{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c9e6d960-6d34-445d-87d2-ee451eef8d71", "code": "QB03BA04", "comments": "VATC|ANTIANEMIC PREPARATIONS|VITAMIN B12 AND FOLIC ACID|Vitamin B12 (cyanocobalamin and analogues)|cobamamide", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB03BA04&showdescription=yes", "code_system": "WHO-VATC", "references": [ "94dde580-6251-47bd-90f7-8800d22bf37a" ] }, { "uuid": "18d58446-5cc4-4ac7-9e66-5479a8100ae4", "code": "13870-90-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=13870-90-1", "code_system": "CAS", "references": [ "94dde580-6251-47bd-90f7-8800d22bf37a", "691164d5-8d46-471c-8b90-8a148d649260" ] }, { "uuid": "cf3dd8f5-4150-44fa-9471-ef9052029c6f", "code": "COBAMAMIDE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Cobamamide", "code_system": "WIKIPEDIA", "references": [ "94dde580-6251-47bd-90f7-8800d22bf37a" ] }, { "uuid": "6a8a9979-e999-45c0-9d7b-e3e895f53ca3", "code": "B03BA04", "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|ANTIANEMIC PREPARATIONS|VITAMIN B12 AND FOLIC ACID|Vitamin B12 (cyanocobalamin and analogues)|cobamamide", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=B03BA04&showdescription=yes", "code_system": "WHO-ATC", "references": [ "94dde580-6251-47bd-90f7-8800d22bf37a" ] }, { "uuid": "c4795455-4a23-4b19-9b7f-040574c916fb", "code": "1915", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1915", "code_system": "INN", "references": [ "94dde580-6251-47bd-90f7-8800d22bf37a" ] }, { "uuid": "532e28eb-85eb-481b-817f-8c1ac878acc4", "code": "237-627-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.034.192", "code_system": "ECHA (EC/EINECS)", "references": [ "94dde580-6251-47bd-90f7-8800d22bf37a" ] }, { "uuid": "ab2b9766-6772-4f98-a52b-4983ab7b7c86", "code": "21373", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/21373/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "94dde580-6251-47bd-90f7-8800d22bf37a" ] }, { "uuid": "ac22c25e-f574-480f-ae47-32113e101354", "code": "m3705", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m3705?q=authorize", "code_system": "MERCK INDEX", "references": [ "94dde580-6251-47bd-90f7-8800d22bf37a" ] }, { "uuid": "e551d4ee-cd0b-47c1-8f12-7f6f113a790e", "code": "SUB06788MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "94dde580-6251-47bd-90f7-8800d22bf37a" ] }, { "uuid": "9d1c4f87-babc-9906-eb62-0b75a6c1fba2", "code": "DTXSID1046009", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1046009", "code_system": "EPA CompTox", "references": [ "87d5559b-bd71-3feb-b19d-2b1b3a87ad08" ] }, { "uuid": "9c6d5ada-6e53-8c4a-4853-8a92dcfaed9f", "code": "C169859", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C169859", "code_system": "NCI_THESAURUS", "references": [ "9c9a101e-e525-896c-5bd4-9bfb52e54bc4" ] }, { "uuid": "2bc78c63-0906-4039-9298-5eec0ec4b00b", "code": "F0R1QK73KB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d4a18cca-62bf-8ece-eb59-10743b737860", "code": "131635025", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/131635025", "code_system": "PUBCHEM", "references": [ "ca0af5a4-609f-80b5-d1df-c1bf32c961f3" ] }, { "uuid": "bc8ee579-6386-cef6-17f7-07ea7bdfca22", "code": "4404", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/4404", "code_system": "DRUG CENTRAL", "references": [ "9c9a101e-e525-896c-5bd4-9bfb52e54bc4" ] }, { "uuid": "d6a7a899-69f2-f55f-9b6d-9dc483cbc11b", "code": "1612 (Number of products:7)", "comments": "Dietary Supplement Label Database|Vitamin|Dibencozide", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1612&item=Dibencozide", "code_system": "DSLD", "references": [ "9c9a101e-e525-896c-5bd4-9bfb52e54bc4" ] }, { "uuid": "a61201f9-3e47-46ef-ad18-ccbcae3832c8", "code": "DB11191", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB11191", "code_system": "DRUG BANK", "references": [ "9c9a101e-e525-896c-5bd4-9bfb52e54bc4" ] }, { "uuid": "f542fbed-2c8a-2377-80cd-fbb87533f4f8", "code": "18408", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18408", "code_system": "CHEBI", "references": [ "9c9a101e-e525-896c-5bd4-9bfb52e54bc4" ] }, { "uuid": "23242295-1950-f849-e8cc-a8efe7ccd04f", "code": "1142195", "type": "PRIMARY", "url": "https://store.usp.org/product/1142195", "code_system": "RS_ITEM_NUM", "references": [ "9c9a101e-e525-896c-5bd4-9bfb52e54bc4" ] }, { "uuid": "d6f54eec-58d5-55fe-b72c-e9ba8987c51d", "code": "100000084059", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "10016092-cf2c-a63b-267b-e567746a33de" ] }, { "uuid": "3c72d892-0aac-ba2d-8884-d5d6dc0fea45", "code": "F0R1QK73KB", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=F0R1QK73KB", "code_system": "DAILYMED", "references": [ "033cc8b8-34ad-6d0a-37a9-d459b593a30e" ] }, { "uuid": "af38dfe9-e728-41f0-513d-216636b07016", "code": "757791", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757791", "code_system": "NSC", "references": [ "d3b2e28e-7fac-8f5c-8a39-2b446d1b5563" ] } ], "relationships": [ { "uuid": "0363c9e3-bd06-4908-aad4-19269cdc9da1", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "bb9c5fe1-96b0-4687-ad8b-e85895ca5955", "refuuid": "74e11707-0d53-4190-aebb-127918af5e2b", "name": "COBAMAMIDE", "unii": "F0R1QK73KB", "linking_id": "F0R1QK73KB", "ref_pname": "COBAMAMIDE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "1e4bcc92-b8a3-4f7c-b1df-bc80657c013b", "name": "5'-DEOXYADENOSYL-B12", "stdName": "5'-DEOXYADENOSYL-B12", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "5ee287c4-581c-48b6-bff4-9606f87627aa" ], "display_name": false }, { "uuid": "bcc55c03-436b-4e87-adf8-35206fa35b2a", "name": "5'-DEOXYADENOSYLCOBALAMIN", "stdName": "5'-DEOXYADENOSYLCOBALAMIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "a4cb975e-144b-4667-89e3-74ddda3ef4fc" ], "display_name": false }, { "uuid": "1b82aaf6-ec71-4e41-b538-194ec557beeb", "name": "5,6-DIMETHYLBENZIMIDAZOLYLCOBAMIDE 5'-DEOXYADENOSINE", "stdName": "5,6-DIMETHYLBENZIMIDAZOLYLCOBAMIDE 5'-DEOXYADENOSINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "5ee287c4-581c-48b6-bff4-9606f87627aa" ], "display_name": false }, { "uuid": "69745267-c6de-484d-b70d-bd698d7b8eff", "name": "ADEMIDE", "stdName": "ADEMIDE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "e74bc33f-8f76-454d-b8d9-42158fef3ed8", "name": "ADENOSYL-B12", "stdName": "ADENOSYL-B12", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "4779efc6-541d-45b7-90b7-19c7da0c8628", "name": "ADOCBL", "stdName": "ADOCBL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "f8b6faa1-343f-46ea-a0a4-eea954c8e69a", "name": "CALOMIDE", "stdName": "CALOMIDE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "d46bc621-a0cd-4be4-94d8-4eed7253c710", "name": "COBALTAMIN S", "stdName": "COBALTAMIN S", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "b3948c21-3deb-4b39-9903-9edf27ff6442", "name": "COBAMAMIDE", "stdName": "COBAMAMIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "101f8e70-2349-48a1-b1f0-eb7c7781266d", "9fe06201-6fde-4375-8532-55ff6e7c6ff3", "bf339b2a-2d99-4aea-80a1-f554501e012f", "ae6c8e66-eac9-46eb-b3cf-44f04e35384e", "11e07667-30b6-4519-a16c-ba905df44a8c", "a0ff6801-9993-4fcd-b75c-b571d6b14349", "2ff79abf-922e-448a-8473-f5aeafe48ed5", "862d0320-6ad6-42eb-9350-7014707a4e8b", "b68eeefa-f0f7-4b57-a960-1cc6de329e4e", "ffaf5050-8304-4a44-9d15-5a9ea96b8a73", "5ee287c4-581c-48b6-bff4-9606f87627aa" ], "display_name": true, "domains": [ "drug", "cosmetic" ], "name_orgs": [ { "uuid": "14204bc9-7127-4279-9237-8151d4cee454", "name_org": "INCI" }, { "uuid": "aaa2965e-cc20-4ff1-a3e9-12e59dcec4f5", "name_org": "INN" } ] }, { "uuid": "29c8fdb9-b000-4db2-ba6a-5a0465370795", "name": "COBAMAMIDE [JAN]", "stdName": "COBAMAMIDE [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2ff79abf-922e-448a-8473-f5aeafe48ed5", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "80da0ffb-b770-4068-a20e-0e4a8ed1e0f1", "name": "COBAMAMIDE [MI]", "stdName": "COBAMAMIDE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "e0ba9c85-eab5-fc5f-15f4-4f3183fa0cbe", "name": "COBAMAMIDE [USP-RS]", "stdName": "COBAMAMIDE [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "86fbd4e3-a6f0-5b08-a24b-5af63f88bc9b" ], "display_name": false }, { "uuid": "53ce6cdd-146d-41a6-8e29-693fd4b9d99b", "name": "COBAMAMIDUM", "stdName": "COBAMAMIDUM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "5ee287c4-581c-48b6-bff4-9606f87627aa" ], "display_name": false }, { "uuid": "2f6c1b53-9160-4e0b-b78d-71c17411f4fa", "name": "COBANZYME", "stdName": "COBANZYME", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "ca0e1420-b42c-4399-9db2-115d396b1e3e", "name": "COBINAMIDE, CO-(5'-DEOXYADENOSIN-5'-YL)-, F-(DIHYDROGEN PHOSPHATE), INNER SALT, 3'-ESTER WITH (5,6-DIMETHYL-1-.ALPHA.-D-RIBOFURANOSYL-1H-BENZIMIDAZOLE-.KAPPA.N3)", "stdName": "COBINAMIDE, CO-(5'-DEOXYADENOSIN-5'-YL)-, F-(DIHYDROGEN PHOSPHATE), INNER SALT, 3'-ESTER WITH (5,6-DIMETHYL-1-.ALPHA.