-c709e55bb70b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390986000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e4da265-ec7e-49d0-b629-5ddbe919c89e",
          "citation": "SRS import [F0VT7K5302]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F0VT7K5302",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390986000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac46f702-387e-454f-a617-68703e0bf4ca",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b3be19e-29e9-45dc-8156-3b6aae4f3f3c",
          "citation": "FLUOPYRAM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82262b6e-d53f-a70e-b0b1-a96aba8ae32c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=658066-35-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4421224c-f9d3-bcb0-fb98-35e87257c23f",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "e72f4e05-b233-6c66-ff3d-2e24cbfab35f",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "7834d303-e003-4905-8f1d-067b7c406b72",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f81f14d9-2af2-4c7e-b50e-5a6762e8bf48",
          "id": "f81f14d9-2af2-4c7e-b50e-5a6762e8bf48",
          "molfile": "\n  Marvin  01132112522D          \n\n 26 27  0  0  0  0            999 V2000\n    9.3842   -1.3868    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7960   -2.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2079   -2.8163    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5109   -1.6897    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0814   -2.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3665   -2.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6563   -2.5134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6563   -3.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9415   -3.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9415   -4.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2268   -4.9890    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2268   -5.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9415   -6.2245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5119   -6.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7970   -5.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0823   -6.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0823   -7.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7970   -7.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5119   -7.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2268   -7.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8148   -8.1795    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9415   -7.8765    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6386   -6.7498    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3665   -3.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3665   -4.5772    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.0814   -3.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 26  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 24  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 20 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 24  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(c(c1)C(=O)NCCc2c(cc(cn2)C(F)(F)F)Cl)C(F)(F)F",
          "formula": "C16H11ClF6N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8ac82601-7032-4f95-bfd5-f34b1867d2d9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "396.7153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f4924838-60a9-4fba-92db-7771856ff928",
      "version": "5",
      "structure": {
        "id": "8c17b47d-f858-4592-9069-69e8ee22707e",
        "molfile": "\n  Marvin  01132107162D          \n\n 26 27  0  0  0  0            999 V2000\n    5.5119   -6.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7970   -5.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0823   -6.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0823   -7.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7970   -7.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5119   -7.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2268   -7.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8148   -8.1795    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9415   -7.8765    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6386   -6.7498    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2268   -5.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2268   -4.9890    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9415   -4.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9415   -3.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6563   -3.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3665   -3.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0814   -3.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0814   -2.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3665   -2.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6563   -2.5134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7960   -2.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3842   -1.3868    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2079   -2.8163    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5109   -1.6897    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3665   -4.5772    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9415   -6.2245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 15 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n 16 25  1  0  0  0  0\n 11 26  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(c(c1)C(=O)NCCc2c(cc(cn2)C(F)(F)F)Cl)C(F)(F)F",
        "formula": "C16H11ClF6N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "396.7153",
        "optical_activity": "NONE",
        "references": [
          "4e4da265-ec7e-49d0-b629-5ddbe919c89e",
          "ac46f702-387e-454f-a617-68703e0bf4ca"
        ],
        "stereo_centers": 0
      },
      "unii": "F0VT7K5302"
    }
  ]
}