-D-RIBOFURANOSYL-1H-BENZIMIDAZOLE-.KAPPA.N3)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "1a655391-c2cf-4373-b958-f4544eee4725" ], "display_name": false }, { "uuid": "1be2ab12-533e-457b-a2b0-c4c651cc865a", "name": "COENZILE", "stdName": "COENZILE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "2f0fe6e2-b961-4074-af4d-6102d45047ed", "name": "COENZYME B12", "stdName": "COENZYME B12", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "a1fb8e1c-7d53-38da-6a22-bc655960f05a", "name": "Cobamamide [WHO-DD]", "stdName": "COBAMAMIDE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f351e1ab-9b14-4f73-7fc3-442c1297cee0" ], "display_name": false }, { "uuid": "13fba09d-68b7-4836-84f6-85d77355a16e", "name": "DBC", "stdName": "DBC", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "951d0b83-2f59-4f80-a1a1-7957421afed4", "name": "DIBENZCOZAMIDE", "stdName": "DIBENZCOZAMIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "5ee287c4-581c-48b6-bff4-9606f87627aa" ], "display_name": false }, { "uuid": "d21b34c2-d32a-4f26-b8fb-a008d68b68a9", "name": "DIMEBENZCOZAMIDE", "stdName": "DIMEBENZCOZAMIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "dba98df8-69db-401e-be85-a734297eba24", "name": "ENZICOBA", "stdName": "ENZICOBA", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "6c0f1bf4-503f-4dc4-946a-55da31b18118", "name": "HERACLENE", "stdName": "HERACLENE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "1fce7b3b-acd5-644a-7856-4c147fb85665", "name": "HL-009", "stdName": "HL-009", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "8c4be7b2-caca-bc2b-c472-5341eaed1bb7" ], "display_name": false }, { "uuid": "27c175ff-104e-4489-ad5c-2c296d630a62", "name": "INDUSIL", "stdName": "INDUSIL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "843085e4-e2d6-4214-b97e-dacd7b7db98f", "862d0320-6ad6-42eb-9350-7014707a4e8b" ], "display_name": false }, { "uuid": "b6a4bc92-3a95-4e76-a9a4-0e2476e9ca72", "name": "LM 176", "stdName": "LM 176", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "5082aeb6-5760-4c33-b672-abc142315b01" ], "display_name": false }, { "uuid": "cd13a46f-f22d-424a-9fb8-62f4a8e7c0eb", "name": "LM-176", "stdName": "LM-176", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "5082aeb6-5760-4c33-b672-abc142315b01" ], "display_name": false }, { "uuid": "935096c9-4d69-6f59-742b-05b9a45a4267", "name": "NSC-757791", "stdName": "NSC-757791", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "d3b2e28e-7fac-8f5c-8a39-2b446d1b5563" ], "display_name": false }, { "uuid": "a9094d2e-2222-433f-b88b-95da1a520ccd", "name": "VITAMIN B12 COENZYME", "stdName": "VITAMIN B12 COENZYME", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "5ee287c4-581c-48b6-bff4-9606f87627aa" ], "display_name": false }, { "uuid": "9eac1e95-e9b6-44a7-a988-831db2994ee7", "name": "cobamamide [INN]", "stdName": "COBAMAMIDE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "862d0320-6ad6-42eb-9350-7014707a4e8b", "11e07667-30b6-4519-a16c-ba905df44a8c", "a2b23924-120b-4201-87d0-0139ecc47e15" ], "display_name": false } ], "references": [ { "uuid": "5ee287c4-581c-48b6-bff4-9606f87627aa", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2ff79abf-922e-448a-8473-f5aeafe48ed5", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "862d0320-6ad6-42eb-9350-7014707a4e8b", "citation": "KEGG", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "843085e4-e2d6-4214-b97e-dacd7b7db98f", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a655391-c2cf-4373-b958-f4544eee4725", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9fe06201-6fde-4375-8532-55ff6e7c6ff3", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a4cb975e-144b-4667-89e3-74ddda3ef4fc", "citation": "http://www.efsa.europa.eu/en/scdocs/doc/ans_ej815_vitamin_B12_op_en,0.pdf?ssbinary=true", "url": "http://www.efsa.europa.eu/en/scdocs/doc/ans_ej815_vitamin_B12_op_en,0.pdf?ssbinary=true", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ae6c8e66-eac9-46eb-b3cf-44f04e35384e", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "11e07667-30b6-4519-a16c-ba905df44a8c", "citation": "INN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5082aeb6-5760-4c33-b672-abc142315b01", "citation": "USP DICTIONARY", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "94dde580-6251-47bd-90f7-8800d22bf37a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391764000, "tags": [ "NOMEN" ] }, { "uuid": "10041e7e-22e9-4372-aaab-918d3a602efb", "citation": "SRS import [F0R1QK73KB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=F0R1QK73KB", "doc_type": "SRS", "public_domain": true, "document_date": 1493391764000, "tags": [ "NOMEN" ] }, { "uuid": "bf339b2a-2d99-4aea-80a1-f554501e012f", "citation": "COBAMAMIDE [JAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "101f8e70-2349-48a1-b1f0-eb7c7781266d", "citation": "COBAMAMIDE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b68eeefa-f0f7-4b57-a960-1cc6de329e4e", "citation": "COBAMAMIDE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ffaf5050-8304-4a44-9d15-5a9ea96b8a73", "citation": "COBAMAMIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a0ff6801-9993-4fcd-b75c-b571d6b14349", "citation": "COBAMAMIDE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "87d5559b-bd71-3feb-b19d-2b1b3a87ad08", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13870-90-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8c4be7b2-caca-bc2b-c472-5341eaed1bb7", "citation": "https://adisinsight.springer.com/drugs/800033627", "doc_type": "WEB PAGE", "public_domain": true }, { "uuid": "9c9a101e-e525-896c-5bd4-9bfb52e54bc4", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "691164d5-8d46-471c-8b90-8a148d649260", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ca0af5a4-609f-80b5-d1df-c1bf32c961f3", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "a2b23924-120b-4201-87d0-0139ecc47e15", "citation": "INN Proposed List 15", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "86fbd4e3-a6f0-5b08-a24b-5af63f88bc9b", "citation": "USP-RS", "doc_type": "USPNF", "public_domain": true }, { "uuid": "d3b2e28e-7fac-8f5c-8a39-2b446d1b5563", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "033cc8b8-34ad-6d0a-37a9-d459b593a30e", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "f351e1ab-9b14-4f73-7fc3-442c1297cee0", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "10016092-cf2c-a63b-267b-e567746a33de", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9d83ae6c-a794-4087-be3e-e404ff242b6a", "id": "9d83ae6c-a794-4087-be3e-e404ff242b6a", "molfile": "\n Marvin 01132108112D \n\n 1 0 0 0 1 0 999 V2000\n 25.7007 -13.3743 0.0000 Co 0 1 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 3\nM END", "smiles": "[Co+3]", "formula": "Co", "atropisomerism": "No", "charge": 3, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "383e2cf8-1cc3-46ad-9836-fc2b0ae57e92" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "58.9332", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "ed822589-f0e9-4eb4-a639-e19c96f0b333", "id": "ed822589-f0e9-4eb4-a639-e19c96f0b333", "molfile": "\n Marvin 01132112172D \n\n 18 20 0 0 1 0 999 V2000\n 13.0496 -6.5877 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.5780 -7.0761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0496 -5.7740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8614 -5.5196 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.1153 -4.7350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6221 -4.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1153 -3.4199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9270 -3.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6591 -3.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6591 -2.4450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3913 -3.6744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3913 -4.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6591 -4.8979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9270 -4.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3546 -6.1809 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 15.2001 -6.1809 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 13.8614 -6.8422 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.1153 -7.6235 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 17 1 1 0 0 0 0\n 4 3 1 1 0 0 0\n 4 5 1 0 0 0 0\n 15 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 14 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 14 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 16 1 1 0 0 0\n 17 15 1 0 0 0 0\n 17 18 1 6 0 0 0\nM CHG 2 16 -1 18 -1\nM END", "smiles": "C[C@@H]1[C@H]([C@@H]([C@H](n2cnc3c(N)ncnc32)O1)[O-])[O-]", "formula": "C10H11N5O3", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b3ff631f-2816-43e6-9afd-75b8a593075c" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "249.2264", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 }, { "uuid": "6f0ccac0-0f06-44e1-978b-a9c4dcc9332b", "id": "6f0ccac0-0f06-44e1-978b-a9c4dcc9332b", "molfile": "\n Marvin 01132105462D \n\n 90 97 0 0 1 0 999 V2000\n 10.9498 -19.1843 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 11.7597 -19.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5420 -18.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9602 -17.7367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7597 -17.7367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1727 -18.4629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1831 -17.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9933 -17.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4114 -16.3047 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.8137 -17.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1430 -15.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8538 -16.2889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8538 -17.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5383 -15.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6742 -15.1235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4687 -14.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8292 -14.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4320 -13.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6899 -13.4092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5383 -12.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8538 -12.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8538 -11.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1430 -12.6097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9811 -13.3987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2127 -13.5452 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.5020 -13.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2127 -14.9980 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 14.0331 -15.1339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8626 -15.7560 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 12.0421 -15.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3365 -15.3377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6413 -15.7560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3365 -14.5017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8731 -12.8502 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 12.1620 -13.2683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1620 -12.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3365 -12.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9234 -13.1584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9234 -11.7107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4374 -12.2752 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 13.4374 -11.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7110 -11.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7110 -10.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9914 -9.7645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4203 -9.7521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2753 -12.2072 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 17.0854 -12.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2753 -11.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9756 -10.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6863 -11.3763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9756 -10.1324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8240 -12.7611 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 17.6341 -12.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0419 -13.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8676 -13.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2751 -14.2090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2751 -12.7611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8502 -15.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5558 -15.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5558 -16.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3117 -16.2783 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 16.3117 -17.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0124 -17.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8325 -17.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2195 -18.2384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2195 -16.8064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5420 -19.8899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9498 -20.6268 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9498 -21.4526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2232 -21.0346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5280 -20.6268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2596 -20.2400 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 13.8241 -20.8255 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.4114 -21.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8190 -22.2783 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 14.5662 -20.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4357 -19.6183 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 15.0212 -19.0222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9111 -18.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6587 -17.8517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2230 -18.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0487 -18.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4671 -19.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2719 -19.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0748 -19.8899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4775 -20.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2491 -19.8899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8259 -19.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6256 -19.4822 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 13.2231 -18.7558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 67 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 1 0 0 0\n 11 9 1 0 0 0 0\n 9 29 1 0 0 0 0\n 12 11 2 0 0 0 0\n 11 28 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 12 1 0 0 0 0\n 15 14 2 0 0 0 0\n 61 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 16 58 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 52 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 46 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 40 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 6 0 0 0\n 27 25 1 0 0 0 0\n 34 25 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 27 1 0 0 0 0\n 29 30 1 1 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 31 2 0 0 0 0\n 34 35 1 6 0 0 0\n 34 36 1 0 0 0 0\n 40 34 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 37 2 0 0 0 0\n 40 41 1 6 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 2 0 0 0 0\n 46 47 1 6 0 0 0\n 46 48 1 0 0 0 0\n 52 46 1 0 0 0 0\n 49 48 1 0 0 0 0\n 50 49 1 0 0 0 0\n 51 49 2 0 0 0 0\n 52 53 1 6 0 0 0\n 54 53 1 0 0 0 0\n 55 54 1 0 0 0 0\n 56 55 1 0 0 0 0\n 57 55 2 0 0 0 0\n 59 58 1 0 0 0 0\n 60 58 1 0 0 0 0\n 61 58 1 0 0 0 0\n 61 62 1 6 0 0 0\n 63 62 1 0 0 0 0\n 64 63 1 0 0 0 0\n 65 64 1 0 0 0 0\n 66 64 2 0 0 0 0\n 68 67 1 0 0 0 0\n 69 68 1 0 0 0 0\n 70 68 2 0 0 0 0\n 71 68 1 0 0 0 0\n 72 71 1 1 0 0 0\n 73 72 1 0 0 0 0\n 72 89 1 0 0 0 0\n 73 74 1 6 0 0 0\n 73 76 1 0 0 0 0\n 75 74 1 0 0 0 0\n 77 76 1 1 0 0 0\n 77 78 1 0 0 0 0\n 89 77 1 0 0 0 0\n 79 78 1 0 0 0 0\n 88 78 1 0 0 0 0\n 80 79 2 0 0 0 0\n 80 81 1 0 0 0 0\n 82 81 1 0 0 0 0\n 81 88 2 0 0 0 0\n 82 83 2 0 0 0 0\n 84 83 1 0 0 0 0\n 83 85 1 0 0 0 0\n 86 85 1 0 0 0 0\n 85 87 2 0 0 0 0\n 87 88 1 0 0 0 0\n 89 90 1 1 0 0 0\nM CHG 1 75 -1\nM END", "smiles": "Cc1cc2c(cc1C)n(cn2)[C@@H]3[C@@H]([C@@H]([C@@H](C[O-])O3)OP(=O)(O)O[C@H](C)CNC(=O)CC[C@]\\4(C)[C@@H](CC(=O)N)C5[C@@]6(C)[C@@](C)(CC(=O)N)[C@H](CCC(=O)N)C(=N6)/C(=C7/[C@@](C)(CC(=O)N)[C@H](CCC(=O)N)C(=N7)/C=C8/C(C)(C)[C@H](CCC(=O)N)C(=N8)/C(=C4\\N5)/C)/C)O", "formula": "C62H89N13O14P", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "EPIMERIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7d9fda55-2a85-4049-ada1-60e836ee6261" }, "defined_stereo": 13, "ez_centers": 3, "molecular_weight": "1271.4249", "optical_activity": "UNSPECIFIED", "stereo_centers": 14 } ], "definition_level": "INCOMPLETE", "uuid": "74e11707-0d53-4190-aebb-127918af5e2b", "version": "27", "structure": { "id": "57e42380-10ef-4f01-b9de-a50d9efd515f", "molfile": "\n Marvin 01132104342D \n\n109117 0 0 1 0 999 V2000\n 25.7007 -13.3743 0.0000 Co 0 1 0 0 0 0 0 0 0 0 0 0\n 14.1308 -12.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9690 -13.3871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8410 -12.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5249 -12.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6764 -13.3976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4178 -13.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8147 -14.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4545 -14.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6607 -15.1104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5249 -15.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8410 -16.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1308 -15.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0210 -15.1208 0.0000 N 0 5 0 0 0 0 0 0 0 0 0 0\n 13.2013 -14.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2013 -13.5335 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.8620 -12.8391 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.4258 -12.2646 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.4258 -11.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7000 -11.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7000 -10.1761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4087 -9.7437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9811 -9.7561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1515 -12.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3267 -12.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9140 -11.7006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9140 -13.1470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1515 -13.2568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4912 -13.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8515 -15.7424 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.3998 -16.2906 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.9821 -17.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1726 -17.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7496 -17.7214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9507 -17.7214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5329 -18.4367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9403 -19.1677 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.5329 -19.8727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9403 -20.6090 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5172 -20.6090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2482 -20.2225 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.8122 -20.8075 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.5536 -20.4368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4232 -19.6014 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.0082 -19.0058 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 14.8982 -18.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6452 -17.8363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2090 -18.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8122 -19.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2351 -19.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0601 -19.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4520 -19.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0340 -18.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2561 -19.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4624 -20.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6138 -19.4654 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.2117 -18.7396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3998 -21.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8071 -22.2591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9403 -21.4341 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.2144 -21.0164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7496 -19.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1622 -18.4470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8018 -17.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0317 -15.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3267 -15.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3267 -14.4892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6321 -15.7424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8410 -17.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2976 -16.2643 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.8357 -15.7110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5406 -15.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5406 -16.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2976 -17.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9977 -17.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8171 -17.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2038 -16.7919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2038 -18.2227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8095 -12.7501 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.2613 -12.1967 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.2613 -11.3665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9609 -10.9540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9609 -10.1237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6710 -11.3665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0707 -12.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6189 -12.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0263 -13.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8513 -13.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2585 -12.7501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2585 -14.1967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8410 -11.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2920 -6.4875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.8717 -7.2647 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.2920 -8.0420 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.3379 -7.7428 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.3379 -6.7865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7835 -8.3169 0.0000 C 0 5 0 0 0 0 0 0 0 0 0 0\n 16.5904 -8.9603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8654 -7.2647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5904 -5.5653 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 17.5444 -5.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4049 -5.7568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2655 -5.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2655 -4.3187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4049 -3.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5444 -4.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5904 -4.0196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0107 -4.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4049 -2.8737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 3 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 2 18 1 0 0 0 0\n 18 19 1 6 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 17 24 1 1 0 0 0\n 25 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 27 25 1 0 0 0 0\n 17 28 1 6 0 0 0\n 16 29 1 6 0 0 0\n 30 15 1 0 0 0 0\n 31 30 1 0 0 0 0\n 13 31 1 0 0 0 0\n 31 32 1 6 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 1 0 0 0\n 42 41 1 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 1 0 0 0 0\n 44 45 1 1 0 0 0\n 46 45 1 0 0 0 0\n 47 46 2 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 2 0 0 0 0\n 49 45 1 0 0 0 0\n 50 49 1 0 0 0 0\n 51 50 2 0 0 0 0\n 52 51 1 0 0 0 0\n 53 52 2 0 0 0 0\n 53 48 1 0 0 0 0\n 54 52 1 0 0 0 0\n 55 51 1 0 0 0 0\n 44 56 1 0 0 0 0\n 56 41 1 0 0 0 0\n 56 57 1 1 0 0 0\n 42 58 1 6 0 0 0\n 59 58 1 0 0 0 0\n 60 39 1 0 0 0 0\n 61 39 2 0 0 0 0\n 37 62 1 1 0 0 0\n 63 34 2 0 0 0 0\n 31 64 1 1 0 0 0\n 30 65 1 1 0 0 0\n 66 65 1 0 0 0 0\n 67 66 2 0 0 0 0\n 68 66 1 0 0 0 0\n 69 12 1 0 0 0 0\n 70 11 1 0 0 0 0\n 71 70 1 0 0 0 0\n 9 71 1 0 0 0 0\n 72 71 1 0 0 0 0\n 73 71 1 0 0 0 0\n 70 74 1 6 0 0 0\n 75 74 1 0 0 0 0\n 76 75 1 0 0 0 0\n 77 76 2 0 0 0 0\n 78 76 1 0 0 0 0\n 7 79 1 0 0 0 0\n 79 80 1 0 0 0 0\n 80 5 1 0 0 0 0\n 80 81 1 1 0 0 0\n 82 81 1 0 0 0 0\n 83 82 2 0 0 0 0\n 84 82 1 0 0 0 0\n 80 85 1 6 0 0 0\n 79 86 1 6 0 0 0\n 87 86 1 0 0 0 0\n 88 87 1 0 0 0 0\n 89 88 2 0 0 0 0\n 90 88 1 0 0 0 0\n 91 4 1 0 0 0 0\n 92 93 1 0 0 0 0\n 94 93 1 0 0 0 0\n 95 94 1 0 0 0 0\n 95 96 1 0 0 0 0\n 96 92 1 0 0 0 0\n 95 97 1 1 0 0 0\n 94 98 1 6 0 0 0\n 93 99 1 1 0 0 0\n 92100 1 1 0 0 0\n100101 1 0 0 0 0\n101102 1 0 0 0 0\n102103 2 0 0 0 0\n103104 1 0 0 0 0\n105104 2 0 0 0 0\n106105 1 0 0 0 0\n101106 2 0 0 0 0\n106107 1 0 0 0 0\n108107 2 0 0 0 0\n100108 1 0 0 0 0\n105109 1 0 0 0 0\nM CHG 4 1 3 14 -1 60 -1 97 -1\nM END", "smiles": "Cc1cc2c(cc1C)n(cn2)[C@@H]3[C@@H]([C@@H]([C@@H](CO)O3)OP(=O)([O-])O[C@H](C)CNC(=O)CC[C@]\\4(C)[C@@H](CC(=O)N)C5[C@@]6(C)[C@@](C)(CC(=O)N)[C@H](CCC(=O)N)C(=N6)/C(=C7/[C@@](C)(CC(=O)N)[C@H](CCC(=O)N)C(=N7)/C=C8/C(C)(C)[C@H](CCC(=O)N)C(=N8)/C(=C4\\[N-]5)/C)/C)O.[CH2-][C@@H]1[C@H]([C@@H]([C@H](n2cnc3c(N)ncnc32)O1)O)O.[Co+3]", "formula": "C62H88N13O14P.C10H12N5O3.Co", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 17, "ez_centers": 3, "molecular_weight": "1579.5846", "optical_activity": "UNSPECIFIED", "references": [ "10041e7e-22e9-4372-aaab-918d3a602efb", "5ee287c4-581c-48b6-bff4-9606f87627aa", "a2b23924-120b-4201-87d0-0139ecc47e15" ], "stereo_centers": 18 }, "unii": "F0R1QK73KB" } ] }